{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cac4fba6-182f-4b8a-9e70-91b33f9f9abd",
          "code": "1132776-59-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1132776-59-0",
          "code_system": "CAS",
          "references": [
            "0bf0434e-14c6-41c2-abfe-ee2775c37bc2",
            "2d1324d2-7ecc-4982-b5ef-f4997f2e7212"
          ]
        },
        {
          "uuid": "21d56c04-1957-4bd5-9be9-8d7436acdc88",
          "code": "72941984",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72941984",
          "code_system": "PUBCHEM",
          "references": [
            "0bf0434e-14c6-41c2-abfe-ee2775c37bc2"
          ]
        },
        {
          "uuid": "dad1a372-ddf8-8623-bb3a-756d95e9bbc4",
          "code": "2268052",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2268052/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c530ebfe-c60c-55ef-0d5f-41eafced286e"
          ]
        },
        {
          "uuid": "62a57187-69a5-44bd-82bd-d7fd0dcf1220",
          "code": "NJ3O2X7MF4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "72ed6a21-101d-e89a-8341-168dfb832468",
          "code": "100000176064",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e6a41653-aab0-0d2a-1e63-dc2894fb538e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8ca0afc6-eabd-45a0-b854-716bb6a9c1a5",
          "name": "3-O-LACTOSYL-L-ASORBIC ACID",
          "stdName": "3-O-LACTOSYL-L-ASORBIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66d3071a-47f6-4b7b-9292-6d21c889a17b",
            "d46815ed-8834-48b4-b52b-f1a29f16dd68"
          ],
          "display_name": false
        },
        {
          "uuid": "55903380-d3ea-4a2e-89e8-a001d56250e5",
          "name": "ASCORBYL LACTOSIDE",
          "stdName": "ASCORBYL LACTOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cfdac600-f816-4ff2-9377-56ab25d69fda",
            "6bf3e15e-4f22-4b62-8b34-1026f944a958",
            "48b9b963-584d-49c9-9fde-adc913882372",
            "66d3071a-47f6-4b7b-9292-6d21c889a17b",
            "e7ac5cec-1bbb-4f57-93e2-84bc59969d2d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fd976fac-d882-48a6-b8bc-c26660414add",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1e75da92-c303-ce96-79ca-24b629b8dfca",
          "name": "Ascorbyl lactoside [WHO-DD]",
          "stdName": "ASCORBYL LACTOSIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81f29001-3029-db46-bbbc-130e4e5acbee"
          ],
          "display_name": false
        },
        {
          "uuid": "dd29b81e-4589-41f2-8a7c-bb53d446871a",
          "name": "EVERWHITE VCL",
          "stdName": "EVERWHITE VCL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bf3e15e-4f22-4b62-8b34-1026f944a958",
            "66d3071a-47f6-4b7b-9292-6d21c889a17b"
          ],
          "display_name": false
        },
        {
          "uuid": "61c31c4c-b7e5-4c16-850b-6ac71d55a0bf",
          "name": "L-ASCORBIC ACID, O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-O-D-GLUCOPYRANOSYL-(1->3)-",
          "stdName": "L-ASCORBIC ACID, O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-O-D-GLUCOPYRANOSYL-(1->3)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be72c7f9-66e2-4605-9978-ee94421bdcbf",
            "66d3071a-47f6-4b7b-9292-6d21c889a17b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6bf3e15e-4f22-4b62-8b34-1026f944a958",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "66d3071a-47f6-4b7b-9292-6d21c889a17b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d46815ed-8834-48b4-b52b-f1a29f16dd68",
          "citation": "http://verayue.en.ec21.com/Ascorbyl_Lactoside--4430190_4436001.html",
          "url": "http://verayue.en.ec21.com/Ascorbyl_Lactoside--4430190_4436001.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfdac600-f816-4ff2-9377-56ab25d69fda",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be72c7f9-66e2-4605-9978-ee94421bdcbf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bf0434e-14c6-41c2-abfe-ee2775c37bc2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391943000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42009512-e368-48c2-8f51-ede6c43af697",
          "citation": "SRS import [NJ3O2X7MF4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NJ3O2X7MF4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391943000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30cc6be8-b924-4ca1-a794-406adb65093d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7ac5cec-1bbb-4f57-93e2-84bc59969d2d",
          "citation": "ASCORBYL LACTOSIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "48b9b963-584d-49c9-9fde-adc913882372",
          "citation": "ASCORBYL LACTOSIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c530ebfe-c60c-55ef-0d5f-41eafced286e",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "2d1324d2-7ecc-4982-b5ef-f4997f2e7212",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f91bdd2b-b6b5-bb52-8fd6-d2541baf0a5d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "81f29001-3029-db46-bbbc-130e4e5acbee",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0e54045a-f955-c640-02da-f4e75ec2c493",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e6a41653-aab0-0d2a-1e63-dc2894fb538e",
          "citation": "EMA 2023",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1212de69-fa01-4cac-9005-18c99f822506",
          "id": "1212de69-fa01-4cac-9005-18c99f822506",
          "molfile": "\n  Marvin  01132101092D          \n\n 34 36  0  0  1  0            999 V2000\n   11.1456   -5.5717    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.9581   -5.7149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6153   -6.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8975   -6.9789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8634   -4.7964    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.7486   -3.9794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9362   -3.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5745   -3.0946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5489   -4.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7319   -4.6794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1220   -5.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9787   -5.9705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1662   -6.1138    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.6359   -5.4818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8234   -5.6250    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.2931   -4.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4807   -5.1364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5413   -6.4003    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.7289   -6.5436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4467   -7.3188    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.7322   -6.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0178   -7.3188    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.3033   -6.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5888   -7.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0178   -8.1438    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.3033   -8.5564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7322   -8.5564    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.7322   -9.3814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4467   -8.1438    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.1611   -8.5564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0716   -7.0323    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7894   -7.8076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8840   -6.8890    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.4143   -7.5210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 33 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 18 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 31  1  0  0  0  0\n 20 19  1  1  0  0  0\n 20 21  1  0  0  0  0\n 29 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  1  0  0  0\n 25 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 26  1  1  0  0  0\n 27 25  1  0  0  0  0\n 27 28  1  1  0  0  0\n 29 27  1  0  0  0  0\n 29 30  1  6  0  0  0\n 31 32  1  1  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@@H]1C(=C(C(=O)O1)O)OC2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@H]3[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O)O)O)O)O",
          "formula": "C18H28O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "963fa3ef-969a-46f2-8eed-041394880759"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "500.4061",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 12
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c47ae24-8188-4f64-8086-b9a47e6c732b",
      "version": "11",
      "structure": {
        "id": "8f366322-da29-44d8-8af4-2e9e27a1d353",
        "molfile": "\n  Marvin  01132107262D          \n\n 36 38  0  0  1  0            999 V2000\n   10.8634   -4.7964    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.1456   -5.5717    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.6153   -6.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8975   -6.9789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9581   -5.7149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7486   -3.9794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9362   -3.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5489   -4.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1220   -5.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7319   -4.6794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5745   -3.0946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6639   -4.5968    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9787   -5.9705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7289   -6.5436    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7894   -7.8076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0716   -7.0323    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4143   -7.5210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8840   -6.8890    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1662   -6.1138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6359   -5.4818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2931   -4.9931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4807   -5.1364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5413   -6.4003    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8234   -5.6250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2591   -7.4621    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1611   -8.5564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4467   -8.1438    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7322   -9.3814    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7322   -8.5564    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3033   -8.5564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0178   -8.1438    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4467   -7.3188    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7322   -6.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0178   -7.3188    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3033   -6.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5888   -7.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  2  5  1  1  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  1  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  7 11  2  0  0  0  0\n  1 12  1  1  0  0  0\n  9 13  1  0  0  0  0\n 32 14  1  0  0  0  0\n 23 14  1  6  0  0  0\n 16 23  1  0  0  0  0\n 16 15  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 17  1  6  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 24  1  0  0  0  0\n 24 21  1  1  0  0  0\n 22 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 32 25  1  6  0  0  0\n 27 32  1  0  0  0  0\n 27 26  1  6  0  0  0\n 29 27  1  0  0  0  0\n 29 28  1  1  0  0  0\n 31 29  1  0  0  0  0\n 31 30  1  1  0  0  0\n 34 31  1  0  0  0  0\n 34 33  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 35  1  1  0  0  0\n 36 35  1  0  0  0  0\n 19 13  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@]1([H])C(=C(C(=O)O1)O)OC2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O[C@@]3([H])[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O)O)O)O)O",
        "formula": "C18H28O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "500.4061",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "30cc6be8-b924-4ca1-a794-406adb65093d",
          "42009512-e368-48c2-8f51-ede6c43af697"
        ],
        "stereo_centers": 12
      },
      "unii": "NJ3O2X7MF4"
    }
  ]
}