{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "950cf41d-eda3-4a70-b26d-9edd60f0e154",
          "code": "5598-13-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5598-13-0",
          "code_system": "CAS",
          "references": [
            "0caaae78-3e3c-4217-b89e-497087ad0939",
            "9038281c-be52-44f2-8b41-963b38c2957b"
          ]
        },
        {
          "uuid": "d82f42b2-0813-48a0-bfe1-e36c3d7d5f06",
          "code": "C007031",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007031",
          "code_system": "MESH",
          "references": [
            "0caaae78-3e3c-4217-b89e-497087ad0939"
          ]
        },
        {
          "uuid": "e1b0d769-4a5d-417f-9c60-c739b603996a",
          "code": "59102",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1824",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "0caaae78-3e3c-4217-b89e-497087ad0939"
          ]
        },
        {
          "uuid": "4ef857ae-a705-495c-903c-619a87e791e3",
          "code": "227-011-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.556",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0caaae78-3e3c-4217-b89e-497087ad0939"
          ]
        },
        {
          "uuid": "efdb7794-735b-4566-bad9-4a5687a8b3ae",
          "code": "m3465",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3465?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0caaae78-3e3c-4217-b89e-497087ad0939"
          ]
        },
        {
          "uuid": "57c43286-9d9b-4c5e-89fe-8316c03e6e48",
          "code": "21803",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21803",
          "code_system": "PUBCHEM",
          "references": [
            "0caaae78-3e3c-4217-b89e-497087ad0939"
          ]
        },
        {
          "uuid": "4b9dd072-a795-4cbc-d23f-3a9e8a56c117",
          "code": "C163642",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C163642",
          "code_system": "NCI_THESAURUS",
          "references": [
            "02a2c56f-df2d-8a0f-4740-ea6d8ea2cd84"
          ]
        },
        {
          "uuid": "3b8959f2-0cfc-4527-a39e-eec504866aec",
          "code": "6981",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6981",
          "code_system": "HSDB",
          "references": [
            "2cdf0502-314f-32bc-af5e-c66c3114b368"
          ]
        },
        {
          "uuid": "7acbeccc-dc73-1cc8-20e5-778bb5f98cad",
          "code": "DTXSID6032352",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6032352",
          "code_system": "EPA CompTox",
          "references": [
            "ad0ed406-ed60-469a-f4ea-83c5f62a5f67"
          ]
        },
        {
          "uuid": "1fb11ddf-c9de-4795-bf78-87cfc63111d3",
          "code": "O49S38267J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b6df98d3-348d-33de-2fc9-8557a379ad6b",
          "code": "34632",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34632",
          "code_system": "CHEBI",
          "references": [
            "8dbaca39-9ec9-cb27-9f03-c85ce7c9595d"
          ]
        },
        {
          "uuid": "70f329a8-283e-8e1d-4dcd-9a657c7eb4d0",
          "code": "60380",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=60380",
          "code_system": "NSC",
          "references": [
            "a08eddd6-a489-ecb0-f9fb-85d257a8a752"
          ]
        },
        {
          "uuid": "12841818-ca8b-3946-47cc-60575848deb9",
          "code": "chlorpyrifos-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/chlorpyrifos-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "4ae06a07-33bb-b9c2-6f76-90a46b56434e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6a3b3828-b577-457c-a2bf-f2dcf06ab522",
          "name": "CHLORPYRIFOS O,O-DIMETHYL ANALOG",
          "stdName": "CHLORPYRIFOS O,O-DIMETHYL ANALOG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90f39485-ed35-4ef6-9190-d52f2e90ce29",
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9",
            "a3335fb2-762b-43cb-b3fe-70499d1d044e"
          ],
          "display_name": false
        },
        {
          "uuid": "0c58cf60-1d4b-4c1f-94c6-72c868aade49",
          "name": "CHLORPYRIFOS O,O-DIMETHYL ANALOG [MI]",
          "stdName": "CHLORPYRIFOS O,O-DIMETHYL ANALOG [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90f39485-ed35-4ef6-9190-d52f2e90ce29",
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9"
          ],
          "display_name": false
        },
        {
          "uuid": "d39e43a2-be75-42e3-b545-642363fa3050",
          "name": "CHLORPYRIFOS-METHYL",
          "stdName": "CHLORPYRIFOS-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56ca2366-3cdd-4cb4-8366-e18ceee31191",
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9",
            "23dedcf3-df1f-411e-a4f4-fe83b4dcbc36",
            "407e4a73-0632-48a1-b943-cfc668e46c29",
            "1673b19b-4e1e-4da3-9f97-b4e1797ea4f7",
            "f79449c7-99cb-4c55-9d7d-a8cedf852363"
          ],
          "display_name": true
        },
        {
          "uuid": "cb554e38-e6fb-4a4e-9ade-9457d37af640",
          "name": "CHLORPYRIFOS-METHYL [HSDB]",
          "stdName": "CHLORPYRIFOS-METHYL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9",
            "f79449c7-99cb-4c55-9d7d-a8cedf852363"
          ],
          "display_name": false
        },
        {
          "uuid": "29dd36a7-c481-4cfe-98b2-6fd389bdfbe1",
          "name": "CHLORPYRIFOS-METHYL [ISO]",
          "stdName": "CHLORPYRIFOS-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56ca2366-3cdd-4cb4-8366-e18ceee31191",
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9"
          ],
          "display_name": false
        },
        {
          "uuid": "8e7ca0f4-69c7-4b0d-9f08-2dceab820217",
          "name": "CHLORPYRIFOS-METHYL [JAN]",
          "stdName": "CHLORPYRIFOS-METHYL [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a70dd08a-b168-01b4-05ef-63b8d9c4e4f2"
          ],
          "display_name": false
        },
        {
          "uuid": "8b20f930-c52d-4a12-b55c-897ff8b7c5fb",
          "name": "NSC-60380",
          "stdName": "NSC-60380",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9",
            "b8dd97b3-b301-4529-9eb5-910a33ab794c"
          ],
          "display_name": false
        },
        {
          "uuid": "0cd08cd7-07fe-4163-b7c7-0d5d9deb79e8",
          "name": "O,O-DIMETHYL O-(3,5,6-TRICHLORO-2-PYRIDINYL) PHOSPHOROTHIOATE",
          "stdName": "O,O-DIMETHYL O-(3,5,6-TRICHLORO-2-PYRIDINYL) PHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5aa3b6e5-f72b-4167-b16c-ddc6a815bbb2",
            "cf6ca8e1-9a3e-4855-bc35-884084bb5963"
          ],
          "display_name": false
        },
        {
          "uuid": "b263d76d-4bf6-41cf-94db-6905d1b25d3b",
          "name": "O,O-DIMETHYL O-3,5,6-TRICHLORO-2-PYRIDYL PHOSPHOROTHIOATE",
          "stdName": "O,O-DIMETHYL O-3,5,6-TRICHLORO-2-PYRIDYL PHOSPHOROTHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5aa3b6e5-f72b-4167-b16c-ddc6a815bbb2",
            "33740492-cd8d-44fd-be3d-3036be26fb97"
          ],
          "display_name": false
        },
        {
          "uuid": "07505b52-ae1e-49db-a8cd-d7d8361bba7e",
          "name": "PHOSPHOROTHIOIC ACID, O,O-DIMETHYL O-(3,5,6-TRICHLORO-2-PYRIDINYL) ESTER",
          "stdName": "PHOSPHOROTHIOIC ACID, O,O-DIMETHYL O-(3,5,6-TRICHLORO-2-PYRIDINYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b204ab78-92bd-4c69-a2c0-fdff27f3cf1b",
            "e8f73d3e-3abc-47a2-a962-53521e48b0b9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1673b19b-4e1e-4da3-9f97-b4e1797ea4f7",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5aa3b6e5-f72b-4167-b16c-ddc6a815bbb2",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf6ca8e1-9a3e-4855-bc35-884084bb5963",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33740492-cd8d-44fd-be3d-3036be26fb97",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b204ab78-92bd-4c69-a2c0-fdff27f3cf1b",
          "citation": "CHEMSPIDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8f73d3e-3abc-47a2-a962-53521e48b0b9",
          "citation": "CHEMSPIDER",
          "doc_type": "CHEMSPIDER",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f79449c7-99cb-4c55-9d7d-a8cedf852363",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90f39485-ed35-4ef6-9190-d52f2e90ce29",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56ca2366-3cdd-4cb4-8366-e18ceee31191",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8dd97b3-b301-4529-9eb5-910a33ab794c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0caaae78-3e3c-4217-b89e-497087ad0939",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f4cc334-3c00-49cd-a8e4-67eda2860145",
          "citation": "SRS import [O49S38267J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O49S38267J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1c72e4c-03ed-43c4-a3c9-7bc1681fa59f",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23dedcf3-df1f-411e-a4f4-fe83b4dcbc36",
          "citation": "CHLORPYRIFOS-METHYL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3335fb2-762b-43cb-b3fe-70499d1d044e",
          "citation": "CHLORPYRIFOS O,O-DIMETHYL ANALOG [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "407e4a73-0632-48a1-b943-cfc668e46c29",
          "citation": "CHLORPYRIFOS-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a70dd08a-b168-01b4-05ef-63b8d9c4e4f2",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2cdf0502-314f-32bc-af5e-c66c3114b368",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+5598-13-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad0ed406-ed60-469a-f4ea-83c5f62a5f67",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5598-13-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "02a2c56f-df2d-8a0f-4740-ea6d8ea2cd84",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "4ae06a07-33bb-b9c2-6f76-90a46b56434e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "8dbaca39-9ec9-cb27-9f03-c85ce7c9595d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a08eddd6-a489-ecb0-f9fb-85d257a8a752",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9038281c-be52-44f2-8b41-963b38c2957b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f361810f-913e-4749-a2cd-4be1669026d9",
          "id": "f361810f-913e-4749-a2cd-4be1669026d9",
          "molfile": "\n  Marvin  01132112372D          \n\n 16 16  0  0  0  0            999 V2000\n    8.2478   -6.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -6.2310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -5.4123    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7128   -5.4123    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3547   -5.4123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7793   -4.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -4.5763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8197   -4.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1053   -4.5632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3964   -4.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -4.5763    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.3964   -3.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -2.9138    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1053   -2.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8197   -3.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -2.9011    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  3  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "COP(=S)(OC)Oc1c(cc(c(Cl)n1)Cl)Cl",
          "formula": "C7H7Cl3NO3PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fb1f2b40-99a5-41de-97cf-53eca84ea914"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "322.5343",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "409f8b23-e895-4291-a11a-24e9b4ccef8d",
      "version": "10",
      "structure": {
        "id": "3fded3d1-959c-44a7-9bb9-f76a2d3d22e3",
        "molfile": "\n  Marvin  01132103232D          \n\n 16 16  0  0  0  0            999 V2000\n    7.5336   -5.4123    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -4.5763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8197   -4.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8197   -3.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1053   -2.9138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3964   -3.3232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -2.9138    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.3964   -4.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1053   -4.5632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6693   -4.5763    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -2.9011    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.5336   -6.2310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2478   -6.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3547   -5.4123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7793   -4.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7128   -5.4123    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  4 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  1 16  2  0  0  0  0\nM  END",
        "smiles": "COP(=S)(OC)Oc1c(cc(c(Cl)n1)Cl)Cl",
        "formula": "C7H7Cl3NO3PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "322.5343",
        "optical_activity": "NONE",
        "references": [
          "b1c72e4c-03ed-43c4-a3c9-7bc1681fa59f",
          "0f4cc334-3c00-49cd-a8e4-67eda2860145"
        ],
        "stereo_centers": 0
      },
      "unii": "O49S38267J"
    }
  ]
}