{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b998d23d-476e-4f72-ad93-4754d2f012c8",
          "code": "5698-96-4",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5698-96-4",
          "code_system": "CAS",
          "references": [
            "5066c320-2ac5-4f01-8342-142bcb5015f9"
          ]
        },
        {
          "uuid": "5e6d64bb-48de-41cf-b991-5a5e8027aebb",
          "code": "17105-15-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17105-15-6",
          "code_system": "CAS",
          "references": [
            "263e939b-af04-46d6-9b3d-58600438b53e",
            "5066c320-2ac5-4f01-8342-142bcb5015f9"
          ]
        },
        {
          "uuid": "7b0819d1-abe8-98eb-b27b-13cb3e9656a6",
          "code": "7015684",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7015684",
          "code_system": "PUBCHEM",
          "references": [
            "755a926b-da1a-6e45-9afc-ff9c3f00b48f"
          ]
        },
        {
          "uuid": "646f2924-18b4-462a-8a4e-fedf1a26f0f2",
          "code": "O19B8F457C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9e3281fb-840f-d308-69c3-c25bca1f518a",
          "code": "DTXSID90937917",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90937917",
          "code_system": "EPA CompTox",
          "references": [
            "34272d03-1d1b-e793-aab6-4b0bce0c1067"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2d964dc1-ff11-482e-b183-26eb99d18bea",
          "name": "(2S)-2-amino-6-[[(4S)-4-amino-4-carboxybutanoyl]amino]hexanoic acid",
          "stdName": "(2S)-2-AMINO-6-(((4S)-4-AMINO-4-CARBOXYBUTANOYL)AMINO)HEXANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5066c320-2ac5-4f01-8342-142bcb5015f9"
          ],
          "display_name": false
        },
        {
          "uuid": "40fd58b3-67ee-4844-a30e-3dd352b933c1",
          "name": "L-Lysine, N<sup>6</sup>-L-γ-glutamyl-",
          "stdName": "L-LYSINE, N6-L-.GAMMA.-GLUTAMYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "450e8946-6293-401c-9ba2-92065ec03d16",
            "948add98-34c9-4a20-a88c-94c2dcd44d22"
          ],
          "display_name": false
        },
        {
          "uuid": "140dbdd1-08af-4a70-a79e-aaa232325589",
          "name": "N<sup>6</sup>-L-γ-Glutamyl-L-lysine",
          "stdName": "N6-L-.GAMMA.-GLUTAMYL-L-LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "450e8946-6293-401c-9ba2-92065ec03d16",
            "948add98-34c9-4a20-a88c-94c2dcd44d22"
          ],
          "display_name": true
        },
        {
          "uuid": "3fc654c2-b6b7-457b-b5cd-e01f1577fe05",
          "name": "N<sup>ε</sup>-(γ-Glutamyl)-L-lysine",
          "stdName": "N.EPSILON.-(.GAMMA.-GLUTAMYL)-L-LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "450e8946-6293-401c-9ba2-92065ec03d16",
            "948add98-34c9-4a20-a88c-94c2dcd44d22"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "948add98-34c9-4a20-a88c-94c2dcd44d22",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "450e8946-6293-401c-9ba2-92065ec03d16",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "263e939b-af04-46d6-9b3d-58600438b53e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394422000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "202c76b9-0d22-471c-8ddc-5337af67058b",
          "citation": "SRS import [O19B8F457C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O19B8F457C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394422000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "755a926b-da1a-6e45-9afc-ff9c3f00b48f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5066c320-2ac5-4f01-8342-142bcb5015f9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "34272d03-1d1b-e793-aab6-4b0bce0c1067",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "348d8782-d0af-e375-577e-5e25e6a80cca",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4da7b4e-a559-43d2-ad64-ce6099728883",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "844c6bf1-1c7f-25ea-5125-f77fb5bddf84",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9c20a0db-fef8-4efc-b5e5-c018dabb3f37",
          "id": "9c20a0db-fef8-4efc-b5e5-c018dabb3f37",
          "molfile": "\n  Marvin  01132108072D          \n\n 19 18  0  0  0  0            999 V2000\n    5.6826   -6.4739    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6826   -7.2989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3970   -6.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1115   -6.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8260   -6.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5405   -6.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2549   -6.0615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9694   -6.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9694   -7.2989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6839   -6.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3984   -6.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1128   -6.0615    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.1128   -5.2365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8273   -6.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8273   -7.2989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5418   -6.0614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9681   -6.0615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9681   -5.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2536   -6.4739    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  END",
          "smiles": "C(CCNC(=O)CC[C@@H](C(=O)O)N)C[C@@H](C(=O)O)N",
          "formula": "C11H21N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "57ef158b-e853-4f2c-a6f8-8b8bec98fa8f"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "275.302",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "27d88223-2b54-411d-a920-a56b2d2e41d1",
      "version": "13",
      "structure": {
        "id": "42bc323a-8763-49d6-928c-fbfb4078be03",
        "molfile": "?-(?-Glutamyl)lysine\n   JSDraw201062416382D\n\n 19 18  0  0  1  0              0 V2000\n   23.1416   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7904   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4925   -8.0860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1416   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4394   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8435   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0885   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1944   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7375   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0885   -9.6460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5457   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3864   -8.0860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7375   -5.7460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8966   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2476   -7.3060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5985   -8.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2476   -5.7460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5985   -9.6460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.9496   -7.3060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  6  0  0  0\n  8 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 16 19  2  0  0  0  0\nM  END",
        "smiles": "C(CCNC(=O)CC[C@@H](C(=O)O)N)C[C@@H](C(=O)O)N",
        "formula": "C11H21N3O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "275.302",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "202c76b9-0d22-471c-8ddc-5337af67058b",
          "948add98-34c9-4a20-a88c-94c2dcd44d22"
        ],
        "stereo_centers": 2
      },
      "unii": "O19B8F457C"
    }
  ]
}