{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "10e07a97-40b4-4446-b93e-a06c8a60d6d6",
          "code": "N05BA06",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|lorazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BA06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "0cc5634d-e392-4e4d-bac6-d757d0ab18b6",
          "code": "N0000175694",
          "comments": "Established Pharmacologic Class [EPC]|Benzodiazepine [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175694",
          "code_system": "NDF-RT",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "e5a59fbf-daeb-495d-be9b-5f1dd8c8e526",
          "code": "N0000007542",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds, 2-Ring [Chemical/Ingredient]|Benzazepines [Chemical/Ingredient]|Benzodiazepines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007542",
          "code_system": "NDF-RT",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "caa44667-c430-4caa-8ebd-59831fa34a92",
          "code": "846-49-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=846-49-1",
          "code_system": "CAS",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b",
            "f13c7ca7-d174-41ba-be6e-01f9d512b709"
          ]
        },
        {
          "uuid": "001a8897-d1ed-4cda-ad7d-d311a0208265",
          "code": "C619",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C619",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "59e43671-ae7a-4ce4-a8fc-8fa67d6b0c29",
          "code": "D008140",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008140",
          "code_system": "MESH",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "dfff1908-313e-4c53-8095-a1070db89e72",
          "code": "NBK548563",
          "comments": "LiverTox|CNS|Sedative/Hypnotic|Benzodiazepine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548563/",
          "code_system": "LIVERTOX",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "8f2a22cb-daa1-424a-ae63-9728a49a001b",
          "code": "LORAZEPAM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lorazepam",
          "code_system": "WIKIPEDIA",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "16b10c6a-8df2-4390-a11d-f6ca3b9e6992",
          "code": "05",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Anticonvulsants/antiepileptics",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/48/?section=42#type145",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "f974dac1-f6d7-4943-9c51-702950f19423",
          "code": "N05BA56",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|lorazepam, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05BA56&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "cf6ca637-4575-4106-9803-ac3650eb813b",
          "code": "QN05BA56",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|lorazepam, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BA56&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "8c819fb0-e4e2-4c38-bc58-10b29c8f7ab7",
          "code": "QN05BA06",
          "comments": "VATC|PSYCHOLEPTICS|ANXIOLYTICS|Benzodiazepine derivatives|lorazepam",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05BA06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "f5ca0d22-8f70-4564-830a-0e24cad446bb",
          "code": "SUB08582MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "7ce9e95b-7186-4a3e-ae4c-9f49e76695bd",
          "code": "2809",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2809",
          "code_system": "INN",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "099e87f6-6570-47d1-b210-ad90f4f2fc1c",
          "code": "212-687-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.534",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "1032fb0d-1892-4324-add5-4f1d2ebbcf05",
          "code": "2885",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "c78cef8e-61b2-4fa5-9999-92c8d5c83b65",
          "code": "5884",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=5884",
          "code_system": "IUPHAR",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "3ca7f711-3ef1-479e-aebc-8f5d614f4970",
          "code": "6470",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6470/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "a0d7f5ef-daf0-4bda-86c6-6dfe9c2886a9",
          "code": "m6906",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6906?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "6c5b48d9-debd-43e3-84cb-11937d6ffe62",
          "code": "DB00186",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00186",
          "code_system": "DRUG BANK",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "255a6114-7221-46f5-a867-e999830da074",
          "code": "CHEMBL580",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL580",
          "code_system": "ChEMBL",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "8ebedc7a-182b-4a22-9039-cd51dcc8b180",
          "code": "3958",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3958",
          "code_system": "PUBCHEM",
          "references": [
            "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b"
          ]
        },
        {
          "uuid": "9599f772-d009-dd68-6418-b5d285bb2546",
          "code": "DTXSID7023225",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023225",
          "code_system": "EPA CompTox",
          "references": [
            "f595db09-ad3a-0b78-eb91-7dbaadc74024"
          ]
        },
        {
          "uuid": "c9a07e67-7f0c-f326-4b24-b58deaf6b0a0",
          "code": "Lorazepam",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM364/",
          "code_system": "LACTMED",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "45f94feb-5679-4513-d050-3098dd8f0310",
          "code": "C1012",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012",
          "code_system": "NCI_THESAURUS",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "f7ee2d12-f207-5e12-a037-bfa12c99266d",
          "code": "C267",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antiemetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C267",
          "code_system": "NCI_THESAURUS",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "b9aeedca-d631-40d7-8ab1-eb4b39604a2f",
          "code": "O26FZP769L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9ef977f7-56e8-f48e-7c47-e2177b3debda",
          "code": "1606",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1606",
          "code_system": "DRUG CENTRAL",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "82779df6-b783-13a4-ffa3-43ccb79b8662",
          "code": "52993",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:52993",
          "code_system": "CHEBI",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "d4008e65-08c9-b9da-877c-b2643cb43763",
          "code": "1370305",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1370305",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd"
          ]
        },
        {
          "uuid": "813b4627-dd09-6262-36f9-471f75336144",
          "code": "O26FZP769L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=O26FZP769L",
          "code_system": "DAILYMED",
          "references": [
            "47377969-c650-1d97-f19b-897318e3eff5"
          ]
        },
        {
          "uuid": "2aaa0a9a-8153-ea3e-3b7d-094220931b27",
          "code": "100000092162",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b138c6f6-43b4-783d-3911-c97259d66d67"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "19598484-c786-49ed-8263-9702a1d3313b",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bcab5f51-bf03-45ad-a0a0-6748802c6799",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68d577a9-116e-4a38-9fd4-9e3223523061",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5425035-2fdc-4d08-80c7-c57f1b702006",
          "citation": "INN Proposed List 23",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL23.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5bf3cb0f-56ca-45de-ba5d-8e7cfede522f",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4df80bb9-fb09-4efe-89b5-e22d302a0218",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d22f85c-0543-412a-9abb-09521606e353",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecfa76a1-d774-4acc-a592-3d6f167f6f79",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da63b221-4637-4e33-9ff6-7a8c1aac7d2b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0fd250ad-c2ff-4590-8959-5f7c95329667",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9939671-7216-4d0f-99e6-95afae1005bf",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57a6ec1e-067a-465c-a2f1-82ce26436129",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65ea327a-660d-48a4-9512-d5ebf87916ff",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76be224c-ed54-4800-8c3b-7a225301f74d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cab9ac5-7b0e-484b-8ef8-785fe8170d9b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd420425-e7b4-43d2-971a-1187a7e0de41",
          "citation": "EP 7.8 LORAZEPAM MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "620af909-022c-4ac7-ac1b-42c0f22cef8b",
          "citation": "USP 36 LORAZEPAM MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "389a5f23-b762-45a4-a968-78a4c789085b",
          "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=07cae057-a593-4e4d-a478-2d7fc9f06857",
          "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=07cae057-a593-4e4d-a478-2d7fc9f06857",
          "doc_type": "DRUG PRODUCT LABEL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dec7ab16-ca27-426d-ab8c-38b9b424b0f2",
          "citation": "SRS import [O26FZP769L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O26FZP769L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389697000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f160028-317f-4183-bbb7-d26494cc6abb",
          "citation": "LORAZEPAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "def20e9f-a560-46e7-9cf5-a29c806f8e43",
          "citation": "LORAZEPAM [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecc061d4-0b04-46aa-88e3-dbb9768abfcd",
          "citation": "LORAZEPAM [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc642535-40f7-4353-8f55-f682e00f8e79",
          "citation": "LORAZEPAM [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c849af4c-bf7f-4d4c-b96f-387928648b10",
          "citation": "LORAZEPAM [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6ba78dc6-8177-4dd1-8148-d6868e76f6ce",
          "citation": "LORAZEPAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd4e76d5-462b-4139-8e05-001dc5676255",
          "citation": "LORAZEPAM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d0766cbd-9cbc-43e0-8e53-cb3be9f51515",
          "citation": "LORAZEPAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c08e203-5018-43db-9a27-fe06d51f2daa",
          "citation": "LORAZEPAM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b5ac203-36b9-43f4-9d53-208713896808",
          "citation": "LORAZEPAM CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bafe165a-7023-d5b9-8a3e-b226aa74bcc4",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "f595db09-ad3a-0b78-eb91-7dbaadc74024",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=846-49-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ecf4a4d3-cd04-a634-14c3-c6508d196e5f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+846-49-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f79d8563-ddfa-cb87-3579-8fff33d8c624",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/357?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "06892b56-7da4-528a-f03e-eba84f2591b9",
          "citation": "LORAZEPAM",
          "doc_type": "MICROMEDEX",
          "public_domain": true
        },
        {
          "uuid": "45a36676-64dd-a641-f5f2-fb9cd7b6d3cd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f13c7ca7-d174-41ba-be6e-01f9d512b709",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8907d7d5-8165-cf78-f019-623b15a02699",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "3d71ed30-274f-6c36-92c3-c074aa26056d",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "eadac566-8e2f-4e86-bbf9-ddf0738956ed",
          "citation": "https://en.wikipedia.org/wiki/Diclazepam",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b220875-a961-4170-b3ce-bafa03253070",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2021/214826Orig1s000ltr.pdf",
          "url": "https://www.accessdata.fda.gov/drugsatfda_docs/appletter/2021/214826Orig1s000ltr.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "403871f8-a544-b88b-79f1-3af17f6610af",
          "citation": "USP",
          "doc_type": "USP",
          "public_domain": true
        },
        {
          "uuid": "90aa61bf-4ad3-4e4d-683d-fe99beceb220",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47377969-c650-1d97-f19b-897318e3eff5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b138c6f6-43b4-783d-3911-c97259d66d67",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e68d0c2-2785-4288-9c2a-aba62ccaff6e",
          "id": "5e68d0c2-2785-4288-9c2a-aba62ccaff6e",
          "molfile": "\n  Marvin  01132104532D          \n\n 21 23  0  0  0  0            999 V2000\n    5.8915   -1.4568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1271   -1.2329    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.7101   -1.9279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9148   -2.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9148   -2.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6355   -3.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6201   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9148   -4.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2122   -4.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2122   -3.3332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4941   -2.9317    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.3203   -1.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5713   -1.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8841   -1.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1299   -1.7580    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.8841   -0.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6099   -0.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3203   -0.7233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0229   -0.2523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8208   -0.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3742    0.1415    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 20  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n 12  4  2  3  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  3  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)C2=c3cc(ccc3=NC(=O)C(N2)O)Cl)Cl",
          "formula": "C15H10Cl2N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "39193ac9-b41e-40a1-bbd9-7a058d32c56c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "321.1585",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dbdd5a8b-0d0d-4c1a-b718-63e24a959406",
      "version": "50",
      "structure": {
        "id": "155d1351-f543-4a38-b3f7-a0ca9293055c",
        "molfile": "\n   JSDraw207182414242D\n\n 21 23  0  0  0  0              0 V2000\n   24.1121   -7.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6160   -7.1486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.9880   -6.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3165   -3.9801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8253   -4.4474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4045   -5.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1121   -9.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.9880   -4.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.5717   -7.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7836   -9.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8717   -3.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6447   -3.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2722   -6.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8499   -6.2578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4257   -9.0467    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   20.2722   -4.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8461   -6.8273    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   25.4749   -9.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7836  -11.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4458  -11.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1121  -12.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  5  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  2  0  0  0  0\n  6 14  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18  7  1  0  0  0  0\n 19 10  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n  5  4  1  0  0  0  0\n 21 19  2  0  0  0  0\n 16 12  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)C2=NC(C(=O)Nc3ccc(cc32)Cl)O)Cl",
        "formula": "C15H10Cl2N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "321.1585",
        "optical_activity": "( + / - )",
        "references": [
          "19598484-c786-49ed-8263-9702a1d3313b",
          "dec7ab16-ca27-426d-ab8c-38b9b424b0f2",
          "d5425035-2fdc-4d08-80c7-c57f1b702006"
        ],
        "stereo_centers": 1
      },
      "unii": "O26FZP769L",
      "relationships": [
        {
          "uuid": "18f7432a-197a-4e11-aec9-61440a933230",
          "amount": {
            "uuid": "0ec240de-fe1d-4f7a-810f-faa2c37e78fb",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98.5
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "bd420425-e7b4-43d2-971a-1187a7e0de41"
          ],
          "related_substance": {
            "uuid": "e93912d5-afae-4699-a833-89f145654d03",
            "refuuid": "dbdd5a8b-0d0d-4c1a-b718-63e24a959406",
            "name": "Lorazepam",
            "unii": "O26FZP769L",
            "linking_id": "O26FZP769L",
            "ref_pname": "Lorazepam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0b82eef9-d29d-4719-b2f6-e4cb0b883021",
          "amount": {
            "uuid": "8d9197d6-bdb0-423b-a9a1-8d772f0eb4d1",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "620af909-022c-4ac7-ac1b-42c0f22cef8b"
          ],
          "related_substance": {
            "uuid": "fedbc19e-812e-4f21-b431-942daac578b4",
            "refuuid": "dbdd5a8b-0d0d-4c1a-b718-63e24a959406",
            "name": "Lorazepam",
            "unii": "O26FZP769L",
            "linking_id": "O26FZP769L",
            "ref_pname": "Lorazepam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7f9a637a-7c82-4d78-a52a-80b3d1616007",
          "amount": {
            "uuid": "455ab3fd-7e80-4107-a965-3ff560634cd8",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "620af909-022c-4ac7-ac1b-42c0f22cef8b"
          ],
          "related_substance": {
            "uuid": "f86a2d7e-f759-4f6d-971d-7725fb86b0aa",
            "refuuid": "39e6c606-3a91-43a7-b34d-35d5c06441bb",
            "name": "Lorazepam acetate",
            "unii": "Y4HA6DWZ18",
            "linking_id": "Y4HA6DWZ18",
            "ref_pname": "Lorazepam acetate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bb23dd3d-0e0d-492c-891f-61e0fc45f220",
          "amount": {
            "uuid": "c012b904-b4a9-4ebb-b966-f336f840ff40",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "bd420425-e7b4-43d2-971a-1187a7e0de41"
          ],
          "related_substance": {
            "uuid": "508b3a74-7638-4916-94b0-81dbc203fff6",
            "refuuid": "39e6c606-3a91-43a7-b34d-35d5c06441bb",
            "name": "Lorazepam acetate",
            "unii": "Y4HA6DWZ18",
            "linking_id": "Y4HA6DWZ18",
            "ref_pname": "Lorazepam acetate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67648a06-660c-4ec5-9090-9762b7494b98",
          "amount": {
            "uuid": "b59e1557-9279-44be-ae0e-0bc769fd806a"
          },
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "bd420425-e7b4-43d2-971a-1187a7e0de41"
          ],
          "related_substance": {
            "uuid": "ab8971fe-be23-4c1d-b40d-f22292a51a74",
            "refuuid": "5b1d8cf2-8f08-4b1d-af46-cdb1de959786",
            "name": "2-Amino-2',5-dichlorobenzophenone",
            "unii": "G806VEO3KE",
            "linking_id": "G806VEO3KE",
            "ref_pname": "2-Amino-2',5-dichlorobenzophenone",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2365c05b-a8b7-4726-989f-0b70d8b1c2ea",
          "amount": {
            "uuid": "7bcef080-771f-4231-844b-66d35573d348",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.01
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "620af909-022c-4ac7-ac1b-42c0f22cef8b"
          ],
          "related_substance": {
            "uuid": "6d1439fc-1d9e-4ea1-9fef-c7f71d5b4559",
            "refuuid": "5b1d8cf2-8f08-4b1d-af46-cdb1de959786",
            "name": "2-Amino-2',5-dichlorobenzophenone",
            "unii": "G806VEO3KE",
            "linking_id": "G806VEO3KE",
            "ref_pname": "2-Amino-2',5-dichlorobenzophenone",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "066c06c2-a708-46c9-afd3-c70699413031",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "bd420425-e7b4-43d2-971a-1187a7e0de41"
          ],
          "related_substance": {
            "uuid": "589129fb-1a8c-4353-a21d-e47249057eec",
            "refuuid": "d32bc970-a549-4db9-920e-df4f1f4918c7",
            "name": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline carboxaldehyde",
            "unii": "8RF5NW66M0",
            "linking_id": "8RF5NW66M0",
            "ref_pname": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline carboxaldehyde",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "264ccc2a-722d-471b-a6f5-d369b59cb756",
          "amount": {
            "uuid": "7f477285-118c-4c3d-ac79-a5c48c9a959a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.3
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "620af909-022c-4ac7-ac1b-42c0f22cef8b"
          ],
          "related_substance": {
            "uuid": "7435e277-2232-40c6-ab2f-64f85c1a0116",
            "refuuid": "d32bc970-a549-4db9-920e-df4f1f4918c7",
            "name": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline carboxaldehyde",
            "unii": "8RF5NW66M0",
            "linking_id": "8RF5NW66M0",
            "ref_pname": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline carboxaldehyde",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "14d91d4a-023e-4893-9b35-55ec290634bc",
          "amount": {
            "uuid": "bd33ca81-f990-4de8-8cab-95ef46d29d63",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "620af909-022c-4ac7-ac1b-42c0f22cef8b"
          ],
          "related_substance": {
            "uuid": "7b7d8a7f-23be-428b-8279-9bbd4b0d536d",
            "refuuid": "3563ea8f-486b-4c51-b31d-0433401fea75",
            "name": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline carboxylic acid",
            "unii": "DYN1NC1YTQ",
            "linking_id": "DYN1NC1YTQ",
            "ref_pname": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline carboxylic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1086bda6-7b53-4aa5-aa9a-c609adec710b",
          "amount": {
            "uuid": "8aa4fe3a-7117-46d7-a335-eecc039d00e3",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 0.15
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "620af909-022c-4ac7-ac1b-42c0f22cef8b"
          ],
          "related_substance": {
            "uuid": "55611032-c4ea-4de4-aa79-904036933077",
            "refuuid": "284622c2-a920-45ef-a8d9-382804164dbe",
            "name": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline methanol",
            "unii": "8EG947OE7V",
            "linking_id": "8EG947OE7V",
            "ref_pname": "6-Chloro-4-(o-chlorophenyl)-2-quinazoline methanol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6c3baca6-5ae4-4997-a28c-00049e5a7f74",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "references": [
            "bd420425-e7b4-43d2-971a-1187a7e0de41"
          ],
          "related_substance": {
            "uuid": "a1f045ff-6e9c-4297-a4e9-51e1ea577dcc",
            "refuuid": "e6dd23e8-593a-4813-a662-03e2c102c936",
            "name": "7-Chloro-5-(2-chlorophenyl)-1,3-dihydro-2h-1,4-benzodiazepin-2-one 4-oxide",
            "unii": "7A15A4JNHO",
            "linking_id": "7A15A4JNHO",
            "ref_pname": "7-Chloro-5-(2-chlorophenyl)-1,3-dihydro-2h-1,4-benzodiazepin-2-one 4-oxide",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9a50d9f9-a513-4afd-bcaa-4847bb31170b",
          "amount": {
            "uuid": "d7aaa183-b1f3-4820-a2d5-b1d9d595f784",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "bd420425-e7b4-43d2-971a-1187a7e0de41"
          ],
          "related_substance": {
            "uuid": "3fcc0948-c204-4c13-8e33-39e45fa41763",
            "refuuid": "48e4e907-210f-4c77-a9ef-f8c5dfc10509",
            "name": "7-CHLORO-5-(2-CHLOROPHENYL)-4,5-DIHYDRO-1H-1,4-BENZODIAZEPINE-2,3-DIONE, (±)-",
            "unii": "E88956SKOE",
            "linking_id": "E88956SKOE",
            "ref_pname": "7-CHLORO-5-(2-CHLOROPHENYL)-4,5-DIHYDRO-1H-1,4-BENZODIAZEPINE-2,3-DIONE, (±)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a9dbf52e-a039-4f73-b872-fc90d93799a5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ca7c7ba9-eb81-4445-8c55-758dccf00e71",
            "refuuid": "dbdd5a8b-0d0d-4c1a-b718-63e24a959406",
            "name": "Lorazepam",
            "unii": "O26FZP769L",
            "linking_id": "O26FZP769L",
            "ref_pname": "Lorazepam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "20d0bbdd-44d5-4ea4-af3e-f65d868ff1ed",
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "389a5f23-b762-45a4-a968-78a4c789085b"
          ],
          "related_substance": {
            "uuid": "216bd1b0-6322-4e51-9860-bc907f170ccf",
            "refuuid": "1cb5c27f-a3a6-49e3-b713-239547bf0f42",
            "name": "LORAZEPAM GLUCURONIDE",
            "unii": "P0G8I56129",
            "linking_id": "P0G8I56129",
            "ref_pname": "LORAZEPAM GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "940f61a1-6b12-4dcd-a0b4-944f34140eb3",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "21071b38-1c91-4fcb-beb8-7dd87dee476c",
            "refuuid": "a84c7c23-3f41-4258-9a5a-dc004d8771c1",
            "name": "LORAZEPAM, (R)-",
            "unii": "H6MU343Z6I",
            "linking_id": "H6MU343Z6I",
            "ref_pname": "LORAZEPAM, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d0b1eb3c-50bb-40fc-8917-af02390903f9",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "074c0980-da53-47c2-82aa-d348a39198cc",
            "refuuid": "750ad0bc-7da5-4fe0-95e2-9cbb7943f496",
            "name": "LORAZEPAM, (S)-",
            "unii": "0VMC8E4D2Y",
            "linking_id": "0VMC8E4D2Y",
            "ref_pname": "LORAZEPAM, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "08fc79a8-b2c2-4ce0-a76b-488454d46d2d",
          "amount": {
            "uuid": "b30be0cf-e490-4dad-b328-27747ec09d5e",
            "average": 91,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "f79d8563-ddfa-cb87-3579-8fff33d8c624"
          ],
          "related_substance": {
            "uuid": "5bb526ba-40bc-414d-ba3e-c79932169a54",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6e408a67-8c3b-47a1-91e6-ffe1ee378674",
          "amount": {
            "uuid": "875ad51a-2d0b-45d2-88c3-fba49f45eec1"
          },
          "qualification": "URINE",
          "type": "PARENT->METABOLITE",
          "references": [
            "eadac566-8e2f-4e86-bbf9-ddf0738956ed"
          ],
          "related_substance": {
            "uuid": "85c1b456-95a5-411f-86f1-509c5608709d",
            "refuuid": "51c49f84-21da-4d27-9ab1-363465f7b0fa",
            "name": "2-CHLORODIAZEPAM",
            "unii": "070818R7PB",
            "linking_id": "070818R7PB",
            "ref_pname": "2-CHLORODIAZEPAM"
          }
        }
      ],
      "names": [
        {
          "uuid": "4cfa9c36-66c3-4917-b061-b0a45f486307",
          "name": "(±)-7-CHLORO-5-(O-CHLOROPHENYL)-1,3-DIHYDRO-3-HYDROXY-2H-1,4-BENZODIAZEPIN-2-ONE",
          "stdName": "(+/-)-7-CHLORO-5-(O-CHLOROPHENYL)-1,3-DIHYDRO-3-HYDROXY-2H-1,4-BENZODIAZEPIN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcab5f51-bf03-45ad-a0a0-6748802c6799"
          ],
          "display_name": false
        },
        {
          "uuid": "74ea425b-4510-4206-b49c-2ae6cce43a95",
          "name": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-5-(2-CHLOROPHENYL)-1,3-DIHYDRO-3-HYDROXY-, (±)-",
          "stdName": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-5-(2-CHLOROPHENYL)-1,3-DIHYDRO-3-HYDROXY-, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcab5f51-bf03-45ad-a0a0-6748802c6799"
          ],
          "display_name": false
        },
        {
          "uuid": "0cccf92e-249c-5c1d-76ed-5b2fec4b7851",
          "name": "7-Chloro-5-(O-chlorophenyl)-1,3-dihydro-3-hydroxy-2H-1,4-benzodiazepin-2-one",
          "stdName": "7-CHLORO-5-(O-CHLOROPHENYL)-1,3-DIHYDRO-3-HYDROXY-2H-1,4-BENZODIAZEPIN-2-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "403871f8-a544-b88b-79f1-3af17f6610af"
          ],
          "display_name": false
        },
        {
          "uuid": "15e0b743-123e-4714-b3cd-094f2afab83e",
          "name": "ATIVAN",
          "stdName": "ATIVAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcab5f51-bf03-45ad-a0a0-6748802c6799"
          ],
          "display_name": false
        },
        {
          "uuid": "9191b075-05d3-4363-a8fd-2c7aeafeb4ec",
          "name": "LORAZ",
          "stdName": "LORAZ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68d577a9-116e-4a38-9fd4-9e3223523061"
          ],
          "display_name": false
        },
        {
          "uuid": "105c9d2a-c376-4319-bced-4e26f4a92fad",
          "name": "LORAZEPAM CIV",
          "stdName": "LORAZEPAM CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65ea327a-660d-48a4-9512-d5ebf87916ff",
            "2b5ac203-36b9-43f4-9d53-208713896808"
          ],
          "display_name": false
        },
        {
          "uuid": "2b388599-d47b-49ac-b184-ee71db448cda",
          "name": "LORAZEPAM CIV [USP-RS]",
          "stdName": "LORAZEPAM CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65ea327a-660d-48a4-9512-d5ebf87916ff"
          ],
          "display_name": false
        },
        {
          "uuid": "22477106-afb9-5070-5727-b145f92a3d93",
          "name": "LORAZEPAM [EP IMPURITY]",
          "stdName": "LORAZEPAM [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4df80bb9-fb09-4efe-89b5-e22d302a0218"
          ],
          "display_name": false
        },
        {
          "uuid": "810856b0-efc5-0bbe-0442-2c65c47f2983",
          "name": "LORAZEPAM [EP MONOGRAPH]",
          "stdName": "LORAZEPAM [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d71ed30-274f-6c36-92c3-c074aa26056d"
          ],
          "display_name": false
        },
        {
          "uuid": "3b406057-97e4-426a-8b5f-8041cc4731f7",
          "name": "LORAZEPAM [JAN]",
          "stdName": "LORAZEPAM [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bafe165a-7023-d5b9-8a3e-b226aa74bcc4"
          ],
          "display_name": false
        },
        {
          "uuid": "339efafb-3a5c-47fe-910e-264edab88162",
          "name": "LORAZEPAM [MART.]",
          "stdName": "LORAZEPAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "da63b221-4637-4e33-9ff6-7a8c1aac7d2b"
          ],
          "display_name": false
        },
        {
          "uuid": "0defef7d-55bc-4196-a0c5-560caecc30c8",
          "name": "LORAZEPAM [MI]",
          "stdName": "LORAZEPAM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0fd250ad-c2ff-4590-8959-5f7c95329667"
          ],
          "display_name": false
        },
        {
          "uuid": "80d3f98f-1a50-4a52-a5d2-c67f84d8fb46",
          "name": "LORAZEPAM [ORANGE BOOK]",
          "stdName": "LORAZEPAM [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecfa76a1-d774-4acc-a592-3d6f167f6f79"
          ],
          "display_name": false
        },
        {
          "uuid": "3e5fdc62-4a4e-456a-ae98-33d5b3fb31dc",
          "name": "LORAZEPAM [USAN]",
          "stdName": "LORAZEPAM [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bf3cb0f-56ca-45de-ba5d-8e7cfede522f"
          ],
          "display_name": false
        },
        {
          "uuid": "5736efee-b35c-7e20-d15c-9bc93e50b176",
          "name": "LORAZEPAM [USP MONOGRAPH]",
          "stdName": "LORAZEPAM [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8907d7d5-8165-cf78-f019-623b15a02699"
          ],
          "display_name": false
        },
        {
          "uuid": "3e2750a0-4b11-422e-9cde-fe6da3ea8b18",
          "name": "LORAZEPAM [VANDF]",
          "stdName": "LORAZEPAM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a6ec1e-067a-465c-a2f1-82ce26436129"
          ],
          "display_name": false
        },
        {
          "uuid": "5c8669ac-04ca-4c5b-96fa-25c0c4c4ba08",
          "name": "LOREEV XR",
          "stdName": "LOREEV XR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b220875-a961-4170-b3ce-bafa03253070"
          ],
          "display_name": false
        },
        {
          "uuid": "6c702501-e3f2-4cef-8918-18a615670b4e",
          "name": "Lorazepam",
          "stdName": "LORAZEPAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c08e203-5018-43db-9a27-fe06d51f2daa",
            "d5425035-2fdc-4d08-80c7-c57f1b702006",
            "1d22f85c-0543-412a-9abb-09521606e353",
            "ecfa76a1-d774-4acc-a592-3d6f167f6f79",
            "19598484-c786-49ed-8263-9702a1d3313b",
            "5bf3cb0f-56ca-45de-ba5d-8e7cfede522f",
            "cc642535-40f7-4353-8f55-f682e00f8e79",
            "57a6ec1e-067a-465c-a2f1-82ce26436129",
            "9f160028-317f-4183-bbb7-d26494cc6abb",
            "0fd250ad-c2ff-4590-8959-5f7c95329667",
            "ecc061d4-0b04-46aa-88e3-dbb9768abfcd",
            "6ba78dc6-8177-4dd1-8148-d6868e76f6ce",
            "4df80bb9-fb09-4efe-89b5-e22d302a0218",
            "d0766cbd-9cbc-43e0-8e53-cb3be9f51515",
            "def20e9f-a560-46e7-9cf5-a29c806f8e43",
            "da63b221-4637-4e33-9ff6-7a8c1aac7d2b",
            "c849af4c-bf7f-4d4c-b96f-387928648b10",
            "b9939671-7216-4d0f-99e6-95afae1005bf",
            "fd4e76d5-462b-4139-8e05-001dc5676255"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f53c86c0-5a1d-4196-91ae-5b756b6f26bd",
              "name_org": "INN"
            },
            {
              "uuid": "e29102f6-cf07-4cb2-9c33-51a0891c0a3b",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "0335ee16-e4f1-daaa-3fc1-7b473ee65b52",
          "name": "Lorazepam [WHO-DD]",
          "stdName": "LORAZEPAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90aa61bf-4ad3-4e4d-683d-fe99beceb220"
          ],
          "display_name": false
        },
        {
          "uuid": "adde37d0-32f9-469c-9193-aac160d1e9b2",
          "name": "WY-4036",
          "stdName": "WY-4036",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19598484-c786-49ed-8263-9702a1d3313b"
          ],
          "display_name": false
        },
        {
          "uuid": "e0bdd07d-05ba-4078-acc5-167f96c47725",
          "name": "lorazepam [INN]",
          "stdName": "LORAZEPAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5425035-2fdc-4d08-80c7-c57f1b702006"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "67a3bd57-d04a-4d89-8f92-07a14cf74f3f",
          "name": "Biological Half-life",
          "value": {
            "uuid": "41921cd4-e7f0-41a1-885e-845922f90c1d",
            "average": 12,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "f79d8563-ddfa-cb87-3579-8fff33d8c624"
          ]
        },
        {
          "uuid": "d8b3c240-94cb-4d09-ac4f-08ef9d3df57e",
          "name": "MAXIMUM TOLERATED DOSE",
          "value": {
            "uuid": "da9020d1-4c1d-4306-9bcf-ade9fef3cda4",
            "average": 4,
            "units": "mg/dose"
          },
          "defining": false,
          "property_type": "TOXICITY",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        },
        {
          "uuid": "652af339-3b5c-42cd-b3d3-cc99d9ab4023",
          "name": "Tmax",
          "value": {
            "uuid": "c7a91794-1958-4222-9e42-826a42be9ca7",
            "average": 3,
            "units": "hours",
            "non_numeric_value": "INTRAMUSCULAR"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "61636e06-4843-44fb-b4e9-4ad869215bc5",
              "name": "ORAL, SOLUTION",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "711e8694-21c1-4174-a141-1636c24eb4ed",
                "average": 1,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "2362b7e4-341a-457c-8e30-b9a6aac70c9e",
              "name": "ORAL, TABLET",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "5283e07f-a6a4-4bbc-aab8-0030c496442b",
                "average": 2,
                "units": "hours",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        },
        {
          "uuid": "f774e586-78e2-4ef1-ad0a-f2f7b6de1ca9",
          "name": "ORAL BIOAVAILABILITY",
          "value": {
            "uuid": "2f9593c5-0294-4216-9f34-0e159ec9e832",
            "type": "MOLE PERCENT OF AMOUNT ADMINISTERED",
            "average": 90,
            "units": "%"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        },
        {
          "uuid": "b0712bdd-ca35-4599-8547-199719ec7a26",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "ead86c50-5db1-4974-a9e9-870e2f3687cb",
            "average": 1.3,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "88ad4404-7f7b-4f50-8c1c-260f8a703f1e",
              "name": "NEONATES WITH ASPHYXIA NEONATORUM",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "358ce195-6b92-4ced-9e7a-2d1ed268eff9",
                "type": "MOLE PERCENT OF AMOUNT ADMINISTERED",
                "average": 0.78,
                "units": "Liters/Kilogram",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "f8552287-f065-428e-810b-5f654aedb370",
              "name": "CHILDREN AND ADOLESCENTS WITH ACUTE LYMPHOCYTIC LEUKEMIA",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "f927d64b-506d-4efd-a113-becb1d1b34de",
                "average": 1.95,
                "units": "Liters/Kilogram",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "87c5a9d0-3ce1-4d48-8c51-6eccf857aad8",
              "name": "PEDIATRICS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "224ab95e-4807-47c3-8382-68bc68ae8a26",
                "average": 1.48,
                "units": "Liters/Kilogram",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "4114aa48-9e7a-462f-9362-8ef956a433ae",
              "name": "RENAL IMPAIRMENT",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "6842980e-98f1-4446-9ffc-16a874595234",
                "average": 1.82,
                "units": "Liters/Kilogram",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "2b92e814-a98e-4b09-a455-450575620317",
              "name": "RENAL IMPAIRMENT UNDERGOING HEMODIALYSIS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "2be532c3-2bf1-48d0-a1c8-454ed8716fa2",
                "average": 2.275,
                "units": "Liters/Kilogram",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        },
        {
          "uuid": "84103b17-186c-4da0-ba66-574416372daf",
          "name": "PROTEIN BINDING",
          "value": {
            "uuid": "e64d1805-3e32-4b4e-9638-e852c0438bd1",
            "type": "MOLE PERCENT OF AMOUNT ADMINISTERED",
            "high": 91,
            "low": 85,
            "units": "%"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        },
        {
          "uuid": "d5addf1e-90f6-4d8b-b699-bde24f7179aa",
          "name": "Route of Elimination",
          "value": {
            "uuid": "21b1b950-a187-49b6-acba-90976effa10e",
            "type": "MOLE PERCENT OF AMOUNT EXCRETED",
            "average": 7,
            "units": "%",
            "non_numeric_value": "FECAL"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "2b52bea6-b4f1-4e25-9211-4cb88515da04",
              "name": "RENAL",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "57198737-3b7f-4d9e-bbca-d42d2a375387",
                "type": "MOLE PERCENT OF AMOUNT EXCRETED",
                "average": 88,
                "units": "%",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        },
        {
          "uuid": "cab9ab3b-34d7-45b7-85bc-561af4efcb48",
          "name": "Biological Half-life",
          "value": {
            "uuid": "b4cb10da-1433-4a88-b573-be322ba503d3",
            "high": 14,
            "low": 12,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "658e1344-96b0-4a3d-8dc3-cd53a7341295",
              "name": "NEONATES WITH ASPHYXIA NEONATORUM (BIRTH TO 1 MONTH)",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "0282fa47-6ace-46a8-ab60-f434faef9690",
                "high": 42,
                "low": 36,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "a81f485c-7368-4453-9d13-6efd8034b75b",
              "name": "CHILDREN WITH ACUTE LYMPHOCYTIC LEUKEMIA (2 TO 12 YEARS)",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "d3f867ca-5cc7-4514-b8b0-6297a808e366",
                "high": 18.2,
                "low": 15.6,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "ea21b6b6-9726-408a-a2dc-04d04050c2b8",
              "name": "RENAL IMPAIRMENT",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "c8c92f6e-fec7-4cad-874a-c721d5de4265",
                "high": 17.5,
                "low": 15,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "e90b75e1-62fa-4c6f-ad2e-aae70d6ecb89",
              "name": "RENAL IMPAIRMENT UNDERGOING DIALYSIS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "c8d2310b-6398-4aaa-ba26-03eaecb0db97",
                "high": 24.5,
                "low": 21,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "f56072d3-9035-4167-a8f0-733d6697f7cd",
              "name": "ADOLESCENTS WITH ACUTE LYMPHOCYTIC LEUKEMIA (12 TO 18 YEARS)",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "64cc1830-32a6-4864-bd87-008152390938",
                "high": 28,
                "low": 24,
                "units": "hours",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "ed9c7e01-46a3-49b6-9292-3aef1edc342c",
              "name": "PEDIATRICS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "8913e888-e196-4798-8727-94321fb1cfef",
                "average": 16.8,
                "units": "hours",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "06892b56-7da4-528a-f03e-eba84f2591b9"
          ]
        }
      ],
      "modifications": {
        "uuid": "b88c8433-ecab-4d1b-ba1f-fcc52ed9bdcb"
      }
    }
  ]
}