{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ebc3907f-d118-416f-bf99-00d5d8590526",
          "code": "5902-95-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5902-95-4",
          "code_system": "CAS",
          "references": [
            "cd86eeeb-32a6-467e-90fc-8f0576be5304",
            "a6e826b1-43e1-4774-bf1c-851f31a7c33e"
          ]
        },
        {
          "uuid": "f14b616d-83ff-4503-b20c-06617f399f27",
          "code": "227-598-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.025.089",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cd86eeeb-32a6-467e-90fc-8f0576be5304"
          ]
        },
        {
          "uuid": "cde923f1-507f-af3f-0c0d-2fd0a4d3bbe1",
          "code": "DTXSID8034748",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8034748",
          "code_system": "EPA CompTox",
          "references": [
            "f7edfc56-9ab4-a30d-febf-cc7cb4f0f76a"
          ]
        },
        {
          "uuid": "cc4cfb57-2f47-275c-e8fe-2d75a1ea57ab",
          "code": "73555192",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73555192",
          "code_system": "PUBCHEM",
          "references": [
            "7d4949e4-c89b-e7b2-5c01-d0b7de2b8aed"
          ]
        },
        {
          "uuid": "b9d1ce13-b44f-47db-8edc-5d300d0b0774",
          "code": "O5A2M92125",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "2e34e5f4-efca-49c3-a5e0-77b9a05c4667",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "783a1594-5d42-4f77-b5c2-6fbbbea25974",
            "refuuid": "ceaa41e2-b2db-4173-908f-a0e4d5bd470a",
            "name": "METHYLARSONIC ACID",
            "unii": "J37VJ5709S",
            "linking_id": "J37VJ5709S",
            "ref_pname": "METHYLARSONIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "838d9ed0-340b-4da2-8c15-744c604662c9",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "597c0dd6-9653-4569-89dc-c14e3d18b5f7",
            "refuuid": "ceaa41e2-b2db-4173-908f-a0e4d5bd470a",
            "name": "METHYLARSONIC ACID",
            "unii": "J37VJ5709S",
            "linking_id": "J37VJ5709S",
            "ref_pname": "METHYLARSONIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "628f07de-6aa8-4728-9490-d813a48a13f3",
          "name": "ARSONIC ACID, METHYL-, CALCIUM SALT (2:1)",
          "stdName": "ARSONIC ACID, METHYL-, CALCIUM SALT (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "806164d6-aa2c-4f7b-a84c-acfa050e652d"
          ],
          "display_name": false
        },
        {
          "uuid": "f3ce00cf-2f78-4e59-a899-959afd90bc4e",
          "name": "CALAR",
          "stdName": "CALAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "d3ca0d38-aa45-434a-9591-99d8cc1203ca",
          "name": "CALCIUM ACID METHANEARSONATE",
          "stdName": "CALCIUM ACID METHANEARSONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "806164d6-aa2c-4f7b-a84c-acfa050e652d"
          ],
          "display_name": false
        },
        {
          "uuid": "75b845bb-1aa4-4263-9d46-abcfb237ff94",
          "name": "CALCIUM ACID METHYL ARSONATE",
          "stdName": "CALCIUM ACID METHYL ARSONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "fd949e1a-ba61-4962-b780-77d8a3e1bff1",
          "name": "CALCIUM BIS(HYDROGEN METHYLARSONATE)",
          "stdName": "CALCIUM BIS(HYDROGEN METHYLARSONATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d3dbe05-8345-481a-8ecd-640bf4481733"
          ],
          "display_name": true
        },
        {
          "uuid": "38618581-6030-4fbf-9b6e-cef4b665bb35",
          "name": "CALCIUM BIS(METHYLARSONATE)",
          "stdName": "CALCIUM BIS(METHYLARSONATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24247071-832c-4c4b-a9ac-2c261418331e"
          ],
          "display_name": false
        },
        {
          "uuid": "2c035681-7857-4e97-a2f2-536661dbcf9f",
          "name": "CALCIUM HYDROGEN METHANEARSONATE",
          "stdName": "CALCIUM HYDROGEN METHANEARSONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "806164d6-aa2c-4f7b-a84c-acfa050e652d"
          ],
          "display_name": false
        },
        {
          "uuid": "58415eea-b645-4bb8-9621-857f3f80bdfe",
          "name": "CALCIUM METHANEARSONATE",
          "stdName": "CALCIUM METHANEARSONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "394aa9da-08bd-4699-921f-48a20da36295",
          "name": "CAMA",
          "stdName": "CAMA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "504fd5a8-a4b5-4873-87a4-a870f172b33c",
          "name": "EPA PESTICIDE CHEMICAL CODE 013806",
          "stdName": "EPA PESTICIDE CHEMICAL CODE 013806",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f23a8332-dfeb-4812-b9fc-eedee7960b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "83e7db01-978d-476f-bdf2-4fa519eb60a8",
          "name": "J8.663K",
          "stdName": "J8.663K",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24247071-832c-4c4b-a9ac-2c261418331e"
          ],
          "display_name": false
        },
        {
          "uuid": "be52477d-e1be-4d0b-be0d-ae0da1ba64b6",
          "name": "MAC",
          "stdName": "MAC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24247071-832c-4c4b-a9ac-2c261418331e"
          ],
          "display_name": false
        },
        {
          "uuid": "f45cf96c-ead6-4a98-90cc-5fd2cadf85bb",
          "name": "METHANEARSONIC ACID, CALCIUM SALT (2:1)",
          "stdName": "METHANEARSONIC ACID, CALCIUM SALT (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "88c644df-11de-4ead-a3a1-71e7957e873b",
          "name": "MSMA, CALCIUM SALT",
          "stdName": "MSMA, CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f23a8332-dfeb-4812-b9fc-eedee7960b0f"
          ],
          "display_name": false
        },
        {
          "uuid": "db983b06-d6f8-4327-882d-c29585c09f34",
          "name": "SUPER CRAB-E-RAD-CALAR",
          "stdName": "SUPER CRAB-E-RAD-CALAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "e1aadfa2-cb98-4cf5-b1c7-ec00e7644936",
          "name": "SUPER DAL-E-RAD-CALAR",
          "stdName": "SUPER DAL-E-RAD-CALAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03e73f0c-30e6-4365-a4fc-1f090b609726"
          ],
          "display_name": false
        },
        {
          "uuid": "55748821-896b-4ce2-9231-5059993efcec",
          "name": "USAF AN-11",
          "stdName": "USAF AN-11",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24247071-832c-4c4b-a9ac-2c261418331e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3d3dbe05-8345-481a-8ecd-640bf4481733",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "03e73f0c-30e6-4365-a4fc-1f090b609726",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/5902-95-4",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/5902-95-4",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "806164d6-aa2c-4f7b-a84c-acfa050e652d",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24247071-832c-4c4b-a9ac-2c261418331e",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J8.663K",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J8.663K",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f23a8332-dfeb-4812-b9fc-eedee7960b0f",
          "citation": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:1,3,31,7,12,25:P3_XCHEMICAL_ID:2714",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:1,3,31,7,12,25:P3_XCHEMICAL_ID:2714",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd86eeeb-32a6-467e-90fc-8f0576be5304",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392058000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb63c7b5-01da-49bf-bcd6-f35d66b1f82f",
          "citation": "SRS import [O5A2M92125]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O5A2M92125",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392058000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7edfc56-9ab4-a30d-febf-cc7cb4f0f76a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5902-95-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d4949e4-c89b-e7b2-5c01-d0b7de2b8aed",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a6e826b1-43e1-4774-bf1c-851f31a7c33e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f00b7f37-c93b-41f0-b333-5ed110e5f620",
          "id": "f00b7f37-c93b-41f0-b333-5ed110e5f620",
          "molfile": "\n  Marvin  01132112272D          \n\n  1  0  0  0  0  0            999 V2000\n    7.2647   -2.5949    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2851ea9-783e-4543-9323-1e2e345f983c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9808bb24-49da-4c88-a7eb-3251f04c5d95",
          "id": "9808bb24-49da-4c88-a7eb-3251f04c5d95",
          "molfile": "\n  Marvin  01132107542D          \n\n  5  4  0  0  0  0            999 V2000\n    2.0721   -3.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0382   -2.6536    0.0000 As  0  0  0  0  0  0  0  0  0  0  0  0\n    1.2671   -2.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0721   -2.0132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8819   -2.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "C[As](=O)(O)O",
          "formula": "CH5AsO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "711d8ef1-a255-45c3-9a08-edd0197f5da4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "139.9703",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "576e22f0-a1a7-4c37-b178-f0bb17083c82",
      "version": "4",
      "structure": {
        "id": "64a27bd9-6062-4b99-a3ef-6ec13d6edd18",
        "molfile": "\n  Marvin  01132105142D          \n\n 11  8  0  0  0  0            999 V2000\n    7.2647   -2.5949    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    4.4780   -2.6536    0.0000 As  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5119   -3.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7069   -2.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5119   -2.0132    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.3217   -2.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4780   -2.6536    0.0000 As  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5119   -3.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7069   -2.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5119   -2.0132    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.3217   -2.8229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n  7 11  2  0  0  0  0\nM  CHG  3   1   2   5  -1  10  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 10   2   3   4   5   6   7   8   9  10  11\nM  SPA   1  5   2   3   4   5   6\nM  SDI   1  4    3.2869   -4.0434    3.2869   -1.5932\nM  SDI   1  4    5.7417   -1.5932    5.7417   -4.0434\nM  SMT   1 2\nM  END",
        "smiles": "C[As](=O)(O)[O-].C[As](=O)(O)[O-].[Ca+2]",
        "formula": "2CH4AsO3.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.0026",
        "optical_activity": "NONE",
        "references": [
          "fb63c7b5-01da-49bf-bcd6-f35d66b1f82f",
          "3d3dbe05-8345-481a-8ecd-640bf4481733"
        ],
        "stereo_centers": 0
      },
      "unii": "O5A2M92125"
    }
  ]
}