{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d550b817-d24d-4f66-8b4d-a96ce5a60fa9",
          "code": "136-45-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=136-45-8",
          "code_system": "CAS",
          "references": [
            "313ff69b-8a1f-44f5-a911-7a816a54aca5",
            "cd85e3af-4c8a-4d8c-9173-47a061b6bc8b"
          ]
        },
        {
          "uuid": "92949ad9-a35e-426a-9e83-e35523fa1735",
          "code": "47201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:462",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "313ff69b-8a1f-44f5-a911-7a816a54aca5"
          ]
        },
        {
          "uuid": "88c665d0-799e-4ead-990a-60989e1235a3",
          "code": "205-245-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.769",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "313ff69b-8a1f-44f5-a911-7a816a54aca5"
          ]
        },
        {
          "uuid": "2cab9151-291c-4801-8428-4beff52cd175",
          "code": "8693",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8693",
          "code_system": "PUBCHEM",
          "references": [
            "313ff69b-8a1f-44f5-a911-7a816a54aca5"
          ]
        },
        {
          "uuid": "9e2d5b26-13fa-2bcf-d0d4-2fc9b1332f20",
          "code": "DTXSID8032544",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8032544",
          "code_system": "EPA CompTox",
          "references": [
            "cfad4c8e-e694-8808-5f69-caf6016abc34"
          ]
        },
        {
          "uuid": "bbbcb19b-5696-4a5a-922b-8d9e7ea8001d",
          "code": "O572Q51ABJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8af85cd8-9720-1015-c934-a2d46bc90837",
          "code": "22364",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=22364",
          "code_system": "NSC",
          "references": [
            "c2e4d63b-0e2e-27ac-ace3-1cb7b441b59e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f466d0cc-c3ac-4655-bb7d-18a0b6b9c97c",
          "name": "2,5-PYRIDINEDICARBOXYLIC ACID, 2,5-DIPROPYL ESTER",
          "stdName": "2,5-PYRIDINEDICARBOXYLIC ACID, 2,5-DIPROPYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "d5cbddd6-adf9-4c5d-8e65-3460a5f56345",
          "name": "2,5-PYRIDINEDICARBOXYLIC ACID, DIPROPYL ESTER",
          "stdName": "2,5-PYRIDINEDICARBOXYLIC ACID, DIPROPYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "e6873ef6-8e15-4e5c-a7b7-e2ffa3b9e1a9",
          "name": "DI-N-PROPYL 2,5-PYRIDINEDICARBOXYLATE",
          "stdName": "DI-N-PROPYL 2,5-PYRIDINEDICARBOXYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "4d97976a-1980-4eea-8e74-742ee95f467e",
          "name": "DIPROPYL 2,5-PYRIDINEDICARBOXYLATE",
          "stdName": "DIPROPYL 2,5-PYRIDINEDICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "57d8ccc1-b273-4995-956b-d3a6317c65ac",
          "name": "DIPROPYL ISOCINCHOMERONATE",
          "stdName": "DIPROPYL ISOCINCHOMERONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd45ab90-7e14-436c-8be4-81315a579661",
            "824c8949-f4e0-4067-ba8e-6ac9c084985c"
          ],
          "display_name": false
        },
        {
          "uuid": "ed25bd50-4f8b-4c74-b78b-bc27fa819ec4",
          "name": "DIPROPYL PYRIDINE-2,5-DICARBOXYLATE",
          "stdName": "DIPROPYL PYRIDINE-2,5-DICARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd45ab90-7e14-436c-8be4-81315a579661",
            "bbd13993-5610-4216-a832-d70f5e846a99"
          ],
          "display_name": false
        },
        {
          "uuid": "75a727ea-525d-4d4e-a8f9-2ec5d0a86889",
          "name": "DIPROPYL PYRIDINEDICARBOXYLATE",
          "stdName": "DIPROPYL PYRIDINEDICARBOXYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "368449dc-df44-4710-a32d-8f79c0b0b1cf",
            "bd45ab90-7e14-436c-8be4-81315a579661",
            "82bbef40-8c09-4c8b-b27c-756d1d9c443f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d7826216-869e-40f6-b685-9012e8d0499a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "40da52c6-e0d1-4261-acac-94a784c5c4de",
          "name": "ISOCINCHOMERONIC ACID DIPROPYL ESTER",
          "stdName": "ISOCINCHOMERONIC ACID DIPROPYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "47d010af-89bd-4f22-8ec2-60fb393d3877",
          "name": "MGK 326",
          "stdName": "MGK 326",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd45ab90-7e14-436c-8be4-81315a579661",
            "dac3de3e-e196-4922-8535-2a7a4145300c"
          ],
          "display_name": false
        },
        {
          "uuid": "abec2a2b-0613-49de-8779-2c00f89ddfb3",
          "name": "MGK REPELLENT 326",
          "stdName": "MGK REPELLENT 326",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "4d2a9270-450a-4c92-8eee-5fa6936ce717",
          "name": "MGK-326",
          "stdName": "MGK-326",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd45ab90-7e14-436c-8be4-81315a579661",
            "6594ea7e-e88b-40f6-9070-97d3ffc5d286"
          ],
          "display_name": false
        },
        {
          "uuid": "d86b997a-158e-4a6d-a01e-fc34e029307b",
          "name": "NSC-22364",
          "stdName": "NSC-22364",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        },
        {
          "uuid": "8262ac10-879e-4ade-95fe-402686f1091d",
          "name": "Quyingding",
          "stdName": "QUYINGDING",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd3c4034-2001-448c-9d87-a3eb967f7a08"
          ],
          "display_name": false,
          "name_jurisdiction": [
            "CN"
          ]
        },
        {
          "uuid": "dbe2e824-8f7e-48d7-b78e-15d72abde8df",
          "name": "R-326",
          "stdName": "R-326",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "368449dc-df44-4710-a32d-8f79c0b0b1cf",
            "bd45ab90-7e14-436c-8be4-81315a579661"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bbd13993-5610-4216-a832-d70f5e846a99",
          "citation": "PCPC-BD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bd45ab90-7e14-436c-8be4-81315a579661",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "824c8949-f4e0-4067-ba8e-6ac9c084985c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "368449dc-df44-4710-a32d-8f79c0b0b1cf",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dac3de3e-e196-4922-8535-2a7a4145300c",
          "citation": "epa",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6594ea7e-e88b-40f6-9070-97d3ffc5d286",
          "citation": "fda-srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "313ff69b-8a1f-44f5-a911-7a816a54aca5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f47ea04-5438-44cd-907a-8eaf0b229e31",
          "citation": "SRS import [O572Q51ABJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O572Q51ABJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82bbef40-8c09-4c8b-b27c-756d1d9c443f",
          "citation": "DIPROPYL PYRIDINEDICARBOXYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfad4c8e-e694-8808-5f69-caf6016abc34",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=136-45-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c2e4d63b-0e2e-27ac-ace3-1cb7b441b59e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cd85e3af-4c8a-4d8c-9173-47a061b6bc8b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dd3c4034-2001-448c-9d87-a3eb967f7a08",
          "citation": "http://www.bcpcpesticidecompendium.org/index_rn_frame.html",
          "url": "http://www.bcpcpesticidecompendium.org/index_rn_frame.html",
          "doc_type": "ISO",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bc79367c-7bbf-484e-9e1e-8ce431f524c1",
          "id": "bc79367c-7bbf-484e-9e1e-8ce431f524c1",
          "molfile": "\n  Marvin  01132109452D          \n\n 18 18  0  0  0  0            999 V2000\n    0.0000   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7096   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4322   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1444   -1.2354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2914   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0036   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0036   -2.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2914   -2.4785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -2.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7210   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7210   -3.3047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4358   -2.0589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1506   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8705   -2.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5803   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 12  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 13 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "CCCOC(=O)c1ccc(C(=O)OCCC)nc1",
          "formula": "C13H17NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "397abbec-ba93-487b-8385-db5875231fae"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "251.2789",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9181df06-d3bf-45d7-9be6-c10690566e9b",
      "version": "8",
      "structure": {
        "id": "0c010a52-d5e4-4e53-a3c9-f06819c61343",
        "molfile": "\n  Marvin  01132100522D          \n\n 18 18  0  0  0  0            999 V2000\n    3.5766   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2914   -2.4785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7210   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0036   -2.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -2.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2914   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7210   -3.3047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0036   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1444   -1.2354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4358   -2.0589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1506   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4322   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8705   -2.0589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7096   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5803   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  1  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  4  2  0  0  0  0\n 10  7  2  0  0  0  0\n 11  3  1  0  0  0  0\n 12  4  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 16  1  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
        "smiles": "CCCOC(=O)c1ccc(C(=O)OCCC)nc1",
        "formula": "C13H17NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "251.2789",
        "optical_activity": "NONE",
        "references": [
          "2dcb7e1d-5070-46b8-b719-9a6f598bc543",
          "1f47ea04-5438-44cd-907a-8eaf0b229e31"
        ],
        "stereo_centers": 0
      },
      "unii": "O572Q51ABJ"
    }
  ]
}