{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a2b00786-cf2d-46bf-96bf-4d1cd33b6f58",
          "code": "16883-83-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16883-83-3",
          "code_system": "CAS",
          "references": [
            "7ad17fdc-1742-4e26-9109-7333252926b5",
            "30ce4115-b067-4a18-91ee-2d06bf439198"
          ]
        },
        {
          "uuid": "1495b453-844b-4bc9-9428-69502f7baddd",
          "code": "240-920-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.185",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ad17fdc-1742-4e26-9109-7333252926b5"
          ]
        },
        {
          "uuid": "81b8a300-9c3b-4e6b-99cb-83a25174d98d",
          "code": "28124",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28124",
          "code_system": "PUBCHEM",
          "references": [
            "7ad17fdc-1742-4e26-9109-7333252926b5"
          ]
        },
        {
          "uuid": "2dacb86e-c57f-6512-4bf3-82d378adbbf2",
          "code": "DTXSID4027785",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4027785",
          "code_system": "EPA CompTox",
          "references": [
            "b1ee0b8c-24fa-1e15-e049-62c4a781ca09"
          ]
        },
        {
          "uuid": "f217252d-cb4c-4054-9329-54a69e57dd08",
          "code": "NUV6UJ7024",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c60e376f-0016-4668-9531-4a56463c83f3",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, 1-(2,2-DIMETHYL-1-(1-METHYLETHYL)-3-(2-METHYL-1-OXOPROPOXY)PROPYL) 2-(PHENYLMETHYL) ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, 1-(2,2-DIMETHYL-1-(1-METHYLETHYL)-3-(2-METHYL-1-OXOPROPOXY)PROPYL) 2-(PHENYLMETHYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbb9386-7d0a-4026-b8dc-efbdcc196c1c"
          ],
          "display_name": false
        },
        {
          "uuid": "f24196be-ce52-44d2-aebe-8f2be7497dbe",
          "name": "1,2-BENZENEDICARBOXYLIC ACID, 2,2-DIMETHYL-1-(1-METHYLETHYL)-3-(2-METHYL-1-OXOPROPOXY)PROPYL PHENYLMETHYL ESTER",
          "stdName": "1,2-BENZENEDICARBOXYLIC ACID, 2,2-DIMETHYL-1-(1-METHYLETHYL)-3-(2-METHYL-1-OXOPROPOXY)PROPYL PHENYLMETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b811b281-c2b2-4824-bed7-6bce0bbd2c28"
          ],
          "display_name": false
        },
        {
          "uuid": "2b9c9f4b-d93c-4cef-b386-01d6913f3daa",
          "name": "1,3-PENTANEDIOL, 2,2,4-TRIMETHYL-, 3-(BENZYL PHTHALATE) ISOBUTYRATE",
          "stdName": "1,3-PENTANEDIOL, 2,2,4-TRIMETHYL-, 3-(BENZYL PHTHALATE) ISOBUTYRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbb9386-7d0a-4026-b8dc-efbdcc196c1c"
          ],
          "display_name": false
        },
        {
          "uuid": "69bbdfcd-5563-40e1-906a-a33d6a3880bb",
          "name": "BENZYL (1-(ISOBUTYRYLOXY)-2,2,4-TRIMETHYLPENTAN-3-YL) PHTHALATE",
          "stdName": "BENZYL (1-(ISOBUTYRYLOXY)-2,2,4-TRIMETHYLPENTAN-3-YL) PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe4b18e-afc5-48f0-905f-e4182ae7296b"
          ],
          "display_name": true
        },
        {
          "uuid": "290fac65-ce0c-4380-80d3-26340e866f52",
          "name": "ISOBUTYRIC ACID, 3-HYDROXY-2,2,4-TRIMETHYLPENTYL ESTER BENZYL PHTHALATE",
          "stdName": "ISOBUTYRIC ACID, 3-HYDROXY-2,2,4-TRIMETHYLPENTYL ESTER BENZYL PHTHALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbb9386-7d0a-4026-b8dc-efbdcc196c1c"
          ],
          "display_name": false
        },
        {
          "uuid": "33619176-8e1f-4bd3-b2d4-7fa06401e9ee",
          "name": "PHTHALIC ACID, BENZYL 3-HYDROXY-1-ISOPROPYL-2,2-DIMETHYLPROPYL ESTER ISOBUTYRATE",
          "stdName": "PHTHALIC ACID, BENZYL 3-HYDROXY-1-ISOPROPYL-2,2-DIMETHYLPROPYL ESTER ISOBUTYRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cbb9386-7d0a-4026-b8dc-efbdcc196c1c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b811b281-c2b2-4824-bed7-6bce0bbd2c28",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4cbb9386-7d0a-4026-b8dc-efbdcc196c1c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abe4b18e-afc5-48f0-905f-e4182ae7296b",
          "citation": "Alchem Pharmtech Product List",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ad17fdc-1742-4e26-9109-7333252926b5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393595000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38602a21-f34c-45ef-848f-d435e2316b64",
          "citation": "SRS import [NUV6UJ7024]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NUV6UJ7024",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393595000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1ee0b8c-24fa-1e15-e049-62c4a781ca09",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16883-83-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "30ce4115-b067-4a18-91ee-2d06bf439198",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c9b1e109-99c1-44cb-92d2-1a4d91a800fb",
          "id": "c9b1e109-99c1-44cb-92d2-1a4d91a800fb",
          "molfile": "\n  Marvin  01132110252D          \n\n 33 34  0  0  0  0            999 V2000\n    1.4337   -3.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -3.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -3.7058    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.5726   -3.2983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -2.0605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2855   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7192   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7192   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2855   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -1.2300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7130   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7130   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -4.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6901   -4.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0370   -4.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -5.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -5.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -6.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -7.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -7.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -7.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -6.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 24  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C(C(C)(C)COC(=O)C(C)C)OC(=O)c1ccccc1C(=O)OCc2ccccc2",
          "formula": "C27H34O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "866bcf17-1869-4e2f-9f8f-bbff69857f0e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "454.5563",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "23e67816-293e-4f22-bbf9-ef927006a95a",
      "version": "4",
      "structure": {
        "id": "d0277f6d-b512-41a8-bb74-815d9cde5249",
        "molfile": "\n  Marvin  01132110462D          \n\n 33 34  0  0  0  0            999 V2000\n    4.2855   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7192   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7192   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9984   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2855   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -1.2300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -2.0605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -3.2983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7130   -0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7130   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -3.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -4.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -5.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6901   -4.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0370   -4.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -3.2983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -3.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -5.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1467   -6.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -7.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -7.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5726   -6.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4337   -7.0119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6 10  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 20  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 28  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 33  2  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C(C(C)(C)COC(=O)C(C)C)OC(=O)c1ccccc1C(=O)OCc2ccccc2",
        "formula": "C27H34O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "454.5563",
        "optical_activity": "( + / - )",
        "references": [
          "b811b281-c2b2-4824-bed7-6bce0bbd2c28",
          "38602a21-f34c-45ef-848f-d435e2316b64"
        ],
        "stereo_centers": 1
      },
      "unii": "NUV6UJ7024"
    }
  ]
}