{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d76aa2e1-c81a-4af8-9ad1-9bf260ff576f", "code": "NYE7YKH9FT", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "535bf4d4-424c-3634-14e8-7a1436f50b6e", "code": "155928860", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/155928860", "code_system": "PUBCHEM", "references": [ "abae7f45-23ce-1ea9-6bf2-ad0cb908bf32" ] }, { "uuid": "6d1d7968-18a6-4a42-a1f9-06b20263613f", "code": "181632-90-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=181632-90-6", "code_system": "CAS", "references": [ "27615000-14fe-4848-ab15-b0290c5b829d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "584a5b10-222c-4f47-b7cf-6bf6f00c21ff", "name": "XYLITOL, 1-OCTANOATE", "stdName": "XYLITOL, 1-OCTANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "27615000-14fe-4848-ab15-b0290c5b829d" ], "display_name": false }, { "uuid": "cfb87384-58a6-4860-be3d-2f353b06dd07", "name": "XYLITYL 1-CAPRYLATE", "stdName": "XYLITYL 1-CAPRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d1203d16-9f95-4610-bde8-fa3465809d83", "90fd8e9a-c716-4500-935a-9512e4a6167e" ], "display_name": true } ], "references": [ { "uuid": "d1203d16-9f95-4610-bde8-fa3465809d83", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "90fd8e9a-c716-4500-935a-9512e4a6167e", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "461d7280-68a1-46a2-8175-f47de3018812", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393315000, "tags": [ "NOMEN" ] }, { "uuid": "0f55f34e-3dfd-4d28-998a-f3e7bd053740", "citation": "CHEMID RECORD 15790-07-5", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "28104372-4541-5ce7-0b02-555a53acd682", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15790-07-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "27615000-14fe-4848-ab15-b0290c5b829d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "abae7f45-23ce-1ea9-6bf2-ad0cb908bf32", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "eb5ce433-1795-47b5-bf04-cde446c926f7", "id": "eb5ce433-1795-47b5-bf04-cde446c926f7", "molfile": "\n Marvin 06302110392D \n\n 19 18 0 0 1 0 999 V2000\n 9.9275 -4.2814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2131 -4.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4987 -4.2814 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7842 -4.6939 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.0698 -4.2815 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.3554 -4.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6410 -4.2815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0698 -3.4565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7843 -5.5189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4987 -3.4564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6420 -4.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6420 -5.5189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3565 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0708 -4.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7853 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4998 -4.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2142 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9286 -4.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6431 -4.2814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 11 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 10 1 6 0 0 0\n 4 5 1 0 0 0 0\n 4 9 1 6 0 0 0\n 5 6 1 0 0 0 0\n 5 8 1 6 0 0 0\n 6 7 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)OC[C@H]([C@@H]([C@H](CO)O)O)O", "formula": "C13H26O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3955d2fc-70a4-4d0b-80ff-434d278664bd" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "278.3425", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "a18f1e4f-0cac-49f2-9b24-32ff13ddfe64", "version": "9", "structure": { "id": "430c6ed2-ae73-4cc2-a59f-ba2d7dc87395", "molfile": "\n JSDraw206302110392D\n\n 19 18 0 0 0 0 0 V2000\n 23.8169 -7.3060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4660 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1149 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7639 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4130 -7.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0620 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7110 -7.3061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4130 -5.7461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7640 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1149 -5.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1679 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1679 -9.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5190 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8699 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.2209 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5720 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9229 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.2739 -8.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.6250 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 5 8 1 6 0 0 0\n 4 9 1 6 0 0 0\n 3 10 1 6 0 0 0\n 1 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)OC[C@H]([C@@H]([C@H](CO)O)O)O", "formula": "C13H26O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "278.3425", "optical_activity": "( + / - )", "references": [ "0f55f34e-3dfd-4d28-998a-f3e7bd053740", "27615000-14fe-4848-ab15-b0290c5b829d" ], "stereo_centers": 3 }, "unii": "NYE7YKH9FT" } ] }