{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "39b9d009-5217-4823-97a6-5302faf1376f",
          "code": "54982-83-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54982-83-1",
          "code_system": "CAS",
          "references": [
            "4cd19daf-731f-4d1f-a988-110fdd554656",
            "3238d7b5-511b-423c-9274-49b334312e7a"
          ]
        },
        {
          "uuid": "bd3fe289-f236-43a6-8f08-8665f8955040",
          "code": "C571594",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67571594",
          "code_system": "MESH",
          "references": [
            "4cd19daf-731f-4d1f-a988-110fdd554656"
          ]
        },
        {
          "uuid": "fe79c38a-5547-483c-8c3d-5c36e7636004",
          "code": "259-423-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.054.003",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4cd19daf-731f-4d1f-a988-110fdd554656"
          ]
        },
        {
          "uuid": "e728f194-8ebd-4a31-b36a-9da9d398d41f",
          "code": "41270",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/41270",
          "code_system": "PUBCHEM",
          "references": [
            "4cd19daf-731f-4d1f-a988-110fdd554656"
          ]
        },
        {
          "uuid": "37e4658c-81c3-d5e6-3be8-16759e411488",
          "code": "DTXSID1044568",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1044568",
          "code_system": "EPA CompTox",
          "references": [
            "eb16c8b1-d9fe-b79c-3555-56cc3ff48d68"
          ]
        },
        {
          "uuid": "5cfb5c75-b3d2-4433-b716-aedb573588a8",
          "code": "NBW53A4P49",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "12e9adf2-ceb5-dd8a-1058-1cc97e49a63d",
          "code": "2604565",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2604565/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "53660076-1817-1514-4ebe-d4fc8d5b61ac"
          ]
        },
        {
          "uuid": "417621d9-7b46-e075-fe50-a7a2a4e41c3a",
          "code": "NBW53A4P49",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=NBW53A4P49",
          "code_system": "DAILYMED",
          "references": [
            "594f6260-e286-6103-0e26-bb174bdc8e3f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c4f215d3-4756-41bc-8776-cd677388862c",
          "name": "1,4-DIOXACYCLOHEXADECANE-5,16-DIONE",
          "stdName": "1,4-DIOXACYCLOHEXADECANE-5,16-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b754820-cdf2-4883-817a-416facc14d6b",
            "78287500-a22e-47ed-a511-3f7e9663a36e"
          ],
          "display_name": false
        },
        {
          "uuid": "9ea75630-9686-4b7e-b9fc-8da158112519",
          "name": "CYCLIC ETHYLENE DODECANEDIOATE",
          "stdName": "CYCLIC ETHYLENE DODECANEDIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b754820-cdf2-4883-817a-416facc14d6b",
            "78287500-a22e-47ed-a511-3f7e9663a36e"
          ],
          "display_name": false
        },
        {
          "uuid": "0de01a53-1ef7-4cf1-b2b9-70fe56582eb4",
          "name": "ETHYLENE DODECANEDIOATE",
          "stdName": "ETHYLENE DODECANEDIOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b754820-cdf2-4883-817a-416facc14d6b",
            "b389b57a-77d9-4bc8-868f-7d5533d4ea08",
            "78287500-a22e-47ed-a511-3f7e9663a36e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ca1064ca-6458-4730-8206-47fb6238cf40",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "37b55a62-bb96-4603-b3c9-f9d6d2b966e9",
          "name": "ETHYLENE DODECANEDIOATE (RIFM)",
          "stdName": "ETHYLENE DODECANEDIOATE (RIFM)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b754820-cdf2-4883-817a-416facc14d6b",
            "120e8a6d-4776-460f-9708-f89b4d5cbbc3"
          ],
          "display_name": false
        },
        {
          "uuid": "42a0acfa-5b74-4afc-9c8c-6eb5af2659de",
          "name": "MUSK C-14",
          "stdName": "MUSK C-14",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b754820-cdf2-4883-817a-416facc14d6b",
            "78287500-a22e-47ed-a511-3f7e9663a36e"
          ],
          "display_name": false
        },
        {
          "uuid": "482c7dcf-d888-4b23-9d46-b16b1db172cf",
          "name": "ZENOLIDE",
          "stdName": "ZENOLIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b754820-cdf2-4883-817a-416facc14d6b",
            "78287500-a22e-47ed-a511-3f7e9663a36e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "120e8a6d-4776-460f-9708-f89b4d5cbbc3",
          "citation": "PCPC-BD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cd19daf-731f-4d1f-a988-110fdd554656",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7f8f490-ef0d-4833-87c5-a6960bc6dcec",
          "citation": "SRS import [NBW53A4P49]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=NBW53A4P49",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391523000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3c962c5-25a4-4afd-a1c3-bfe0cf434fab",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b389b57a-77d9-4bc8-868f-7d5533d4ea08",
          "citation": "ETHYLENE DODECANEDIOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78287500-a22e-47ed-a511-3f7e9663a36e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1b754820-cdf2-4883-817a-416facc14d6b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb16c8b1-d9fe-b79c-3555-56cc3ff48d68",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=54982-83-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53660076-1817-1514-4ebe-d4fc8d5b61ac",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "3238d7b5-511b-423c-9274-49b334312e7a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "594f6260-e286-6103-0e26-bb174bdc8e3f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0cf03956-d843-4f34-bb8d-63e2ddf0552c",
          "id": "0cf03956-d843-4f34-bb8d-63e2ddf0552c",
          "molfile": "\n  Marvin  01132100552D          \n\n 18 18  0  0  0  0            999 V2000\n    2.0171   -8.1887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8404   -8.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3679   -8.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1342   -8.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8741   -8.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5600   -8.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2999   -8.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9859   -8.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7856   -8.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2258   -7.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6983   -7.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9319   -7.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1920   -7.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1381   -6.2651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5061   -7.5467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7662   -7.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0802   -7.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2806   -7.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n 18  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "C1CCCCCC(=O)OCCOC(=O)CCCC1",
          "formula": "C14H24O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90a2b2fd-f805-4281-8c3b-f539793443cb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "256.3385",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "66246874-39bf-49d1-9f63-ada3a03682e8",
      "version": "7",
      "structure": {
        "id": "780e1bbe-4877-4434-a0f9-55f50b5d96fa",
        "molfile": "\n  Marvin  01132106142D          \n\n 18 18  0  0  0  0            999 V2000\n    4.7662   -7.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5061   -7.5467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0802   -7.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2806   -7.4371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8404   -8.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3679   -8.7691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1342   -8.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8741   -8.8283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5600   -8.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2999   -8.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9859   -8.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7856   -8.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2258   -7.7818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6983   -7.1475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9319   -7.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1920   -7.0883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0171   -8.1887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1381   -6.2651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  2 16  1  0  0  0  0\n  5 17  2  0  0  0  0\n 16 18  2  0  0  0  0\nM  END",
        "smiles": "C1CCCCCC(=O)OCCOC(=O)CCCC1",
        "formula": "C14H24O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "256.3385",
        "optical_activity": "NONE",
        "references": [
          "b3c962c5-25a4-4afd-a1c3-bfe0cf434fab",
          "c7f8f490-ef0d-4833-87c5-a6960bc6dcec"
        ],
        "stereo_centers": 0
      },
      "unii": "NBW53A4P49"
    }
  ]
}