{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e16d5fdc-41e1-4edd-82f7-b5f5835ace1f",
          "code": "5080-50-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5080-50-2",
          "code_system": "CAS",
          "references": [
            "81429ed4-511f-46b9-bf03-fd62cf4203d3",
            "b164c718-42c1-48a3-b741-4f843aa8fed6"
          ]
        },
        {
          "uuid": "a9b57359-f81e-4c40-954e-25fd88e779bc",
          "code": "C61624",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61624",
          "code_system": "NCI_THESAURUS",
          "references": [
            "81429ed4-511f-46b9-bf03-fd62cf4203d3"
          ]
        },
        {
          "uuid": "b664fc4f-cea1-4575-a6ae-d2a61dc6c85f",
          "code": "476316",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/476316/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "81429ed4-511f-46b9-bf03-fd62cf4203d3"
          ]
        },
        {
          "uuid": "64b1e65d-3ab9-40d5-b080-d7949e95b9e6",
          "code": "m1349",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1349?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "81429ed4-511f-46b9-bf03-fd62cf4203d3"
          ]
        },
        {
          "uuid": "c2d6dc4e-b878-4d77-b7e7-053cce7f63a7",
          "code": "SUB12717MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "81429ed4-511f-46b9-bf03-fd62cf4203d3"
          ]
        },
        {
          "uuid": "02549497-e0c3-902a-9d4c-c24f61503d40",
          "code": "DTXSID3040693",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3040693",
          "code_system": "EPA CompTox",
          "references": [
            "162dd55b-590d-6cff-0bac-c7cea9720044"
          ]
        },
        {
          "uuid": "e25eb3cd-5204-3d98-f298-29f6162edba3",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "45cf0761-624d-1b70-6823-3f854d13470d"
          ]
        },
        {
          "uuid": "f7b687c8-a7bc-43da-8634-ae36eaaa3020",
          "code": "NDW10MX58T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "55f971f1-9440-3870-228a-aa8cb83efcdf",
          "code": "2733928",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2733928",
          "code_system": "PUBCHEM",
          "references": [
            "b7f04ebd-670f-d041-15ea-ce769e231b3f"
          ]
        },
        {
          "uuid": "2f7a2908-2cde-df12-95a9-f9e83058935b",
          "code": "100000077950",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "392ba1f6-b699-c87f-4003-a7ae4ea48db9"
          ]
        },
        {
          "uuid": "1824fc42-1e96-543c-83b4-a90407c26a54",
          "code": "NDW10MX58T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=NDW10MX58T",
          "code_system": "DAILYMED",
          "references": [
            "66735149-44f8-43e7-9641-1082cb048f42"
          ]
        },
        {
          "uuid": "f7bf4db0-6944-fafc-a730-9318618ebec6",
          "code": "747431",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=747431",
          "code_system": "NSC",
          "references": [
            "5ba93cce-db11-2c93-7269-705fa94cf24a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b625c4c7-bceb-4e6c-b0d6-395844b7b4a0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e148c0e5-c191-4c27-affd-5b336e527462",
            "refuuid": "523e21ff-f2d9-4fbb-9842-1e91ad778ba6",
            "name": "LEVOCARNITINE",
            "unii": "0G389FZZ9M",
            "linking_id": "0G389FZZ9M",
            "ref_pname": "LEVOCARNITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5a629714-0892-44fe-b02a-ddef4da1e1bc",
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "related_substance": {
            "uuid": "38e27061-0c8d-4637-8f0f-e2e29e97c82a",
            "refuuid": "a03a8e7c-2b51-48fc-be24-488f16099369",
            "name": "ACETYLCARNITINE",
            "unii": "6DH1W9VH8Q",
            "linking_id": "6DH1W9VH8Q",
            "ref_pname": "ACETYLCARNITINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "24de7d69-df27-4194-b959-e012fad2bbc7",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "5405378b-6179-4e14-8bca-786c2e259ecf",
            "refuuid": "700783ca-fe48-4fcc-b83a-715d9257b5bd",
            "name": "ALTERNATIVE DEFINITION for [LEVACECARNINE HYDROCHLORIDE]",
            "linking_id": "700783ca-fe48-4fcc-b83a-715d9257b5bd",
            "ref_pname": "NO NAME",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "87b998a4-2a29-47e6-b9dd-dbc87fcdc2d7",
          "name": "1-PROPANAMINIUM, 2-(ACETYLOXY)-3-CARBOXY-N,N,N-TRIMETHYL-, CHLORIDE (1:1), (2R)-",
          "stdName": "1-PROPANAMINIUM, 2-(ACETYLOXY)-3-CARBOXY-N,N,N-TRIMETHYL-, CHLORIDE (1:1), (2R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "display_name": false
        },
        {
          "uuid": "50ea41ab-6339-4ede-aa88-b45e73b62103",
          "name": "ACETYL CARNITINE HCL",
          "stdName": "ACETYL CARNITINE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "0168e736-a1ec-4e79-9188-80886b34b109",
            "a61132f4-476f-414c-83d1-16df857f1c83"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f7dce3a7-1de8-4ab0-9cbb-9a368708b332",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f022a581-379f-4e2f-9734-707a494502c0",
          "name": "ACETYL-L-CARNITINE CHLORIDE",
          "stdName": "ACETYL-L-CARNITINE CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce"
          ],
          "display_name": false
        },
        {
          "uuid": "9129096f-1a89-409a-a85d-e732c74ce501",
          "name": "ACETYL-L-CARNITINE HYDROCHLORIDE",
          "stdName": "ACETYL-L-CARNITINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "0168e736-a1ec-4e79-9188-80886b34b109"
          ],
          "display_name": false
        },
        {
          "uuid": "b8d2e597-2939-4bbb-a9b4-a2be0b015d35",
          "name": "ACETYLCARNITINE CHLORIDE",
          "stdName": "ACETYLCARNITINE CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "display_name": false
        },
        {
          "uuid": "5ddaed88-b5d3-45b5-a254-00ff51efbfde",
          "name": "ACETYLCARNITINE HYDROCHLORIDE",
          "stdName": "ACETYLCARNITINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ac96223-d534-4495-a344-359d16f55cfa",
            "39a41a43-45f7-444f-84ce-8dc2f0d02575",
            "cc862136-4322-4053-b307-69647f9e1bbd",
            "eaa1fdba-2b6a-44ef-b6ee-403ede761dae",
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "5b3acb83-f4b9-48e7-8cc0-f6603cf85034",
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce",
            "4bb78fad-9e6c-4fd1-adf1-c90bcde6b3b2"
          ],
          "display_name": false
        },
        {
          "uuid": "d0fb1693-30f9-4c62-9ecf-c0c93eb3a9e2",
          "name": "ACETYLCARNITINE HYDROCHLORIDE [MART.]",
          "stdName": "ACETYLCARNITINE HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39a41a43-45f7-444f-84ce-8dc2f0d02575"
          ],
          "display_name": false
        },
        {
          "uuid": "ea9d741e-fb97-4c56-ad46-c885f66d7524",
          "name": "ACETYLCARNITINE HYDROCHLORIDE [MI]",
          "stdName": "ACETYLCARNITINE HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce"
          ],
          "display_name": false
        },
        {
          "uuid": "4e285484-f5a2-4ef4-8d55-fcfd6177d534",
          "name": "ACETYLCARNITINE HYDROCHLORIDE, L-",
          "stdName": "ACETYLCARNITINE HYDROCHLORIDE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "display_name": false
        },
        {
          "uuid": "7ca0a80b-3b1c-43fe-8ff5-3bb467d282eb",
          "name": "AMMONIUM, (3-CARBOXY-2-HYDROXYPROPYL)TRIMETHYL-, CHLORIDE, ACETATE, (-)-",
          "stdName": "AMMONIUM, (3-CARBOXY-2-HYDROXYPROPYL)TRIMETHYL-, CHLORIDE, ACETATE, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "display_name": false
        },
        {
          "uuid": "b90c3286-4ab5-47dd-3833-77bd1ff6be1e",
          "name": "Acetylcarnitine hydrochloride [WHO-DD]",
          "stdName": "ACETYLCARNITINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc7e065a-4bbe-4897-42c0-cf041c3813d9"
          ],
          "display_name": false
        },
        {
          "uuid": "1394c751-f1df-4569-9cff-4c7d611c183d",
          "name": "BRANIGEN",
          "stdName": "BRANIGEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "display_name": false
        },
        {
          "uuid": "f7352291-215f-40f6-8b07-0e27a7ec589a",
          "name": "LEVACECARNINE HYDROCHLORIDE",
          "stdName": "LEVACECARNINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce"
          ],
          "display_name": true
        },
        {
          "uuid": "4270b1f3-a010-4fe9-85d2-da1c7a823b93",
          "name": "NICETILE",
          "stdName": "NICETILE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce"
          ],
          "display_name": false
        },
        {
          "uuid": "7432dc84-02fe-4667-8bdb-fdddb350ece6",
          "name": "NORMOBREN",
          "stdName": "NORMOBREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "6924e074-8e49-4912-9d77-30cf254008fa"
          ],
          "display_name": false
        },
        {
          "uuid": "f52d5c75-11aa-4126-aad5-42957f49ea0f",
          "name": "NSC-747431",
          "stdName": "NSC-747431",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ba93cce-db11-2c93-7269-705fa94cf24a"
          ],
          "display_name": false
        },
        {
          "uuid": "fbcf3e0a-fec7-41b2-a519-7957dbcd38b4",
          "name": "ORISTAR ACH",
          "stdName": "ORISTAR ACH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "0168e736-a1ec-4e79-9188-80886b34b109"
          ],
          "display_name": false
        },
        {
          "uuid": "f4b6d146-8ed5-4605-9cbb-f53424092447",
          "name": "ST-200",
          "stdName": "ST-200",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce"
          ],
          "display_name": false
        },
        {
          "uuid": "89ad931b-1897-47ab-a591-67b71a864326",
          "name": "ZIBREN",
          "stdName": "ZIBREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b125d1-0e19-44ff-a948-eff28fc185f6",
            "5ffcba51-de17-44bc-b135-85f3a6cf84ce"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6924e074-8e49-4912-9d77-30cf254008fa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f11f369e-930e-45f3-b8cd-a9f4483c9fc1",
          "citation": "ACD 9.0",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ffcba51-de17-44bc-b135-85f3a6cf84ce",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87b125d1-0e19-44ff-a948-eff28fc185f6",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39a41a43-45f7-444f-84ce-8dc2f0d02575",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ac96223-d534-4495-a344-359d16f55cfa",
          "citation": "MART",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0168e736-a1ec-4e79-9188-80886b34b109",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7eea0e88-505f-4371-b403-6225e1cfbd1b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc862136-4322-4053-b307-69647f9e1bbd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81429ed4-511f-46b9-bf03-fd62cf4203d3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cab87e60-977c-4198-9719-c547f659e4e7",
          "citation": "SRS import [NDW10MX58T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NDW10MX58T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389915000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bb78fad-9e6c-4fd1-adf1-c90bcde6b3b2",
          "citation": "ACETYLCARNITINE HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a61132f4-476f-414c-83d1-16df857f1c83",
          "citation": "ACETYL CARNITINE HCL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5b3acb83-f4b9-48e7-8cc0-f6603cf85034",
          "citation": "ACETYLCARNITINE HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eaa1fdba-2b6a-44ef-b6ee-403ede761dae",
          "citation": "ACETYLCARNITINE HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "162dd55b-590d-6cff-0bac-c7cea9720044",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5080-50-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b7f04ebd-670f-d041-15ea-ce769e231b3f",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "45cf0761-624d-1b70-6823-3f854d13470d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b164c718-42c1-48a3-b741-4f843aa8fed6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5ba93cce-db11-2c93-7269-705fa94cf24a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "66735149-44f8-43e7-9641-1082cb048f42",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cc7e065a-4bbe-4897-42c0-cf041c3813d9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "392ba1f6-b699-c87f-4003-a7ae4ea48db9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fb1f71df-23ac-4c28-96d9-a86544daa2ae",
          "id": "fb1f71df-23ac-4c28-96d9-a86544daa2ae",
          "molfile": "\n  Marvin  01132113002D          \n\n  1  0  0  0  1  0            999 V2000\n    0.0059   -0.1839    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a267ac7c-b262-492b-a170-c4d82dea42b0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f72c86c2-a369-4a8d-89f4-a605cbe40ab3",
          "id": "f72c86c2-a369-4a8d-89f4-a605cbe40ab3",
          "molfile": "\n  Marvin  01132112492D          \n\n 14 13  0  0  1  0            999 V2000\n    1.9378    1.2724    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.6527    1.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3677    1.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0710    1.8064    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.3793    0.7091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2228    1.6839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5077    1.2724    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   -0.0613    1.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0788    0.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3181    1.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9378    0.1605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6527   -0.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3677    0.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6498   -1.0769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  1 11  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\nM  CHG  2   4  -1   7   1\nM  END",
          "smiles": "CC(=O)O[C@H](CC(=O)[O-])C[N+](C)(C)C",
          "formula": "C9H17NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2b7f1a0-0c10-4eb2-9d15-73f822b3e535"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "203.2359",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4a0ebe62-033e-434e-ae08-c48fab653f3c",
      "version": "19",
      "structure": {
        "id": "25280ce1-5ef4-4e1b-8e6d-a916a494f2c0",
        "molfile": "\n  Marvin  01132102042D          \n\n 15 13  0  0  1  0            999 V2000\n   13.9090   -3.1956    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   14.6240   -2.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3391   -3.1956    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.0540   -2.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7690   -3.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4723   -2.6616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3391   -4.3075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0540   -4.7190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7690   -4.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0511   -5.5449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7806   -3.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3399   -2.6032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3225   -3.7793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0832   -3.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4071   -4.6519    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  7  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1  2  1  0  0  0  0\n  8 10  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n 12  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1 13  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1 14  1  0  0  0  0\n  3  7  1  1  0  0  0\nM  CHG  2   1   1  15  -1\nM  END",
        "smiles": "CC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-]",
        "formula": "C9H18NO4.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "239.6968",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cab87e60-977c-4198-9719-c547f659e4e7",
          "6924e074-8e49-4912-9d77-30cf254008fa"
        ],
        "stereo_centers": 1
      },
      "unii": "NDW10MX58T"
    }
  ]
}