{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "752118d3-b6f8-4a29-90c0-aaa20512d608", "code": "29920-31-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=29920-31-8", "code_system": "CAS", "references": [ "aba2b24b-8538-4ac6-9c82-2cba4cfdd031", "a8ed1a3d-22cb-402d-bdd3-e83456f6ccc5" ] }, { "uuid": "8aa5fc74-bb09-44cb-9ff4-7c9e72116e6c", "code": "249-955-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.399", "code_system": "ECHA (EC/EINECS)", "references": [ "aba2b24b-8538-4ac6-9c82-2cba4cfdd031" ] }, { "uuid": "f1c42dd5-3747-b2f0-51db-5524f5b68c04", "code": "DTXSID40865519", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40865519", "code_system": "EPA CompTox", "references": [ "8caa626c-6802-cd59-c127-8b9d672c8477" ] }, { "uuid": "b3ba1992-c9ee-47a9-8e50-ac554c3ec2c5", "code": "NI7H5NCD5F", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "87ad9c64-5ed0-4ab8-b1dd-077a4b119e14", "name": "1,3-BENZENEDICARBOXYLIC ACID, 5-(2-(1-(((2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)AMINO)CARBONYL)-2-OXOPROPYL)DIAZENYL)-, 1,3-DIMETHYL ESTER", "stdName": "1,3-BENZENEDICARBOXYLIC ACID, 5-(2-(1-(((2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)AMINO)CARBONYL)-2-OXOPROPYL)DIAZENYL)-, 1,3-DIMETHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ea03331b-1e6c-4586-8ffe-5e29ef900017", "3f41fb59-7e35-4897-b15b-4807af61de16" ], "display_name": false }, { "uuid": "78b7d1f1-64ce-4a33-8a41-504d480e17ce", "name": "C.I. PIGMENT YELLOW 120", "stdName": "C.I. PIGMENT YELLOW 120", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3f41fb59-7e35-4897-b15b-4807af61de16", "eedf1548-d85d-4bc9-a2d6-62e64c28390a" ], "display_name": false }, { "uuid": "52188a1b-16e6-43d4-88be-c0ddefcf1c30", "name": "CI PIGMENT YELLOW 120", "stdName": "CI PIGMENT YELLOW 120", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3f41fb59-7e35-4897-b15b-4807af61de16", "eedf1548-d85d-4bc9-a2d6-62e64c28390a" ], "display_name": false }, { "uuid": "c4058f5d-86f8-4a25-875f-29e5538d2339", "name": "ISOPHTHALIC ACID, 5-((1-((2-OXO-5-BENZIMIDAZOLINYL)CARBAMOYL)ACETONYL)AZO)-, DIMETHYL ESTER", "stdName": "ISOPHTHALIC ACID, 5-((1-((2-OXO-5-BENZIMIDAZOLINYL)CARBAMOYL)ACETONYL)AZO)-, DIMETHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3f41fb59-7e35-4897-b15b-4807af61de16", "eedf1548-d85d-4bc9-a2d6-62e64c28390a" ], "display_name": false }, { "uuid": "3b60be78-acb1-4055-a742-822a443f0130", "name": "PIGMENT YELLOW 120", "stdName": "PIGMENT YELLOW 120", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3f41fb59-7e35-4897-b15b-4807af61de16", "eedf1548-d85d-4bc9-a2d6-62e64c28390a" ], "display_name": true }, { "uuid": "f8fceda5-38a8-4767-881a-c8e193b814ef", "name": "PY-120", "stdName": "PY-120", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3f41fb59-7e35-4897-b15b-4807af61de16", "eedf1548-d85d-4bc9-a2d6-62e64c28390a" ], "display_name": false } ], "references": [ { "uuid": "ea03331b-1e6c-4586-8ffe-5e29ef900017", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3f41fb59-7e35-4897-b15b-4807af61de16", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eedf1548-d85d-4bc9-a2d6-62e64c28390a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aba2b24b-8538-4ac6-9c82-2cba4cfdd031", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393657000, "tags": [ "NOMEN" ] }, { "uuid": "1574d8f6-6d57-4734-9361-ea551f7fa843", "citation": "SRS import [NI7H5NCD5F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NI7H5NCD5F", "doc_type": "SRS", "public_domain": true, "document_date": 1493393657000, "tags": [ "NOMEN" ] }, { "uuid": "48abe969-21bd-4256-9b9b-46f2cae0d90b", "citation": "CHEMID RECORD 29920-31-8", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8caa626c-6802-cd59-c127-8b9d672c8477", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "a8ed1a3d-22cb-402d-bdd3-e83456f6ccc5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2d227df8-9925-4c7d-a8c4-5c047e1d307d", "id": "2d227df8-9925-4c7d-a8c4-5c047e1d307d", "molfile": "\n Marvin 01132102262D \n\n 33 35 0 0 0 0 999 V2000\n 3.9379 -8.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2221 -8.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5107 -8.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7949 -8.4864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5087 -7.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2242 -6.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2207 -6.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5056 -5.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7942 -6.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7937 -6.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0802 -5.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0807 -4.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3688 -6.0020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3683 -6.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9339 -5.5940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9315 -4.7662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6415 -4.3546 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 4.6390 -3.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9236 -3.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3490 -3.1151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3569 -4.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3593 -5.5931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0669 -4.3537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7821 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7844 -5.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4968 -6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2109 -5.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0022 -5.8421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4823 -5.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3053 -5.1657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9913 -4.5028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2127 -4.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4962 -4.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 10 5 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 15 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 21 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 33 24 2 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 32 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccc2c(c1)[nH]c(=O)[nH]2)/N=N/c3cc(cc(c3)C(=O)OC)C(=O)OC", "formula": "C21H19N5O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6078688f-29a8-4fea-b254-c2d72588fde2" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "453.4057", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "52cdd898-d6f4-48a8-96aa-b8ee6a1b8586", "version": "5", "structure": { "id": "454c04f9-0b5e-4b1b-a20b-61a309daaf9d", "molfile": "\n Marvin 01132103392D \n\n 33 35 0 0 0 0 999 V2000\n 1.7949 -8.4864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5107 -8.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2221 -8.4796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9379 -8.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5087 -7.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2242 -6.8292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2207 -6.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9339 -5.5940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9315 -4.7662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6415 -4.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6390 -3.5267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3490 -3.1151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9236 -3.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3569 -4.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3593 -5.5931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0669 -4.3537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7821 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7844 -5.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4968 -6.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2109 -5.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0022 -5.8421 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4823 -5.1715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3053 -5.1657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9913 -4.5028 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2127 -4.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4962 -4.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5056 -5.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7942 -6.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0802 -5.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0807 -4.7650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3688 -6.0020 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3683 -6.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7937 -6.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 10 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 20 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 17 2 0 0 0 0\n 7 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 28 33 1 0 0 0 0\n 33 5 2 0 0 0 0\nM END", "smiles": "CC(=O)C(C(=O)Nc1ccc2c(c1)[nH]c(=O)[nH]2)/N=N/c3cc(cc(c3)C(=O)OC)C(=O)OC", "formula": "C21H19N5O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "453.4057", "optical_activity": "( + / - )", "references": [ "48abe969-21bd-4256-9b9b-46f2cae0d90b", "1574d8f6-6d57-4734-9361-ea551f7fa843" ], "stereo_centers": 1 }, "unii": "NI7H5NCD5F" } ] }