{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f88b542c-a590-4c61-8ad1-a4719dc847d1", "code": "4090-51-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4090-51-1", "code_system": "CAS", "references": [ "cdd6d096-23f0-4308-83c0-f67d5fa8df59", "04f6c8ae-01a7-47f9-9d2f-a7e834b01c03" ] }, { "uuid": "aaf96f1d-94ff-40de-a1f5-0464242551db", "code": "223-829-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.663", "code_system": "ECHA (EC/EINECS)", "references": [ "cdd6d096-23f0-4308-83c0-f67d5fa8df59" ] }, { "uuid": "b2b8776e-8b06-4b23-8410-ac7334cb0002", "code": "77714", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77714", "code_system": "PUBCHEM", "references": [ "cdd6d096-23f0-4308-83c0-f67d5fa8df59" ] }, { "uuid": "edf5cfd0-8171-fed0-778c-747273a24676", "code": "DTXSID4063290", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4063290", "code_system": "EPA CompTox", "references": [ "39de154f-c2c8-319f-bcde-c55e5b821f46" ] }, { "uuid": "dc166585-a520-404f-885a-ef322f8f2a94", "code": "NZ339B63J4", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "04f6c8ae-01a7-47f9-9d2f-a7e834b01c03" ] } ], "substance_class": "chemical", "names": [ { "uuid": "8c02efa0-fbee-4722-aebf-a953980babe5", "name": "1,3,2-DIOXAPHOSPHORINANE, 2,2'-OXYBIS(5,5-DIMETHYL-, 2,2'-DISULFIDE", "stdName": "1,3,2-DIOXAPHOSPHORINANE, 2,2'-OXYBIS(5,5-DIMETHYL-, 2,2'-DISULFIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "043aefba-d46c-4803-9999-9a1fbf59d9cc", "dc2b56ff-da19-413c-88be-2a5fd75f4358" ], "display_name": true }, { "uuid": "798016db-9ade-49ac-9e2e-39d3545bc468", "name": "2-((5,5-DIMETHYL-2-SULFANYLIDENE-1,3,2.LAMBDA.5-DIOXAPHOSPHINAN-2-YL)OXY)-5,5-DIMETHYL-2-SULFANYLIDENE-1,3,2.LAMBDA.5-DIOXAPHOSPHINANE", "stdName": "2-((5,5-DIMETHYL-2-SULFANYLIDENE-1,3,2.LAMBDA.5-DIOXAPHOSPHINAN-2-YL)OXY)-5,5-DIMETHYL-2-SULFANYLIDENE-1,3,2.LAMBDA.5-DIOXAPHOSPHINANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "04f6c8ae-01a7-47f9-9d2f-a7e834b01c03" ], "display_name": false } ], "references": [ { "uuid": "dc2b56ff-da19-413c-88be-2a5fd75f4358", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "043aefba-d46c-4803-9999-9a1fbf59d9cc", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "cdd6d096-23f0-4308-83c0-f67d5fa8df59", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393045000, "tags": [ "NOMEN" ] }, { "uuid": "ce187557-08c5-44a5-9d36-9924905b8127", "citation": "CHEMID RECORD 4090-51-1", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "39de154f-c2c8-319f-bcde-c55e5b821f46", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4090-51-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "04f6c8ae-01a7-47f9-9d2f-a7e834b01c03", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0c0a3bd6-6896-456f-acf9-14ab7350ae1c", "id": "0c0a3bd6-6896-456f-acf9-14ab7350ae1c", "molfile": "\n Marvin 01132100522D \n\n 19 20 0 0 0 0 999 V2000\n 2.4771 -2.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9482 -2.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4162 -2.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2387 -1.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2387 -0.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9482 -0.5012 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6290 -0.1228 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5828 0.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2421 1.1882 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0541 1.3339 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2390 2.0161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5264 2.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8126 2.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5298 2.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8114 1.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5283 0.7745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6660 -0.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6660 -1.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 2 19 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 18 6 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 17 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\nM END", "smiles": "CC1(C)COP(=S)(OC1)OP2(=S)OCC(C)(C)CO2", "formula": "C10H20O5P2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "812c298b-ac89-49d7-8db7-803a0b978d67" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.3429", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e5dd328d-7443-4cb2-92bc-e26b927320b2", "version": "7", "structure": { "id": "c6cd8df9-dcdb-4a43-ad88-c0d3decb31eb", "molfile": "\n Marvin 01132110162D \n\n 19 20 0 0 0 0 999 V2000\n 2.6660 -0.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9482 -0.5012 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2387 -0.9137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2387 -1.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9482 -2.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4771 -2.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4162 -2.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6660 -1.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5828 0.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2421 1.1882 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2390 2.0161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5264 2.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8126 2.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 1.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5298 2.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8114 1.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5283 0.7745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0541 1.3339 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6290 -0.1228 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 1 1 0 0 0 0\n 2 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 10 1 0 0 0 0\n 10 18 2 0 0 0 0\n 2 19 2 0 0 0 0\nM END", "smiles": "CC1(C)COP(=S)(OC1)OP2(=S)OCC(C)(C)CO2", "formula": "C10H20O5P2S2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.3429", "optical_activity": "NONE", "references": [ "ce187557-08c5-44a5-9d36-9924905b8127" ], "stereo_centers": 0 }, "unii": "NZ339B63J4" } ] }