{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dcc5799b-0b45-4a6c-9865-132daf2ae8e4",
          "code": "142350-99-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=142350-99-0",
          "code_system": "CAS",
          "references": [
            "8bedc772-6a2f-462a-a818-31216509eeac",
            "c92502fa-c6ca-45ac-a3ee-73a1fe680969"
          ]
        },
        {
          "uuid": "cdeab76a-3a9f-4adb-b0f4-454b4da15c62",
          "code": "16119330",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16119330",
          "code_system": "PUBCHEM",
          "references": [
            "8bedc772-6a2f-462a-a818-31216509eeac"
          ]
        },
        {
          "uuid": "c7c7a043-12f3-467a-8cc9-75ea8d2089f8",
          "code": "NGL0OTK5E8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "94401457-5e2b-5f6c-4e4d-6743c4615293",
          "code": "DTXSID70162023",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70162023",
          "code_system": "EPA CompTox",
          "references": [
            "8e81a995-4873-a59f-0146-29a661b7e95b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7e1c3946-64e4-4b2d-898a-a9a7a3ed9246",
          "comments": "440 uM IC50 vs in vitro prostaglandin synthesis",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "baba95d3-c0db-46e6-9e43-bd9703e2d74d"
          ],
          "related_substance": {
            "uuid": "a6e51397-11db-4806-afd1-a53c5a9be60a",
            "refuuid": "bfeed3ae-01a7-4a35-8b8f-b459d75344c7",
            "name": "IPOMOEA AQUATICA LEAF",
            "unii": "0PDN17832A",
            "linking_id": "0PDN17832A",
            "ref_pname": "IPOMOEA AQUATICA LEAF",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f9cb156e-03e8-432e-835e-365be31a207b",
          "comments": "Among the compounds tested in this study, N-coumaroyldopamine and N-caffeoyldopamine were the two most potent compounds, able to increase cAMP at the concentrations < 0.05 uM in U937 cells. The decreasing order of potency was N-coumaroyldopamine > N- affeoyldopamine > N-feruloyldopamine > N-sinapoyldopamine > N-cinnamoyldopamine.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "aff02745-b6e7-4850-a925-96bfe11a3ba2"
          ],
          "related_substance": {
            "uuid": "533e6bf4-4038-479b-8b56-b8af0e090648",
            "refuuid": "1433bfc4-e7cb-4337-9017-324838a42091",
            "name": "THEOBROMA CACAO WHOLE",
            "unii": "EB048G1S9J",
            "linking_id": "EB048G1S9J",
            "ref_pname": "THEOBROMA CACAO WHOLE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2f010ef7-77cc-4db0-8700-a152c75b167e",
          "name": "2-PROPENAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-3-(4-HYDROXY-3-METHOXYPHENYL)-, (2E)-",
          "stdName": "2-PROPENAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-3-(4-HYDROXY-3-METHOXYPHENYL)-, (2E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eaa1355-c012-4dc3-903f-080f0991aa1c",
            "f4c5adf9-a8df-46d1-a218-2fdb2af6f2c8"
          ],
          "display_name": false
        },
        {
          "uuid": "be7ef38f-2b36-4e06-94c3-44ccc4b63edb",
          "name": "2-PROPENAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-3-(4-HYDROXY-3-METHOXYPHENYL)-, (E)-",
          "stdName": "2-PROPENAMIDE, N-(2-(3,4-DIHYDROXYPHENYL)ETHYL)-3-(4-HYDROXY-3-METHOXYPHENYL)-, (E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eaa1355-c012-4dc3-903f-080f0991aa1c",
            "f4c5adf9-a8df-46d1-a218-2fdb2af6f2c8"
          ],
          "display_name": false
        },
        {
          "uuid": "9f4db33a-c1f4-4fce-907c-1ef7dca05b7c",
          "name": "N-FERULOYL DOPAMINE, TRANS-",
          "stdName": "N-FERULOYL DOPAMINE, TRANS-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eaa1355-c012-4dc3-903f-080f0991aa1c",
            "3e453204-f3d6-4d00-b0c3-65a67282074d"
          ],
          "display_name": true
        },
        {
          "uuid": "7193bcaa-8945-42bf-a837-a00c57e911a9",
          "name": "N-FERYLOYLDOPAMINE",
          "stdName": "N-FERYLOYLDOPAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3146fa42-19db-4b3d-b433-9d3b8271df3e",
            "6eaa1355-c012-4dc3-903f-080f0991aa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "ac84c297-ddbf-4308-8b8f-f652f2bc7a9b",
          "name": "TRANS-FERULOYLDOPAMINE",
          "stdName": "TRANS-FERULOYLDOPAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6eaa1355-c012-4dc3-903f-080f0991aa1c",
            "f4c5adf9-a8df-46d1-a218-2fdb2af6f2c8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3e453204-f3d6-4d00-b0c3-65a67282074d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6eaa1355-c012-4dc3-903f-080f0991aa1c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4c5adf9-a8df-46d1-a218-2fdb2af6f2c8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3146fa42-19db-4b3d-b433-9d3b8271df3e",
          "citation": "Chem Pharm Bull, 40(2)396-400(1992)",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bedc772-6a2f-462a-a818-31216509eeac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "baba95d3-c0db-46e6-9e43-bd9703e2d74d",
          "citation": "TSENG C-F ET AL, CHEM PHARM BULL, 40(2)396-400(1992)",
          "url": "https://www.jstage.jst.go.jp/article/cpb1958/40/2/40_2_396/_pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aff02745-b6e7-4850-a925-96bfe11a3ba2",
          "citation": "PARK, J; N-COUMAROYLDOPAMINE AND N-CAFFEOYLDOPAMINE INCREASE CAMP VIA BETA 2-ADRENOCEPTORS IN MYELOCYTIC U937 CELLS; THE FASEB JOURNAL; 19(6)497-502,2005",
          "url": "http://www.fasebj.org/content/19/6/497.full.pdf+html",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5cb8efb-c55b-4221-aacc-588d28c3c235",
          "citation": "SRS import [NGL0OTK5E8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NGL0OTK5E8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391546000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a04e594e-1db6-c9e1-1831-2c6ead488208",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=142350-99-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c92502fa-c6ca-45ac-a3ee-73a1fe680969",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8e81a995-4873-a59f-0146-29a661b7e95b",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6fabcb5f-e3e8-4316-9fa2-64ae89f15768",
          "id": "6fabcb5f-e3e8-4316-9fa2-64ae89f15768",
          "molfile": "\n  Marvin  01132105482D          \n\n 24 25  0  0  0  0            999 V2000\n   16.4033   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5783   -6.6166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1657   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3407   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9283   -5.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1033   -5.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6907   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8657   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4532   -5.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4533   -6.6166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6283   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2157   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3907   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9782   -8.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1532   -8.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9157   -7.3311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1532   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -5.9021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9782   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3407   -4.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1657   -4.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5783   -5.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4033   -5.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 23  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 21  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 20 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(ccc1O)/C=C/C(=O)NCCc2ccc(c(c2)O)O",
          "formula": "C18H19NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "17acbc7d-d84b-4d1b-814e-b7ca28ad5366"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "329.3478",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "98bbffc9-8450-4e37-9aa5-10c83e30fa97",
      "version": "5",
      "structure": {
        "id": "6d96afa1-d302-4f75-9a60-c6ec61cf08ea",
        "molfile": "\n  Marvin  01132105422D          \n\n 24 25  0  0  0  0            999 V2000\n   11.8657   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4533   -6.6166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6283   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2157   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3907   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9782   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1532   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -5.9021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -7.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1532   -8.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9782   -8.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9157   -7.3311    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4532   -5.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6907   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1033   -5.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9283   -5.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3407   -4.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1657   -4.4732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5783   -5.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1657   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3407   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5783   -6.6166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4033   -6.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4033   -5.1876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n  5 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  1 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 16 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 19 24  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(ccc1O)/C=C/C(=O)NCCc2ccc(c(c2)O)O",
        "formula": "C18H19NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "329.3478",
        "optical_activity": "NONE",
        "references": [
          "d5cb8efb-c55b-4221-aacc-588d28c3c235",
          "f4c5adf9-a8df-46d1-a218-2fdb2af6f2c8"
        ],
        "stereo_centers": 0
      },
      "unii": "NGL0OTK5E8"
    }
  ]
}