{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc855a2d-ef67-489d-be9f-b7ce6a90070c",
          "code": "220435-39-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=220435-39-2",
          "code_system": "CAS",
          "references": [
            "7eb16242-7bf2-4050-9b34-1f8cbf0e84ab",
            "8a3143e5-fe6b-427b-a57f-3fb36880b8a3"
          ]
        },
        {
          "uuid": "721bdc05-d8da-4f47-b8b0-2bc6e54893f8",
          "code": "1366935",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1366935/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7eb16242-7bf2-4050-9b34-1f8cbf0e84ab"
          ]
        },
        {
          "uuid": "2195d123-7ccf-47fd-a9cb-53b314317ce7",
          "code": "71587647",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587647",
          "code_system": "PUBCHEM",
          "references": [
            "7eb16242-7bf2-4050-9b34-1f8cbf0e84ab"
          ]
        },
        {
          "uuid": "b8ad7e7d-163b-1e85-a19c-c861d9b56c2a",
          "code": "DTXSID90176521",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90176521",
          "code_system": "EPA CompTox",
          "references": [
            "b5a848a2-365f-4139-e852-e741462f39de"
          ]
        },
        {
          "uuid": "e89565a8-da89-47f8-8b1d-f21d31b7a9dc",
          "code": "NV5D25VL1O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9d8e22fd-149a-fe1a-0e24-fc1a60ec19ea",
          "code": "NV5D25VL1O",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=NV5D25VL1O",
          "code_system": "DAILYMED",
          "references": [
            "6eef6d7e-b187-7e08-721c-7a8156bfc49d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3805807a-7e62-4012-87f3-040842cecb07",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "51c85031-f709-4b30-bda9-b76402667888",
            "refuuid": "1362a207-8096-47d4-826c-b49073f3245e",
            "name": "URSOLIC ACID",
            "unii": "P3M2575F3F",
            "linking_id": "P3M2575F3F",
            "ref_pname": "URSOLIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d580eeb7-9978-41f1-b105-d7f8c3346df1",
          "name": "DUBOISIA URSOLIC ACID, SODIUM SALT, PREMIER",
          "stdName": "DUBOISIA URSOLIC ACID, SODIUM SALT, PREMIER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e33057d7-8c79-44b0-93d6-58dbca5a6afd",
            "ec2496fc-2a2e-49df-b1dd-a8e4e1d22f7c"
          ],
          "display_name": false
        },
        {
          "uuid": "09f9fef0-ef55-4a05-9a05-a06140404f6a",
          "name": "SODIUM URSOLATE",
          "stdName": "SODIUM URSOLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e33057d7-8c79-44b0-93d6-58dbca5a6afd",
            "7648fe8c-d217-473a-90d7-5d3b55ef2ade",
            "ec2496fc-2a2e-49df-b1dd-a8e4e1d22f7c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8e288fd4-f7ab-4cc2-bc15-b03b18c6a9c3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "42995d69-3060-44f1-9a44-25626a520bed",
          "name": "URS-12-3EN-28-OIC ACID, 3-HYDROXY-, MONOSODIUM SALT, (3-.BETA.)-",
          "stdName": "URS-12-3EN-28-OIC ACID, 3-HYDROXY-, MONOSODIUM SALT, (3-.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e33057d7-8c79-44b0-93d6-58dbca5a6afd",
            "ec2496fc-2a2e-49df-b1dd-a8e4e1d22f7c"
          ],
          "display_name": false
        },
        {
          "uuid": "3da408d8-430a-4bbe-9ccd-37aaf15c30a6",
          "name": "URS-12-EN-28-OIC ACID, 3-HYDROXY-, SODIUM SALT (1:1), (3.BETA.)-",
          "stdName": "URS-12-EN-28-OIC ACID, 3-HYDROXY-, SODIUM SALT (1:1), (3.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e33057d7-8c79-44b0-93d6-58dbca5a6afd",
            "2d0fc43f-b8ee-4b7f-8575-71413812ced9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ec2496fc-2a2e-49df-b1dd-a8e4e1d22f7c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e33057d7-8c79-44b0-93d6-58dbca5a6afd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d0fc43f-b8ee-4b7f-8575-71413812ced9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7eb16242-7bf2-4050-9b34-1f8cbf0e84ab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391602000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f725499-94bd-4b42-94ad-b58d40d39e29",
          "citation": "SRS import [NV5D25VL1O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NV5D25VL1O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391602000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7648fe8c-d217-473a-90d7-5d3b55ef2ade",
          "citation": "SODIUM URSOLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5a848a2-365f-4139-e852-e741462f39de",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=220435-39-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8a3143e5-fe6b-427b-a57f-3fb36880b8a3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6eef6d7e-b187-7e08-721c-7a8156bfc49d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6dc1d1da-1f05-417a-92cb-bca0c4dc13fa",
          "id": "6dc1d1da-1f05-417a-92cb-bca0c4dc13fa",
          "molfile": "\n  Marvin  01132105422D          \n\n  1  0  0  0  1  0            999 V2000\n   15.3840   -8.2337    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f4603c88-baab-46d4-a45b-937fa1e8a129"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "64d8ae84-578c-40a3-bc3c-d0b91591781d",
          "id": "64d8ae84-578c-40a3-bc3c-d0b91591781d",
          "molfile": "\n  Marvin  01132105152D          \n\n 33 37  0  0  1  0            999 V2000\n   13.6278   -5.0362    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.6235   -4.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3414   -5.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3329   -6.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6171   -6.6885    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.6156   -7.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8997   -7.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1901   -7.5073    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.1819   -8.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1921   -6.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4800   -6.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7639   -6.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7639   -7.5073    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.0477   -7.9198    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.0404   -7.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3357   -7.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6196   -7.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6196   -8.7448    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.9029   -9.1532    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.3357   -9.1573    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9153   -9.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7403   -9.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0477   -8.7448    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.7639   -9.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4800   -8.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4800   -7.9198    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.4736   -7.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9034   -6.2693    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.9058   -5.4440    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.1861   -5.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3277   -7.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0384   -6.6885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3271   -7.9193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 29  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 28  5  1  0  0  0  0\n  5 31  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 26  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 28 10  1  6  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  1  0  0  0\n 13 14  1  0  0  0  0\n 26 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 14 23  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 20  1  1  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  1  0  0  0\n 29 28  1  0  0  0  0\n 29 30  1  1  0  0  0\n 31 32  1  0  0  0  0\n 31 33  2  0  0  0  0\nM  CHG  1  19  -1\nM  END",
          "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)[O-])[C@@H]2[C@H]1C)C(=O)O",
          "formula": "C30H47O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1ac965b0-7746-455c-ba66-6ad0edcbf2ba"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "455.6935",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d649cfb2-6334-4ab9-9ec1-9dd41758172b",
      "version": "6",
      "structure": {
        "id": "0724e49f-e152-405b-965d-5a773d5263e3",
        "molfile": "\n  Marvin  01132100392D          \n\n 37 40  0  0  1  0            999 V2000\n   14.3414   -5.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6278   -5.0362    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.6235   -4.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9058   -5.4440    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.1861   -5.0283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9034   -6.2693    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.6171   -6.6885    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.3277   -7.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0384   -6.6885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3271   -7.9193    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.3329   -6.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6156   -7.5107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8997   -7.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1901   -7.5073    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.1819   -8.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4800   -7.9198    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.4800   -8.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7639   -9.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0477   -8.7448    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.2111   -9.7072    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3357   -9.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9153   -9.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6196   -8.7448    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6196   -7.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3357   -7.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0477   -7.9198    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.0404   -7.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7639   -7.5073    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.7570   -8.3323    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7639   -6.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4800   -6.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1921   -6.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9029   -9.1532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7403   -9.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4736   -7.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8986   -7.0907    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3840   -8.2337    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  6  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 21 19  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 19  1  0  0  0  0\n 26 27  1  1  0  0  0\n 28 26  1  0  0  0  0\n 28 16  1  0  0  0  0\n 28 29  1  6  0  0  0\n 30 28  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  2  0  0  0  0\n 32  6  1  0  0  0  0\n 32 14  1  0  0  0  0\n 23 33  1  1  0  0  0\n 21 34  1  0  0  0  0\n 16 35  1  1  0  0  0\n  6 36  1  1  0  0  0\nM  CHG  2  10  -1  37   1\nM  END",
        "smiles": "C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@]2([H])[C@H]1C)C(=O)[O-].[Na+]",
        "formula": "C30H47O3.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "478.6833",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "2d0fc43f-b8ee-4b7f-8575-71413812ced9",
          "2f725499-94bd-4b42-94ad-b58d40d39e29"
        ],
        "stereo_centers": 10
      },
      "unii": "NV5D25VL1O"
    }
  ]
}