{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "92e17598-b762-448f-9b19-280206b83fef", "code": "6410-32-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6410-32-8", "code_system": "CAS", "references": [ "d02e3ce4-db8c-4bf4-8c98-e0070b61df08", "3aff4da2-0ad6-4442-82bd-4f9283d1a1b4" ] }, { "uuid": "31363806-f029-4b5e-80f2-3488df7aa773", "code": "229-102-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.456", "code_system": "ECHA (EC/EINECS)", "references": [ "d02e3ce4-db8c-4bf4-8c98-e0070b61df08" ] }, { "uuid": "e51f24f9-0a95-6849-567a-bbac4d889086", "code": "DTXSID0064333", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0064333", "code_system": "EPA CompTox", "references": [ "38a84335-63ec-9ebc-26b9-6b4276879011" ] }, { "uuid": "bbe98753-14b5-41da-885d-d635cc20826c", "code": "NBU8SDR4UU", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "3aff4da2-0ad6-4442-82bd-4f9283d1a1b4" ] }, { "uuid": "92ebaf32-fe54-41c3-96f0-a782230a9cc6", "code": "80857", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/80857", "code_system": "PUBCHEM" } ], "substance_class": "chemical", "names": [ { "uuid": "fde96728-3f34-4835-9138-dd49862efaf2", "name": "2-Naphthalenecarboxamide, 3-hydroxy-4-[2-(2-methyl-4-nitrophenyl)diazenyl]-N-(2-methylphenyl)-", "stdName": "2-NAPHTHALENECARBOXAMIDE, 3-HYDROXY-4-(2-(2-METHYL-4-NITROPHENYL)DIAZENYL)-N-(2-METHYLPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "09396d74-1fc5-4c28-a958-491234896bfe" ], "display_name": true }, { "uuid": "0f0752bf-689e-45b2-b57f-984e3e73f91b", "name": "3-Hydroxy-4-[2-(2-methyl-4-nitrophenyl)diazenyl]-N-(2-methylphenyl)-2-naphthalenecarboxamide", "stdName": "3-HYDROXY-4-(2-(2-METHYL-4-NITROPHENYL)DIAZENYL)-N-(2-METHYLPHENYL)-2-NAPHTHALENECARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3aff4da2-0ad6-4442-82bd-4f9283d1a1b4" ], "display_name": false }, { "uuid": "d585b3d6-8549-4095-8a5e-b67ef55e2011", "name": "C.I. Pigment Red 12", "stdName": "C.I. PIGMENT RED 12", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3aff4da2-0ad6-4442-82bd-4f9283d1a1b4" ], "display_name": false }, { "uuid": "c5c238d4-31f7-4e19-812a-42ade584c2c6", "name": "PERMANENT BORDEAUX F2R", "stdName": "PERMANENT BORDEAUX F2R", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3aff4da2-0ad6-4442-82bd-4f9283d1a1b4" ], "display_name": false } ], "references": [ { "uuid": "09396d74-1fc5-4c28-a958-491234896bfe", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d02e3ce4-db8c-4bf4-8c98-e0070b61df08", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392364000, "tags": [ "NOMEN" ] }, { "uuid": "38a84335-63ec-9ebc-26b9-6b4276879011", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6410-32-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3aff4da2-0ad6-4442-82bd-4f9283d1a1b4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4071e6c9-8a29-40ff-9576-da91ec5396df", "id": "4071e6c9-8a29-40ff-9576-da91ec5396df", "molfile": "\n Marvin 01132103242D \n\n 33 36 0 0 0 0 999 V2000\n 2.1623 -5.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4444 -4.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7265 -5.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0086 -4.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7265 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4444 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1623 -3.6932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1623 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4358 -2.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8888 -2.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8802 -1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -1.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -0.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3332 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -1.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3246 -1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3246 -2.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0425 -2.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -3.6932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7690 -4.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4869 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -4.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4955 -5.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7690 -4.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -5.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9313 -5.3365 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 7.9313 -6.1582 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.6492 -4.9214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -3.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 32 2 0 0 0 0\n 13 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 18 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 32 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 27 2 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 2 0 0 0 0\n 25 29 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 32 33 1 0 0 0 0\nM CHG 2 29 1 30 -1\nM END", "smiles": "Cc1ccccc1NC(=O)c2cc3ccccc3c(c2O)/N=N/c4ccc(cc4C)[N+](=O)[O-]", "formula": "C25H20N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "302ba2e0-6e2e-4092-b02a-dfd0c4ddd856" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "440.4516", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5b958a71-9130-4f21-8f3d-59b78caa7532", "version": "6", "structure": { "id": "36adfbeb-faaf-49a3-bd3c-2d086771595c", "molfile": "\n Marvin 01132102552D \n\n 33 36 0 0 0 0 999 V2000\n 1.4358 -2.4650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1623 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1623 -3.6932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4444 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4444 -4.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7265 -5.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0086 -4.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7265 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1623 -5.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8888 -2.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -2.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -3.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3246 -2.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0425 -2.8715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -3.6932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7690 -4.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7690 -4.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4955 -5.3365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -4.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9313 -5.3365 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 7.9313 -6.1582 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.6492 -4.9214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2134 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4869 -3.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -5.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3246 -1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -1.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6067 -0.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3332 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -0.4152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0511 -1.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8802 -1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 11 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 6 2 0 0 0 0\n 5 10 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 33 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 27 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 25 2 0 0 0 0\n 18 19 2 0 0 0 0\n 18 26 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 24 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 24 25 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 32 2 0 0 0 0\n 28 29 2 0 0 0 0\n 28 33 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\nM CHG 2 21 1 22 -1\nM END", "smiles": "Cc1ccccc1NC(=O)c2cc3ccccc3c(c2O)/N=N/c4ccc(cc4C)[N+](=O)[O-]", "formula": "C25H20N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "440.4516", "optical_activity": "NONE", "references": [ "09396d74-1fc5-4c28-a958-491234896bfe" ], "stereo_centers": 0 }, "unii": "NBU8SDR4UU" } ] }