{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "15e14749-6fd2-446e-ba83-071bef3fae65", "code": "727732-91-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=727732-91-4", "code_system": "CAS", "references": [ "d0cde9f7-94c0-4a59-a4ed-e2fb25397a9c", "b72e20a2-7ca6-4cef-ad04-5409286111af" ] }, { "uuid": "2545edee-e3b1-4f02-b162-7ba63840d6c4", "code": "24285036", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24285036", "code_system": "PUBCHEM", "references": [ "d0cde9f7-94c0-4a59-a4ed-e2fb25397a9c" ] }, { "uuid": "6d3c90bc-4d71-424a-92f2-36589c4da3a3", "code": "NW9L0542MA", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f0d4e697-b2b4-48f7-afcf-21ee27b758f4", "name": "ACTOWHITE CT247", "stdName": "ACTOWHITE CT247", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "ea7340c7-e466-4974-986b-763e658db400", "f7b65d5e-ed91-44c4-b632-83f89ba3575c" ], "display_name": false }, { "uuid": "43b594a5-9e02-4418-88ef-b2c387970d6e", "name": "CYCLOHEXANECARBOXAMIDE, N-(2-(4-HYDROXYPHENYL)ETHYL)-", "stdName": "CYCLOHEXANECARBOXAMIDE, N-(2-(4-HYDROXYPHENYL)ETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea7340c7-e466-4974-986b-763e658db400", "f7b65d5e-ed91-44c4-b632-83f89ba3575c" ], "display_name": false }, { "uuid": "391993c2-57f8-43ea-b14e-2da49275de26", "name": "N-CYCLOHEXANOYL TYRAMINE", "stdName": "N-CYCLOHEXANOYL TYRAMINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "14359fee-66a6-4cfa-967b-f21bde67dcef", "ea7340c7-e466-4974-986b-763e658db400", "03625e28-5385-45b6-abcc-e0cba7fa9b8d" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "458364da-9f63-45cd-98ca-3d91780186b0", "name_org": "INCI" } ] } ], "references": [ { "uuid": "14359fee-66a6-4cfa-967b-f21bde67dcef", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ea7340c7-e466-4974-986b-763e658db400", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f7b65d5e-ed91-44c4-b632-83f89ba3575c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d0cde9f7-94c0-4a59-a4ed-e2fb25397a9c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393195000, "tags": [ "NOMEN" ] }, { "uuid": "179ce4ab-1de0-4f04-b7b8-2c245a7ff11c", "citation": "SRS import [NW9L0542MA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NW9L0542MA", "doc_type": "SRS", "public_domain": true, "document_date": 1493393195000, "tags": [ "NOMEN" ] }, { "uuid": "03625e28-5385-45b6-abcc-e0cba7fa9b8d", "citation": "N-CYCLOHEXANOYL TYRAMINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b72e20a2-7ca6-4cef-ad04-5409286111af", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7dbc82ec-50c4-433d-ac4b-cc9244672c06", "id": "7dbc82ec-50c4-433d-ac4b-cc9244672c06", "molfile": "\n Marvin 01132106322D \n\n 18 19 0 0 0 0 999 V2000\n 5.5358 -4.5264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8215 -4.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8215 -5.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -6.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -5.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -6.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -7.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9637 -7.4138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9637 -8.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2492 -8.6513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -8.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -8.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -8.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -9.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -9.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -9.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -4.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -4.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 18 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 17 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 16 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "C1CCC(CC1)C(=O)NCCc2ccc(cc2)O", "formula": "C15H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "49776312-6cb5-4168-a2e7-3b3ef0f8ec71" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "247.3333", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "0620aea6-9870-45a9-8b1d-26d11c72da0b", "version": "3", "structure": { "id": "79b0c33f-f113-4faf-b8f7-4bf62ec5cbcd", "molfile": "\n Marvin 01132106192D \n\n 18 19 0 0 0 0 999 V2000\n 2.6781 -6.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -5.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -6.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8215 -5.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8215 -4.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5358 -4.5264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -4.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -4.9389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -7.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9637 -7.4138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9637 -8.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -8.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -8.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -8.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1070 -9.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3926 -9.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6781 -9.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2492 -8.6513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 5 2 0 0 0 0\n 8 7 1 0 0 0 0\n 2 8 2 0 0 0 0\n 1 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 12 17 1 0 0 0 0\n 11 18 2 0 0 0 0\nM END", "smiles": "C1CCC(CC1)C(=O)NCCc2ccc(cc2)O", "formula": "C15H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "247.3333", "optical_activity": "NONE", "references": [ "179ce4ab-1de0-4f04-b7b8-2c245a7ff11c", "f7b65d5e-ed91-44c4-b632-83f89ba3575c" ], "stereo_centers": 0 }, "unii": "NW9L0542MA" } ] }