{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8c30458b-7e2b-4f4d-91ac-7242f1b47e92",
          "code": "475-81-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=475-81-0",
          "code_system": "CAS",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8",
            "18332b5a-a378-4f30-bcba-7adfb0c09797"
          ]
        },
        {
          "uuid": "01ef4372-c7ec-443d-9d8e-1e38113f5565",
          "code": "C005004",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005004",
          "code_system": "MESH",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "7913887d-ba3d-43d6-998d-8c7471fcf29f",
          "code": "GLAUCINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glaucine",
          "code_system": "WIKIPEDIA",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "31aaea91-2999-4c50-a6ad-05a25d0dc1bf",
          "code": "1368876",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368876/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "caf1b858-927f-4216-8721-237ab8fe4b2b",
          "code": "m5741",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5741?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "0ab13658-2acb-4427-a569-2c25106bc0b1",
          "code": "SUB13972MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "08b95c40-b592-4e32-8c66-149d2174ea7e",
          "code": "207-501-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.820",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "942d1be1-cf4a-4279-adc4-22791171037e",
          "code": "16754",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16754",
          "code_system": "PUBCHEM",
          "references": [
            "ed07c455-c4f0-498c-93b7-5efc99956bf8"
          ]
        },
        {
          "uuid": "8da065cb-86ec-8cec-24dc-f276c9236244",
          "code": "DTXSID8031100",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8031100",
          "code_system": "EPA CompTox",
          "references": [
            "62fceaee-7159-71e8-7e71-4a7cbafacfdf"
          ]
        },
        {
          "uuid": "8f60d6b4-6bce-43ea-b203-0e73cdab10c8",
          "code": "NU19306XA7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b9b389a-b330-1890-cfd3-c6030cb00d6a",
          "code": "5373",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5373",
          "code_system": "CHEBI",
          "references": [
            "38767893-0ae2-f894-1a77-b149884dd4c6"
          ]
        },
        {
          "uuid": "03678b4f-416d-4fd4-413d-c75553764804",
          "code": "100000078186",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3aca3ff4-271d-81a9-48d4-d70d787172a2"
          ]
        },
        {
          "uuid": "b12f0889-4e3f-a12c-2d62-0510ee05bdf4",
          "code": "34396",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=34396",
          "code_system": "NSC",
          "references": [
            "be4814e4-6b9f-8e9d-06e5-859cea5c3e29"
          ]
        },
        {
          "uuid": "cb967d33-24f4-28ac-e851-dd3a71faa901",
          "code": "NU19306XA7",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=NU19306XA7",
          "code_system": "DAILYMED",
          "references": [
            "18920c91-b5ef-f6b0-64c5-09a58205355d"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bec3fac6-c88e-4b8e-94ad-ba4e87ca03fc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "11e5e455-faeb-442e-9c3a-d8a3ecb86327",
            "refuuid": "0d6646cd-2db3-4126-9ebc-5dba10698795",
            "name": "GLAUCINE",
            "unii": "NU19306XA7",
            "linking_id": "NU19306XA7",
            "ref_pname": "GLAUCINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2a9aec64-54cb-41cc-9de2-e1c4ae5a1ea9",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "c65351be-d4db-41c9-a1bd-cc331b859124",
            "refuuid": "6b8beb6a-879d-417c-9caa-80ecfff20a8a",
            "name": "GLAUCINE HYDROBROMIDE",
            "unii": "7BPY1SMR1C",
            "linking_id": "7BPY1SMR1C",
            "ref_pname": "GLAUCINE HYDROBROMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fb209539-8b7a-4b50-aa5f-496fa572de2a",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5739d4b7-2671-4414-b6ed-548cd41ccfb9",
            "refuuid": "6452cca0-1627-43bc-8b8f-050bdad4f65e",
            "name": "GLAUCINE HYDROCHLORIDE",
            "unii": "69444SR62I",
            "linking_id": "69444SR62I",
            "ref_pname": "GLAUCINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4832c2c3-5995-480b-aaae-0b74536466bb",
          "amount": {
            "uuid": "70bb14c9-a71a-4f29-a755-dda41b5e4f90"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "d5cb5d68-62e3-4b31-94a5-969b58b97ebd"
          ],
          "related_substance": {
            "uuid": "63274742-937d-4400-af54-cafc1284b92d",
            "refuuid": "9cfa763d-20ee-4b73-a87f-da6bfe0da64b",
            "name": "GLAUCINE PHOSPHATE",
            "unii": "6SVU59BSY2",
            "linking_id": "6SVU59BSY2",
            "ref_pname": "GLAUCINE PHOSPHATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e0d48f1-6b35-4639-9c8b-5cbdad04def5",
          "name": "(6AS)-5,6,6A,7-TETRAHYDRO-1,2,9,10-TETRAMETHOXY-6-METHYL-4H-DIBENZO(DE,G)QUINOLINE",
          "stdName": "(6AS)-5,6,6A,7-TETRAHYDRO-1,2,9,10-TETRAMETHOXY-6-METHYL-4H-DIBENZO(DE,G)QUINOLINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21696f8f-e092-484a-b55f-37a9a444de4e",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "a8a1d1fc-f440-459c-a769-2a8bd5c8e9cc",
          "name": "1,2,9,10-TETRAMETHOXYAPORPHINE",
          "stdName": "1,2,9,10-TETRAMETHOXYAPORPHINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21696f8f-e092-484a-b55f-37a9a444de4e",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "21ed79cb-c3bc-4120-9087-07409f3b19f5",
          "name": "BOLDINE DIMETHYL ETHER",
          "stdName": "BOLDINE DIMETHYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21696f8f-e092-484a-b55f-37a9a444de4e",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "f606fda9-241e-4819-9e64-d0045b5d2aba",
          "name": "BROMCHOLITIN",
          "stdName": "BROMCHOLITIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21696f8f-e092-484a-b55f-37a9a444de4e",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "7d50c203-45e6-4d02-ae4f-29899f2aad86",
          "name": "D-GLAUCINE",
          "stdName": "D-GLAUCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ae316b-dff4-4ed1-91f2-80e0254141b0",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "8c4be0d1-56ec-4d1f-9090-462841cbec0d",
          "name": "GLAUCINE",
          "stdName": "GLAUCINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "734c063d-6e22-4518-8d84-905174e64052",
            "21696f8f-e092-484a-b55f-37a9a444de4e",
            "f8652c7a-f5d1-4470-a1c5-f6c94cd3ce7a",
            "ff72daa0-3337-4faf-9442-04961f127dff",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04",
            "d6c7dc09-ed02-4e15-9f83-62ec2b21a785",
            "6e01272c-e07d-4a35-a10b-06305966819b",
            "5f1b4667-9516-4f24-a9be-3776faa6795f",
            "7c179cb6-d439-440b-9f24-dd85264698ca",
            "415f44ce-eacc-4d90-884b-3bb4f434e87d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a6533d9d-1245-4bca-8202-bd495edefaf1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6a5faddf-c4ee-422f-95aa-ddbf33a34b33",
          "name": "GLAUCINE [MART.]",
          "stdName": "GLAUCINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f1b4667-9516-4f24-a9be-3776faa6795f"
          ],
          "display_name": false
        },
        {
          "uuid": "5d21a212-aed7-4c99-8cae-4a9c561c1899",
          "name": "GLAUCINE [MI]",
          "stdName": "GLAUCINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff72daa0-3337-4faf-9442-04961f127dff",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "93cf52be-b19a-4be5-84ba-0b38f3160940",
          "name": "GLAUVENT",
          "stdName": "GLAUVENT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "21696f8f-e092-484a-b55f-37a9a444de4e",
            "f31563ae-285d-4b00-8bca-ae40c6f94e04"
          ],
          "display_name": false
        },
        {
          "uuid": "12914f33-855e-ac80-5765-7856dd41ea03",
          "name": "Glaucine [WHO-DD]",
          "stdName": "GLAUCINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47551a8b-70e8-0da5-1276-f814282aca66"
          ],
          "display_name": false
        },
        {
          "uuid": "f2a06979-7ef1-4b7e-972e-1e31007818bc",
          "name": "NSC-34396",
          "stdName": "NSC-34396",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f31563ae-285d-4b00-8bca-ae40c6f94e04",
            "5084ede1-2f4e-4581-82ea-6d91b9a9ab2c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "21696f8f-e092-484a-b55f-37a9a444de4e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f31563ae-285d-4b00-8bca-ae40c6f94e04",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f1b4667-9516-4f24-a9be-3776faa6795f",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff72daa0-3337-4faf-9442-04961f127dff",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "734c063d-6e22-4518-8d84-905174e64052",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6c7dc09-ed02-4e15-9f83-62ec2b21a785",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1ae316b-dff4-4ed1-91f2-80e0254141b0",
          "citation": "https://www.jstage.jst.go.jp/article/bpb1993/17/2/17_2_262/_pdf",
          "url": "https://www.jstage.jst.go.jp/article/bpb1993/17/2/17_2_262/_pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5084ede1-2f4e-4581-82ea-6d91b9a9ab2c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed07c455-c4f0-498c-93b7-5efc99956bf8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d54ef2da-21c1-49b0-90a6-7cb8a34d8563",
          "citation": "SRS import [NU19306XA7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NU19306XA7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389717000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8652c7a-f5d1-4470-a1c5-f6c94cd3ce7a",
          "citation": "GLAUCINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6e01272c-e07d-4a35-a10b-06305966819b",
          "citation": "GLAUCINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7c179cb6-d439-440b-9f24-dd85264698ca",
          "citation": "GLAUCINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "415f44ce-eacc-4d90-884b-3bb4f434e87d",
          "citation": "GLAUCINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62fceaee-7159-71e8-7e71-4a7cbafacfdf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=475-81-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "38767893-0ae2-f894-1a77-b149884dd4c6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "18332b5a-a378-4f30-bcba-7adfb0c09797",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "be4814e4-6b9f-8e9d-06e5-859cea5c3e29",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47551a8b-70e8-0da5-1276-f814282aca66",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "18920c91-b5ef-f6b0-64c5-09a58205355d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "3aca3ff4-271d-81a9-48d4-d70d787172a2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d5cb5d68-62e3-4b31-94a5-969b58b97ebd",
          "citation": "stm",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b5015ae3-ce44-4dc5-a1dd-b72ef530f83b",
          "id": "b5015ae3-ce44-4dc5-a1dd-b72ef530f83b",
          "molfile": "\n  Marvin  01132109222D          \n\n 26 29  0  0  1  0            999 V2000\n    6.2083   -3.7121    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.4928   -4.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0759   -4.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3604   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -4.1230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -4.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3604   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -2.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0759   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -1.2336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -0.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6437   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6437   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -4.1230    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9190   -4.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 24  1  1  0  0  0\n  1 26  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 12  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  8  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 11  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 26  2  0  0  0  0\n 15 14  1  0  0  0  0\n 14 17  2  0  0  0  0\n 16 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 20  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 26  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CN1CCc2cc(c(c3-c4cc(c(cc4C[C@H]1c23)OC)OC)OC)OC",
          "formula": "C21H25NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9c65d2b2-1006-4ca7-b9ef-27085faae41b"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "355.4283",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0d6646cd-2db3-4126-9ebc-5dba10698795",
      "version": "11",
      "structure": {
        "id": "87b93573-0475-4230-b0fe-31b26eb5666b",
        "molfile": "\n  Marvin  01132107022D          \n\n 27 30  0  0  1  0            999 V2000\n    6.2083   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0759   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3604   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -2.4706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3604   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0759   -4.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -4.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -3.7121    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9190   -4.1230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -4.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6437   -3.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6437   -2.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9190   -0.0012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4928   -1.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -1.2336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7866   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2083   -4.5337    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -4.1230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6404   -4.9491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  5  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17  1  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 19  2  0  0  0  0\n 22  2  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 12 25  1  6  0  0  0\n  3 10  1  0  0  0  0\n 26  8  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
        "smiles": "CN1CCc2cc(c(c3-c4cc(c(cc4C[C@@]1([H])c23)OC)OC)OC)OC",
        "formula": "C21H25NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "355.4283",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "21696f8f-e092-484a-b55f-37a9a444de4e",
          "d54ef2da-21c1-49b0-90a6-7cb8a34d8563"
        ],
        "stereo_centers": 1
      },
      "unii": "NU19306XA7"
    }
  ]
}