{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f1c15ccd-2544-4ba7-8b2e-ecc243cdda97", "code": "541523-61-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=541523-61-9", "code_system": "CAS", "references": [ "fc87c3cc-2ab0-4557-a66c-a8d995ba3241", "85cbf58f-07a0-4a81-8850-1a4dff9795fb" ] }, { "uuid": "c64a3a87-f0cc-45c9-afb2-e228d56021f9", "code": "4657034", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4657034", "code_system": "PUBCHEM", "references": [ "fc87c3cc-2ab0-4557-a66c-a8d995ba3241" ] }, { "uuid": "61bfb40d-9f1a-44bb-810f-501b78ffcd53", "code": "NFI07NJA7E", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b2349da4-1b3d-41f4-8635-f34aa0063854", "name": "ETHYLHEXYL CYCLOHEXYL UREA", "stdName": "ETHYLHEXYL CYCLOHEXYL UREA", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3be20b92-71e1-4f84-ba1a-a825dd1d731e", "d2e97edf-541e-466e-ab0a-0797a92cf2e4", "bb733d4e-6ee3-41d8-8c5b-a0b45881186d" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "2c59478e-b237-41f9-b168-159f0234f35a", "name_org": "INCI" } ] }, { "uuid": "136aac5a-70a7-4541-85d2-1ef2cf93753e", "name": "UREA, N-CYCLOHEXYL-N'-(2-ETHYLHEXYL)-", "stdName": "UREA, N-CYCLOHEXYL-N'-(2-ETHYLHEXYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3be20b92-71e1-4f84-ba1a-a825dd1d731e", "d2e97edf-541e-466e-ab0a-0797a92cf2e4" ], "display_name": false } ], "references": [ { "uuid": "d2e97edf-541e-466e-ab0a-0797a92cf2e4", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3be20b92-71e1-4f84-ba1a-a825dd1d731e", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fc87c3cc-2ab0-4557-a66c-a8d995ba3241", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393200000, "tags": [ "NOMEN" ] }, { "uuid": "7acd6fd1-39a2-4035-b955-9f2965d48052", "citation": "SRS import [NFI07NJA7E]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NFI07NJA7E", "doc_type": "SRS", "public_domain": true, "document_date": 1493393200000, "tags": [ "NOMEN" ] }, { "uuid": "a4f26b01-08d8-445e-991f-6f0f762dde30", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bb733d4e-6ee3-41d8-8c5b-a0b45881186d", "citation": "ETHYLHEXYL CYCLOHEXYL UREA [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "85cbf58f-07a0-4a81-8850-1a4dff9795fb", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ea8e3a2f-e15b-4a21-b60b-87f02d1daaf0", "id": "ea8e3a2f-e15b-4a21-b60b-87f02d1daaf0", "molfile": "\n Marvin 01132112082D \n\n 18 18 0 0 0 0 999 V2000\n 16.9905 -8.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2760 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5616 -8.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8471 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1326 -8.0319 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 14.1326 -7.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8471 -6.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4181 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7036 -8.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9891 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9891 -9.2695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2746 -8.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5601 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5601 -9.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8456 -9.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1310 -9.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1310 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8456 -8.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)CNC(=O)NC1CCCCC1", "formula": "C15H30N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a14485f5-3ac5-4d0d-b535-db88a73d973b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "254.4121", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "9a2ab158-1af6-4723-8ba4-a4af6faed4aa", "version": "3", "structure": { "id": "7e6584bf-95df-4b09-898b-1fffd806e1a6", "molfile": "\n Marvin 01132106342D \n\n 18 18 0 0 0 0 999 V2000\n 11.2746 -8.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5601 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5601 -9.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8456 -9.6819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1310 -9.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1310 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8456 -8.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9891 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9891 -9.2695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7036 -8.0319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4181 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1326 -8.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1326 -7.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8471 -6.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8471 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5616 -8.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2760 -8.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9905 -8.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 2 7 1 0 0 0 0\n 1 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)CNC(=O)NC1CCCCC1", "formula": "C15H30N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "254.4121", "optical_activity": "( + / - )", "references": [ "7acd6fd1-39a2-4035-b955-9f2965d48052", "a4f26b01-08d8-445e-991f-6f0f762dde30" ], "stereo_centers": 1 }, "unii": "NFI07NJA7E" } ] }