{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f610593a-63bc-462e-9c28-62a27b3d4c59", "code": "36306-86-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36306-86-2", "code_system": "CAS", "references": [ "253af0ba-1804-4bc0-a34d-590ebefc1c8e", "c41be379-51ae-4e61-bfdb-3e624bef7ff6" ] }, { "uuid": "ccf94cbe-6f69-4f1d-874c-a4f87098bd02", "code": "252-960-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.131", "code_system": "ECHA (EC/EINECS)", "references": [ "253af0ba-1804-4bc0-a34d-590ebefc1c8e" ] }, { "uuid": "5845c6c4-47a0-4916-b132-cef30b5c71af", "code": "118291", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118291", "code_system": "PUBCHEM", "references": [ "253af0ba-1804-4bc0-a34d-590ebefc1c8e" ] }, { "uuid": "a5b09c8f-2e62-4fa3-80e4-76069e94a176", "code": "NTJ9ZB2QZ9", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a663dc40-a6a6-05e0-1c04-34f0923044cf", "code": "DTXSID60865814", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60865814", "code_system": "EPA CompTox", "references": [ "46df4161-91e1-d4cd-2383-c1d2885906af" ] } ], "substance_class": "chemical", "names": [ { "uuid": "cce7dacb-8fe2-442b-b561-3237a11f4998", "name": "1-ETHOXY-4-(1-ETHOXYETHENYL)-3,3,5,5-TETRAMETHYLCYCLOHEXENE", "stdName": "1-ETHOXY-4-(1-ETHOXYETHENYL)-3,3,5,5-TETRAMETHYLCYCLOHEXENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d5d56dcf-9383-422c-9d46-e24a6f02a423" ], "display_name": true }, { "uuid": "a5b98bf2-81c8-4eba-85d7-a41a7b391ba7", "name": "CYCLOHEXENE, 1-ETHOXY-4-(1-ETHOXYETHENYL)-3,3,5,5-TETRAMETHYL-", "stdName": "CYCLOHEXENE, 1-ETHOXY-4-(1-ETHOXYETHENYL)-3,3,5,5-TETRAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6c920937-258e-4c18-ba63-245783e2060b" ], "display_name": false } ], "references": [ { "uuid": "6c920937-258e-4c18-ba63-245783e2060b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d5d56dcf-9383-422c-9d46-e24a6f02a423", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "253af0ba-1804-4bc0-a34d-590ebefc1c8e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392253000, "tags": [ "NOMEN" ] }, { "uuid": "99410195-5817-479c-b335-bfbde0fd4a53", "citation": "SRS import [NTJ9ZB2QZ9]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NTJ9ZB2QZ9", "doc_type": "SRS", "public_domain": true, "document_date": 1493392253000, "tags": [ "NOMEN" ] }, { "uuid": "c41be379-51ae-4e61-bfdb-3e624bef7ff6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "46df4161-91e1-d4cd-2383-c1d2885906af", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "23063a79-5ec8-4e87-956d-d9f2da2e628e", "id": "23063a79-5ec8-4e87-956d-d9f2da2e628e", "molfile": "\n Marvin 01132101582D \n\n 18 18 0 0 0 0 999 V2000\n 8.1091 -6.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1091 -5.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3947 -5.3301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3947 -4.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1091 -4.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6802 -4.0926 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.9657 -4.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4354 -5.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4960 -5.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2513 -4.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2513 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5368 -2.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8223 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1078 -2.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9657 -2.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6802 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4926 -3.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9623 -2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 16 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 15 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\nM END", "smiles": "CCOC(=C)C1C(C)(C)C=C(CC1(C)C)OCC", "formula": "C16H28O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "408482db-78b9-45d4-bdf7-f74383259b06" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "252.3929", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "961a0712-cab9-4a86-89eb-d8469dcc9a05", "version": "6", "structure": { "id": "acca3355-ee03-4b8b-9cdc-c96fc286656c", "molfile": "\n Marvin 01132108582D \n\n 18 18 0 0 0 0 999 V2000\n 4.5368 -2.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2513 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2513 -4.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9657 -4.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4354 -5.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4960 -5.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6802 -4.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3947 -4.5051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3947 -5.3301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1091 -5.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1091 -6.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1091 -4.0926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6802 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4926 -3.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9623 -2.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9657 -2.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8223 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1078 -2.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 7 4 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 8 12 2 0 0 0 0\n 13 7 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 13 1 0 0 0 0\n 2 16 2 0 0 0 0\n 1 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCOC(=C)C1C(C)(C)C=C(CC1(C)C)OCC", "formula": "C16H28O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "252.3929", "optical_activity": "( + / - )", "references": [ "99410195-5817-479c-b335-bfbde0fd4a53", "6c920937-258e-4c18-ba63-245783e2060b" ], "stereo_centers": 1 }, "unii": "NTJ9ZB2QZ9" } ] }