{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bde21ddf-c338-44c9-8512-980e6c2fae78",
          "code": "15721-78-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15721-78-5",
          "code_system": "CAS",
          "references": [
            "95a7e0c0-4a3a-404c-87fe-f57f3ab77ff3",
            "1fa47a3f-ca37-4ad6-a5c3-99dc6d3f6b89"
          ]
        },
        {
          "uuid": "034d8e69-8712-46ee-a90c-5cf5895625a5",
          "code": "239-816-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.182",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "95a7e0c0-4a3a-404c-87fe-f57f3ab77ff3"
          ]
        },
        {
          "uuid": "5bb8ab48-5442-4d25-ba48-63f5a90bd9d1",
          "code": "85069",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/85069",
          "code_system": "PUBCHEM",
          "references": [
            "95a7e0c0-4a3a-404c-87fe-f57f3ab77ff3"
          ]
        },
        {
          "uuid": "d248a862-67ab-b9d9-78be-3a5325bb7c20",
          "code": "DTXSID3029310",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3029310",
          "code_system": "EPA CompTox",
          "references": [
            "9e641703-954d-600d-36ae-9c4d4450ae6f"
          ]
        },
        {
          "uuid": "d9f0db02-aa90-44b3-9615-a0bed65b99d1",
          "code": "NF06JO4WIX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "481ab7d2-b592-4dbc-a5b7-b70ed498caf1",
          "name": "4,4'-BIS(1,1,3,3-TETRAMETHYLBUTYL)DIPHENYLAMINE",
          "stdName": "4,4'-BIS(1,1,3,3-TETRAMETHYLBUTYL)DIPHENYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40b9434b-76bf-41e2-b070-8188b094edac"
          ],
          "display_name": true
        },
        {
          "uuid": "d3151670-e217-49ff-8aa3-7e3d33cf3f59",
          "name": "4,4'-DI-TERT-OCTYLDIPHENYLAMINE",
          "stdName": "4,4'-DI-TERT-OCTYLDIPHENYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        },
        {
          "uuid": "d7c06996-7e42-4395-a203-ae398d70a920",
          "name": "BENZENAMINE, 4-(1,1,3,3-TETRAMETHYLBUTYL)-N-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENYL)-",
          "stdName": "BENZENAMINE, 4-(1,1,3,3-TETRAMETHYLBUTYL)-N-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        },
        {
          "uuid": "3e329d81-5b23-4b82-8b43-06c3e22ee264",
          "name": "BIS(P-TERT-OCTYLPHENYL)AMINE",
          "stdName": "BIS(P-TERT-OCTYLPHENYL)AMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        },
        {
          "uuid": "defe37d2-0b18-4123-a93e-cc41f246df46",
          "name": "DIPHENYLAMINE, 4,4'-BIS(1,1,3,3-TETRAMETHYLBUTYL)-",
          "stdName": "DIPHENYLAMINE, 4,4'-BIS(1,1,3,3-TETRAMETHYLBUTYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        },
        {
          "uuid": "ff034863-91c0-4d96-888d-9fb230f726dd",
          "name": "N,N-BIS(4-TERT-OCTYLPHENYL)AMINE",
          "stdName": "N,N-BIS(4-TERT-OCTYLPHENYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        },
        {
          "uuid": "548fc0f6-eb26-4052-a4ed-27d89500511d",
          "name": "P,P'-DI-TERT-OCTYLDIPHENYLAMINE",
          "stdName": "P,P'-DI-TERT-OCTYLDIPHENYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        },
        {
          "uuid": "289e6f19-cfa3-4d15-a5a8-3f2b2bf36146",
          "name": "PERMANOX OD",
          "stdName": "PERMANOX OD",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
            "ca17ba39-c126-4223-84f5-ea5d1ce21624"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "40b9434b-76bf-41e2-b070-8188b094edac",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a5f3d702-2f52-4867-927a-c7e7dda3d6a3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca17ba39-c126-4223-84f5-ea5d1ce21624",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95a7e0c0-4a3a-404c-87fe-f57f3ab77ff3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5476411-c4f7-4a2e-b7d9-7b96abce126a",
          "citation": "SRS import [NF06JO4WIX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NF06JO4WIX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e50afd8-d514-4850-9ac3-33e7b447ef5e",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e641703-954d-600d-36ae-9c4d4450ae6f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15721-78-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1fa47a3f-ca37-4ad6-a5c3-99dc6d3f6b89",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2590f3c0-f52a-4f83-a0dc-78994acee5bd",
          "id": "2590f3c0-f52a-4f83-a0dc-78994acee5bd",
          "molfile": "\n  Marvin  01132102052D          \n\n 29 30  0  0  0  0            999 V2000\n   11.6922   -6.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0679   -6.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4090   -7.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4262   -6.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7087   -5.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9102   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2986   -4.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4749   -5.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1969   -4.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4797   -5.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7653   -4.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7653   -3.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0506   -3.4528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3340   -3.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6156   -3.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9019   -3.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9019   -4.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6094   -5.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3340   -4.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2838   -5.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5902   -5.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9746   -4.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4572   -5.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3029   -6.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0250   -6.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1234   -6.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5577   -6.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4824   -3.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1969   -3.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 29  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 28 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 19 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 20  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)Nc2ccc(cc2)C(C)(C)CC(C)(C)C",
          "formula": "C28H43N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "17a52af8-29b1-4875-95a9-9db0a93bb299"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "393.6488",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "976247ed-499f-4642-8028-d687bbdd5811",
      "version": "5",
      "structure": {
        "id": "3a7909e3-87c5-4b6e-9806-b78bae408137",
        "molfile": "\n  Marvin  01132103062D          \n\n 29 30  0  0  0  0            999 V2000\n    7.0506   -3.4528    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7653   -3.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7653   -4.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4797   -5.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1969   -4.6999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1969   -3.8760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4824   -3.4571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9102   -5.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7087   -5.6337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0679   -6.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6922   -6.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4090   -7.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4262   -6.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2986   -4.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4749   -5.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3340   -3.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6156   -3.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9019   -3.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9019   -4.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6094   -5.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3340   -4.6932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2838   -5.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4572   -5.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3029   -6.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0250   -6.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1234   -6.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5577   -6.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5902   -5.7112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9746   -4.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  8 14  1  0  0  0  0\n  8 15  1  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 16  2  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 22 28  1  0  0  0  0\n 22 29  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)Nc2ccc(cc2)C(C)(C)CC(C)(C)C",
        "formula": "C28H43N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "393.6488",
        "optical_activity": "NONE",
        "references": [
          "0e50afd8-d514-4850-9ac3-33e7b447ef5e",
          "c5476411-c4f7-4a2e-b7d9-7b96abce126a"
        ],
        "stereo_centers": 0
      },
      "unii": "NF06JO4WIX"
    }
  ]
}