{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5e377766-6f32-4ef1-b514-cf81769f9b0d", "code": "N0000000102", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Norepinephrine Transporter Interactions [MoA]|Norepinephrine Uptake Inhibitors [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000102", "code_system": "NDF-RT", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "15525440-2eaa-4b21-b2bb-497790173d70", "code": "N0000175749", "comments": "Established Pharmacologic Class [EPC]|Serotonin and Norepinephrine Reuptake Inhibitor [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175749", "code_system": "NDF-RT", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "c4d9fc91-c966-4ca1-b24a-a6afabf2cabb", "code": "QN06AX23", "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|desvenlafaxine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AX23&showdescription=yes", "code_system": "WHO-VATC", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "a1762c11-44a4-440d-8564-3cfdeed8f131", "code": "93413-62-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=93413-62-8", "code_system": "CAS", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00", "f7e6b116-1be4-4856-8704-61fa0c8b94e6" ] }, { "uuid": "12cea8f5-fa97-4530-9524-5ea2e29f1963", "code": "C61703", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61703", "code_system": "NCI_THESAURUS", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "3bcc8dfa-a3fa-426b-afa4-0d24c83492fd", "code": "C086816", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67086816", "code_system": "MESH", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "14d9fcba-506f-4d6a-8f45-21d22926bc26", "code": "286", "comments": "LiverTox|CNS|Antidepressant|SSRI", "type": "PRIMARY", "url": "https://livertox.nlm.nih.gov/Desvenlafaxine.htm", "code_system": "LIVERTOX", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "3436f40e-772a-484e-aadb-2b6084c4f9fb", "code": "DESVENLAFAXINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Desvenlafaxine", "code_system": "WIKIPEDIA", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "e166be03-e91d-48ba-96c2-2e0767de9668", "code": "SUB25380", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "b68e1795-804e-4302-bf6d-30331036ccb0", "code": "8361", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8361", "code_system": "INN", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "de89e41b-923f-4939-a88f-2d48bc22d4cf", "code": "7158", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7158", "code_system": "IUPHAR", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "f8ba5432-aa0b-45c1-813d-37c6767c392e", "code": "734064", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/734064/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "8a60b6cb-c194-4032-a5c9-bac0d67b2812", "code": "m4207", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4207?q=authorize", "code_system": "MERCK INDEX", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "650bd5ba-4a1b-4310-88bd-5cab8f37a300", "code": "DB06700", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB06700", "code_system": "DRUG BANK", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "aa7653a8-3dc3-49bc-8af3-a5c78c3fc1f3", "code": "130198-07-1", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=130198-07-1", "code_system": "CAS", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00", "ce4e449a-2a5f-4ce8-bcbe-dc5190aff83e" ] }, { "uuid": "fe33100a-4203-45d7-bc51-e40b8cea2d1a", "code": "CHEMBL1118", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1118", "code_system": "ChEMBL", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "70b35e28-e0c8-43fb-8d5f-cce573c7836c", "code": "N0000182137", "comments": "Cytochrome P450 2D6 Inhibitors [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000182137", "code_system": "NDF-RT", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "45a25b4d-8dcf-44b9-891f-64e37f69dc67", "code": "N06AX23", "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|desvenlafaxine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N06AX23&showdescription=yes", "code_system": "WHO-ATC", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "e88489a2-0dc3-4f0d-b653-cfebebf0a261", "code": "N0000000109", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|Active Transporter Interactions [MoA]|Neurotransmitter Transporter Interactions [MoA]|Serotonin Transporter Interactions [MoA]|Serotonin Uptake Inhibitors [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000109", "code_system": "NDF-RT", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] }, { "uuid": "f43123ed-c470-5cda-132d-63f22d28fbfd", "code": "7993", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7993", "code_system": "HSDB", "references": [ "74a608ce-a098-6f2e-8ad7-073819b14a02" ] }, { "uuid": "95922c19-718a-bb1b-7b33-d041a17a64a6", "code": "C265", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265", "code_system": "NCI_THESAURUS", "references": [ "edc0b69a-2cfd-c67d-698a-19e99eea352b" ] }, { "uuid": "e63d07d0-d30d-4864-be8c-07b4a235d3fd", "code": "NG99554ANW", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7f0f9f40-528e-d204-7dd8-9e745268eef8", "code": "Desvenlafaxine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM698/", "code_system": "LACTMED", "references": [ "edc0b69a-2cfd-c67d-698a-19e99eea352b" ] }, { "uuid": "73faa3b1-7749-0d35-3c74-611583df0850", "code": "4380", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/4380", "code_system": "DRUG CENTRAL", "references": [ "edc0b69a-2cfd-c67d-698a-19e99eea352b" ] }, { "uuid": "51f202ff-ca7d-219f-fcff-7ef78e22d8d2", "code": "83527", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83527", "code_system": "CHEBI", "references": [ "edc0b69a-2cfd-c67d-698a-19e99eea352b" ] }, { "uuid": "d08aa3f7-19c4-1aca-fdab-54bdeea79712", "code": "DTXSID40869118", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40869118", "code_system": "EPA CompTox", "references": [ "edc0b69a-2cfd-c67d-698a-19e99eea352b" ] }, { "uuid": "1494fb93-cf56-0796-f0a3-27e3843944bf", "code": "1175751", "type": "PRIMARY", "url": "https://store.usp.org/product/1175751", "code_system": "RS_ITEM_NUM", "references": [ "edc0b69a-2cfd-c67d-698a-19e99eea352b" ] }, { "uuid": "e4e8b10a-b2c6-9518-c55c-5a36fcb246ae", "code": "100000089362", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "30652762-f919-ead0-d1e6-4c4c69e48692" ] }, { "uuid": "da011fae-4027-488c-d10d-e6451bff91cb", "code": "NG99554ANW", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=NG99554ANW", "code_system": "DAILYMED", "references": [ "8c990c4c-9688-e02c-db52-f9d47d03eee5" ] }, { "uuid": "5f653e2a-9b0a-4800-9054-d6daf8f9dc02", "code": "125017", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/125017", "code_system": "PUBCHEM", "references": [ "1fa72e64-66b6-4e95-bbfa-5af506b13e00" ] } ], "substance_class": "chemical", "references": [ { "uuid": "a1456b77-0986-4f0d-a5ec-e6a13ee4567b", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "8ef08679-0671-4f74-8ea5-4d8380cd0889", "citation": "ACD 9.0", "doc_type": "ACD", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6698c2a6-4eaa-4616-83b4-f6fd8bf3add3", "citation": "INN Proposed List 89", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL89.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "00128b48-a644-4b93-a4c2-54702e33ab6e", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8bed7998-60e5-4b6c-b685-1172bd843991", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "96226617-c946-438c-92f2-fcb312e2c959", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "22d13d57-df2d-4fc7-a419-6ee00dcd4f4d", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "30eda0b6-21e3-479d-8562-46e6f8185ced", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e5ee706c-b691-47d5-b060-78a7ff4601be", "citation": "ORANGE BOOK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ca81f237-d809-4ae9-9946-adb5ecef6247", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1fa72e64-66b6-4e95-bbfa-5af506b13e00", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390600000, "tags": [ "NOMEN" ] }, { "uuid": "7a6ce130-6c6b-440a-bf7f-375ebea020e9", "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "doc_type": "DRUG PRODUCT LABEL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e6ad4a87-8e32-41c5-9441-a79cd1f315f1", "citation": "SRS import [NG99554ANW]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NG99554ANW", "doc_type": "SRS", "public_domain": true, "document_date": 1493390600000, "tags": [ "NOMEN" ] }, { "uuid": "fe202bef-2e67-4958-8d3e-cbe84510c4d4", "citation": "DESVENLAFAXINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7f3173f4-c2c6-4e19-8d5a-d72042850a6b", "citation": "DESVENLAFAXINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f51fde62-fa96-49ea-b3d9-2f83d0d75808", "citation": "DESVENLAFAXINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "331cd95e-40cf-49fd-b7ae-7e51cfd5fa8b", "citation": "DESVENLAFAXINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c8bd534a-3d78-429b-adfe-3cd4e8fe9cd5", "citation": "DESVENLAFAXINE [ORANGE BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "74a608ce-a098-6f2e-8ad7-073819b14a02", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+93413-62-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "db5ebf60-e19c-c5d3-068b-58d62b24eff5", "citation": "Pharmacol Rev 65:578–640, April 2013", "url": "http://dx.doi.org/10.1124/pr.111.005439", "doc_type": "JA", "public_domain": true }, { "uuid": "2f94d98f-1f74-f743-ca30-09a4672af76a", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+93413-62-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "edc0b69a-2cfd-c67d-698a-19e99eea352b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "83d5f983-a419-9126-1562-605e9abf14d6", "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2008/021992lbl.pdf", "doc_type": "NDA PUBLIC REVIEW", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ce4e449a-2a5f-4ce8-bcbe-dc5190aff83e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f7e6b116-1be4-4856-8704-61fa0c8b94e6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bd42a328-5876-fd62-aeb2-112ca127fcd1", "citation": "USP 10/2020", "doc_type": "USPNF", "public_domain": true }, { "uuid": "b1af1942-52f4-c0d4-86cd-b06fe91767ed", "citation": "USP-RS", "doc_type": "USPNF", "public_domain": true }, { "uuid": "d937a470-e091-4a0b-9ad5-0e1b50d60a50", "citation": "USP", "doc_type": "USPNF", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0fff5f18-084f-4786-a95b-9f3b25627b8e", "citation": "USP", "doc_type": "USPNF", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c6f19cc7-6a1a-a590-0df5-260325188147", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "8c990c4c-9688-e02c-db52-f9d47d03eee5", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "a56b7499-bf02-4ded-9305-03155e926551", "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "doc_type": "DRUG PRODUCT LABEL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "30652762-f919-ead0-d1e6-4c4c69e48692", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "bff156f2-7f5a-472f-b18f-5b08a69019e5", "citation": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "url": "http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=f2f03495-12b6-457a-901f-958b9c844bfd", "doc_type": "DRUG PRODUCT LABEL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4470efc0-5c3d-4aba-9a67-ce44072c2cb2", "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1", "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "082a8f33-be81-4df1-9dc0-b0d9e3509bf1", "citation": "Updated Information | Recommended Acceptable Intake Limits for Nitrosamine Drug Substance-Related Impurities (NDSRIs); Table 1", "url": "https://www.fda.gov/regulatory-information/search-fda-guidance-documents/updated-information-recommended-acceptable-intake-limits-nitrosamine-drug-substance-related", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "24b86b70-6d45-4295-9aef-7c0c151893b5", "citation": "Deecher, Darlene C., et al. \"Desvenlafaxine succinate: a new serotonin and norepinephrine reuptake inhibitor.\" Journal of pharmacology and experimental therapeutics 318.2 (2006): 657-665.", "url": "https://jpet.aspetjournals.org/content/jpet/318/2/657.full.pdf", "doc_type": "JA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c771222b-7abf-4774-aecf-7d63ab95d647", "id": "c771222b-7abf-4774-aecf-7d63ab95d647", "molfile": "\n Marvin 01132110182D \n\n 19 20 0 0 0 0 999 V2000\n 2.8396 2.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6453 1.9458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0740 2.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0041 1.1735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5784 0.4742 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.7758 0.5533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3380 -0.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5444 -0.0822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1735 0.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3709 0.7600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6113 1.3863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4049 1.3195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9403 -0.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3750 0.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6182 -0.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5757 -1.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8612 -1.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1893 -1.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2287 -0.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 13 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 12 6 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 9 2 0 0 0 0\n 11 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 1 0 0 0 0\n 19 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\nM END", "smiles": "CN(C)CC(c1ccc(cc1)O)C2(CCCCC2)O", "formula": "C16H25NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c9ed2fd0-4a6e-4539-8199-53bf98cf852c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "263.3758", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "eb2e8a38-528a-4b49-9dba-f7af328d3996", "version": "40", "structure": { "id": "7e1feb9e-883f-4b6e-8990-d2476c0f48e0", "molfile": "\n JSDraw207162419192D\n\n 19 20 0 0 0 0 0 V2000\n 26.5977 -7.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.2834 -8.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0769 -7.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4043 -6.1003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3741 -5.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.2474 -8.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7244 -4.6370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1070 -7.5405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.0409 -7.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7437 -8.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8704 -5.6971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5201 -6.8838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9351 -9.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5679 -9.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1978 -4.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5367 -3.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.4873 -11.3886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8604 -11.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1335 -12.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0 0 0 0\n 5 3 2 0 0 0 0\n 6 3 1 0 0 0 0\n 7 4 1 0 0 0 0\n 8 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 6 2 0 0 0 0\n 11 5 1 0 0 0 0\n 12 9 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 2 1 0 0 0 0\n 15 7 1 0 0 0 0\n 16 7 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 13 1 0 0 0 0\n 19 18 1 0 0 0 0\n 11 9 2 0 0 0 0\n 17 19 1 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\nM END", "smiles": "CN(C)CC(c1ccc(cc1)O)C2(CCCCC2)O", "formula": "C16H25NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "263.3758", "optical_activity": "( + / - )", "references": [ "e6ad4a87-8e32-41c5-9441-a79cd1f315f1", "a1456b77-0986-4f0d-a5ec-e6a13ee4567b", "6698c2a6-4eaa-4616-83b4-f6fd8bf3add3" ], "stereo_centers": 1 }, "unii": "NG99554ANW", "relationships": [ { "uuid": "aa4c03c0-b7a4-42ff-954c-3d0cc4917d6d", "amount": { "uuid": "7fdd476b-cace-4ab1-8ecb-47ca5484a245" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5d348d40-e0ef-4a09-a5e9-b4a6a5c6395d", "refuuid": "eb2e8a38-528a-4b49-9dba-f7af328d3996", "name": "DESVENLAFAXINE", "unii": "NG99554ANW", "linking_id": "NG99554ANW", "ref_pname": "DESVENLAFAXINE", "substance_class": "reference" } }, { "uuid": "79edde1f-f43d-4f4f-b992-b83180dd9a7b", "amount": { "uuid": "47183f55-317e-450a-be46-7dfd1731add5" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "9675f84d-980c-4a0e-81b0-e3b0d3316fd9", "refuuid": "c8c074e9-c4ea-4221-a7e0-7c46a99d5b06", "name": "DESVENLAFAXINE HYDROCHLORIDE", "unii": "3TP4E4F972", "linking_id": "3TP4E4F972", "ref_pname": "DESVENLAFAXINE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "566f8ea1-f35d-400d-98c5-152a056a1cc9", "amount": { "uuid": "ca1be6a6-5474-4a78-8f9d-a54492995595" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "7201047f-8172-4963-b7c2-be941f14163f", "refuuid": "4997fb91-fc35-4d59-8af2-d183658d36d4", "name": "DESVENLAFAXINE FUMARATE", "unii": "ATX24E9M6L", "linking_id": "ATX24E9M6L", "ref_pname": "DESVENLAFAXINE FUMARATE", "substance_class": "reference" } }, { "uuid": "8b386b3b-0bd0-47fc-9d90-827ca320486f", "amount": { "uuid": "e0caa842-5a5c-4754-994d-6f597dff2690" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "69847519-8d4e-4878-906f-b1d7aaa91edb", "refuuid": "1ddaa8b3-42e6-40ab-ac8f-bd5962787d81", "name": "DESVENLAFAXINE FUMARATE MONOHYDRATE", "unii": "R5JHD7L72A", "linking_id": "R5JHD7L72A", "ref_pname": "DESVENLAFAXINE FUMARATE MONOHYDRATE", "substance_class": "reference" } }, { "uuid": "357513d5-ddd5-4b9a-a42f-6c0454f87aaf", "amount": { "uuid": "8b524668-906d-45ab-a835-a7209606c571" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "9ce1026e-dc25-477e-8502-8f91a0f6bd4f", "refuuid": "f26e9b2a-bea7-4b96-9083-55313f166b20", "name": "DESVENLAFAXINE SUCCINATE", "unii": "ZB22ENF0XR", "linking_id": "ZB22ENF0XR", "ref_pname": "DESVENLAFAXINE SUCCINATE", "substance_class": "reference" } }, { "uuid": "4dfedaa0-d41b-48ca-bd5e-c6d02d37007f", "amount": { "uuid": "0d821749-6bec-4110-bd81-56af6c041741" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "62c144d4-d329-4bd2-8b0c-901b2b32b39a", "refuuid": "59128837-a33e-4a33-9b60-c17f4d7e7dbe", "name": "DESVENLAFAXINE SUCCINATE ANHYDROUS", "unii": "H9E1T0BI90", "linking_id": "H9E1T0BI90", "ref_pname": "DESVENLAFAXINE SUCCINATE ANHYDROUS", "substance_class": "reference" } }, { "uuid": "a8c57602-f429-4447-b02a-02d2e1731740", "amount": { "uuid": "c82d4c35-a327-4bc0-9e2a-69724926bdfa" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "6e823add-e5bf-4dee-a571-e197dc847b66", "refuuid": "ba863f7c-ed60-4c2a-af94-154dfd06816f", "name": "DESVENLAFAXINE BENZOATE", "unii": "ZG9HEJ3BBR", "linking_id": "ZG9HEJ3BBR", "ref_pname": "DESVENLAFAXINE BENZOATE", "substance_class": "reference" } }, { "uuid": "305bdf3d-911d-4594-9ad6-585f037ec4aa", "amount": { "uuid": "693bd33d-b982-478a-a8dc-df35f664f5e2" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "d7b7e43f-03e9-4ca3-a48e-bf92e1d1d7f6", "refuuid": "062e75f2-b72d-4e09-8608-c41105b96bff", "name": "DESVENLAFAXINE, (-)-", "unii": "HY5T9WKI4O", "linking_id": "HY5T9WKI4O", "ref_pname": "DESVENLAFAXINE, (-)-", "substance_class": "reference" } }, { "uuid": "7c6da51a-375f-42b7-9ade-e157064f8c43", "amount": { "uuid": "b28b6f7c-4636-4d14-8d71-22d86b96c515" }, "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "d51e95e5-86b8-4d42-abb6-3e1b2ae6484c", "refuuid": "3b2b2587-dccc-4e11-87a8-416efe1ef95c", "name": "DESVENLAFAXINE, (+)-", "unii": "189BFR45S0", "linking_id": "189BFR45S0", "ref_pname": "DESVENLAFAXINE, (+)-", "substance_class": "reference" } }, { "uuid": "16657d97-9e04-4c76-b301-0cc3215262a8", "amount": { "uuid": "d4db9d6f-ad1b-452e-b1c9-4276567bed05", "average": 30, "units": "%" }, "type": "BINDER->LIGAND", "references": [ "db5ebf60-e19c-c5d3-068b-58d62b24eff5" ], "related_substance": { "uuid": "dc9fd9a1-a0b1-4475-ac28-cd146d9c56b3", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "7c5f268d-9290-49a4-b7f7-5a4c04d9a76d", "amount": { "uuid": "3c050ae5-2fbc-4418-be58-b86d550c18a0" }, "type": "PRODRUG->METABOLITE ACTIVE", "related_substance": { "uuid": "290dca73-b016-4641-99b1-7a1f30c6f20b", "refuuid": "b1612f89-800b-404d-996d-61deb4b3033d", "name": "TOLUDESVENLAFAXINE", "unii": "A7CGH459FN", "linking_id": "A7CGH459FN", "ref_pname": "TOLUDESVENLAFAXINE" } }, { "uuid": "faf5826d-dc65-4ad3-9e5d-f69476870c38", "amount": { "uuid": "c2c59578-ab0d-42a9-a983-011434a4f568" }, "type": "METABOLIC ENZYME->SUBSTRATE", "references": [ "83d5f983-a419-9126-1562-605e9abf14d6" ], "related_substance": { "uuid": "399e55dd-dc4e-4279-82d7-6cd1aaac4ad7", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" } }, { "uuid": "205d2e07-6106-423e-9cbc-1fd9b8eec9cb", "amount": { "uuid": "4f8c28fb-46df-495c-930a-17761241152b", "average": 45, "units": "%" }, "qualification": "URINE", "type": "EXCRETED UNCHANGED", "interaction_type": "AMOUNT EXCRETED", "references": [ "83d5f983-a419-9126-1562-605e9abf14d6" ], "related_substance": { "uuid": "8aa609d1-ac34-474f-a203-24f6ccdcf8a8", "refuuid": "eb2e8a38-528a-4b49-9dba-f7af328d3996", "name": "DESVENLAFAXINE", "unii": "NG99554ANW", "linking_id": "NG99554ANW", "ref_pname": "DESVENLAFAXINE", "substance_class": "reference" } }, { "uuid": "a2f46ad9-8581-4a72-8d00-dbbd4be8ca60", "amount": { "uuid": "68dead5b-41d8-4af8-8f52-a26d525834c6", "units": "PERCENT PEAK AREA", "high_limit": 0.15 }, "qualification": "USP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "d937a470-e091-4a0b-9ad5-0e1b50d60a50" ], "related_substance": { "uuid": "ef91484d-970d-49da-86cb-e6a037811e2e", "refuuid": "a406addf-f9d2-4ed3-bed0-b20af9ec96ea", "name": "RAC DEHYDRO-O-DESMETHYL VENLAFAXINE", "unii": "84ZK5B3ZT6", "linking_id": "84ZK5B3ZT6", "ref_pname": "RAC DEHYDRO-O-DESMETHYL VENLAFAXINE" } }, { "uuid": "509d7044-4df0-4fc9-a592-290bb5a7bc88", "amount": { "uuid": "df83701d-f7da-4260-8aed-f26e2082d782", "units": "PERCENT PEAK AREA", "high_limit": 0.15 }, "qualification": "USP", "type": "IMPURITY->PARENT", "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)", "references": [ "0fff5f18-084f-4786-a95b-9f3b25627b8e" ], "related_substance": { "uuid": "2f33e945-b781-4a06-a507-f8a0957513de", "refuuid": "92ab23e1-a435-47c7-b5a9-3312f26acfe7", "name": "VENLAFAXINE", "unii": "GRZ5RCB1QG", "linking_id": "GRZ5RCB1QG", "ref_pname": "VENLAFAXINE" } }, { "uuid": "ee8430a7-4c56-4311-8f4d-6bda1e178904", "amount": { "uuid": "d6de90d7-0b4b-4005-9683-b50450a0cdf8" }, "type": "IMPURITY->PARENT", "references": [ "082a8f33-be81-4df1-9dc0-b0d9e3509bf1" ], "related_substance": { "uuid": "89c339eb-22b3-4b4e-98b3-a8ffbf8c22fa", "refuuid": "a007eb31-9be1-4231-ab03-cc0bdcb604a0", "name": "N-nitroso-desmethyl-desvenlafaxine", "unii": "D3L9BQ44P8", "linking_id": "D3L9BQ44P8", "ref_pname": "N-nitroso-desmethyl-desvenlafaxine", "substance_class": "reference" } }, { "uuid": "0e323e99-c70e-4eda-9e22-86ecba16bfa5", "amount": { "uuid": "ecf43ba9-d1b4-4de1-b6ee-759c429f5194" }, "type": "PARENT->METABOLITE ACTIVE", "interaction_type": "MAJOR", "mediator_substance": { "uuid": "f38ccf2c-3d54-41b4-a24f-3809f138b4f5", "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b", "name": "CYTOCHROME P450 2D6", "unii": "8E4LAA4357", "linking_id": "8E4LAA4357", "ref_pname": "CYTOCHROME P450 2D6", "substance_class": "reference" }, "references": [ "bff156f2-7f5a-472f-b18f-5b08a69019e5" ], "related_substance": { "uuid": "ca5a258f-42f2-4042-87c0-fae936320a1c", "refuuid": "92ab23e1-a435-47c7-b5a9-3312f26acfe7", "name": "VENLAFAXINE", "unii": "GRZ5RCB1QG", "linking_id": "GRZ5RCB1QG", "ref_pname": "VENLAFAXINE", "substance_class": "reference" } }, { "uuid": "d2fdde8a-718a-46dc-b63d-2a4b05fd59ec", "amount": { "uuid": "b1e07c78-a6e7-40fd-9a11-b62fbc92a107", "average": 531.3, "high": 644.3, "low": 418.3, "units": "NANOMOLAR" }, "qualification": "IC50", "type": "TARGET->WEAK INHIBITOR", "references": [ "24b86b70-6d45-4295-9aef-7c0c151893b5" ], "related_substance": { "uuid": "01155c4b-1554-46a3-838a-2153b393bda9", "refuuid": "0984671c-0dd0-410d-b763-0a7c9195929d", "name": "SODIUM-DEPENDENT NORADRENALINE TRANSPORTER", "unii": "HN86OLH1NW", "linking_id": "HN86OLH1NW", "ref_pname": "SODIUM-DEPENDENT NORADRENALINE TRANSPORTER", "substance_class": "reference" } }, { "uuid": "782c3ac9-1cb0-4627-a5d3-4e01b2a609ac", "amount": { "uuid": "0212daae-f40f-492d-9cc3-9f23294aaf85", "average": 47.3, "high": 66.7, "low": 27.9, "units": "NANOMOLAR" }, "qualification": "IC50", "type": "TARGET->INHIBITOR", "related_substance": { "uuid": "7c0e6205-535c-4f56-84c6-700c91eeaac5", "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405", "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER", "unii": "CJZ26L1EGI", "linking_id": "CJZ26L1EGI", "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER", "substance_class": "reference" } } ], "names": [ { "uuid": "78dbd938-27e3-4025-b363-6f1887b2b398", "name": "D-VENIZ", "stdName": "D-VENIZ", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ca81f237-d809-4ae9-9946-adb5ecef6247", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "e2a2ebae-8d58-4285-b5f6-26d647551bbb", "name": "DESVENLAFAXINE", "stdName": "DESVENLAFAXINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "fe202bef-2e67-4958-8d3e-cbe84510c4d4", "331cd95e-40cf-49fd-b7ae-7e51cfd5fa8b", "e5ee706c-b691-47d5-b060-78a7ff4601be", "6698c2a6-4eaa-4616-83b4-f6fd8bf3add3", "30eda0b6-21e3-479d-8562-46e6f8185ced", "22d13d57-df2d-4fc7-a419-6ee00dcd4f4d", "c8bd534a-3d78-429b-adfe-3cd4e8fe9cd5", "7f3173f4-c2c6-4e19-8d5a-d72042850a6b", "f51fde62-fa96-49ea-b3d9-2f83d0d75808", "a1456b77-0986-4f0d-a5ec-e6a13ee4567b", "00128b48-a644-4b93-a4c2-54702e33ab6e", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "6dd74952-56ef-4a25-8d46-3a45fe3776f2", "name_org": "INN" } ] }, { "uuid": "8844f261-4d3f-4417-ae85-3ae3de2b6110", "name": "DESVENLAFAXINE [MI]", "stdName": "DESVENLAFAXINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "00128b48-a644-4b93-a4c2-54702e33ab6e", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "88affd7a-1f8f-4b4a-b00d-691149437ae5", "name": "DESVENLAFAXINE [ORANGE BOOK]", "stdName": "DESVENLAFAXINE [ORANGE BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e5ee706c-b691-47d5-b060-78a7ff4601be", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "7b78f93f-e986-1966-9e9d-3892ec891cd0", "name": "DESVENLAFAXINE [USP MONOGRAPH]", "stdName": "DESVENLAFAXINE [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bd42a328-5876-fd62-aeb2-112ca127fcd1" ], "display_name": false }, { "uuid": "12606d9d-2a0a-9cd5-8a3b-e98a30049390", "name": "DESVENLAFAXINE [USP-RS]", "stdName": "DESVENLAFAXINE [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b1af1942-52f4-c0d4-86cd-b06fe91767ed" ], "display_name": false }, { "uuid": "8a99dc04-5de1-4d2a-b1b4-babe41c5b52e", "name": "DESVENLAFAXINE [VANDF]", "stdName": "DESVENLAFAXINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "30eda0b6-21e3-479d-8562-46e6f8185ced", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "f24dfeaa-64f8-7eb0-ce9c-d599afe31fc6", "name": "Desvenlafaxine [WHO-DD]", "stdName": "DESVENLAFAXINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c6f19cc7-6a1a-a590-0df5-260325188147" ], "display_name": false }, { "uuid": "71ea86fb-4543-49fa-ac96-c26492a2b655", "name": "MDD-XR", "stdName": "MDD-XR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ca81f237-d809-4ae9-9946-adb5ecef6247", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "4e81df74-58f7-461b-8d88-71b9d23743d1", "name": "NEWVEN", "stdName": "NEWVEN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ca81f237-d809-4ae9-9946-adb5ecef6247", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "86b99fa6-b5eb-4f72-bfa8-cd4dba5a6da4", "name": "O-DESMETHYLVENLAFAXINE", "stdName": "O-DESMETHYLVENLAFAXINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "96226617-c946-438c-92f2-fcb312e2c959", "8bed7998-60e5-4b6c-b685-1172bd843991" ], "display_name": false }, { "uuid": "17d9104e-c2d4-4f5f-85de-53ef67c56ec9", "name": "desvenlafaxine [INN]", "stdName": "DESVENLAFAXINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6698c2a6-4eaa-4616-83b4-f6fd8bf3add3" ], "display_name": false } ], "properties": [ { "uuid": "7db30393-01d4-4d11-8e12-4b2af6c98c89", "name": "Tmax", "value": { "uuid": "282570a6-50e3-4f20-a3b0-383c84ed2bbb", "average": 7.5, "units": "hours" }, "defining": false, "parameters": [ { "uuid": "3d8c3a5f-6946-47be-aa3e-d68d240c5a5b", "name": "ORAL ADMINISTRATION", "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "83d5f983-a419-9126-1562-605e9abf14d6" ] }, { "uuid": "b257d819-05db-435e-a46a-df07d0e11d8e", "name": "ORAL BIOAVAILABILITY", "value": { "uuid": "44ec1447-ef3c-413f-9e11-b570933d8ded", "average": 80, "units": "%" }, "defining": false, "property_type": "PHARMACOKINETIC", "references": [ "83d5f983-a419-9126-1562-605e9abf14d6" ] }, { "uuid": "b54e581c-67f5-4d23-a9ba-53671baa791d", "name": "Biological Half-life", "value": { "uuid": "f251d789-345c-4159-bc46-2be4355bc4d6", "average": 11, "units": "hours" }, "defining": false, "parameters": [ { "uuid": "d2420210-cc88-44db-8928-b180bb43d3d1", "name": "ORAL ADMINISTRATION", "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "83d5f983-a419-9126-1562-605e9abf14d6" ] }, { "uuid": "5eb1a71b-8673-4a80-bf8e-64a38a3ae330", "name": "Volume of Distribution", "value": { "uuid": "ca3c69d3-451f-4501-aca0-cdc6a95fa446", "average": 3.4, "units": "Liters/Kilogram" }, "defining": false, "parameters": [ { "uuid": "f320f14a-efac-4392-8dc5-187700ca94d7", "name": "INTRAVENOUS ADMINISTRATION", "references": [] }, { "uuid": "a2b189d9-611b-4e81-8850-b050f1a5c0c4", "name": "STEADY-STATE", "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "83d5f983-a419-9126-1562-605e9abf14d6" ] } ] } ] }