{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f009a63f-c88d-4582-a1f7-2cc1dcab71e1",
          "code": "545-47-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=545-47-1",
          "code_system": "CAS",
          "references": [
            "fe1cf556-730e-4259-a12c-9d210db309a4",
            "504abe90-400d-48ea-8bcf-ef2cabf08400"
          ]
        },
        {
          "uuid": "51aaebe5-c130-4d5e-aa86-bd642f3f717d",
          "code": "C010480",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010480",
          "code_system": "MESH",
          "references": [
            "fe1cf556-730e-4259-a12c-9d210db309a4"
          ]
        },
        {
          "uuid": "1302e870-e02a-4f5a-afae-3940b8909920",
          "code": "LUPEOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lupeol",
          "code_system": "WIKIPEDIA",
          "references": [
            "fe1cf556-730e-4259-a12c-9d210db309a4"
          ]
        },
        {
          "uuid": "9b53e681-58ad-4006-8df7-95e3e8d7c139",
          "code": "m6938",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6938?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "fe1cf556-730e-4259-a12c-9d210db309a4"
          ]
        },
        {
          "uuid": "be5f9537-8606-43cd-bd96-e48b495bb841",
          "code": "208-889-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.082",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fe1cf556-730e-4259-a12c-9d210db309a4"
          ]
        },
        {
          "uuid": "753e5f75-af06-46ab-a859-c65a72aa3a92",
          "code": "259846",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/259846",
          "code_system": "PUBCHEM",
          "references": [
            "fe1cf556-730e-4259-a12c-9d210db309a4"
          ]
        },
        {
          "uuid": "37055f25-5296-896f-7b29-24ac81cdf9de",
          "code": "7687",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7687",
          "code_system": "HSDB",
          "references": [
            "0cdcd935-3e92-824c-614a-b9553cc6e9c3"
          ]
        },
        {
          "uuid": "de37de4e-7bc4-905f-4a96-9e5de6f624ad",
          "code": "DB12622",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12622",
          "code_system": "DRUG BANK",
          "references": [
            "70922098-69a9-eaf2-52a7-c74f6b4c3ec3"
          ]
        },
        {
          "uuid": "f0ff2d78-dcfc-4685-810c-2572f2b99c9c",
          "code": "O268W13H3O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2a19d076-b3b5-ae85-753d-2293f48466d2",
          "code": "6570",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6570",
          "code_system": "CHEBI",
          "references": [
            "70922098-69a9-eaf2-52a7-c74f6b4c3ec3"
          ]
        },
        {
          "uuid": "9d37fafb-f429-4713-d7fe-5376c5b5dfd9",
          "code": "90487",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=90487",
          "code_system": "NSC",
          "references": [
            "428edb53-4132-f23b-88fb-d8138e7dc03f"
          ]
        },
        {
          "uuid": "8b507c1c-857a-0326-d3e8-56c051d94630",
          "code": "DTXSID901025006",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901025006",
          "code_system": "EPA CompTox",
          "references": [
            "70922098-69a9-eaf2-52a7-c74f6b4c3ec3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f336a06c-fc9f-4843-9701-b43f17dfa5cd",
          "comments": "CALENDULA OFFICINALIS FLOWER terpenoid",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "92afa602-5bd5-42c7-8ae0-f02e6d8221f6"
          ],
          "related_substance": {
            "uuid": "ea73acf6-0cdb-4efd-b0af-2b954f136272",
            "refuuid": "e2dbbdeb-f16f-4daa-8570-a3f703139cb9",
            "name": "CALENDULA OFFICINALIS FLOWER",
            "unii": "P0M7O4Y7YD",
            "linking_id": "P0M7O4Y7YD",
            "ref_pname": "CALENDULA OFFICINALIS FLOWER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ad33460-46bb-492d-b9a9-a02e6f14037d",
          "name": "(+)-LUPEOL",
          "stdName": "(+)-LUPEOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708cc52c-d90a-486d-9060-dac3302f3026",
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "27f0785e-c84f-4aa1-a1ac-bdfda4f4f210",
          "name": "(3-.BETA.)-LUP-20(29)-EN-3-OL",
          "stdName": "(3-.BETA.)-LUP-20(29)-EN-3-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "6f3d3fed-0421-409f-9add-af7a2f4fcc93",
          "name": ".BETA.-VISCOL",
          "stdName": ".BETA.-VISCOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "0663ceaf-7946-41d7-9f24-49a71b2e7ffb",
          "name": "3.BETA.-HYDROXYLUP-20(29)-ENE",
          "stdName": "3.BETA.-HYDROXYLUP-20(29)-ENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708cc52c-d90a-486d-9060-dac3302f3026",
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "bd170392-bcd0-4cb2-a583-c3c18ddbbc2c",
          "name": "CLERODOL",
          "stdName": "CLERODOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "e959fbea-7d9d-4794-a19b-888f65d83422",
          "name": "FAGARASTEROL",
          "stdName": "FAGARASTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "0c23ed8d-0817-47e5-b51d-ce38df16d0f0",
          "name": "FAGARSTEROL",
          "stdName": "FAGARSTEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "9da9312e-7339-4548-b509-2ba290cc78df",
          "name": "LUP-20(29)-EN-3-.BETA.-OL",
          "stdName": "LUP-20(29)-EN-3-.BETA.-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "7e0118a8-33aa-496c-8877-b79737785c4d",
          "name": "LUP-20(29)-EN-3-OL, (3-.BETA.)-",
          "stdName": "LUP-20(29)-EN-3-OL, (3-.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "7d5c96a9-c04a-4dfb-ac4c-535cb9e2075c",
          "name": "LUPENOL",
          "stdName": "LUPENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "c0a5cf3e-f9b8-4166-856d-5644a63e34cb",
          "name": "LUPEOL",
          "stdName": "LUPEOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ae3bc60-6c44-4543-be0f-14925e653ce8",
            "388d14ff-3690-44b0-9285-db1a58ccdb39",
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "ad96ce43-dc28-4a09-9639-60c17cfe9ca0",
            "06430ee5-ae05-43a2-9c1a-3a2c08c51c31",
            "8a3e2cf5-6a33-4bbd-a673-85debd9c80ff",
            "cbfb56eb-d0d3-4519-84bf-4a1abf13a705",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "29fcc5e4-18eb-425c-9ea3-f34f6d64d8ee",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "307c0fab-5c04-469d-a502-8b85c0a1af02",
          "name": "LUPEOL [HSDB]",
          "stdName": "LUPEOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "cbfb56eb-d0d3-4519-84bf-4a1abf13a705"
          ],
          "display_name": false
        },
        {
          "uuid": "cb2a6177-efd0-41b9-adef-bd341fbfedba",
          "name": "LUPEOL [MI]",
          "stdName": "LUPEOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "06430ee5-ae05-43a2-9c1a-3a2c08c51c31"
          ],
          "display_name": false
        },
        {
          "uuid": "10069bf2-e132-42a5-9008-7b63bee71134",
          "name": "LUPEOL, (+)-",
          "stdName": "LUPEOL, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3967f0b8-6be5-493f-84fc-c599d81d2d60",
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "4a2db92b-0343-4843-b99d-92d17d62d8cd",
          "name": "MONOGYNOL B",
          "stdName": "MONOGYNOL B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        },
        {
          "uuid": "8d42ac4e-aac2-42b6-a857-949b37443e4f",
          "name": "NSC-90487",
          "stdName": "NSC-90487",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708cc52c-d90a-486d-9060-dac3302f3026",
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2"
          ],
          "display_name": false
        },
        {
          "uuid": "e1181e45-54d4-4b28-9f91-0cd2b1b9ee65",
          "name": "TRITERPENE LUPEOL",
          "stdName": "TRITERPENE LUPEOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
            "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8de9a891-8772-4a3b-9850-e9f0ebc3e0e2",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "708cc52c-d90a-486d-9060-dac3302f3026",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3967f0b8-6be5-493f-84fc-c599d81d2d60",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbfb56eb-d0d3-4519-84bf-4a1abf13a705",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06430ee5-ae05-43a2-9c1a-3a2c08c51c31",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad96ce43-dc28-4a09-9639-60c17cfe9ca0",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe1cf556-730e-4259-a12c-9d210db309a4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391344000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92afa602-5bd5-42c7-8ae0-f02e6d8221f6",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "287d148b-89e0-49fb-b6c1-a5def420f90d",
          "citation": "SRS import [O268W13H3O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O268W13H3O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391344000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a3e2cf5-6a33-4bbd-a673-85debd9c80ff",
          "citation": "LUPEOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "388d14ff-3690-44b0-9285-db1a58ccdb39",
          "citation": "LUPEOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9ae3bc60-6c44-4543-be0f-14925e653ce8",
          "citation": "LUPEOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0cdcd935-3e92-824c-614a-b9553cc6e9c3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+545-47-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "70922098-69a9-eaf2-52a7-c74f6b4c3ec3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "504abe90-400d-48ea-8bcf-ef2cabf08400",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "428edb53-4132-f23b-88fb-d8138e7dc03f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4e11d20e-2de8-4b49-aa02-33d671863648",
          "id": "4e11d20e-2de8-4b49-aa02-33d671863648",
          "molfile": "\n  Marvin  01132104042D          \n\n 31 35  0  0  1  0            999 V2000\n   10.3339   -9.5040    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.1630   -9.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4258  -10.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7690  -10.8422    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   11.3537  -11.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7527  -11.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0343  -12.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3324  -11.6426    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.4663  -12.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3447  -10.8258    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.6388  -10.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9164  -10.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9040  -11.6179    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1816  -12.0202    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.9510  -11.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4756  -11.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7656  -11.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7450  -12.8124    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.0268  -13.2146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4552  -13.2433    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5795  -13.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8692  -13.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1652  -12.8452    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8712  -13.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5936  -12.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6060  -12.0448    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.3548  -11.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0794  -10.3989    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.9153   -8.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3134   -8.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0903   -8.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 28  1  1  0  0  0  0\n  1 29  1  6  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n 28  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n 10  8  1  0  0  0  0\n  8 26  1  0  0  0  0\n 10 11  1  0  0  0  0\n 28 10  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  1  0  0  0\n 13 14  1  0  0  0  0\n 26 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 14 23  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 20  1  1  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  1  0  0  0\n 30 29  1  0  0  0  0\n 31 29  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)C(CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)O)[C@@H]12",
          "formula": "C30H50O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f906eabf-b2ca-44c1-b03c-be586c5a15c9"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "426.7185",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3d5266e8-0f55-493b-9fc0-9389fcdd1b34",
      "version": "10",
      "structure": {
        "id": "6dfc1a2f-add1-443f-b750-31a5162d546b",
        "molfile": "\n  Marvin  01132105432D          \n\n 35 39  0  0  1  0            999 V2000\n    7.1816  -12.0202    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9510  -11.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7450  -12.8124    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.3324  -11.6426    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.3339   -9.5040    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.7690  -10.8422    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7656  -11.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3134   -8.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0903   -8.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1652  -12.8452    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9040  -11.6179    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.3447  -10.8258    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.0794  -10.3989    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4756  -11.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1409  -11.2431    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6388  -10.3948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4282  -13.5613    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0343  -12.0653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1436  -10.0213    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7527  -11.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4258  -10.2717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4552  -13.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5795  -13.8796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4663  -12.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6060  -12.0448    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0268  -13.2146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8712  -13.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3548  -11.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5936  -12.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8958  -12.4388    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9153   -8.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1630   -9.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8692  -13.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3537  -11.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9164  -10.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9 31  2  0  0  0  0\n 21  6  1  0  0  0  0\n  8 31  1  0  0  0  0\n 20 18  1  0  0  0  0\n 11 35  1  0  0  0  0\n 13  6  1  0  0  0  0\n 32  5  1  0  0  0  0\n  5 13  1  0  0  0  0\n  7 14  1  0  0  0  0\n  3 22  1  0  0  0  0\n  4 24  1  6  0  0  0\n 35 16  1  0  0  0  0\n 11 25  1  0  0  0  0\n 27 29  1  0  0  0  0\n 13 15  1  6  0  0  0\n 23 22  1  0  0  0  0\n 33 22  1  0  0  0  0\n 18  4  1  0  0  0  0\n  1 11  1  0  0  0  0\n 29 25  1  0  0  0  0\n  6 34  1  1  0  0  0\n  3 26  1  1  0  0  0\n  6 20  1  0  0  0  0\n  1 10  1  0  0  0  0\n 12  4  1  0  0  0  0\n 10 27  1  0  0  0  0\n 11 30  1  6  0  0  0\n 14  1  1  0  0  0  0\n 25  4  1  0  0  0  0\n 21 32  1  0  0  0  0\n  1  2  1  1  0  0  0\n 10 17  1  6  0  0  0\n 12 19  1  1  0  0  0\n  7  3  1  0  0  0  0\n  5 31  1  6  0  0  0\n 25 28  1  1  0  0  0\n 13 12  1  0  0  0  0\n 22 10  1  0  0  0  0\n 16 12  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@]([H])(CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@@]12[H]",
        "formula": "C30H50O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "426.7185",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "287d148b-89e0-49fb-b6c1-a5def420f90d",
          "3f2e26a2-32f4-4856-9fae-ecfff6be7d6d"
        ],
        "stereo_centers": 10
      },
      "unii": "O268W13H3O"
    }
  ]
}