{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "69985c27-227f-45df-9efc-e721851690a1",
          "code": "27311-52-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27311-52-0",
          "code_system": "CAS",
          "references": [
            "a09651db-2613-4461-bb69-4ddc07992fda",
            "5d11b2f6-0740-441f-87fd-f6e1f5e84ff2"
          ]
        },
        {
          "uuid": "ba2defd8-1053-41c3-b3c5-776a088963a6",
          "code": "21889084",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21889084",
          "code_system": "PUBCHEM",
          "references": [
            "a09651db-2613-4461-bb69-4ddc07992fda"
          ]
        },
        {
          "uuid": "64aad678-d72f-a589-3798-de76fae61df4",
          "code": "DTXSID10181758",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10181758",
          "code_system": "EPA CompTox",
          "references": [
            "bd9adb09-616f-7b65-04c6-9c1c1c74b24a"
          ]
        },
        {
          "uuid": "f07aa6da-822b-4d68-b839-4a2271fc06b9",
          "code": "NOJ4K5V5UH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "bd675e15-e328-4be8-9afd-c4566f238624",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "4628fb74-61f6-4f60-bfae-4849884f847f",
            "refuuid": "446bd240-153c-4f06-9c4e-8077274125d7",
            "name": "2,2'-METHYLENEBIS(4-AMINOPHENOL)",
            "unii": "433B39S481",
            "linking_id": "433B39S481",
            "ref_pname": "2,2'-METHYLENEBIS(4-AMINOPHENOL)",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "44add78c-2946-479d-ac42-d4f500ab7084",
          "name": "2,2'-METHYLENEBIS(4-AMINOPHENOL) DIHYDROCHLORIDE",
          "stdName": "2,2'-METHYLENEBIS(4-AMINOPHENOL) DIHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5fcb4f8-1681-4123-8bc0-26535f5c82a7",
            "e1a9cb96-9753-48f3-95ab-52ae61ed757d"
          ],
          "display_name": true
        },
        {
          "uuid": "0644512e-6cfb-47d9-ab4e-6bce88a49a41",
          "name": "2,2'-METHYLENEBIS-4-AMINOPHENOL HCL",
          "stdName": "2,2'-METHYLENEBIS-4-AMINOPHENOL HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "b5fcb4f8-1681-4123-8bc0-26535f5c82a7",
            "e1a9cb96-9753-48f3-95ab-52ae61ed757d",
            "f8a49583-9a3e-4743-9488-3d6d5568b8ef"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "56c987bb-b26e-4e5f-9a83-deb79cbf5fe3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "29a20912-90e6-4c16-ba17-dd50bb31583f",
          "name": "PHENOL, 2,2'-METHYLENEBIS(4-AMINO, DIHYDROCHLORIDE",
          "stdName": "PHENOL, 2,2'-METHYLENEBIS(4-AMINO, DIHYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5fcb4f8-1681-4123-8bc0-26535f5c82a7",
            "e1a9cb96-9753-48f3-95ab-52ae61ed757d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b5fcb4f8-1681-4123-8bc0-26535f5c82a7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e1a9cb96-9753-48f3-95ab-52ae61ed757d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a09651db-2613-4461-bb69-4ddc07992fda",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd400e16-b88c-4135-a2f0-80a7ef9dfe0f",
          "citation": "SRS import [NOJ4K5V5UH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NOJ4K5V5UH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391401000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8a49583-9a3e-4743-9488-3d6d5568b8ef",
          "citation": "2,2'-METHYLENEBIS-4-AMINOPHENOL HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd9adb09-616f-7b65-04c6-9c1c1c74b24a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27311-52-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d11b2f6-0740-441f-87fd-f6e1f5e84ff2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8722948e-17b2-4fa7-bff5-0dc6b0e877ba",
          "id": "8722948e-17b2-4fa7-bff5-0dc6b0e877ba",
          "molfile": "\n  Marvin  01132107012D          \n\n  1  0  0  0  0  0            999 V2000\n   10.8481   -5.3236    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "28e6d797-e247-41a2-addb-410cc9c24751"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0e31a186-06c2-4588-a1ee-1dd6c5e7811a",
          "id": "0e31a186-06c2-4588-a1ee-1dd6c5e7811a",
          "molfile": "\n  Marvin  01132100582D          \n\n 17 18  0  0  0  0            999 V2000\n    4.0723   -6.6695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7849   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7849   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5022   -5.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2149   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9320   -5.0193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2149   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9320   -6.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6402   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6402   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -5.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -4.1942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0700   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0700   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -6.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -7.4946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5022   -6.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 17  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 17  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 15  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc(c(Cc2cc(ccc2O)N)cc1N)O",
          "formula": "C13H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f531aae9-d207-47da-b562-d022d3e87a9a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "230.263",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4a8c4f52-4247-413f-a2a3-db5898b9d545",
      "version": "4",
      "structure": {
        "id": "e6de18fa-88f8-4c16-a649-29049d31e31b",
        "molfile": "\n  Marvin  01132111572D          \n\n 19 18  0  0  0  0            999 V2000\n    6.9320   -6.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2149   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2149   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5022   -5.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7849   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7849   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5022   -6.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0723   -6.6695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9320   -5.0193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6402   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -6.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0700   -6.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0700   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -5.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6402   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -4.1942    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3575   -7.4946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8494   -5.3242    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.8494   -5.3242    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  2  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 10 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n  1  2  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  18  19\nM  SPA   1  1  18\nM  SDI   1  4   10.4294   -5.7442   10.4294   -4.9042\nM  SDI   1  4   11.2694   -4.9042   11.2694   -5.7442\nM  SMT   1 2\nM  END",
        "smiles": "c1cc(c(Cc2cc(ccc2O)N)cc1N)O.Cl.Cl",
        "formula": "C13H14N2O2.2ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "303.1847",
        "optical_activity": "NONE",
        "references": [
          "b5fcb4f8-1681-4123-8bc0-26535f5c82a7",
          "cd400e16-b88c-4135-a2f0-80a7ef9dfe0f"
        ],
        "stereo_centers": 0
      },
      "unii": "NOJ4K5V5UH"
    }
  ]
}