{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e795143b-d3f0-48c7-add6-a0053b013217", "code": "68631-49-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68631-49-2", "code_system": "CAS", "references": [ "319469e6-2261-43ae-afca-44bf52644522", "1944f2a8-0d16-4238-997e-fc51cd6742f5" ] }, { "uuid": "6ee6dc90-b386-4e14-b132-727a09231894", "code": "155166", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/155166", "code_system": "PUBCHEM", "references": [ "319469e6-2261-43ae-afca-44bf52644522" ] }, { "uuid": "210521cd-9511-5671-2fd6-3dd689a239fc", "code": "DTXSID4030047", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4030047", "code_system": "EPA CompTox", "references": [ "bdffa14b-6361-a38b-7d46-e7bd74263ca9" ] }, { "uuid": "5d13161a-c27f-40f1-8aa9-bd745d2be19c", "code": "NX58WCQ511", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a8022306-e180-de55-b8da-68e0c2446a14", "code": "C184300", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C184300", "code_system": "NCI_THESAURUS", "references": [ "32f8f26b-e4e8-58fa-3afa-3cb684dda091" ] } ], "substance_class": "chemical", "names": [ { "uuid": "95a6c8b3-0a90-4306-9930-e6799615715b", "name": "2,2',4,4',5,5'-HEXABROMODIPHENYL ETHER", "stdName": "2,2',4,4',5,5'-HEXABROMODIPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3656d953-f0f8-4d93-8d81-7b224e3f9a7d" ], "display_name": true }, { "uuid": "83eaa5c9-db4e-4ce6-93a2-8b31c4fd1b43", "name": "BENZENE, 1,1'-OXYBIS(2,4,5-TRIBROMO-", "stdName": "BENZENE, 1,1'-OXYBIS(2,4,5-TRIBROMO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b4a21280-c1a2-4f45-9d78-5fb8e24005b5" ], "display_name": false }, { "uuid": "5ddba7f6-79a6-4530-a499-6371c497f96c", "name": "PBDE 153", "stdName": "PBDE 153", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b4a21280-c1a2-4f45-9d78-5fb8e24005b5" ], "display_name": false } ], "references": [ { "uuid": "3656d953-f0f8-4d93-8d81-7b224e3f9a7d", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b4a21280-c1a2-4f45-9d78-5fb8e24005b5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "319469e6-2261-43ae-afca-44bf52644522", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391990000, "tags": [ "NOMEN" ] }, { "uuid": "d0255180-bb99-42f8-b030-ca806241683c", "citation": "SRS import [NX58WCQ511]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NX58WCQ511", "doc_type": "SRS", "public_domain": true, "document_date": 1493391990000, "tags": [ "NOMEN" ] }, { "uuid": "bdffa14b-6361-a38b-7d46-e7bd74263ca9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68631-49-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "32f8f26b-e4e8-58fa-3afa-3cb684dda091", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "1944f2a8-0d16-4238-997e-fc51cd6742f5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "956cb6ea-4bac-4a74-9415-4b13bd03406a", "id": "956cb6ea-4bac-4a74-9415-4b13bd03406a", "molfile": "\n Marvin 01132107452D \n\n 19 20 0 0 0 0 999 V2000\n 5.7044 -2.4700 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9914 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9914 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5596 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.8214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1449 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1449 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 -2.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 -3.2915 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7131 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4700 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7131 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5596 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 -2.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 -3.2915 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 18 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 17 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 15 2 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "c1c(c(cc(c1Br)Oc2cc(c(cc2Br)Br)Br)Br)Br", "formula": "C12H4Br6O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9effcce7-65a3-4184-9b8f-7e9e24ee3348" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "643.5812", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "72b21bb6-6118-48f6-b361-e8b8c5b82db7", "version": "4", "structure": { "id": "dc497e2e-4bc8-41a7-999d-dbca3e05ed88", "molfile": "\n Marvin 01132111252D \n\n 19 20 0 0 0 0 999 V2000\n 2.8579 -0.8214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1449 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1449 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 -2.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7131 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7131 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5596 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 -0.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5596 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9914 -1.2264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 -2.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9914 -2.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7044 -2.4700 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2783 -3.2915 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 0.0000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4700 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4261 -3.2915 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 8 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 4 6 2 0 0 0 0\n 4 17 1 0 0 0 0\n 5 7 2 0 0 0 0\n 5 19 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 18 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 12 2 0 0 0 0\n 11 13 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 16 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "c1c(c(cc(c1Br)Oc2cc(c(cc2Br)Br)Br)Br)Br", "formula": "C12H4Br6O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "643.5812", "optical_activity": "NONE", "references": [ "d0255180-bb99-42f8-b030-ca806241683c", "3656d953-f0f8-4d93-8d81-7b224e3f9a7d" ], "stereo_centers": 0 }, "unii": "NX58WCQ511" } ] }