{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5a33cba3-6ded-4637-90c5-0b24b74d7be7", "code": "1413-67-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1413-67-8", "code_system": "CAS", "references": [ "eb306126-3e9e-438c-92e2-ee95ddbbd036", "fa6b638d-0b64-489f-8463-8ace5fe88811" ] }, { "uuid": "c577a943-07c5-44b0-b3c7-c1a27f609278", "code": "LYSERGOL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Lysergol", "code_system": "WIKIPEDIA", "references": [ "eb306126-3e9e-438c-92e2-ee95ddbbd036" ] }, { "uuid": "fda8a18c-7233-9b34-9e87-96436c28e2ff", "code": "14987", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14987", "code_system": "PUBCHEM", "references": [ "1a91dc07-606e-2ff5-878b-843ee7bb5fe3" ] }, { "uuid": "2c681f84-53cc-4d2a-a69f-c86ab6973dc1", "code": "NTR684Z1AZ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "12af3ab8-774b-4e49-b2db-80c30624aefc", "name": "(7-METHYL-4,6,6A,7,8,9-HEXAHYDRO-INDOLO(4,3-FG)QUINOLIN-9-YL)-METHANOL", "stdName": "(7-METHYL-4,6,6A,7,8,9-HEXAHYDRO-INDOLO(4,3-FG)QUINOLIN-9-YL)-METHANOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "585106c7-4041-4a97-986d-0b548da963f3" ], "display_name": false }, { "uuid": "1018fbc4-154c-4695-9f99-0d54d38691d8", "name": "LYSERGOL", "stdName": "LYSERGOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "585106c7-4041-4a97-986d-0b548da963f3" ], "display_name": true } ], "references": [ { "uuid": "585106c7-4041-4a97-986d-0b548da963f3", "citation": "http://en.wikipedia.org/wiki/Lysergol", "url": "http://en.wikipedia.org/wiki/Lysergol", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "eb306126-3e9e-438c-92e2-ee95ddbbd036", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389659000, "tags": [ "NOMEN" ] }, { "uuid": "bc0a9662-3b8d-4451-a894-f395886cf2e4", "citation": "SRS import [NTR684Z1AZ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NTR684Z1AZ", "doc_type": "SRS", "public_domain": true, "document_date": 1493389659000, "tags": [ "NOMEN" ] }, { "uuid": "23f1059c-519e-44ed-bfa8-b6a85079b74a", "citation": "WIKIPEDIA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a91dc07-606e-2ff5-878b-843ee7bb5fe3", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "fa6b638d-0b64-489f-8463-8ace5fe88811", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1f633ef6-e411-4447-9624-327548ea8868", "id": "1f633ef6-e411-4447-9624-327548ea8868", "molfile": "\n Marvin 01132101472D \n\n 19 22 0 0 1 0 999 V2000\n 6.4156 -2.3121 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.4156 -1.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6727 -1.0594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1448 -2.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1448 -3.5364 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 7.9068 -3.9224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4537 -3.9700 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.4537 -4.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7585 -5.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7585 -6.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3484 -6.1231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3484 -5.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6098 -4.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6098 -4.0082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3150 -3.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0342 -3.9892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7251 -3.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7251 -2.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0342 -4.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 4 1 1 0 0 0 0\n 1 18 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 5 1 6 0 0 0\n 7 8 1 0 0 0 0\n 7 17 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 19 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 19 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 19 16 1 0 0 0 0\n 18 17 2 0 0 0 0\nM END", "smiles": "CN1C[C@@H](C=C2c3cccc4c3c(C[C@H]21)c[nH]4)CO", "formula": "C16H18N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f15d0d80-8945-4b62-a0b4-2435a7141c16" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "254.3275", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "581a0a68-6b6e-4eda-bbfa-9f42373d4765", "version": "6", "structure": { "id": "7f5d9edd-c5ef-4389-8073-4cb03a7639ab", "molfile": "\n Marvin 01132106372D \n\n 20 23 0 0 1 0 999 V2000\n 5.7255 -3.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4542 -3.9703 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.1453 -3.5367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9074 -3.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1453 -2.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4161 -2.3123 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.7255 -2.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4161 -1.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6731 -1.0595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4542 -4.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7589 -5.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0346 -4.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0346 -3.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3153 -3.6034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6101 -4.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6101 -4.8469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3487 -5.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3487 -6.1236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7589 -6.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4542 -3.2749 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 1 2 0 0 0 0\n 6 8 1 1 0 0 0\n 9 8 1 0 0 0 0\n 10 2 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 1 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 11 2 0 0 0 0\n 17 12 2 0 0 0 0\n 2 20 1 1 0 0 0\nM END", "smiles": "CN1C[C@@H](C=C2c3cccc4c3c(C[C@]21[H])c[nH]4)CO", "formula": "C16H18N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "254.3275", "optical_activity": "UNSPECIFIED", "references": [ "bc0a9662-3b8d-4451-a894-f395886cf2e4", "23f1059c-519e-44ed-bfa8-b6a85079b74a" ], "stereo_centers": 2 }, "unii": "NTR684Z1AZ" } ] }