{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ff459fe4-ff78-4e8d-9c39-7cf5af03712c", "code": "C007852", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67007852", "code_system": "MESH", "references": [ "b79569da-176b-4649-8aa5-06454df9825a" ] }, { "uuid": "35ebf420-1df4-42f8-9be9-0c8509726b1c", "code": "74347-32-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=74347-32-3", "code_system": "CAS", "references": [ "b79569da-176b-4649-8aa5-06454df9825a", "039739bb-cc20-45a0-9d99-0b0d63ab5427" ] }, { "uuid": "6cba3310-6814-4219-8358-328f7ec5dfce", "code": "m5761", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5761?q=authorize", "code_system": "MERCK INDEX", "references": [ "b79569da-176b-4649-8aa5-06454df9825a" ] }, { "uuid": "b98897b2-1ee9-41ed-8e3c-2327351d2954", "code": "SUB03023MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "b79569da-176b-4649-8aa5-06454df9825a" ] }, { "uuid": "74451afb-bb95-4d00-8476-bfae89108d67", "code": "277-833-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.736", "code_system": "ECHA (EC/EINECS)", "references": [ "b79569da-176b-4649-8aa5-06454df9825a" ] }, { "uuid": "181a18ce-b70b-403d-95a6-68aea8ff6de7", "code": "76958129", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76958129", "code_system": "PUBCHEM", "references": [ "b79569da-176b-4649-8aa5-06454df9825a" ] }, { "uuid": "92bf9029-f5da-4a04-bacb-8694c5400af9", "code": "NR47LC4280", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "67ae666a-4d96-aa7d-e9fc-57a322e4fed6", "code": "100000086177", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "d3887dd6-b8f1-e101-ea5c-4f7ad9d6f541" ] }, { "uuid": "c4e30e76-e292-cb61-4890-4eda94ebbe88", "code": "DTXSID60225353", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60225353", "code_system": "EPA CompTox", "references": [ "c7a0b4fd-133d-0bd2-7257-7468fcf6ca3a" ] } ], "relationships": [ { "uuid": "6b92f68c-1d3f-46de-8f9f-f5b58b8ed590", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "11384408-ab60-4165-86ed-35a13c5ee1a2", "refuuid": "dd7d8b09-3b98-435a-a944-79908cc4fd86", "name": "GLUCOHEPTONIC ACID", "unii": "B1F50160Z2", "linking_id": "B1F50160Z2", "ref_pname": "GLUCOHEPTONIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "5ef05951-27c6-433b-a50f-2afc51822733", "name": "ALPHA-GLUCOHEPTONIC ACID, MAGNESIUM SALT (2:1)", "stdName": "ALPHA-GLUCOHEPTONIC ACID, MAGNESIUM SALT (2:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "85b31fbc-cbdc-43ad-a5d4-8e548850ef92", "999a5f51-e88c-43b1-a84d-afc768b6a38b" ], "display_name": false }, { "uuid": "79e0e962-7df7-4fbf-9f6c-2cf841fc4d32", "name": "GLUCOHEPTONIC ACID MAGNESIUM SALT [MI]", "stdName": "GLUCOHEPTONIC ACID MAGNESIUM SALT [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "550f94cb-e5c6-4f02-92c9-38027a591014", "999a5f51-e88c-43b1-a84d-afc768b6a38b" ], "display_name": false }, { "uuid": "8e53adf1-de7f-414f-b43a-adafea148592", "name": "GLUCOHEPTONIC ACID, MAGNESIUM SALT", "stdName": "GLUCOHEPTONIC ACID, MAGNESIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "704c7e06-15b4-4f96-9c63-8ac38e90420e", "999a5f51-e88c-43b1-a84d-afc768b6a38b" ], "display_name": false }, { "uuid": "f6f71f15-702d-41b0-995c-c7a9e454b650", "name": "MAGNESIUM GLUCEPTATE", "stdName": "MAGNESIUM GLUCEPTATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "147bbc5f-dcbd-4e7d-9b3b-24cf837701d2", "d17a3938-2e9c-4d80-bcaf-2938c109dbae", "91967786-16f2-4647-964f-ff0d3f98f8ac", "6cd19736-a12f-4734-9ee8-b7835a292205", "709e5f08-f0b4-49b6-9959-85f68f4a9406", "4ca77c6f-91c3-4f4b-9ffb-1f97cf69c720", "999a5f51-e88c-43b1-a84d-afc768b6a38b" ], "display_name": true }, { "uuid": "3449e2c1-52a1-4164-8492-bb0ebd602332", "name": "MAGNESIUM GLUCEPTATE [MART.]", "stdName": "MAGNESIUM GLUCEPTATE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d17a3938-2e9c-4d80-bcaf-2938c109dbae" ], "display_name": false }, { "uuid": "68f09b06-f9bc-404e-8e1e-e7b2fde07072", "name": "MAGNESIUM GLUCOSEMONOCARBONATE", "stdName": "MAGNESIUM GLUCOSEMONOCARBONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "704c7e06-15b4-4f96-9c63-8ac38e90420e", "999a5f51-e88c-43b1-a84d-afc768b6a38b" ], "display_name": false }, { "uuid": "e01d5fd6-36ae-bb37-c121-26ca1257eea2", "name": "Magnesium gluceptate [WHO-DD]", "stdName": "MAGNESIUM GLUCEPTATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3d27ae6b-ca4a-fd58-c2b1-af77a537bc1a" ], "display_name": false } ], "references": [ { "uuid": "709e5f08-f0b4-49b6-9959-85f68f4a9406", "citation": "MARTINDALE", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "147bbc5f-dcbd-4e7d-9b3b-24cf837701d2", "citation": "DL", "doc_type": "MARTINDALE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "704c7e06-15b4-4f96-9c63-8ac38e90420e", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "999a5f51-e88c-43b1-a84d-afc768b6a38b", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d17a3938-2e9c-4d80-bcaf-2938c109dbae", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "85b31fbc-cbdc-43ad-a5d4-8e548850ef92", "citation": "RXNORM", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4ca77c6f-91c3-4f4b-9ffb-1f97cf69c720", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "550f94cb-e5c6-4f02-92c9-38027a591014", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b79569da-176b-4649-8aa5-06454df9825a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390470000, "tags": [ "NOMEN" ] }, { "uuid": "8991f99b-4d7d-4ad5-a49e-254a0b5164f8", "citation": "SRS import [NR47LC4280]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NR47LC4280", "doc_type": "SRS", "public_domain": true, "document_date": 1493390470000, "tags": [ "NOMEN" ] }, { "uuid": "91967786-16f2-4647-964f-ff0d3f98f8ac", "citation": "MAGNESIUM GLUCEPTATE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6cd19736-a12f-4734-9ee8-b7835a292205", "citation": "MAGNESIUM GLUCEPTATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "12ce751e-5115-594c-e2c8-2df47474abe2", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=74347-32-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "039739bb-cc20-45a0-9d99-0b0d63ab5427", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "3d27ae6b-ca4a-fd58-c2b1-af77a537bc1a", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "c7a0b4fd-133d-0bd2-7257-7468fcf6ca3a", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "d3887dd6-b8f1-e101-ea5c-4f7ad9d6f541", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f98f3322-0e78-46c7-8dcc-5f95c0f4c427", "id": "f98f3322-0e78-46c7-8dcc-5f95c0f4c427", "molfile": "\n Marvin 01132112562D \n\n 1 0 0 0 1 0 999 V2000\n 7.0465 -1.0312 0.0000 Mg 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Mg+2]", "formula": "Mg", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "10f77529-f92f-4796-901f-5be55a5ee3f2" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "24.3051", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "5ec57ad2-a83d-4708-84b0-cf1c20f8b9e8", "id": "5ec57ad2-a83d-4708-84b0-cf1c20f8b9e8", "molfile": "\n Marvin 01132104542D \n\n 15 14 0 0 1 0 999 V2000\n 0.1252 -1.8461 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 0.1160 -2.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5898 -1.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3001 -1.8507 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.8401 -1.4337 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 0.8310 -0.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5505 -1.8370 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1.5413 -2.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2654 -1.4245 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.2563 -0.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9804 -1.8370 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.9712 -2.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6908 -1.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6817 -0.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4058 -1.8324 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 5 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 2 0 0 0 0\nM CHG 1 4 -1\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)O)O)O)O)O)O)[O-]", "formula": "C7H13O8", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "905dce1d-a09e-4c5e-a729-49d30f79be0e" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "225.1736", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "3c566f42-41ae-44c2-b7fe-412059971b0c", "version": "9", "structure": { "id": "7f41d6be-2e3d-45a1-88ec-a24324fc245d", "molfile": "\n Marvin 01132106372D \n\n 31 28 0 0 1 0 999 V2000\n 7.0465 -1.0312 0.0000 Mg 0 2 0 0 0 0 0 0 0 0 0 0\n -0.5898 -1.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1252 -1.8461 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.1160 -2.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8401 -1.4337 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.8310 -0.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5505 -1.8370 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.5413 -2.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2654 -1.4245 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.2563 -0.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9804 -1.8370 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.9712 -2.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6908 -1.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6817 -0.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4058 -1.8324 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -1.3001 -1.8507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5898 -1.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1252 -1.8461 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.1160 -2.6711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8401 -1.4337 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.8310 -0.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5505 -1.8370 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.5413 -2.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2654 -1.4245 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.2563 -0.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9804 -1.8370 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.9712 -2.6665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6908 -1.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6817 -0.5996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4058 -1.8324 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n -1.3001 -1.8507 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 6 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 6 0 0 0\n 13 11 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 13 1 0 0 0 0\n 16 2 1 0 0 0 0\n 17 18 1 0 0 0 0\n 31 17 1 0 0 0 0\n 18 19 1 6 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 1 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 1 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 1 0 0 0\n 26 24 1 0 0 0 0\n 26 27 1 6 0 0 0\n 28 26 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 28 1 0 0 0 0\nM CHG 3 1 2 15 -1 30 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 15 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31\nM SPA 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SDI 1 4 -1.7201 -3.0911 -1.7201 -0.1796\nM SDI 1 4 4.8258 -0.1796 4.8258 -3.0911\nM SMT 1 2\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.[Mg+2]", "formula": "2C7H13O8.Mg", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "474.6523", "optical_activity": "UNSPECIFIED", "references": [ "709e5f08-f0b4-49b6-9959-85f68f4a9406", "8991f99b-4d7d-4ad5-a49e-254a0b5164f8" ], "stereo_centers": 10 }, "unii": "NR47LC4280" } ] }