{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "041e9f18-1070-418e-9b80-64e593085ae6",
          "code": "34531-26-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=34531-26-5",
          "code_system": "CAS",
          "references": [
            "a19302b2-bb8e-4005-b08d-325ad1e36468",
            "6b3b5ac2-0b27-49c2-a715-7824633a68c4"
          ]
        },
        {
          "uuid": "d5e05b67-3090-4701-ad62-ee4e27dbb37f",
          "code": "1596929",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1596929/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a19302b2-bb8e-4005-b08d-325ad1e36468"
          ]
        },
        {
          "uuid": "26820451-ff10-440f-92d0-62f625c26b41",
          "code": "252-073-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.324",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a19302b2-bb8e-4005-b08d-325ad1e36468"
          ]
        },
        {
          "uuid": "440906dc-ba60-47b2-b444-351df6469234",
          "code": "118173",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118173",
          "code_system": "PUBCHEM",
          "references": [
            "a19302b2-bb8e-4005-b08d-325ad1e36468"
          ]
        },
        {
          "uuid": "2d7d5ef4-e2be-471a-81bc-7d0f9cec80fb",
          "code": "O14R793D1H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f8c38962-4896-f648-3ba8-f80fe8f046d7",
          "code": "DTXSID00885591",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00885591",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "e6fce829-ba8a-e2b5-49bd-50bca3711608",
          "code": "O14R793D1H",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=O14R793D1H",
          "code_system": "DAILYMED",
          "references": [
            "58a94feb-f43f-4cff-826b-5a26901bf8cf"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c87a0f60-852b-4790-9194-c2af5effe1bd",
          "name": "(±)-ETHYLHEXYL GALLATE",
          "stdName": "(+/-)-ETHYLHEXYL GALLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779c18f9-7a32-4d16-8160-23ebccfb171d",
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f"
          ],
          "display_name": false
        },
        {
          "uuid": "2d83209d-13f0-479b-934d-bd6578350c0d",
          "name": "2-ETHYLHEXYL 3,4,5-TRIHYDROXYBENZOATE",
          "stdName": "2-ETHYLHEXYL 3,4,5-TRIHYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779"
          ],
          "display_name": false
        },
        {
          "uuid": "bcebd7f6-54d3-4f49-b47c-754aef7c3347",
          "name": "2-ETHYLHEXYL GALLATE",
          "stdName": "2-ETHYLHEXYL GALLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d18088e0-dbba-471c-b556-e806673deb7b"
          ],
          "display_name": false
        },
        {
          "uuid": "170e54b8-01a9-4abc-81d6-31d3b4e26da7",
          "name": "3,4,5-TRIHYDROXYBENZOIC ACID, 2-ETHYLHEXYL ESTER",
          "stdName": "3,4,5-TRIHYDROXYBENZOIC ACID, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779"
          ],
          "display_name": false
        },
        {
          "uuid": "4c0a5be0-9034-4889-a9dc-49ee72656cc0",
          "name": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, 2-ETHYLHEXYL ESTER",
          "stdName": "BENZOIC ACID, 3,4,5-TRIHYDROXY-, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779"
          ],
          "display_name": false
        },
        {
          "uuid": "8b3e07f7-1ac6-4db6-8ccc-d4c421e657e6",
          "name": "ETHYLHEXYL GALLATE",
          "stdName": "ETHYLHEXYL GALLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779",
            "942114d5-0f81-4d2b-b7d7-c578a2972b13"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "cd7332db-98fe-470c-bfbc-abfe741c1049",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "95f9497d-532a-4c0b-9b71-92e0f00e1cf2",
          "name": "ETHYLHEXYL GALLATE, (±)-",
          "stdName": "ETHYLHEXYL GALLATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "779c18f9-7a32-4d16-8160-23ebccfb171d",
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f"
          ],
          "display_name": false
        },
        {
          "uuid": "4b23ea19-8ce2-4cb5-9638-57091bc29e8b",
          "name": "GALLIC ACID, 2-ETHYLHEXYL ESTER",
          "stdName": "GALLIC ACID, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779"
          ],
          "display_name": false
        },
        {
          "uuid": "8545a70d-c854-49a5-9c7c-23021ab05dff",
          "name": "OCTYLIS GALLAS (EP)",
          "stdName": "OCTYLIS GALLAS (EP)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779"
          ],
          "display_name": false
        },
        {
          "uuid": "857aa485-eac5-4940-89fa-8ee30007e8d4",
          "name": "ORISTAR OG",
          "stdName": "ORISTAR OG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
            "d540377d-e2a1-4d13-b93d-a022f7b72779"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d540377d-e2a1-4d13-b93d-a022f7b72779",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0ab9d70b-573a-4c32-9a3b-6466569dc04f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d18088e0-dbba-471c-b556-e806673deb7b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "779c18f9-7a32-4d16-8160-23ebccfb171d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a19302b2-bb8e-4005-b08d-325ad1e36468",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94d2b4ad-789f-43d2-b568-db11b196c363",
          "citation": "SRS import [O14R793D1H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=O14R793D1H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "942114d5-0f81-4d2b-b7d7-c578a2972b13",
          "citation": "ETHYLHEXYL GALLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b3b5ac2-0b27-49c2-a715-7824633a68c4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "58a94feb-f43f-4cff-826b-5a26901bf8cf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7ce3f752-06b6-4dee-b339-9b41c41cd5af",
          "id": "7ce3f752-06b6-4dee-b339-9b41c41cd5af",
          "molfile": "\n  Marvin  01132106292D          \n\n 20 20  0  0  0  0            999 V2000\n    6.2592   -1.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2592   -1.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -2.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -3.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -3.5235    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.1158   -3.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -2.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -4.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -4.7610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -5.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2592   -5.9985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -5.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -5.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4013   -5.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6869   -5.5860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4014   -6.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6869   -7.2360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -7.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -8.0610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -6.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 20  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1cc(c(c(c1)O)O)O",
          "formula": "C15H22O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1688a273-9117-4ba1-9a2f-9d61529eea1d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "282.3328",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3edea8f7-5c92-49ce-926a-c9d2f3e400a2",
      "version": "5",
      "structure": {
        "id": "d785bb1d-9d95-4b3e-a046-9ddf9435bd63",
        "molfile": "\n  Marvin  01132111102D          \n\n 20 20  0  0  0  0            999 V2000\n    4.8303   -5.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -5.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4013   -5.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4014   -6.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -7.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -6.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6869   -7.2360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6869   -5.5860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2592   -1.0485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2592   -1.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -2.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -3.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -2.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -3.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -3.5235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2592   -5.9985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -5.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5447   -4.7610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8303   -4.3485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1158   -8.0610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17  1  1  0  0  0  0\n  5 20  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1cc(c(c(c1)O)O)O",
        "formula": "C15H22O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "282.3328",
        "optical_activity": "( + / - )",
        "references": [
          "d18088e0-dbba-471c-b556-e806673deb7b",
          "94d2b4ad-789f-43d2-b568-db11b196c363"
        ],
        "stereo_centers": 1
      },
      "unii": "O14R793D1H"
    }
  ]
}