{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "004e1f80-4622-4b3b-9dce-246df5c11366",
          "code": "97404-02-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97404-02-9",
          "code_system": "CAS",
          "references": [
            "0ca7a83b-5111-4e39-bb21-c6692941e510",
            "2db6550d-a748-4b02-825c-a66148049a40"
          ]
        },
        {
          "uuid": "bc1abfa0-d9c8-4094-9828-753e6351a516",
          "code": "1016649-32-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1016649-32-3",
          "code_system": "CAS",
          "references": [
            "0ca7a83b-5111-4e39-bb21-c6692941e510",
            "a0f18061-6c9d-4efc-a906-7b45bca06549"
          ]
        },
        {
          "uuid": "cf80a006-9561-4ac3-8df7-c30bc640dfcf",
          "code": "306-764-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.097.013",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0ca7a83b-5111-4e39-bb21-c6692941e510"
          ]
        },
        {
          "uuid": "320546b7-72b5-4c52-9284-37a17de7a9a8",
          "code": "9881454",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9881454",
          "code_system": "PUBCHEM",
          "references": [
            "0ca7a83b-5111-4e39-bb21-c6692941e510"
          ]
        },
        {
          "uuid": "a367a2a6-4337-4e75-bc05-92789268fe90",
          "code": "O1JIQ710E2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8c7e7016-ed19-41ff-a857-ddc6e820cca2",
          "code": "DTXSID40874045",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40874045",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "17ac3a6c-458a-4190-ae80-b70988cde157",
          "name": "1H-IMIDAZOLIUM, 2-(2-(4-AMINOPHENYL)DIAZENYL)-1,3-DIMETHYL-, CHLORIDE (1:1)",
          "stdName": "1H-IMIDAZOLIUM, 2-(2-(4-AMINOPHENYL)DIAZENYL)-1,3-DIMETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02e9faa3-8055-4fff-a087-274df9d524e0"
          ],
          "display_name": false
        },
        {
          "uuid": "48792581-07da-4468-b802-703cdef4934c",
          "name": "2-((4-AMINOPHENYL)AZO)-1,3-DIMETHYL-1H-IMIDAZOLIUM CHLORIDE",
          "stdName": "2-((4-AMINOPHENYL)AZO)-1,3-DIMETHYL-1H-IMIDAZOLIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12bd0875-ab41-4338-8af7-dbcc489d5d70"
          ],
          "display_name": false
        },
        {
          "uuid": "01ed9880-246b-43fa-8b1a-5c1c6ef0451e",
          "name": "BASIC ORANGE 31",
          "stdName": "BASIC ORANGE 31",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "270ad0d1-7c69-4d2b-b75b-ee8c458877d5",
            "57a18eb5-1f75-42bc-9f48-e1203c336dde"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f10d696c-fb88-4477-9ee5-a1680b7d428b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c134c7d2-e1e4-4817-acd9-1d18357b0f06",
          "name": "COLOREX BO31",
          "stdName": "COLOREX BO31",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a18eb5-1f75-42bc-9f48-e1203c336dde"
          ],
          "display_name": false
        },
        {
          "uuid": "c6d81bf1-5edc-41ed-adad-1a7ea9db7bf1",
          "name": "VIBRACOLOR FLAME ORANGE",
          "stdName": "VIBRACOLOR FLAME ORANGE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57a18eb5-1f75-42bc-9f48-e1203c336dde"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "12bd0875-ab41-4338-8af7-dbcc489d5d70",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "57a18eb5-1f75-42bc-9f48-e1203c336dde",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02e9faa3-8055-4fff-a087-274df9d524e0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ca7a83b-5111-4e39-bb21-c6692941e510",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63fc44b1-b845-40fe-adce-e02da8819c71",
          "citation": "SRS import [O1JIQ710E2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O1JIQ710E2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392589000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "270ad0d1-7c69-4d2b-b75b-ee8c458877d5",
          "citation": "BASIC ORANGE 31 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2db6550d-a748-4b02-825c-a66148049a40",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a0f18061-6c9d-4efc-a906-7b45bca06549",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f48a984a-7c6c-44f7-bff7-d7170f56e738",
          "id": "f48a984a-7c6c-44f7-bff7-d7170f56e738",
          "molfile": "\n  Marvin  01132112412D          \n\n  1  0  0  0  0  0            999 V2000\n   11.3660   -9.4946    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "70944158-43c6-4938-b7e7-426ef8c778c2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "9bd8b877-a6ca-4c46-a02a-07bfb1c1373e",
          "id": "9bd8b877-a6ca-4c46-a02a-07bfb1c1373e",
          "molfile": "\n  Marvin  01132108062D          \n\n 16 17  0  0  0  0            999 V2000\n    8.8216   -3.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9930   -4.2027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4410   -4.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8535   -5.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6606   -5.3587    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.2737   -5.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7468   -4.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4613   -4.1257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1757   -4.5382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8902   -4.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6047   -4.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3192   -4.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3192   -3.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0337   -2.8882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6047   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8902   -3.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 16  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\nM  CHG  1   5   1\nM  END",
          "smiles": "Cn1cc[n+](C)c1/N=N/c2ccc(cc2)N",
          "formula": "C11H14N5",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ee06ef5f-c9c9-404d-ad4f-5ab6de28a873"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "216.2628",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9a7113fa-f119-4baa-978e-b7e16a6efd20",
      "version": "5",
      "structure": {
        "id": "6d99e0d7-59f9-4ab3-82ca-ffc3be03cbdf",
        "molfile": "\n  Marvin  01132105422D          \n\n 17 17  0  0  0  0            999 V2000\n   11.3660   -9.4946    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   10.4613   -4.1257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7468   -4.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6606   -5.3587    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.2737   -5.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8535   -5.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4410   -4.8158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9930   -4.2027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8216   -3.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1757   -4.5382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8902   -4.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6047   -4.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3192   -4.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3192   -3.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0337   -2.8882    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6047   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8902   -3.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  2 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 11 17  2  0  0  0  0\nM  CHG  2   1  -1   4   1\nM  END",
        "smiles": "C[n+]1ccn(C)c1/N=N/c2ccc(cc2)N.[Cl-]",
        "formula": "C11H14N5.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "251.7157",
        "optical_activity": "NONE",
        "references": [
          "12bd0875-ab41-4338-8af7-dbcc489d5d70",
          "63fc44b1-b845-40fe-adce-e02da8819c71"
        ],
        "stereo_centers": 0
      },
      "unii": "O1JIQ710E2"
    }
  ]
}