{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0aee4b10-0926-4bf4-b7af-f7138a04bfd6",
          "code": "94125-34-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94125-34-5",
          "code_system": "CAS",
          "references": [
            "7b0d872e-65c8-4471-99ae-bc511fb006f2",
            "a7bfeb6a-6491-4163-a5aa-7cbe3b72f8ad"
          ]
        },
        {
          "uuid": "d87db2f7-9f9d-4ac2-aa1a-08ebb0f985c6",
          "code": "129031",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3620",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7b0d872e-65c8-4471-99ae-bc511fb006f2"
          ]
        },
        {
          "uuid": "cd92a9ac-925d-4530-9b64-5737951ddd31",
          "code": "m9262",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9262?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7b0d872e-65c8-4471-99ae-bc511fb006f2"
          ]
        },
        {
          "uuid": "f9e4c51b-048f-4edc-bc1d-c590aa98cd5d",
          "code": "91751",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91751",
          "code_system": "PUBCHEM",
          "references": [
            "7b0d872e-65c8-4471-99ae-bc511fb006f2"
          ]
        },
        {
          "uuid": "420deac0-b4f8-d227-ab67-354bca299553",
          "code": "DTXSID9034868",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9034868",
          "code_system": "EPA CompTox",
          "references": [
            "c7e5d8b7-c081-6bc4-3f4f-1d01fd03594e"
          ]
        },
        {
          "uuid": "f307ee8d-cf61-45e6-9e09-f300907c79a9",
          "code": "NG7LE47J14",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0b2300de-96f3-e79b-9797-c465275ca9a6",
          "code": "prosulfuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/prosulfuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "8862aa16-0933-e33e-783a-047ac8ccc9a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b378f7c5-cb48-464f-9c7e-dd7f7db3b09f",
          "name": "1-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)-3-(2-(3,3,3-TRIFLUOROPROPYL)PHENYLSULFONYL)UREA",
          "stdName": "1-(4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)-3-(2-(3,3,3-TRIFLUOROPROPYL)PHENYLSULFONYL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d325e9d2-59a8-4932-be8c-56a7498a1979",
            "7a01b75e-5798-49a2-bcd2-60c92c164583"
          ],
          "display_name": false
        },
        {
          "uuid": "bf7200c0-4a3d-44cf-a56d-407bc5bb6910",
          "name": "CGA-152005",
          "stdName": "CGA-152005",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f0d0794-fe12-4298-a28b-6f9c9bfb229f",
            "5347898a-ebc3-4289-95cf-e152ee4e83b2"
          ],
          "display_name": false
        },
        {
          "uuid": "516f2fa2-92fa-4475-8764-067365a2c87e",
          "name": "N-(((4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)-2-(3,3,3-TRIFLUOROPROPYL)BENZENESULFONAMIDE",
          "stdName": "N-(((4-METHOXY-6-METHYL-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)-2-(3,3,3-TRIFLUOROPROPYL)BENZENESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d325e9d2-59a8-4932-be8c-56a7498a1979",
            "0a3709a2-2dc0-462b-b2d9-6eef3ce3211c"
          ],
          "display_name": false
        },
        {
          "uuid": "1da67d2d-7214-4a26-a53f-89fa685d3074",
          "name": "PEAK",
          "stdName": "PEAK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f0d0794-fe12-4298-a28b-6f9c9bfb229f",
            "5347898a-ebc3-4289-95cf-e152ee4e83b2"
          ],
          "display_name": false
        },
        {
          "uuid": "3dce6424-282b-41e1-a709-b60c9b719107",
          "name": "PROSULFURON",
          "stdName": "PROSULFURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f0d0794-fe12-4298-a28b-6f9c9bfb229f",
            "887733e9-bf9a-4cfa-98dd-826a93d508af",
            "a7115d88-a64b-4da2-9a17-45da42db10fa",
            "8dfc2091-a1ab-422a-95ac-1d06ef846733",
            "003c6fbf-768a-4ade-95e6-5f6a0c3ce44a",
            "4d0e205a-9e79-43a3-ab4b-21f1076de5ee"
          ],
          "display_name": true
        },
        {
          "uuid": "f3b1c757-ce72-4fc8-a2c6-5b31000cb507",
          "name": "PROSULFURON [ISO]",
          "stdName": "PROSULFURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f0d0794-fe12-4298-a28b-6f9c9bfb229f",
            "887733e9-bf9a-4cfa-98dd-826a93d508af"
          ],
          "display_name": false
        },
        {
          "uuid": "d6a1d5f3-a555-4b88-ad2b-89d616a76bda",
          "name": "PROSULFURON [MI]",
          "stdName": "PROSULFURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f0d0794-fe12-4298-a28b-6f9c9bfb229f",
            "4d0e205a-9e79-43a3-ab4b-21f1076de5ee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "003c6fbf-768a-4ade-95e6-5f6a0c3ce44a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d325e9d2-59a8-4932-be8c-56a7498a1979",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a01b75e-5798-49a2-bcd2-60c92c164583",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a3709a2-2dc0-462b-b2d9-6eef3ce3211c",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4d0e205a-9e79-43a3-ab4b-21f1076de5ee",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f0d0794-fe12-4298-a28b-6f9c9bfb229f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5347898a-ebc3-4289-95cf-e152ee4e83b2",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "887733e9-bf9a-4cfa-98dd-826a93d508af",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b0d872e-65c8-4471-99ae-bc511fb006f2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e92e75b-648a-4032-8b6e-43c184b74c05",
          "citation": "SRS import [NG7LE47J14]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NG7LE47J14",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05bc1544-cc30-4195-b85d-db02529e63cb",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8dfc2091-a1ab-422a-95ac-1d06ef846733",
          "citation": "PROSULFURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7115d88-a64b-4da2-9a17-45da42db10fa",
          "citation": "PROSULFURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7e5d8b7-c081-6bc4-3f4f-1d01fd03594e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94125-34-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8862aa16-0933-e33e-783a-047ac8ccc9a1",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a7bfeb6a-6491-4163-a5aa-7cbe3b72f8ad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8199dd17-fb61-4414-b79b-36ad12a808c4",
          "id": "8199dd17-fb61-4414-b79b-36ad12a808c4",
          "molfile": "\n  Marvin  01132106432D          \n\n 28 29  0  0  0  0            999 V2000\n    9.6082   -6.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8860   -5.9464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8860   -5.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5958   -4.7050    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5958   -3.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3105   -3.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8862   -3.4674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1676   -3.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4476   -3.4702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7327   -3.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7327   -4.5534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0226   -3.4712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3075   -3.8880    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7206   -4.6031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8907   -3.1692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5887   -4.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8689   -3.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1604   -4.3010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1604   -5.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8689   -5.5401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5887   -5.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2449   -5.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9077   -5.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5832   -5.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1782   -5.8077    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1941   -6.1163    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9187   -4.9797    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1676   -4.7088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 28  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 28  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 21  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
          "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccccc2CCC(F)(F)F)nc(n1)OC",
          "formula": "C15H16F3N5O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "77ed76a7-d203-4450-bb41-18692367a183"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "419.3805",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ee074ac5-37aa-456f-8a9f-78816bac88d5",
      "version": "4",
      "structure": {
        "id": "5cc463d3-a9bb-4c33-8bc5-6b4ddb30dfc1",
        "molfile": "\n  Marvin  01132104482D          \n\n 28 29  0  0  0  0            999 V2000\n    6.7323   -3.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0222   -3.4710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3072   -3.8878    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5884   -4.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8687   -3.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1602   -4.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1602   -5.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8687   -5.5398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5884   -5.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2446   -5.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9073   -5.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5828   -5.4937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1778   -5.8073    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1937   -6.1159    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9183   -4.9794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7202   -4.6028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8904   -3.1690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7323   -4.5531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4471   -3.4700    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1671   -3.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8856   -3.4672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5952   -3.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3099   -3.4649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5952   -4.7047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8854   -5.1182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8854   -5.9460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6076   -6.3578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1671   -4.7085    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n  4  9  2  0  0  0  0\n  3 16  2  0  0  0  0\n  3 17  2  0  0  0  0\n  1 18  2  0  0  0  0\n  1 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 25 28  1  0  0  0  0\n 28 20  2  0  0  0  0\nM  END",
        "smiles": "Cc1nc(NC(=O)NS(=O)(=O)c2ccccc2CCC(F)(F)F)nc(n1)OC",
        "formula": "C15H16F3N5O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "419.3805",
        "optical_activity": "NONE",
        "references": [
          "0e92e75b-648a-4032-8b6e-43c184b74c05",
          "05bc1544-cc30-4195-b85d-db02529e63cb"
        ],
        "stereo_centers": 0
      },
      "unii": "NG7LE47J14"
    }
  ]
}