{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ff945911-53a9-4466-a715-843db62a4e2b",
          "code": "87-79-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=87-79-6",
          "code_system": "CAS",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67",
            "6480fdb4-eb62-4a08-a663-9d9354828c9f"
          ]
        },
        {
          "uuid": "d1247fe6-22d3-4bd3-a2b1-0722b21b93f6",
          "code": "21 CFR 186.1839",
          "comments": "PART 186 -- INDIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 186.1839 Sorbose.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=186.1839",
          "code_system": "CFR",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67"
          ]
        },
        {
          "uuid": "b079a28b-232b-4f08-87d1-ab24b1884f12",
          "code": "D013013",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013013",
          "code_system": "MESH",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67"
          ]
        },
        {
          "uuid": "441091ec-2274-44d9-84ab-b318bdb38e3d",
          "code": "SORBOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sorbose",
          "code_system": "WIKIPEDIA",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67"
          ]
        },
        {
          "uuid": "10d8b857-21af-43e5-8e36-ceb24f2f48ab",
          "code": "3615-39-2",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3615-39-2",
          "code_system": "CAS",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67",
            "ec1a8e09-60e0-4c1a-89b6-c39c232febf6"
          ]
        },
        {
          "uuid": "88f1d6bf-5a43-4823-8d4d-047517a15eec",
          "code": "201-771-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.611",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67"
          ]
        },
        {
          "uuid": "cd3caa73-7f0f-40e5-945f-fa4c98cdc243",
          "code": "m10122",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10122?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67"
          ]
        },
        {
          "uuid": "f547ca8f-0105-4375-936a-98229418e483",
          "code": "6904",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6904",
          "code_system": "PUBCHEM",
          "references": [
            "d0bb527b-314f-44cd-ae0a-cf90208cae67"
          ]
        },
        {
          "uuid": "e09c709f-01b0-55e4-81e6-ab382aca9bbf",
          "code": "780",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/780",
          "code_system": "HSDB",
          "references": [
            "8aee4350-9f3f-98f0-ad57-43e76b4c942d"
          ]
        },
        {
          "uuid": "7d8843c7-c2dd-8475-c763-f7714289f3ee",
          "code": "DTXSID1048704",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1048704",
          "code_system": "EPA CompTox",
          "references": [
            "ddf92c91-3587-dad8-a294-ebbc8d3938bb"
          ]
        },
        {
          "uuid": "b71ecf6a-9763-453d-9fdd-ef7cff46092c",
          "code": "35673-97-3",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=35673-97-3",
          "code_system": "CAS",
          "references": [
            "06195926-ab20-9150-936c-8efdaaad09a0"
          ]
        },
        {
          "uuid": "b93d7f21-40f7-4c52-997d-cb5b0381ab4f",
          "code": "7270-77-1",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7270-77-1",
          "code_system": "CAS",
          "references": [
            "06195926-ab20-9150-936c-8efdaaad09a0"
          ]
        },
        {
          "uuid": "02a12663-138d-40d7-9857-0643698f9831",
          "code": "NV2001607Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d14990f3-61cd-4b30-668f-f52b144de231",
          "code": "27922",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27922",
          "code_system": "CHEBI",
          "references": [
            "a8076fe5-72ed-495a-fecd-c7ca6a70d6f7"
          ]
        },
        {
          "uuid": "66285ec5-3cec-e928-03f9-a4abed782d4b",
          "code": "17266",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17266",
          "code_system": "CHEBI",
          "references": [
            "a8076fe5-72ed-495a-fecd-c7ca6a70d6f7"
          ]
        },
        {
          "uuid": "a304330b-8da3-4910-7037-0204b4125ceb",
          "code": "48649",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:48649",
          "code_system": "CHEBI",
          "references": [
            "a8076fe5-72ed-495a-fecd-c7ca6a70d6f7"
          ]
        },
        {
          "uuid": "9797442b-91bd-a10d-4861-185cc1b50c49",
          "code": "97195",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=97195",
          "code_system": "NSC",
          "references": [
            "31be120b-090f-e16e-6724-aaa4e4666dff"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6f9e8a5b-7e4a-4294-85a8-4249fa5bc896",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "327b472e-83c4-4667-9037-c2204fe7edb5",
            "refuuid": "26d29aa0-20c5-459e-b97d-ccaabf0b3570",
            "name": "ALTERNATIVE DEFINITION for [SORBOSE]",
            "linking_id": "26d29aa0-20c5-459e-b97d-ccaabf0b3570",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "6aaa3c7a-2103-483a-acb0-5eeecbc77abf",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "9a6b005e-7155-4df1-8f02-ec2399a78d34",
            "refuuid": "b59082be-eb5f-4fb5-a84c-6b43b076fffe",
            "name": "ALTERNATIVE DEFINITION for [SORBOSE]",
            "linking_id": "b59082be-eb5f-4fb5-a84c-6b43b076fffe",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9d1dedba-f141-4401-ace5-456ecdfb6679",
          "name": "L-SORBOSE",
          "stdName": "L-SORBOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceb02a74-83ca-4e57-a285-cf05ada25e59",
            "8e51d64e-2e6a-457a-b5dd-fa7cb9f475fb"
          ],
          "display_name": false
        },
        {
          "uuid": "c6903777-52a9-477f-89bf-a82e8dac0496",
          "name": "NSC-97195",
          "stdName": "NSC-97195",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceb02a74-83ca-4e57-a285-cf05ada25e59",
            "0a58ddca-6d5e-415d-97bb-322cb1eebf3a"
          ],
          "display_name": false
        },
        {
          "uuid": "5096fdb0-620d-47d7-8987-4c6946754ddd",
          "name": "SORBIN",
          "stdName": "SORBIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceb02a74-83ca-4e57-a285-cf05ada25e59",
            "8e51d64e-2e6a-457a-b5dd-fa7cb9f475fb"
          ],
          "display_name": false
        },
        {
          "uuid": "4e6842b7-e824-4a93-afb7-ec1f3d6b6186",
          "name": "SORBOSE",
          "stdName": "SORBOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54388b8c-1a2d-4034-b73e-9f6f97d7bb4a",
            "ceb02a74-83ca-4e57-a285-cf05ada25e59",
            "b8c82996-1ccb-4ab5-81d5-4c20c5d3a6ef",
            "6c6be9c2-3eee-4223-8c6d-24942cff08a8",
            "8e51d64e-2e6a-457a-b5dd-fa7cb9f475fb",
            "55fbdcd9-7797-4692-ba57-a5dde6f8eb10"
          ],
          "display_name": true
        },
        {
          "uuid": "4eea65d2-d1ba-434e-bdf9-1058b99a3c32",
          "name": "SORBOSE [HSDB]",
          "stdName": "SORBOSE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceb02a74-83ca-4e57-a285-cf05ada25e59",
            "55fbdcd9-7797-4692-ba57-a5dde6f8eb10"
          ],
          "display_name": false
        },
        {
          "uuid": "eb06cb84-708f-48f4-86d6-053994c45a55",
          "name": "SORBOSE [MI]",
          "stdName": "SORBOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54388b8c-1a2d-4034-b73e-9f6f97d7bb4a",
            "ceb02a74-83ca-4e57-a285-cf05ada25e59"
          ],
          "display_name": false
        },
        {
          "uuid": "18a32a30-cf6d-4d31-ba12-cb673a149a01",
          "name": "SORBOSE, L-",
          "stdName": "SORBOSE, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceb02a74-83ca-4e57-a285-cf05ada25e59",
            "8e51d64e-2e6a-457a-b5dd-fa7cb9f475fb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8e51d64e-2e6a-457a-b5dd-fa7cb9f475fb",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ceb02a74-83ca-4e57-a285-cf05ada25e59",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54388b8c-1a2d-4034-b73e-9f6f97d7bb4a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55fbdcd9-7797-4692-ba57-a5dde6f8eb10",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a58ddca-6d5e-415d-97bb-322cb1eebf3a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0bb527b-314f-44cd-ae0a-cf90208cae67",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "847f2e3c-ea33-49d7-a68b-ab3f66005ac5",
          "citation": "SRS import [NV2001607Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NV2001607Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389672000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c6be9c2-3eee-4223-8c6d-24942cff08a8",
          "citation": "SORBOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b8c82996-1ccb-4ab5-81d5-4c20c5d3a6ef",
          "citation": "SORBOSE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8aee4350-9f3f-98f0-ad57-43e76b4c942d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+87-79-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ddf92c91-3587-dad8-a294-ebbc8d3938bb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=87-79-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06195926-ab20-9150-936c-8efdaaad09a0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec1a8e09-60e0-4c1a-89b6-c39c232febf6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6480fdb4-eb62-4a08-a663-9d9354828c9f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a8076fe5-72ed-495a-fecd-c7ca6a70d6f7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "31be120b-090f-e16e-6724-aaa4e4666dff",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5b42bfa2-5bea-4330-a39b-6da9021008ff",
          "id": "5b42bfa2-5bea-4330-a39b-6da9021008ff",
          "molfile": "\n  Marvin  01132104442D          \n\n 12 11  0  0  1  0            999 V2000\n    5.4047   -6.2987    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.4421   -7.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -5.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9815   -6.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1000   -5.8544    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.0623   -5.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8280   -6.2342    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.8654   -7.0578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5233   -5.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4856   -4.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2558   -6.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9465   -5.7250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5e70984b-0bad-4d34-adb5-268731729e91"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8658749d-8b94-4038-a5f9-9f203f9ca5ab",
      "version": "15",
      "structure": {
        "id": "2e399947-fc1a-47e1-b44d-24d39f6653bb",
        "molfile": "\n  Marvin  01132102292D          \n\n 12 11  0  0  1  0            999 V2000\n    6.8280   -6.2342    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.1000   -5.8544    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4047   -6.2987    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4421   -7.1225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6767   -5.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9815   -6.3635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0623   -5.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5233   -5.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4856   -4.9613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2558   -6.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9465   -5.7250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8654   -7.0578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  7  1  1  0  0  0\n  8  1  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n  1 12  1  1  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "847f2e3c-ea33-49d7-a68b-ab3f66005ac5",
          "8e51d64e-2e6a-457a-b5dd-fa7cb9f475fb"
        ],
        "stereo_centers": 3
      },
      "unii": "NV2001607Y"
    }
  ]
}