{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2fea02a6-105a-412d-b977-7bc0637098e3",
          "code": "118-57-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118-57-0",
          "code_system": "CAS",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a",
            "96c67a5c-9425-47d1-b46b-0fe6cd4769b7"
          ]
        },
        {
          "uuid": "220eb9a2-3a54-4353-afce-661edab9200c",
          "code": "C72101",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72101",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "3f831151-375a-47f0-8239-06335f82fd0f",
          "code": "ACETAMINOSALOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acetaminosalol",
          "code_system": "WIKIPEDIA",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "17ad7ef4-1faf-4279-8ad6-5fb6e134d2da",
          "code": "SUB05217MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "1904e657-8309-4f48-9625-866b59b7fe9c",
          "code": "616",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=616",
          "code_system": "INN",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "1a8ea42c-a02f-48ec-9f24-3d4bae02aabb",
          "code": "204-261-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.875",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "1f98cd73-0d45-41a5-a06f-44795e651392",
          "code": "m990",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m990?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "40af4539-0556-4638-81e3-69125993a2a5",
          "code": "CHEMBL92590",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL92590",
          "code_system": "ChEMBL",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "2d6bd055-2f4e-4ab4-a2b5-c13f9a6074e5",
          "code": "1984",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1984",
          "code_system": "PUBCHEM",
          "references": [
            "a22a7f8f-b9bf-4457-ba7f-85246f186c6a"
          ]
        },
        {
          "uuid": "608bbcbe-77a5-eeda-4057-4d69d3d05d7a",
          "code": "DTXSID7045865",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7045865",
          "code_system": "EPA CompTox",
          "references": [
            "f336b1fc-46b7-76ce-6e32-e5595e4fdf36"
          ]
        },
        {
          "uuid": "880e8fe8-7b52-7674-9727-4f5d08904e8f",
          "code": "C2356",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2356",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3f6986f4-fbec-047f-cf67-06a1063a54c3"
          ]
        },
        {
          "uuid": "aedbbf50-b0a9-4563-9165-7d7fe1a1950c",
          "code": "O3J7H54KMD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cc96ab64-4d3b-6377-e51a-889f034ef5e6",
          "code": "53",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/53",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3f6986f4-fbec-047f-cf67-06a1063a54c3"
          ]
        },
        {
          "uuid": "83d2bcc4-4599-c98a-0e22-2a2244493cd1",
          "code": "100000087918",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e3b35dea-e671-6934-01c4-07582573ee4d"
          ]
        },
        {
          "uuid": "a547add1-1517-5b9e-c8e1-10d9063fbce2",
          "code": "757877",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=757877",
          "code_system": "NSC",
          "references": [
            "aa819028-e57a-88aa-3098-f66e0fc99d32"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7da47927-17d7-49a6-b4e4-5db7403e9677",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "56c349df-3365-4fc8-a72e-ac5b9e6d8c0c",
            "refuuid": "f2cc78a2-c8dd-418b-af8f-1b1183c53aa8",
            "name": "ACETAMINOSALOL",
            "unii": "O3J7H54KMD",
            "linking_id": "O3J7H54KMD",
            "ref_pname": "ACETAMINOSALOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2558680f-a3fb-4e58-b968-d127dd7ce39f",
          "name": "ACETAMINOSALOL",
          "stdName": "ACETAMINOSALOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09df81da-ff15-468e-acfd-1d4b0e0ce3a2",
            "7e1ab2ee-dc99-46e4-ac97-b14bf2823f27",
            "8632bcd8-c004-40a8-98e9-63c04fcca58b",
            "e10335a3-e1e9-465f-a116-91125731e685",
            "26a25c23-6d43-4e2f-a7a2-ccb5437522da",
            "5123fd2c-7774-439f-b815-ba843a3ee324",
            "02c6c8f4-8017-40cd-86ed-2dc9b1444733",
            "11243f34-7f62-4a65-bfd6-1b269c3b0fb7",
            "43b1b59a-0421-4ab7-8ada-90cc29d99d47",
            "c7f908a2-fd5d-404f-9c01-e6f70f0e9473",
            "769f86a2-bfdb-49ac-aa4d-f065055199e5",
            "090d0f4d-972c-4d13-929a-2180566aa42b"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dad2c899-8dfa-4fc4-accd-fbd12f6ca8c8",
              "name_org": "INN"
            },
            {
              "uuid": "7715ea40-139c-48c1-b55b-d5ebdcfb718d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a276d24b-b78e-4972-b115-183cc2dd323c",
          "name": "ACETAMINOSALOL [MART.]",
          "stdName": "ACETAMINOSALOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11243f34-7f62-4a65-bfd6-1b269c3b0fb7"
          ],
          "display_name": false
        },
        {
          "uuid": "0ec36f52-9746-47b0-997a-3f96bfd2f300",
          "name": "ACETAMINOSALOL [MI]",
          "stdName": "ACETAMINOSALOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02c6c8f4-8017-40cd-86ed-2dc9b1444733",
            "c7f908a2-fd5d-404f-9c01-e6f70f0e9473"
          ],
          "display_name": false
        },
        {
          "uuid": "83587c32-3e00-3e89-ce88-308c795fc83a",
          "name": "Acetaminosalol [WHO-DD]",
          "stdName": "ACETAMINOSALOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b493eaa-cc10-dca3-7fef-a3af32645c24"
          ],
          "display_name": false
        },
        {
          "uuid": "4b34f274-9e5f-2bab-cca9-d68e2a9938fa",
          "name": "NSC-757877",
          "stdName": "NSC-757877",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa819028-e57a-88aa-3098-f66e0fc99d32"
          ],
          "display_name": false
        },
        {
          "uuid": "85747c62-40ca-4198-887c-d284a9d36fb6",
          "name": "acetaminosalol [INN]",
          "stdName": "ACETAMINOSALOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8632bcd8-c004-40a8-98e9-63c04fcca58b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "09df81da-ff15-468e-acfd-1d4b0e0ce3a2",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8632bcd8-c004-40a8-98e9-63c04fcca58b",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "11243f34-7f62-4a65-bfd6-1b269c3b0fb7",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7f908a2-fd5d-404f-9c01-e6f70f0e9473",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02c6c8f4-8017-40cd-86ed-2dc9b1444733",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "769f86a2-bfdb-49ac-aa4d-f065055199e5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e10335a3-e1e9-465f-a116-91125731e685",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a22a7f8f-b9bf-4457-ba7f-85246f186c6a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07898b67-6ec0-4a81-892f-1b88435d246b",
          "citation": "SRS import [O3J7H54KMD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O3J7H54KMD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ae94bc9-906e-41cf-86c3-334e6b72e104",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26a25c23-6d43-4e2f-a7a2-ccb5437522da",
          "citation": "ACETAMINOSALOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "43b1b59a-0421-4ab7-8ada-90cc29d99d47",
          "citation": "ACETAMINOSALOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "090d0f4d-972c-4d13-929a-2180566aa42b",
          "citation": "ACETAMINOSALOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5123fd2c-7774-439f-b815-ba843a3ee324",
          "citation": "ACETAMINOSALOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7e1ab2ee-dc99-46e4-ac97-b14bf2823f27",
          "citation": "ACETAMINOSALOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f336b1fc-46b7-76ce-6e32-e5595e4fdf36",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=118-57-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3f6986f4-fbec-047f-cf67-06a1063a54c3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "96c67a5c-9425-47d1-b46b-0fe6cd4769b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "aa819028-e57a-88aa-3098-f66e0fc99d32",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7b493eaa-cc10-dca3-7fef-a3af32645c24",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e3b35dea-e671-6934-01c4-07582573ee4d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f07f640-c2f9-4c1f-acf4-f3cc773bc26b",
          "id": "6f07f640-c2f9-4c1f-acf4-f3cc773bc26b",
          "molfile": "\n  Marvin  01132105462D          \n\n 20 21  0  0  0  0            999 V2000\n    6.4277   -0.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4239   -1.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1326   -1.4505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7054   -1.4476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9926   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2770   -1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5661   -1.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5666   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8527    0.2084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413   -0.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1410   -1.0287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095   -0.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095    1.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273    1.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    1.4505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2820    0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9971   -0.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 20  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 19  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)Nc1ccc(cc1)OC(=O)c2ccccc2O",
          "formula": "C15H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e9c57dbf-fecb-4d8c-822d-772b5528bf79"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "271.2686",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f2cc78a2-c8dd-418b-af8f-1b1183c53aa8",
      "version": "13",
      "structure": {
        "id": "ccd5bc40-55eb-4680-9ffa-298c7e964fa8",
        "molfile": "\n  Marvin  01132110352D          \n\n 20 21  0  0  0  0            999 V2000\n    2.1413    1.4505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273    1.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095    1.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095   -0.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273    0.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413   -0.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1410   -1.0287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8527    0.2084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5666   -0.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5661   -1.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2770   -1.4430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9926   -1.0322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7054   -1.4476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4239   -1.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1326   -1.4505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4277   -0.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9971   -0.2116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2820    0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 14 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 11  2  0  0  0  0\nM  END",
        "smiles": "CC(=O)Nc1ccc(cc1)OC(=O)c2ccccc2O",
        "formula": "C15H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "271.2686",
        "optical_activity": "NONE",
        "references": [
          "07898b67-6ec0-4a81-892f-1b88435d246b",
          "7ae94bc9-906e-41cf-86c3-334e6b72e104",
          "8632bcd8-c004-40a8-98e9-63c04fcca58b"
        ],
        "stereo_centers": 0
      },
      "unii": "O3J7H54KMD"
    }
  ]
}