{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8bc7ee36-d5bd-4a3d-8658-2dfe932580c2", "code": "3442-21-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3442-21-5", "code_system": "CAS", "references": [ "33932888-7577-4e21-96d8-13fb4a8ff03d", "83942576-bde3-4f4b-ad32-0762fb3a5a80" ] }, { "uuid": "26699e2e-75f4-48df-bd4c-16e1283fc5c9", "code": "222-351-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.320", "code_system": "ECHA (EC/EINECS)", "references": [ "33932888-7577-4e21-96d8-13fb4a8ff03d" ] }, { "uuid": "40924086-0572-f64b-4611-4add0f308347", "code": "DTXSID30879786", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30879786", "code_system": "EPA CompTox" }, { "uuid": "21c257ee-b9e4-4e28-afd4-48f6997545fc", "code": "NRJ266RH4N", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "85e626ee-fc5f-49aa-875a-97e69583a15e", "amount": { "uuid": "b340080a-8d8d-4da6-83db-6ae9ee6a39e5" }, "type": "PARENT->SALT/SOLVATE", "references": [ "fb7f4519-4342-4ded-93e2-202a393836d9" ], "related_substance": { "uuid": "c9e8c4e3-3f94-44b5-aadf-8afa756b2ae6", "refuuid": "b02194ea-3b53-4002-99ae-6adec9e91af9", "name": "5-[2-[4-[2-(7-Amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl]-1-naphthalenyl]diazenyl]-2-hydroxybenzoic acid", "unii": "EPS78V2ECX", "linking_id": "EPS78V2ECX", "ref_pname": "5-[2-[4-[2-(7-Amino-1-hydroxy-3-sulfo-2-naphthalenyl)diazenyl]-1-naphthalenyl]diazenyl]-2-hydroxybenzoic acid", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "3500e54f-e2ab-4b35-9e6d-20d4d1e4d476", "name": "BENZOIC ACID, 5-(2-(4-(2-(7-AMINO-1-HYDROXY-3-SULFO-2-NAPHTHALENYL)DIAZENYL)-1-NAPHTHALENYL)DIAZENYL)-2-HYDROXY-, SODIUM SALT (1:2)", "stdName": "BENZOIC ACID, 5-(2-(4-(2-(7-AMINO-1-HYDROXY-3-SULFO-2-NAPHTHALENYL)DIAZENYL)-1-NAPHTHALENYL)DIAZENYL)-2-HYDROXY-, SODIUM SALT (1:2)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b002e79b-bd05-420a-89e7-816c1053bf49", "c7932739-101d-43f7-9d63-7f5f6a1f3bd4" ], "display_name": false }, { "uuid": "c73ef769-709c-4b3d-8f75-0f1ea3e19480", "name": "DIRECT BLACK 51, 5-SALICYLATE-", "stdName": "DIRECT BLACK 51, 5-SALICYLATE-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b002e79b-bd05-420a-89e7-816c1053bf49", "c4c64983-4ba0-4e87-aa8c-b981504368f1" ], "display_name": false }, { "uuid": "59ba03ec-de90-4af8-96da-802b55e3aa5b", "name": "DISODIUM 5-((4-((7-AMINO-1-HYDROXY-3-SULPHONATO-2-NAPHTHYL)AZO)-1-NAPHTHYL)AZO)SALICYLATE", "stdName": "DISODIUM 5-((4-((7-AMINO-1-HYDROXY-3-SULPHONATO-2-NAPHTHYL)AZO)-1-NAPHTHYL)AZO)SALICYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b002e79b-bd05-420a-89e7-816c1053bf49", "526cccf0-85ae-4c72-a253-137fd94c5e85", "83942576-bde3-4f4b-ad32-0762fb3a5a80" ], "display_name": true } ], "references": [ { "uuid": "526cccf0-85ae-4c72-a253-137fd94c5e85", "citation": "http://echa.europa.eu", "url": "http://echa.europa.eu", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b002e79b-bd05-420a-89e7-816c1053bf49", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c4c64983-4ba0-4e87-aa8c-b981504368f1", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c7932739-101d-43f7-9d63-7f5f6a1f3bd4", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "33932888-7577-4e21-96d8-13fb4a8ff03d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392818000, "tags": [ "NOMEN" ] }, { "uuid": "fb7f4519-4342-4ded-93e2-202a393836d9", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "83942576-bde3-4f4b-ad32-0762fb3a5a80", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e54dbe3a-f50f-4acc-b051-2b5ab2946cac", "id": "e54dbe3a-f50f-4acc-b051-2b5ab2946cac", "molfile": "\n Marvin 01132111522D \n\n 1 0 0 0 0 0 999 V2000\n 12.5956 -12.4878 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "32ce3681-d83d-4a2c-88f3-b930d2da35ff" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "9e9d3fe5-6f4f-483e-abb6-06e87706a037", "id": "9e9d3fe5-6f4f-483e-abb6-06e87706a037", "molfile": "\n Marvin 01132108142D \n\n 40 44 0 0 0 0 999 V2000\n 5.6030 -7.3277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -7.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1740 -7.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -7.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -8.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7451 -8.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7451 -9.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -10.2153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -11.0403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -11.4529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -12.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -13.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -13.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -14.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -15.1655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -15.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -16.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -17.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -17.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -18.4656 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.7451 -17.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7451 -16.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0306 -17.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0306 -18.4656 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.3161 -17.2281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -13.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6030 -13.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3175 -13.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3175 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6030 -12.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1740 -9.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -10.2153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1740 -8.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -8.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0306 -10.2153 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4430 -10.9298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6180 -9.5008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3161 -10.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 36 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 35 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 37 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 33 2 0 0 0 0\n 10 9 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 32 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 27 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 23 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 2 0 0 0 0\n 23 22 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 32 27 1 0 0 0 0\n 28 29 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 2 0 0 0 0\n 37 40 2 0 0 0 0\nM CHG 2 21 -1 25 -1\nM END", "smiles": "c1ccc2c(c1)c(ccc2/N=N/c3c(cc4ccc(cc4c3O)N)S(=O)(=O)O)/N=N/c5ccc(c(c5)C(=O)[O-])[O-]", "formula": "C27H17N5O7S", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "11f651b3-37be-4a17-b2b2-a3b64e4f32c0" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "555.5203", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f33aace1-5a9d-43f3-9aa0-b7447506e4b7", "version": "9", "structure": { "id": "53bb5426-5bbe-49bc-b103-28e58e34739d", "molfile": "\n Marvin 01132104212D \n\n 42 44 0 0 0 0 999 V2000\n 12.5956 -12.4878 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 4.1741 -11.4529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -12.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -13.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -13.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -14.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -15.1655 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -15.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -16.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1741 -17.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -17.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -18.4656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7451 -17.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0306 -17.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0306 -18.4656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3161 -17.2281 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.7451 -16.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -13.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6030 -13.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3175 -13.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3175 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6030 -12.2779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -12.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -11.0403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -10.2153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1740 -9.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -10.2153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1740 -8.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -8.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8885 -7.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6030 -7.3277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1740 -7.3278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -7.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4596 -8.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7451 -8.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7451 -9.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0306 -10.2153 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4430 -10.9298 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1.6180 -9.5008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3161 -10.6279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5956 -12.4878 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 18 14 1 0 0 0 0\n 9 18 2 0 0 0 0\n 19 6 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 24 19 1 0 0 0 0\n 3 24 1 0 0 0 0\n 2 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 29 35 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 2 0 0 0 0\n 26 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 2 0 0 0 0\n 38 41 2 0 0 0 0\nM CHG 4 1 1 17 -1 39 -1 42 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 1 42\nM SPA 1 1 1\nM SDI 1 4 12.1756 -12.9078 12.1756 -12.0678\nM SDI 1 4 13.0156 -12.0678 13.0156 -12.9078\nM SMT 1 2\nM END", "smiles": "c1ccc2c(c1)c(ccc2/N=N/c3c(cc4ccc(cc4c3O)N)S(=O)(=O)[O-])/N=N/c5ccc(c(c5)C(=O)[O-])O.[Na+].[Na+]", "formula": "C27H17N5O7S.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "601.4998", "optical_activity": "NONE", "references": [ "c7932739-101d-43f7-9d63-7f5f6a1f3bd4", "83942576-bde3-4f4b-ad32-0762fb3a5a80" ], "stereo_centers": 0 }, "unii": "NRJ266RH4N" } ] }