{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "41887856-dbd9-4818-8a8b-eb831c325694", "code": "NN2JCD2W5N", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "37448fdd-633a-4f07-99c5-833a621ff28e", "code": "17464-88-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=17464-88-9", "code_system": "CAS", "references": [ "341f8194-393d-4379-95b3-7f60c58caecc", "5cdfc942-f9ce-4a44-8838-a48484b4c0c4" ] }, { "uuid": "4235c6f1-c515-49b5-9bcf-3b2672751f8c", "code": "241-480-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.694", "code_system": "ECHA (EC/EINECS)", "references": [ "341f8194-393d-4379-95b3-7f60c58caecc" ] }, { "uuid": "d0148a95-6b1e-4363-be1f-77d2033749ac", "code": "87125", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87125", "code_system": "PUBCHEM", "references": [ "341f8194-393d-4379-95b3-7f60c58caecc" ] }, { "uuid": "a8339adc-ec4d-44a9-4b8b-160d65253d4d", "code": "DTXSID4066202", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4066202", "code_system": "EPA CompTox", "references": [ "b9c9f026-c25a-dcad-32ad-e1c7d753e870" ] } ], "substance_class": "chemical", "names": [ { "uuid": "33271e74-46e3-47b2-9b46-afc12fc3a7a3", "name": "Imidazo[4,5-d]imidazole-2,5(1H,3H)-dione, tetrahydro-1,3,4,6-tetrakis(methoxymethyl)-", "stdName": "IMIDAZO(4,5-D)IMIDAZOLE-2,5(1H,3H)-DIONE, TETRAHYDRO-1,3,4,6-TETRAKIS(METHOXYMETHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fc75d34a-1458-42c3-8309-e447d1c7430a", "a371e91a-844d-44eb-9610-31ce21608184" ], "display_name": false }, { "uuid": "52f6a5ea-7997-4c06-80de-3fd8afaeae95", "name": "MX 270", "stdName": "MX 270", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5cdfc942-f9ce-4a44-8838-a48484b4c0c4" ], "display_name": false }, { "uuid": "44c4d69e-01f5-4390-ab28-edbfa7cfc392", "name": "TMMG", "stdName": "TMMG", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bf5f0713-27a8-4126-ae38-3a5cebc08df5" ], "display_name": false }, { "uuid": "499a4b50-ddb3-416e-958f-6577bc019722", "name": "Tetrahydro-1,3,4,6-tetrakis(methoxymethyl)imidazo[4,5-d]imidazole-2,5(1H,3H)-dione", "stdName": "TETRAHYDRO-1,3,4,6-TETRAKIS(METHOXYMETHYL)IMIDAZO(4,5-D)IMIDAZOLE-2,5(1H,3H)-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5cdfc942-f9ce-4a44-8838-a48484b4c0c4" ], "display_name": false }, { "uuid": "d5afd3a4-ed85-43ba-a15d-202c7233a276", "name": "Tetrakis(methoxymethyl)glycoluril", "stdName": "TETRAKIS(METHOXYMETHYL)GLYCOLURIL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5cdfc942-f9ce-4a44-8838-a48484b4c0c4" ], "display_name": true } ], "references": [ { "uuid": "fc75d34a-1458-42c3-8309-e447d1c7430a", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a371e91a-844d-44eb-9610-31ce21608184", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "341f8194-393d-4379-95b3-7f60c58caecc", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394004000, "tags": [ "NOMEN" ] }, { "uuid": "b9c9f026-c25a-dcad-32ad-e1c7d753e870", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=17464-88-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5cdfc942-f9ce-4a44-8838-a48484b4c0c4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bf5f0713-27a8-4126-ae38-3a5cebc08df5", "citation": "https://patents.google.com/patent/WO2002034217A1", "url": "https://patents.google.com/patent/WO2002034217A1", "doc_type": "PATENT", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "20907e8c-3e51-41b0-979b-537c86e08f75", "id": "20907e8c-3e51-41b0-979b-537c86e08f75", "molfile": "\n Marvin 01132101512D \n\n 22 23 0 0 0 0 999 V2000\n 2.1628 -2.6885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9472 -2.9333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5559 -2.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3448 -2.6161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6109 -3.3948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4338 -3.3936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6861 -2.5995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4682 -2.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0042 -2.7603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6759 -2.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0139 -2.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0062 -1.2936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7000 -4.1722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4888 -4.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0976 -3.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8820 -4.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0309 -4.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0385 -5.4948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3586 -4.1889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5750 -4.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0095 -4.0781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2881 -4.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 11 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 19 1 0 0 0 0\n 6 7 1 0 0 0 0\n 13 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 11 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 17 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "COCN1C2C(N(COC)C1=O)N(COC)C(=O)N2COC", "formula": "C12H22N4O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3b5add5b-d50a-412d-9c2b-77bbcf3928f1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "318.3268", "optical_activity": "NONE", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "7829f2db-c5f1-4317-908e-9020aec319f5", "version": "6", "structure": { "id": "d68acdb5-311e-4667-a60f-01ea75ae7f7a", "molfile": "\n JSDraw202212506502D\n\n 22 23 0 0 0 0 0 V2000\n 21.1867 -3.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6706 -4.6320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1969 -4.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6808 -6.4376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1680 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6808 -8.9544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1969 -10.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6706 -10.7600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1867 -12.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7656 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2056 -7.6960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6552 -8.9544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1391 -10.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6654 -10.7600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1493 -12.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5704 -7.6960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1304 -7.6960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6552 -6.4376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1391 -4.9545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6654 -4.6320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.1493 -3.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 7 11 1 0 0 0 0\n 4 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 6 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 13 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 5 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "COCN1C2C(N(COC)C1=O)N(COC)C(=O)N2COC", "formula": "C12H22N4O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "318.3268", "optical_activity": "NONE", "references": [ "fc75d34a-1458-42c3-8309-e447d1c7430a", "5cdfc942-f9ce-4a44-8838-a48484b4c0c4" ], "stereo_centers": 2 }, "modifications": { "uuid": "611eada0-2186-4975-a367-b956c608099e" }, "unii": "NN2JCD2W5N" } ] }