{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d1b600d2-8b78-40d4-8f7b-dc57a772ab49",
          "code": "118-65-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=118-65-0",
          "code_system": "CAS",
          "references": [
            "ff82c41a-a80b-470f-a63b-72670bd921be",
            "bdd3eeda-1913-40d3-a7dd-c076aad3357a"
          ]
        },
        {
          "uuid": "fba6715d-7922-4957-98d5-123844052ad3",
          "code": "C024714",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67024714",
          "code_system": "MESH",
          "references": [
            "ff82c41a-a80b-470f-a63b-72670bd921be"
          ]
        },
        {
          "uuid": "98fd5976-f8b7-4e79-a94b-2489f593f5de",
          "code": "204-267-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.003.880",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ff82c41a-a80b-470f-a63b-72670bd921be"
          ]
        },
        {
          "uuid": "dc688002-059b-4487-a15b-44ea11f2ab45",
          "code": "m3145",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3145?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ff82c41a-a80b-470f-a63b-72670bd921be"
          ]
        },
        {
          "uuid": "11fe58ea-5635-4286-8494-364b54e2d3bd",
          "code": "5281522",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281522",
          "code_system": "PUBCHEM",
          "references": [
            "ff82c41a-a80b-470f-a63b-72670bd921be"
          ]
        },
        {
          "uuid": "e72109b9-705b-464a-94f0-a105e79044fc",
          "code": "NRY8I0KNIR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "03839ee2-1ecc-f264-0f3f-4f06761be4bb",
          "code": "DTXSID10881246",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10881246",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b7f868b4-81b4-456e-a69d-4d3aac9add42",
          "name": ".GAMMA.-CARYOPHYLLENE",
          "stdName": ".GAMMA.-CARYOPHYLLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82eea2c1-c128-4911-9a4d-05f0ea519263",
            "dbe82bd6-671c-4b35-88f4-ea3b9ecef85a"
          ],
          "display_name": false
        },
        {
          "uuid": "2f5675a9-92e3-43dd-890b-ddb86e83d78f",
          "name": "BICYCLO(7.2.0)UNDEC-4-ENE, 4,11,11-TRIMETHYL-8-METHYLENE-, (1R,4Z,9S)-",
          "stdName": "BICYCLO(7.2.0)UNDEC-4-ENE, 4,11,11-TRIMETHYL-8-METHYLENE-, (1R,4Z,9S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82eea2c1-c128-4911-9a4d-05f0ea519263",
            "5d4b1860-f8b9-4a7e-8280-27a99c3fb7e7"
          ],
          "display_name": false
        },
        {
          "uuid": "d6e46c99-1d38-453a-ad94-78e0f89271bb",
          "name": "CARYOPHYLLENE ISOCARYOPHYLLENE",
          "stdName": "CARYOPHYLLENE ISOCARYOPHYLLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "598c6c8a-91bc-456a-8e99-d3167591f1c6",
            "82eea2c1-c128-4911-9a4d-05f0ea519263",
            "2eff94e3-766f-4fdc-93d5-83dda20c66cf"
          ],
          "display_name": false
        },
        {
          "uuid": "16acbcf4-d410-4d6b-b08d-83b8bc62caf4",
          "name": "CARYOPHYLLENE ISOCARYOPHYLLENE [MI]",
          "stdName": "CARYOPHYLLENE ISOCARYOPHYLLENE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82eea2c1-c128-4911-9a4d-05f0ea519263",
            "2eff94e3-766f-4fdc-93d5-83dda20c66cf"
          ],
          "display_name": false
        },
        {
          "uuid": "23ddf898-a659-430b-9bdf-c24f96f40225",
          "name": "CIS-CARYOPHYLLENE",
          "stdName": "CIS-CARYOPHYLLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82eea2c1-c128-4911-9a4d-05f0ea519263",
            "dbe82bd6-671c-4b35-88f4-ea3b9ecef85a"
          ],
          "display_name": false
        },
        {
          "uuid": "12df2321-7d55-474c-8cf4-040ca5badbc6",
          "name": "ISOCARYOPHYLLENE",
          "stdName": "ISOCARYOPHYLLENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82eea2c1-c128-4911-9a4d-05f0ea519263",
            "dbe82bd6-671c-4b35-88f4-ea3b9ecef85a"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "82eea2c1-c128-4911-9a4d-05f0ea519263",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d4b1860-f8b9-4a7e-8280-27a99c3fb7e7",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2eff94e3-766f-4fdc-93d5-83dda20c66cf",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff82c41a-a80b-470f-a63b-72670bd921be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390831000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b0e4d1ef-ad44-49e2-b452-de58714b62a3",
          "citation": "SRS import [NRY8I0KNIR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NRY8I0KNIR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390831000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "598c6c8a-91bc-456a-8e99-d3167591f1c6",
          "citation": "CARYOPHYLLENE ISOCARYOPHYLLENE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dbe82bd6-671c-4b35-88f4-ea3b9ecef85a",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bdd3eeda-1913-40d3-a7dd-c076aad3357a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3b518ab0-ec2e-4d21-b246-6af02c0afe5a",
          "id": "3b518ab0-ec2e-4d21-b246-6af02c0afe5a",
          "molfile": "\n  Marvin  01132103092D          \n\n 15 16  0  0  1  0            999 V2000\n   13.4783  -10.0074    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.6538  -10.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6538   -9.1830    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.4403   -8.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0472   -9.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4783   -9.1830    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.0099   -8.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8240   -8.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5495   -8.8234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1325   -8.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8344   -9.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5450  -10.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8302  -10.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0108  -10.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5985  -11.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n  1 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  3  1  6  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\nM  END",
          "smiles": "C/C/1=C/CCC(=C)[C@H]2C[C@](C)(C)[C@@H]2CC1",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c4c59161-9999-4b81-8230-5b2a998b8b74"
          },
          "defined_stereo": 2,
          "ez_centers": 1,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "40b5e1de-17de-4c1d-af94-9962a6e00a6c",
      "version": "3",
      "structure": {
        "id": "eb7348d9-35d4-47b2-90d8-c5ae3a9f8391",
        "molfile": "\n  Marvin  01132112112D          \n\n 17 18  0  0  1  0            999 V2000\n   15.8418   -9.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5523  -10.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8372  -10.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5568   -8.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8310   -8.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0165   -8.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4846   -9.1873    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.0174  -10.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4846  -10.0121    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.6597   -9.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6597  -10.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4846   -8.3623    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9012  -10.5954    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6049  -11.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1401   -8.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4461   -8.3904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0529   -9.4055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8  3  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  3  1  0  0  0  0\n  1  2  1  0  0  0  0\n  7 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 10  1  0  0  0  0\n  7 12  1  1  0  0  0\n  9 13  1  6  0  0  0\n  8 14  2  0  0  0  0\n  4 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n 10 17  1  0  0  0  0\nM  END",
        "smiles": "C/C/1=C/CCC(=C)[C@@]2([H])CC(C)(C)[C@]2([H])CC1",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 1,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b0e4d1ef-ad44-49e2-b452-de58714b62a3",
          "dbe82bd6-671c-4b35-88f4-ea3b9ecef85a"
        ],
        "stereo_centers": 2
      },
      "unii": "NRY8I0KNIR"
    }
  ]
}