{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c9430f75-2923-477d-a939-f63819908316",
          "code": "16941-11-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16941-11-0",
          "code_system": "CAS",
          "references": [
            "7b9fbbb5-ae29-4632-8220-994372e9da54",
            "1ef44db9-19d4-4057-9b66-721fdc78ef8a"
          ]
        },
        {
          "uuid": "3117bf55-dbb0-429a-b47d-20aebdf7c78c",
          "code": "C513217",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67513217",
          "code_system": "MESH",
          "references": [
            "7b9fbbb5-ae29-4632-8220-994372e9da54"
          ]
        },
        {
          "uuid": "b88ee20f-290f-4334-92a5-ea931a79bbcb",
          "code": "AMMONIUM HEXAFLUOROPHOSPHATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ammonium_hexafluorophosphate",
          "code_system": "WIKIPEDIA",
          "references": [
            "7b9fbbb5-ae29-4632-8220-994372e9da54"
          ]
        },
        {
          "uuid": "e5a41b85-ceb5-4c73-be94-fc243bbff04e",
          "code": "m1793",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1793?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7b9fbbb5-ae29-4632-8220-994372e9da54"
          ]
        },
        {
          "uuid": "119ef95a-8222-47c3-9518-f37463d724d6",
          "code": "241-009-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.266",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7b9fbbb5-ae29-4632-8220-994372e9da54"
          ]
        },
        {
          "uuid": "bc962e61-b73d-3c39-a2b3-630784883cdb",
          "code": "9793912",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9793912",
          "code_system": "PUBCHEM",
          "references": [
            "28c58881-1bf5-2bde-6343-ef2d62a38f2d"
          ]
        },
        {
          "uuid": "7279d834-3580-4ba1-b49d-7d595f8b0825",
          "code": "NS308031PJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa72c2de-2be0-1225-5677-cb71519831b6",
          "code": "DTXSID00884948",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00884948",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "a3bc8580-0b5c-d76b-d561-41d7e7c22dca",
          "code": "407930",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=407930",
          "code_system": "NSC",
          "references": [
            "6594a572-41b6-cb89-c5c8-399e60c5e3b7"
          ]
        },
        {
          "uuid": "5713bcce-9445-88d5-77c5-8515f547ab37",
          "code": "403554",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=403554",
          "code_system": "NSC",
          "references": [
            "6594a572-41b6-cb89-c5c8-399e60c5e3b7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "879f85d6-5b9c-46ec-9107-486c90442717",
          "name": "AMMONIUM HEXAFLUOROPHOSPHATE",
          "stdName": "AMMONIUM HEXAFLUOROPHOSPHATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbe6f636-2249-4b0f-b348-cb472446b9cd",
            "773b4716-a370-4c76-8738-6e55feae0853",
            "9c27b27c-3f29-47dd-b288-98ce05b1fa86",
            "02dcc668-1f22-4435-8cb1-a26e73732669",
            "59e76f29-99f4-4682-8a39-3f62bcb005cb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c6d0faf7-472f-4071-a338-7d1e6c8be476",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "019f1d94-208d-4d54-99ed-0ed9f2942f8a",
          "name": "AMMONIUM HEXAFLUOROPHOSPHATE (NH4PF6)",
          "stdName": "AMMONIUM HEXAFLUOROPHOSPHATE (NH4PF6)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3694ac4-3ee9-44d2-a68f-4c6b876cbe8f",
            "59e76f29-99f4-4682-8a39-3f62bcb005cb"
          ],
          "display_name": false
        },
        {
          "uuid": "596cd061-db56-45c5-9165-3a491da07ffc",
          "name": "AMMONIUM HEXAFLUOROPHOSPHATE [MI]",
          "stdName": "AMMONIUM HEXAFLUOROPHOSPHATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02dcc668-1f22-4435-8cb1-a26e73732669",
            "59e76f29-99f4-4682-8a39-3f62bcb005cb"
          ],
          "display_name": false
        },
        {
          "uuid": "f6846bbc-f4fe-424e-bec5-32d74d6a208b",
          "name": "HEXAFLUOROPHOSPHATE(1-) AMMONIUM (1:1)",
          "stdName": "HEXAFLUOROPHOSPHATE(1-) AMMONIUM (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02dcc668-1f22-4435-8cb1-a26e73732669",
            "59e76f29-99f4-4682-8a39-3f62bcb005cb"
          ],
          "display_name": false
        },
        {
          "uuid": "e2117040-bdc7-40e3-847b-21e7bdef6a0c",
          "name": "NSC-403554",
          "stdName": "NSC-403554",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d20a97a-61da-496c-8fad-cd9a7c9f8c99",
            "59e76f29-99f4-4682-8a39-3f62bcb005cb"
          ],
          "display_name": false
        },
        {
          "uuid": "7b2ccce5-2770-422b-8a69-a8ab3d0bb987",
          "name": "NSC-407930",
          "stdName": "NSC-407930",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3694ac4-3ee9-44d2-a68f-4c6b876cbe8f",
            "59e76f29-99f4-4682-8a39-3f62bcb005cb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "02dcc668-1f22-4435-8cb1-a26e73732669",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "59e76f29-99f4-4682-8a39-3f62bcb005cb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d20a97a-61da-496c-8fad-cd9a7c9f8c99",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3694ac4-3ee9-44d2-a68f-4c6b876cbe8f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c27b27c-3f29-47dd-b288-98ce05b1fa86",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b9fbbb5-ae29-4632-8220-994372e9da54",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1659a35-ed3d-4d5f-8b79-f5c193326d16",
          "citation": "SRS import [NS308031PJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NS308031PJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "295e1e4b-edd6-4519-a222-ed33c96f8ea8",
          "citation": "CHEMID RECORD 16941-11-0",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbe6f636-2249-4b0f-b348-cb472446b9cd",
          "citation": "AMMONIUM HEXAFLUOROPHOSPHATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "773b4716-a370-4c76-8738-6e55feae0853",
          "citation": "AMMONIUM HEXAFLUOROPHOSPHATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "28c58881-1bf5-2bde-6343-ef2d62a38f2d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "1ef44db9-19d4-4057-9b66-721fdc78ef8a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6594a572-41b6-cb89-c5c8-399e60c5e3b7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c667f314-f1be-44ae-97a7-63e4545069e3",
          "id": "c667f314-f1be-44ae-97a7-63e4545069e3",
          "molfile": "\n  Marvin  01132110152D          \n\n  1  0  0  0  0  0            999 V2000\n    9.8590  -10.3088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "N",
          "formula": "H3N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e1659378-dd7f-443e-9f22-e82d1e071091"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0305",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2edf7c24-cca4-493c-9d7a-9ad4d47e5c76",
          "id": "2edf7c24-cca4-493c-9d7a-9ad4d47e5c76",
          "molfile": "\n  Marvin  01132102312D          \n\n  7  6  0  0  0  0            999 V2000\n   13.6678   -9.7951    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9534  -10.2077    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9534  -11.0326    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2389   -9.7951    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2389  -10.6201    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9534   -9.3826    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6678  -10.6201    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  1  0  0  0  0\nM  END",
          "smiles": "FP(F)(F)(F)(F)F",
          "formula": "F6P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aaa20a8f-f28c-4083-af17-9323ac131599"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "144.9642",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "064343ac-321a-46e0-b8a4-d2174c0a7ba6",
      "version": "7",
      "structure": {
        "id": "c0a6bfb2-d85e-4b7d-b0d7-e15c79ec87f1",
        "molfile": "\n  Marvin  01132109572D          \n\n  8  6  0  0  0  0            999 V2000\n   12.9534  -10.2077    0.0000 P   0  5  0  0  0  0  0  0  0  0  0  0\n   13.6678   -9.7951    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9534  -11.0326    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2389   -9.7951    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2389  -10.6201    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9534   -9.3826    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6678  -10.6201    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8590  -10.3088    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  7  1  0  0  0  0\nM  CHG  2   1  -1   8   1\nM  END",
        "smiles": "F[P-](F)(F)(F)(F)F.[NH4+]",
        "formula": "F6P.H4N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "163.0026",
        "optical_activity": "NONE",
        "references": [
          "e1659a35-ed3d-4d5f-8b79-f5c193326d16",
          "295e1e4b-edd6-4519-a222-ed33c96f8ea8"
        ],
        "stereo_centers": 0
      },
      "unii": "NS308031PJ"
    }
  ]
}