{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "32e0daa2-4df3-4d1c-a9e4-f10620ab0eba",
          "code": "22194-39-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22194-39-4",
          "code_system": "CAS",
          "references": [
            "0383d37a-a9da-4236-b644-d54aba7fd47a",
            "308c2cf4-a34b-4133-99ae-6ec8d69ebf9c"
          ]
        },
        {
          "uuid": "39d54453-1f77-4625-85c7-a9688728c2a8",
          "code": "30987",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/30987",
          "code_system": "PUBCHEM",
          "references": [
            "0383d37a-a9da-4236-b644-d54aba7fd47a"
          ]
        },
        {
          "uuid": "48d9fdb2-5c6c-5736-6e87-8198f39114a6",
          "code": "DTXSID20176731",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20176731",
          "code_system": "EPA CompTox",
          "references": [
            "cc821d2c-c766-4f6c-cefa-a4c4d73e7e77"
          ]
        },
        {
          "uuid": "612f4b7d-726e-4bfd-b818-c02a73653b96",
          "code": "NK259942HJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "1a18b80c-12af-4364-8616-5f90612f5d72",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "74aec2b9-8f73-4718-88f3-0fe305fa3f28",
            "refuuid": "a05ec20c-8fe2-4e02-ba7f-df69e5e30248",
            "name": "ASPIRIN",
            "unii": "R16CO5Y76E",
            "linking_id": "R16CO5Y76E",
            "ref_pname": "ASPIRIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5bf26832-88b9-4796-9df1-780203035b8c",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "597ec53a-53e6-4e27-a530-9104bf58036c",
            "refuuid": "a05ec20c-8fe2-4e02-ba7f-df69e5e30248",
            "name": "ASPIRIN",
            "unii": "R16CO5Y76E",
            "linking_id": "R16CO5Y76E",
            "ref_pname": "ASPIRIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7ba3d679-7d04-4e18-ab0e-09d5f86257e3",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a4b3143f-5e3a-44d4-8830-f1cbffa37979",
            "refuuid": "bb33ce2a-adb7-4088-ad4a-1e259b21b5f0",
            "name": "Glycine",
            "unii": "TE7660XO1C",
            "linking_id": "TE7660XO1C",
            "ref_pname": "Glycine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5ccd5979-fa5c-4e20-beb5-8cd0929d2d7c",
          "name": "ASPIRIN GLYCINE CALCIUM",
          "stdName": "ASPIRIN GLYCINE CALCIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fc9880d-4ff7-4f81-ad05-880cb90a0c05"
          ],
          "display_name": true
        },
        {
          "uuid": "72c3232b-c78b-41aa-b3fa-a0e38ef3a64d",
          "name": "CALCIUM ACETYLSALICYLATE-GLYCINE DOUBLE SALT",
          "stdName": "CALCIUM ACETYLSALICYLATE-GLYCINE DOUBLE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46777fa3-cab6-41ca-8d0f-4b48cf68244d"
          ],
          "display_name": false
        },
        {
          "uuid": "6847666f-00fa-40b3-beb5-d23d9c255971",
          "name": "CALCIUM, (GLYCINATO)(SALICYLATO)-, ACETATE (ESTER)",
          "stdName": "CALCIUM, (GLYCINATO)(SALICYLATO)-, ACETATE (ESTER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46777fa3-cab6-41ca-8d0f-4b48cf68244d"
          ],
          "display_name": false
        },
        {
          "uuid": "57c0395d-31e0-4291-9e88-17a270aab797",
          "name": "GLYCINE-CALCIUM ACETYLSALICYLATE DOUBLE SALT",
          "stdName": "GLYCINE-CALCIUM ACETYLSALICYLATE DOUBLE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46777fa3-cab6-41ca-8d0f-4b48cf68244d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2fc9880d-4ff7-4f81-ad05-880cb90a0c05",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "46777fa3-cab6-41ca-8d0f-4b48cf68244d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0383d37a-a9da-4236-b644-d54aba7fd47a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389751000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8713f705-be97-4b34-b025-19deffb99f9f",
          "citation": "SRS import [NK259942HJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NK259942HJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389751000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc821d2c-c766-4f6c-cefa-a4c4d73e7e77",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22194-39-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "308c2cf4-a34b-4133-99ae-6ec8d69ebf9c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6b673bd6-6f85-432d-b8d1-193eae6dcfcc",
          "id": "6b673bd6-6f85-432d-b8d1-193eae6dcfcc",
          "molfile": "\n  Marvin  01132105352D          \n\n  1  0  0  0  0  0            999 V2000\n    4.4862    0.0000    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e234db0b-e4e6-4bf0-8769-010e39000b24"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ea0927ed-d95d-48f7-992f-f4fdd4ab8e51",
          "id": "ea0927ed-d95d-48f7-992f-f4fdd4ab8e51",
          "molfile": "\n  Marvin  01132112062D          \n\n  5  4  0  0  0  0            999 V2000\n    6.7021   -1.6197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0065   -1.2193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2852   -1.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2852   -2.4437    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5922   -1.2193    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C(C(=O)[O-])N",
          "formula": "C2H4NO2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7cbbe4d3-1ba7-4816-a125-4deb9955e528"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "74.0587",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "e734f726-5dcc-4e80-95b0-a954500b931f",
          "id": "e734f726-5dcc-4e80-95b0-a954500b931f",
          "molfile": "\n  Marvin  01132111582D          \n\n 13 13  0  0  0  0            999 V2000\n    0.4263   -2.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6163   -1.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.0118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3970   -1.3045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9902   -1.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8284   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4267   -3.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2048   -2.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3923   -2.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7760   -1.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9506   -0.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3266   -0.2465    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7286   -0.5419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  CHG  1  12  -1\nM  END",
          "smiles": "CC(=O)Oc1ccccc1C(=O)[O-]",
          "formula": "C9H7O4",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e661c1ff-c555-479c-b303-f405d09c7da8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "179.1498",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ddd4b3a1-709d-4052-9710-6d805767d4bf",
      "version": "4",
      "structure": {
        "id": "674fde28-88af-42bc-9139-1490eac0bc51",
        "molfile": "\n  Marvin  01132105232D          \n\n 19 17  0  0  0  0            999 V2000\n    2.7760   -1.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9506   -0.7884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9902   -1.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3970   -1.3045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6163   -1.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3266   -0.2465    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.7286   -0.5419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.0118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3923   -2.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8284   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4263   -2.3651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2048   -2.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4267   -3.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2874   -1.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2874   -2.4447    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5941   -1.2198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7049   -1.6204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0090   -1.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4862    0.0000    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n 11  5  1  0  0  0  0\n 12  9  2  0  0  0  0\n 13 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  5  2  0  0  0  0\n  9  1  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 14  1  0  0  0  0\n 10  3  1  0  0  0  0\nM  CHG  3   6  -1  15  -1  19   2\nM  END",
        "smiles": "CC(=O)Oc1ccccc1C(=O)[O-].C(C(=O)[O-])N.[Ca+2]",
        "formula": "C9H7O4.C2H4NO2.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "293.2866",
        "optical_activity": "NONE",
        "references": [
          "8713f705-be97-4b34-b025-19deffb99f9f",
          "46777fa3-cab6-41ca-8d0f-4b48cf68244d"
        ],
        "stereo_centers": 0
      },
      "unii": "NK259942HJ"
    }
  ]
}