{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ba2ea434-4be2-47ec-9eda-595016ef0259", "code": "ND5R4S9Y98", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f5d67146-3f49-43fc-a5c6-7db6e0b0fffa", "code": "1507344-37-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1507344-37-7", "code_system": "CAS", "references": [ "76c0691b-9229-47e6-88a8-6b41e486d780" ] }, { "uuid": "adaa00aa-98bd-ed67-6e4f-8e8a2934e229", "code": "118006013", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118006013", "code_system": "PUBCHEM", "references": [ "b42c9d2e-4e5f-40c0-ffdd-fe8d582876e0" ] } ], "relationships": [ { "uuid": "d6342ecd-fcf4-4273-b5c9-528853c8f20d", "amount": { "uuid": "8f685a00-79a5-4e3f-81f7-19d3ffa23040" }, "type": "ACTIVE MOIETY", "references": [ "6fd605c8-f611-47a8-99e9-81b46eb7f7fe" ], "related_substance": { "uuid": "458b960d-ae92-401f-8472-37d92cd042fa", "refuuid": "2b4105d8-ba83-4d1c-998e-7d222d67a795", "name": "Cryosim-3", "unii": "ND5R4S9Y98", "linking_id": "ND5R4S9Y98", "ref_pname": "Cryosim-3", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "a621d10b-016c-43a6-bfbc-ec6a96dbeca5", "name": "1-Di(isopropyl)phosphinoyl-nonane", "stdName": "1-DI(ISOPROPYL)PHOSPHINOYL-NONANE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "76c0691b-9229-47e6-88a8-6b41e486d780" ], "display_name": false }, { "uuid": "187bde1d-8218-4148-9576-de21e7fd9a5d", "name": "Bis(1-methylethyl)nonylphosphine oxide", "stdName": "BIS(1-METHYLETHYL)NONYLPHOSPHINE OXIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "76c0691b-9229-47e6-88a8-6b41e486d780" ], "display_name": false }, { "uuid": "4b9f8e61-0184-4536-b5fa-dd1d3d7340c9", "name": "Cryosim-3", "stdName": "CRYOSIM-3", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b51967f-388d-4d6f-9156-31f76ff13521" ], "display_name": true }, { "uuid": "708f33e4-782d-47b6-b716-95c32db9c90a", "name": "DIPA 1-9", "stdName": "DIPA 1-9", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "76c0691b-9229-47e6-88a8-6b41e486d780" ], "display_name": false }, { "uuid": "d4e081de-41a8-4d19-b495-f9422f28342f", "name": "Diisopropyl nonyl phosphine oxide", "stdName": "DIISOPROPYL NONYL PHOSPHINE OXIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "04dd4db1-977f-45d4-9c58-4020ffeb196d" ], "display_name": false }, { "uuid": "fa9d2a7f-baba-48ff-a1a5-ed800a9606af", "name": "Phosphine oxide, bis(1-methylethyl)nonyl-", "stdName": "PHOSPHINE OXIDE, BIS(1-METHYLETHYL)NONYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "76c0691b-9229-47e6-88a8-6b41e486d780" ], "display_name": false } ], "references": [ { "uuid": "04dd4db1-977f-45d4-9c58-4020ffeb196d", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3b51967f-388d-4d6f-9156-31f76ff13521", "citation": "Sigma-Aldrich", "doc_type": "SIGMA-ALDRICH", "public_domain": true }, { "uuid": "76c0691b-9229-47e6-88a8-6b41e486d780", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6fd605c8-f611-47a8-99e9-81b46eb7f7fe", "citation": "US20200261477\t(Scifinder ref)", "doc_type": "PATENT", "public_domain": true }, { "uuid": "b42c9d2e-4e5f-40c0-ffdd-fe8d582876e0", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "691b71b2-5313-497b-baae-07a809090aef", "id": "691b71b2-5313-497b-baae-07a809090aef", "molfile": "1-Di(isopropyl)phosphinoyl-nonane\n CDK 02112418362D\n1507344-37-7 Copyright (C) 2024 ACS\n 17 16 0 0 0 0 0 0 0 0999 V2000\n 8.8000 -7.3633 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8229 -6.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8457 -7.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8686 -6.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8915 -7.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9143 -6.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9372 -7.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9601 -6.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9829 -7.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0058 -6.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7771 -7.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7543 -7.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7771 -9.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2095 -6.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8000 -5.3175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0284 -6.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3906 -8.3861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 1 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 1 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 1 17 2 0 0 0 0\nM END", "smiles": "CCCCCCCCCP(=O)(C(C)C)C(C)C", "formula": "C15H33OP", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a0dc4339-f162-4641-b434-b26c14fae4a9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "260.3962", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2b4105d8-ba83-4d1c-998e-7d222d67a795", "version": "6", "structure": { "id": "aaad2bb1-efbe-4a08-8e64-9c6652df14e9", "molfile": "1-Di(isopropyl)phosphinoyl-nonane\n JSDraw202112418362D\n\n 17 16 0 0 0 0 0 V2000\n 20.4395 -7.8771 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7905 -7.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1414 -7.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4925 -7.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8435 -7.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1944 -7.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5455 -7.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8965 -7.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2474 -7.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5985 -7.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0884 -8.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7375 -7.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0884 -10.2170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6596 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -5.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0996 -6.5260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2196 -9.2280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 1 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 1 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 1 17 2 0 0 0 0\nM END", "smiles": "CCCCCCCCCP(=O)(C(C)C)C(C)C", "formula": "C15H33OP", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "260.3962", "optical_activity": "NONE", "references": [ "76c0691b-9229-47e6-88a8-6b41e486d780" ], "stereo_centers": 0 }, "unii": "ND5R4S9Y98" } ] }