{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0c32ddf0-a3d0-4bab-a056-1058f5e5d28b",
          "code": "943454-45-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=943454-45-3",
          "code_system": "CAS",
          "references": [
            "aacde615-e859-4e5c-ae8f-ea16002ef63f",
            "ffad6e91-045d-4ab4-a8f0-67ad7c2e064e"
          ]
        },
        {
          "uuid": "71650233-4e99-4a9d-acb8-dd8fd4465144",
          "code": "71587881",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587881",
          "code_system": "PUBCHEM",
          "references": [
            "aacde615-e859-4e5c-ae8f-ea16002ef63f"
          ]
        },
        {
          "uuid": "62d61e24-518f-d50a-b7e1-08389fdb6966",
          "code": "DTXSID40241435",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40241435",
          "code_system": "EPA CompTox",
          "references": [
            "3738205c-b471-a4fa-67c6-ace81f7967cf"
          ]
        },
        {
          "uuid": "9480bea9-4d59-488e-8760-d367b8bb4832",
          "code": "NBY5E976UV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "74d6986b-5858-40f5-903c-65e81888144f",
          "name": "HEXYLDIOXODECYL METHYL TYROSINATE",
          "stdName": "HEXYLDIOXODECYL METHYL TYROSINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "218f009e-544c-4a7f-a462-c5d5797220bd",
            "8310eb61-79ab-4d52-af94-d4713d919427",
            "9a288b16-bc6b-4ac7-be49-5a82b2e66135"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3d917c84-d023-477a-a291-def5c97f6e5f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "34ffbea0-c0ed-4953-9fc4-2a79e481b1c3",
          "name": "K6EAAL-19",
          "stdName": "K6EAAL-19",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "218f009e-544c-4a7f-a462-c5d5797220bd",
            "9a288b16-bc6b-4ac7-be49-5a82b2e66135"
          ],
          "display_name": false
        },
        {
          "uuid": "e9ef5136-cf22-4fc8-8411-2b76deba2820",
          "name": "L-TYROSINE, N-(2-HEXYL-1,3-DIOXODECYL)-, METHYL ESTER",
          "stdName": "L-TYROSINE, N-(2-HEXYL-1,3-DIOXODECYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "218f009e-544c-4a7f-a462-c5d5797220bd",
            "aabb8704-7c78-4cdb-8d11-45dc0629517c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "218f009e-544c-4a7f-a462-c5d5797220bd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aabb8704-7c78-4cdb-8d11-45dc0629517c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aacde615-e859-4e5c-ae8f-ea16002ef63f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391534000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e03f531-b250-4577-95d5-770ef15baf4b",
          "citation": "SRS import [NBY5E976UV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NBY5E976UV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391534000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8310eb61-79ab-4d52-af94-d4713d919427",
          "citation": "HEXYLDIOXODECYL METHYL TYROSINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a288b16-bc6b-4ac7-be49-5a82b2e66135",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3738205c-b471-a4fa-67c6-ace81f7967cf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=943454-45-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ffad6e91-045d-4ab4-a8f0-67ad7c2e064e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a39644bd-1dac-4e33-9088-e5c111fb451a",
          "id": "a39644bd-1dac-4e33-9088-e5c111fb451a",
          "molfile": "\n  Marvin  01132108302D          \n\n 32 32  0  0  1  0            999 V2000\n    9.7546   -3.9810    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.0401   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3257   -3.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3257   -4.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6112   -5.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -4.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1824   -5.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -3.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6112   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7546   -4.8060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -5.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -4.8060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.7546   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0401   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3257   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6112   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1824   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -7.2809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8979   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6123   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3268   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0412   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7556   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4701   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1846   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -2.7435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -3.9810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8979   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  1  0  0  0\n  1 29  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)C(CCCCCC)C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)OC",
          "formula": "C26H41NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "111ba8d7-13f1-4818-b1c3-d4af0a605e46"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "447.6084",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "83625430-cbb5-42e4-b694-fb53cadc3c6e",
      "version": "4",
      "structure": {
        "id": "fff03ddf-d0b6-43db-bd30-0a1bec701a01",
        "molfile": "\n  Marvin  01132113152D          \n\n 32 32  0  0  1  0            999 V2000\n    9.7546   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0401   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3257   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6112   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1824   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -5.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -4.8060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8979   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6123   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3268   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0412   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7556   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4701   -6.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1846   -6.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -7.2809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7546   -4.8060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3257   -4.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6112   -5.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1824   -5.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -4.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8967   -3.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6112   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3257   -3.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0401   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -2.7435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1834   -3.9810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4690   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7546   -3.9810    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.8979   -3.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 10  2  0  0  0  0\n 31 19  1  1  0  0  0\n 26 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 31 27  1  0  0  0  0\n 30 28  2  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n  8 19  1  0  0  0  0\n 29 32  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)C(CCCCCC)C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)OC",
        "formula": "C26H41NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "447.6084",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9e03f531-b250-4577-95d5-770ef15baf4b",
          "aabb8704-7c78-4cdb-8d11-45dc0629517c"
        ],
        "stereo_centers": 2
      },
      "unii": "NBY5E976UV"
    }
  ]
}