{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "feb658d0-c88a-4302-9013-36c18d1be786",
          "code": "80-04-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-04-6",
          "code_system": "CAS",
          "references": [
            "efdbd897-0b6c-45cb-8262-7cc05ddfc507",
            "3e83ca0f-c1d5-40c1-81d9-faa4aa12da30"
          ]
        },
        {
          "uuid": "b8a5b84f-a9f2-4cda-b481-3d5cafa2e668",
          "code": "201-244-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.132",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "efdbd897-0b6c-45cb-8262-7cc05ddfc507"
          ]
        },
        {
          "uuid": "e4bf428f-90bb-4309-b7e1-af53fcf79fdd",
          "code": "94932",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94932",
          "code_system": "PUBCHEM",
          "references": [
            "efdbd897-0b6c-45cb-8262-7cc05ddfc507"
          ]
        },
        {
          "uuid": "2d5b6cdc-1caa-13eb-a339-9d73911f0660",
          "code": "DTXSID0044993",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044993",
          "code_system": "EPA CompTox",
          "references": [
            "b47de5f0-2bf7-697b-8164-b2da82755068"
          ]
        },
        {
          "uuid": "c74b4802-00de-45e5-9552-f47f82e76d66",
          "code": "NXZ4H12R1Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7af261a9-ce11-f7ab-2b20-cb055bf86d20",
          "code": "8990",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8990",
          "code_system": "NSC",
          "references": [
            "3bb51cfe-c9fb-7632-6780-8eb0d2026ebc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cfdf602e-abb8-420e-8fc2-a37530011098",
          "name": "2,2-BIS(4-HYDROXYCYCLOHEXYL)PROPANE",
          "stdName": "2,2-BIS(4-HYDROXYCYCLOHEXYL)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41bea1f4-9733-4a83-803c-42121fd990a8",
            "8485b693-d0a3-48ea-bb61-ab27f3eaa6c1"
          ],
          "display_name": false
        },
        {
          "uuid": "2d6a1403-2ba3-4dbe-afab-60aa7857d40e",
          "name": "4,4'-PROPANE-2,2-DIYLDICYCLOHEXANOL",
          "stdName": "4,4'-PROPANE-2,2-DIYLDICYCLOHEXANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85c966e6-6b0c-4f79-a38e-e5cf74d5c15c",
            "41bea1f4-9733-4a83-803c-42121fd990a8"
          ],
          "display_name": false
        },
        {
          "uuid": "23b43b4c-72a3-4125-a4f6-66f12a229fd7",
          "name": "DICYCLOHEXANOLPROPANE",
          "stdName": "DICYCLOHEXANOLPROPANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41bea1f4-9733-4a83-803c-42121fd990a8",
            "8485b693-d0a3-48ea-bb61-ab27f3eaa6c1"
          ],
          "display_name": false
        },
        {
          "uuid": "a5c86e53-dcb6-4bd8-a8dd-56f03534f6b9",
          "name": "HBPA",
          "stdName": "HBPA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41bea1f4-9733-4a83-803c-42121fd990a8",
            "8485b693-d0a3-48ea-bb61-ab27f3eaa6c1"
          ],
          "display_name": false
        },
        {
          "uuid": "38648396-cd02-45b8-814f-138069fc9520",
          "name": "HYDROGENATED BISPHENOL A",
          "stdName": "HYDROGENATED BISPHENOL A",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7448a45-5507-4145-bdd0-0fb54a433898"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5f07b6c0-de54-412a-80a1-868e64aaf646",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "840eae5d-a94f-40e4-9b75-b6e2ec72fecf",
          "name": "NSC-8990",
          "stdName": "NSC-8990",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1888d9d-2c38-4566-b0e9-fe0ede9c4039",
            "41bea1f4-9733-4a83-803c-42121fd990a8"
          ],
          "display_name": false
        },
        {
          "uuid": "6ba0310b-e1a2-4c0c-8a91-f703764c1e5d",
          "name": "PERHYDROBISPHENOL",
          "stdName": "PERHYDROBISPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41bea1f4-9733-4a83-803c-42121fd990a8",
            "8485b693-d0a3-48ea-bb61-ab27f3eaa6c1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a7448a45-5507-4145-bdd0-0fb54a433898",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8485b693-d0a3-48ea-bb61-ab27f3eaa6c1",
          "citation": "http://www.chemicalbook.com/ProdSupplierGNCB4669962_EN.htm",
          "url": "http://www.chemicalbook.com/ProdSupplierGNCB4669962_EN.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41bea1f4-9733-4a83-803c-42121fd990a8",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85c966e6-6b0c-4f79-a38e-e5cf74d5c15c",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1888d9d-2c38-4566-b0e9-fe0ede9c4039",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efdbd897-0b6c-45cb-8262-7cc05ddfc507",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391112000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70dd5070-b035-4fd2-b8f8-a72e3452f9e6",
          "citation": "SRS import [NXZ4H12R1Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NXZ4H12R1Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391112000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0aa31b42-3e35-4792-bc86-5f00b9920a1f",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b47de5f0-2bf7-697b-8164-b2da82755068",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-04-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7f10cbb-0605-c63f-4767-6952d8ba9b89",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "3e83ca0f-c1d5-40c1-81d9-faa4aa12da30",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3bb51cfe-c9fb-7632-6780-8eb0d2026ebc",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e5969dad-185c-431e-832e-7cacd203bbbe",
          "id": "e5969dad-185c-431e-832e-7cacd203bbbe",
          "molfile": "\n  Marvin  01132111532D          \n\n 17 18  0  0  0  0            999 V2000\n    5.5954   -3.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0053   -4.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2892   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7217   -4.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7217   -3.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4332   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1541   -3.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8656   -2.8819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1541   -4.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4332   -4.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5849   -5.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1657   -6.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5804   -6.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4049   -6.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8149   -7.6836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8196   -6.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4096   -5.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 10  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C1CCC(CC1)O)C2CCC(CC2)O",
          "formula": "C15H28O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c5aca205-318e-4494-a687-a0eb8ff02448"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "240.3822",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1c4921d4-a660-4e8c-b516-59a5146d544a",
      "version": "6",
      "structure": {
        "id": "392c3c63-dc98-4d12-8c0c-ffa8f946ac32",
        "molfile": "\n  Marvin  01132103022D          \n\n 17 18  0  0  0  0            999 V2000\n    6.0053   -4.5311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7217   -4.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7217   -3.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4332   -2.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1541   -3.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1541   -4.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4332   -4.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8656   -2.8819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5849   -5.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1657   -6.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5804   -6.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4049   -6.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8196   -6.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4096   -5.5348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8149   -7.6836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5954   -3.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2892   -4.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16  1  1  0  0  0  0\n 17  1  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C1CCC(CC1)O)C2CCC(CC2)O",
        "formula": "C15H28O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "240.3822",
        "optical_activity": "NONE",
        "references": [
          "0aa31b42-3e35-4792-bc86-5f00b9920a1f",
          "70dd5070-b035-4fd2-b8f8-a72e3452f9e6"
        ],
        "stereo_centers": 0
      },
      "unii": "NXZ4H12R1Z"
    }
  ]
}