{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "69ed4660-c737-4591-9853-ba0fe4a7e456",
          "code": "621-71-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=621-71-6",
          "code_system": "CAS",
          "references": [
            "a2ce2326-d674-4c05-b927-91eaf67adf4d",
            "89dcd7b5-aa7a-4ece-b4a4-de02e463c77b"
          ]
        },
        {
          "uuid": "d4c0a8b0-b162-4491-8034-1f1b3c728502",
          "code": "C010800",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67010800",
          "code_system": "MESH",
          "references": [
            "a2ce2326-d674-4c05-b927-91eaf67adf4d"
          ]
        },
        {
          "uuid": "80510a33-8ff2-4228-850b-2b1b6959378c",
          "code": "1314419",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314419/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a2ce2326-d674-4c05-b927-91eaf67adf4d"
          ]
        },
        {
          "uuid": "09c7189a-cbe7-47d5-8605-45147416b4f0",
          "code": "SUB177854",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a2ce2326-d674-4c05-b927-91eaf67adf4d"
          ]
        },
        {
          "uuid": "eaff79c4-ebbf-4e29-a7b1-bf3c785889b9",
          "code": "69310",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69310",
          "code_system": "PUBCHEM",
          "references": [
            "a2ce2326-d674-4c05-b927-91eaf67adf4d"
          ]
        },
        {
          "uuid": "82090575-de09-4fa4-8982-14b3e617c5db",
          "code": "210-702-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.730",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a2ce2326-d674-4c05-b927-91eaf67adf4d"
          ]
        },
        {
          "uuid": "377d1f39-42ab-288d-8313-935d5d5e1454",
          "code": "DTXSID1042651",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1042651",
          "code_system": "EPA CompTox",
          "references": [
            "f196e1b1-2e14-9d1c-583d-4ef43341e06d"
          ]
        },
        {
          "uuid": "4906e028-4bcf-fc2b-e5db-da02d6794fdc",
          "code": "C153424",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C153424",
          "code_system": "NCI_THESAURUS",
          "references": [
            "023c8717-9638-3fc5-3d3a-8b17e52d173b"
          ]
        },
        {
          "uuid": "32aa8a38-c085-0e23-c77e-b310f77e90f2",
          "code": "C242",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Hormone Antagonist[C547]|Anti-Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C242",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0a11d4fe-485e-0b65-f470-219e9e75171d"
          ]
        },
        {
          "uuid": "21ab53e8-ebad-4ca8-8cc4-241bdcdedbcc",
          "code": "O1PB8EU98M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "67c1acd3-0ef7-a99a-433b-8724b63b1245",
          "code": "77388",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:77388",
          "code_system": "CHEBI",
          "references": [
            "0a11d4fe-485e-0b65-f470-219e9e75171d"
          ]
        },
        {
          "uuid": "0b72ea1c-ae18-059e-c3f2-cb52369e3d24",
          "code": "147475",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=147475",
          "code_system": "NSC",
          "references": [
            "3ee473c0-cc5e-bc4d-2a22-380d225b9ea8"
          ]
        },
        {
          "uuid": "9b161204-1b34-3e1a-d26f-e626f79c4bba",
          "code": "O1PB8EU98M",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=O1PB8EU98M",
          "code_system": "DAILYMED",
          "references": [
            "6520d2d8-cc8d-5f47-35fc-740a0397e945"
          ]
        },
        {
          "uuid": "7380ca67-5526-9f8e-0472-1848b4c36017",
          "code": "100000163547",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c69c2775-1cf9-7ebb-9e2a-ea522733d873"
          ]
        },
        {
          "uuid": "06ed548b-5c10-4d93-809d-1988e9e3b85a",
          "code": "11930",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=11930",
          "code_system": "INN",
          "references": [
            "c84dea7a-5c1e-86ec-795f-ac6d3cae7445"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f0f63f9d-385b-490c-9737-8ab125fc814a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c76ea9d6-bde6-4014-aad8-358c41a8d18d",
            "refuuid": "a5a57cff-a3d9-45fa-a996-62c9671f721f",
            "name": "TRICAPRIN",
            "unii": "O1PB8EU98M",
            "linking_id": "O1PB8EU98M",
            "ref_pname": "TRICAPRIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "64b9a7a0-9667-4969-8c26-08ae55fe041c",
          "name": "1,2,3-PROPANOL TRIDECANOATE",
          "stdName": "1,2,3-PROPANOL TRIDECANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50a8324-78be-4b45-9a76-3a6ec4508743",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "8107e178-6bb3-48fa-87b8-b07dc000452f",
          "name": "1,2,3-TRICAPRINOYLGLYCEROL",
          "stdName": "1,2,3-TRICAPRINOYLGLYCEROL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1947d69-1cd5-4ebe-a906-34900bef07cc",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "390c3e70-1825-471f-8ece-8a4e5a155d89",
          "name": "CAPRIC ACID TRIGLYCERIDE",
          "stdName": "CAPRIC ACID TRIGLYCERIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1947d69-1cd5-4ebe-a906-34900bef07cc",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "d5ba8e34-e7f8-4704-b94b-665a71c17ae9",
          "name": "CAPRIC TRIGLYCERIDE",
          "stdName": "CAPRIC TRIGLYCERIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5705df2-b76b-4458-8f43-01c9b9ae554d",
            "32cdb4d0-8b9a-4395-a7f9-d0773929d59c",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "e72ea21e-1aa1-4f1a-b8ef-8c66975b84ce",
          "name": "CAPRIC TRIGLYCERIDE [VANDF]",
          "stdName": "CAPRIC TRIGLYCERIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32cdb4d0-8b9a-4395-a7f9-d0773929d59c",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "1eadd9dd-ed13-4d1f-82c2-19d5085e7757",
          "name": "CAPTEX 1000",
          "stdName": "CAPTEX 1000",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50a8324-78be-4b45-9a76-3a6ec4508743",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "6e5bfea6-ce37-4830-8f02-56dc9ce74a03",
          "name": "DECANOIC ACID TRIGLYCERIDE",
          "stdName": "DECANOIC ACID TRIGLYCERIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e058adc5-e9ce-4bef-87c2-5c2045d16ce1",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "44a91a3d-6b6b-4634-91ac-1282882ce050",
          "name": "DECANOIC ACID, 1,2,3-PROPANETRIYL ESTER",
          "stdName": "DECANOIC ACID, 1,2,3-PROPANETRIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50a8324-78be-4b45-9a76-3a6ec4508743",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "0b5d1a8d-7638-4e96-9888-563f20b39d87",
          "name": "DYNASAN 110",
          "stdName": "DYNASAN 110",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbdd5be-b8fc-4274-b90c-a524fe4c6e59",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "7931b504-d7d7-41fd-959c-3f1854ca69e8",
          "name": "GLYCEROL TRIDECANOATE",
          "stdName": "GLYCEROL TRIDECANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50a8324-78be-4b45-9a76-3a6ec4508743",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "c093327c-f64e-4d17-b18d-732ec05c34ef",
          "name": "GLYCERYL TRICAPRATE",
          "stdName": "GLYCERYL TRICAPRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50a8324-78be-4b45-9a76-3a6ec4508743",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "55fcda80-9cfc-459b-8594-19fe4cc0860f",
          "name": "NSC-147475",
          "stdName": "NSC-147475",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbdd5be-b8fc-4274-b90c-a524fe4c6e59",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "62afd7cf-3283-41c8-bdaa-f7042268c77c",
          "name": "PANACET 1000",
          "stdName": "PANACET 1000",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbdd5be-b8fc-4274-b90c-a524fe4c6e59",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "33e842a7-5df6-4d30-979a-cad10074fe31",
          "name": "TRICAPRIN",
          "stdName": "TRICAPRIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c50a8324-78be-4b45-9a76-3a6ec4508743",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8",
            "e1640f7b-e169-403d-86b5-23584f883921"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "92d0f2fd-e0cc-47ab-b1cb-0d4c06ac3ccc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5e99812e-3103-4b4a-9335-0573597dcf84",
          "name": "TRICAPRINOYLGLYCEROL",
          "stdName": "TRICAPRINOYLGLYCEROL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1947d69-1cd5-4ebe-a906-34900bef07cc",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "af2c9ef4-36a3-4201-92fc-0af0f389ede4",
          "name": "TRIDECANOIN",
          "stdName": "TRIDECANOIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbdd5be-b8fc-4274-b90c-a524fe4c6e59",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "c79b452a-dbaa-4559-b0ea-7e80449a0674",
          "name": "TRIGLYCERIDE DECANOATE",
          "stdName": "TRIGLYCERIDE DECANOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e058adc5-e9ce-4bef-87c2-5c2045d16ce1",
            "31f787bd-42f6-46f6-802e-dbab67b7a7e8"
          ],
          "display_name": false
        },
        {
          "uuid": "b643bfb2-2846-8c71-e4ec-af8f1fe2263c",
          "name": "tricaprin [INN]",
          "stdName": "TRICAPRIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c84dea7a-5c1e-86ec-795f-ac6d3cae7445"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c1947d69-1cd5-4ebe-a906-34900bef07cc",
          "citation": "http://chemicalland21.com/lifescience/foco/TRICAPRIN.htm",
          "url": "http://chemicalland21.com/lifescience/foco/TRICAPRIN.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "31f787bd-42f6-46f6-802e-dbab67b7a7e8",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e058adc5-e9ce-4bef-87c2-5c2045d16ce1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c50a8324-78be-4b45-9a76-3a6ec4508743",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32cdb4d0-8b9a-4395-a7f9-d0773929d59c",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cbdd5be-b8fc-4274-b90c-a524fe4c6e59",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2ce2326-d674-4c05-b927-91eaf67adf4d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390816000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7c7482d-f8fe-4ef2-b7f5-39bcebc52d2a",
          "citation": "SRS import [O1PB8EU98M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O1PB8EU98M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390816000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a519e19d-4729-4220-b628-fbda7a4cd0e3",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5705df2-b76b-4458-8f43-01c9b9ae554d",
          "citation": "CAPRIC TRIGLYCERIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1640f7b-e169-403d-86b5-23584f883921",
          "citation": "TRICAPRIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f196e1b1-2e14-9d1c-583d-4ef43341e06d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=621-71-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "023c8717-9638-3fc5-3d3a-8b17e52d173b",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0a11d4fe-485e-0b65-f470-219e9e75171d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c84dea7a-5c1e-86ec-795f-ac6d3cae7445",
          "citation": "P126",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "3ee473c0-cc5e-bc4d-2a22-380d225b9ea8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6520d2d8-cc8d-5f47-35fc-740a0397e945",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "89dcd7b5-aa7a-4ece-b4a4-de02e463c77b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c69c2775-1cf9-7ebb-9e2a-ea522733d873",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "28e5bc24-4b68-415b-903c-db62c710e046",
          "id": "28e5bc24-4b68-415b-903c-db62c710e046",
          "molfile": "\n  Marvin  01132102142D          \n\n 39 38  0  0  0  0            999 V2000\n   -1.6683   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9539   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2394   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4752   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1896   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9041   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6185   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3330   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0475   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7620   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7620   -8.1295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4765   -6.8919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1909   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9054   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9054   -6.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6198   -5.6544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6198   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9054   -4.4170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -4.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0488   -3.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0488   -2.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7633   -1.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7633   -1.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4777   -0.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4777    0.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1922    0.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6198   -7.3044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -6.0670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0488   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7633   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4777   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1922   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9068   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6212   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3357   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0501   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7646   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 28  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 29  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 35  1  0  0  0  0\n 37 36  1  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC",
          "formula": "C33H62O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4bfefaa3-fcc2-410d-b041-eaeb5740109a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "554.843",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a5a57cff-a3d9-45fa-a996-62c9671f721f",
      "version": "12",
      "structure": {
        "id": "6c3750f2-e7cd-45d4-aaab-dbaffaf6c733",
        "molfile": "\n  Marvin  01132105372D          \n\n 39 38  0  0  0  0            999 V2000\n   -1.6683   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9539   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2394   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4752   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1896   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9041   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6185   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3330   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0475   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7620   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4765   -6.8919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1909   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9054   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6198   -7.3044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -6.0670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0488   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7633   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4777   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1922   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9068   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6212   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3357   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0501   -6.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7646   -7.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9054   -6.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6198   -5.6544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6198   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9054   -4.4170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -4.4170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3344   -3.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0488   -3.1794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0488   -2.3544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7633   -1.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7633   -1.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4777   -0.7044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4777    0.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1922    0.5332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7620   -8.1295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 13  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  2  0  0  0  0\n 30 28  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 36 35  1  0  0  0  0\n 36 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n 39 10  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC",
        "formula": "C33H62O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "554.843",
        "optical_activity": "NONE",
        "references": [
          "a7c7482d-f8fe-4ef2-b7f5-39bcebc52d2a",
          "a519e19d-4729-4220-b628-fbda7a4cd0e3"
        ],
        "stereo_centers": 0
      },
      "unii": "O1PB8EU98M"
    }
  ]
}