{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c08311ad-eaab-45b6-8c2a-ad139606183f",
          "code": "5850-87-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5850-87-3",
          "code_system": "CAS",
          "references": [
            "b35eb19e-012f-4b61-8a8d-827fc95334f4",
            "8ba1b2b1-754e-49a0-a240-12a831277706"
          ]
        },
        {
          "uuid": "07c87200-095f-4491-b529-90ed8954cb2b",
          "code": "227-459-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.963",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b35eb19e-012f-4b61-8a8d-827fc95334f4"
          ]
        },
        {
          "uuid": "1f9a06cf-da42-f54b-47b4-2faae1c29f36",
          "code": "DTXSID7064025",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7064025",
          "code_system": "EPA CompTox",
          "references": [
            "4b32c3ce-3c87-5f49-2f9f-be846119639d"
          ]
        },
        {
          "uuid": "5dca9cae-0884-4a6d-9572-d19648c1fe26",
          "code": "O4M4O2734M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "291e726a-b2db-44ce-8ba5-1fa3b65e8bad",
          "amount": {
            "uuid": "63dcb9b2-51da-4db2-8dbf-49950bc053b6"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ec149f08-429b-4e60-92e4-445a77c17ac1",
            "refuuid": "e7931632-30c8-4d29-8a42-69de2026e8eb",
            "name": "PIGMENT RED 51 FREE ACID",
            "unii": "C5SKP97SMC",
            "linking_id": "C5SKP97SMC",
            "ref_pname": "PIGMENT RED 51 FREE ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "22b5218f-9b56-4613-b5ab-591e4cf84bc2",
          "name": "BENZENESULFONIC ACID, 4-((2-HYDROXY-1-NAPHTHALENYL)AZO)-2-METHYL-, BARIUM SALT (2:1)",
          "stdName": "BENZENESULFONIC ACID, 4-((2-HYDROXY-1-NAPHTHALENYL)AZO)-2-METHYL-, BARIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb49525d-cace-419d-af8a-36f82fd6d208"
          ],
          "display_name": false
        },
        {
          "uuid": "b7c9697f-7c12-43e7-8a3b-a66ae590601c",
          "name": "BENZENESULFONIC ACID, 4-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-2-METHYL-, BARIUM SALT (2:1)",
          "stdName": "BENZENESULFONIC ACID, 4-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-2-METHYL-, BARIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe27d64f-242c-4c49-8a5d-95d1075ed864"
          ],
          "display_name": false
        },
        {
          "uuid": "eed616d7-baa0-48d4-a40d-e56801701d2d",
          "name": "C.I. PIGMENT RED 51, BARIUM SALT (2:1)",
          "stdName": "C.I. PIGMENT RED 51, BARIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb49525d-cace-419d-af8a-36f82fd6d208"
          ],
          "display_name": false
        },
        {
          "uuid": "16eeaa51-0542-4028-a247-b78cb9959eba",
          "name": "CI 15580",
          "stdName": "CI 15580",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "0111a906-37f7-4c2e-a0df-8999cb207d54",
            "2b0908a4-f16a-4b8d-861e-9b884689b4c6"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "088cdeb2-fc08-48f4-af7d-03d3cccdad25",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d3aa75d4-9a77-431f-8137-7d5846516f9f",
          "name": "PIGMENT RED 51",
          "stdName": "PIGMENT RED 51",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0111a906-37f7-4c2e-a0df-8999cb207d54"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "fe27d64f-242c-4c49-8a5d-95d1075ed864",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0111a906-37f7-4c2e-a0df-8999cb207d54",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb49525d-cace-419d-af8a-36f82fd6d208",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b35eb19e-012f-4b61-8a8d-827fc95334f4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "077163d4-c2e8-4007-a6d6-97c8f05011ba",
          "citation": "SRS import [O4M4O2734M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O4M4O2734M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391972000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b0908a4-f16a-4b8d-861e-9b884689b4c6",
          "citation": "CI 15580 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b32c3ce-3c87-5f49-2f9f-be846119639d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5850-87-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8ba1b2b1-754e-49a0-a240-12a831277706",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7b74325b-1d5d-44b8-bff6-e09a22a21ef4",
          "id": "7b74325b-1d5d-44b8-bff6-e09a22a21ef4",
          "molfile": "\n  Marvin  01132106252D          \n\n  1  0  0  0  0  0            999 V2000\n   29.4887  -10.4256    0.0000 Ba  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ba+2]",
          "formula": "Ba",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b2f08e4-7251-416b-abec-24440bc77ece"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "137.3269",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e0335ee6-7c3e-4ebb-9aa5-a23760106cf0",
          "id": "e0335ee6-7c3e-4ebb-9aa5-a23760106cf0",
          "molfile": "\n  Marvin  01132111372D          \n\n 24 26  0  0  0  0            999 V2000\n   25.6078   -9.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8913   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8913  -10.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796  -10.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677  -10.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -9.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -8.3566    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -7.5291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9981   -8.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3520   -8.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796  -11.6535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677  -12.0717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4722  -12.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7603  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0440  -12.8992    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   22.7603  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4722  -14.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1886  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9092  -14.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6167  -14.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6167  -13.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9003  -12.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1886  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n 12  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 24 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 24 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 23  1  0  0  0  0\nM  CHG  1  16  -1\nM  END",
          "smiles": "Cc1cc(ccc1S(=O)(=O)O)/N=N/c2c3ccccc3ccc2[O-]",
          "formula": "C17H13N2O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "bad42832-eecc-4257-95a2-44fa59fc14d0"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "341.3629",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "683618db-3adb-47ec-9142-ac9242c9a207",
      "version": "6",
      "structure": {
        "id": "795cb25f-2ae4-4fe2-a60c-fc10446a0365",
        "molfile": "\n  Marvin  01132106182D          \n\n 49 52  0  0  0  0            999 V2000\n   29.4887  -10.4256    0.0000 Ba  0  2  0  0  0  0  0  0  0  0  0  0\n   24.9003  -12.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6167  -13.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6167  -14.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9092  -14.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1886  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4722  -14.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7603  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0440  -12.8992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7603  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677  -10.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -7.5291    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.9981   -8.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3520   -8.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -8.3566    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -9.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6078   -9.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8913   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8913  -10.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796  -10.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796  -11.6535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677  -12.0717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4722  -12.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1886  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9003  -12.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6167  -13.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6167  -14.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.9092  -14.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1886  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4722  -14.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7603  -14.1407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0440  -12.8992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7603  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677  -10.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -7.5291    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.9981   -8.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.3520   -8.3566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -8.3566    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796   -9.1887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6078   -9.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8913   -9.5980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.8913  -10.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796  -10.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1796  -11.6535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4677  -12.0717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.4722  -12.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1886  -13.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 14  2  0  0  0  0\n 16 13  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 12  2  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 11  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 10  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25  6  1  0  0  0  0\n 25  2  2  0  0  0  0\n 25 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 49 26  2  0  0  0  0\n 28 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 30  1  0  0  0  0\n 49 30  1  0  0  0  0\n 32 31  2  0  0  0  0\n 34 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 48 34  2  0  0  0  0\n 36 35  1  0  0  0  0\n 45 35  2  0  0  0  0\n 41 36  2  0  0  0  0\n 40 37  1  0  0  0  0\n 40 38  2  0  0  0  0\n 40 39  2  0  0  0  0\n 41 40  1  0  0  0  0\n 43 41  1  0  0  0  0\n 43 42  1  0  0  0  0\n 44 43  2  0  0  0  0\n 45 44  1  0  0  0  0\n 46 45  1  0  0  0  0\n 47 46  2  0  0  0  0\n 48 47  1  0  0  0  0\n 49 48  1  0  0  0  0\nM  CHG  3   1   2  13  -1  37  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1 15  17  18  19  20  21  22  23  24  25  26  27  28  29  30  31\nM  SAL   1 15  32  33  34  35  36  37  38  39  40  41  42  43  44  45  46\nM  SAL   1  3  47  48  49\nM  SPA   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SPA   1  9  17  18  19  20  21  22  23  24  25\nM  SDI   1  4   21.6240  -14.9699   21.6240   -7.1091\nM  SDI   1  4   26.0367   -7.1091   26.0367  -14.9699\nM  SMT   1 2\nM  END",
        "smiles": "Cc1cc(ccc1S(=O)(=O)[O-])/N=N/c2c3ccccc3ccc2O.Cc1cc(ccc1S(=O)(=O)[O-])/N=N/c2c3ccccc3ccc2O.[Ba+2]",
        "formula": "2C17H13N2O4S.Ba",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "820.0526",
        "optical_activity": "NONE",
        "references": [
          "fe27d64f-242c-4c49-8a5d-95d1075ed864",
          "077163d4-c2e8-4007-a6d6-97c8f05011ba"
        ],
        "stereo_centers": 0
      },
      "unii": "O4M4O2734M"
    }
  ]
}