{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c25f31c7-8031-0e5b-b5fe-bce084c9720a",
          "code": "1294284",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1294284",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "4c0a11eb-9001-f408-a788-3fb88990729e"
          ]
        },
        {
          "uuid": "261052ba-3d8c-4040-ac0e-a4dcdd52d51e",
          "code": "885329-49-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=885329-49-7",
          "code_system": "CAS",
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ]
        },
        {
          "uuid": "d9d6a79d-185e-8631-d177-8019a7ba6f6d",
          "code": "DTXSID301044769",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301044769",
          "code_system": "EPA CompTox",
          "references": [
            "cbc761a5-c569-ff84-00bb-e32dfdd362db"
          ]
        },
        {
          "uuid": "8cf31979-d119-97d8-113a-81cfa2f01820",
          "code": "1113-83-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1113-83-3",
          "code_system": "CAS",
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ]
        },
        {
          "uuid": "42694638-2322-5340-f235-0292e2f5eb6e",
          "code": "123802",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/123802",
          "code_system": "PUBCHEM",
          "references": [
            "ecc36852-3420-5e55-f19e-9827f4543f63"
          ]
        },
        {
          "uuid": "10919afe-9a16-9c18-c4e1-3d25275b03e5",
          "code": "N-Glycolylneuraminic acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Glycolylneuraminic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "2de3a171-79b8-b583-ae13-9463f5832316"
          ]
        },
        {
          "uuid": "21a2a900-ce1e-4d0a-aff3-ddfe5949ab15",
          "code": "NB446XTC7L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d0351ff2-94a8-4091-bd53-0532d7f779d4",
          "code": "80124-69-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80124-69-2",
          "code_system": "CAS",
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "ecc36852-3420-5e55-f19e-9827f4543f63",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2de3a171-79b8-b583-ae13-9463f5832316",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8271c9d0-11f5-231e-d295-6cf47ecd139a",
          "citation": "ZINC",
          "url": "http://zinc.docking.org/substances/subsets/in-vivo/",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "af905b2c-9d39-4645-9b5d-bce2c0aafaac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4c0a11eb-9001-f408-a788-3fb88990729e",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "cbc761a5-c569-ff84-00bb-e32dfdd362db",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da4297b1-1a05-4c74-9e6b-8aae50735b2b",
          "id": "da4297b1-1a05-4c74-9e6b-8aae50735b2b",
          "molfile": "\n  Marvin  07222210532D          \n\n 22 21  0  0  1  0            999 V2000\n    3.5723    1.2375    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8578    0.8250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2868    0.8250    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.5723    2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    1.2375    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.8578    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.8250    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1434    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7157    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0013    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2868    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4302    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7157    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7157    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1446    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4302    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  6  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  1  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  6  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  1  0  0  0\n  7 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 15  1  0  0  0  0\n 10 16  1  6  0  0  0\n 12 17  1  0  0  0  0\n 12 18  2  0  0  0  0\n 13 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 17 22  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)NC(=O)CO)O)C(=O)C(=O)O",
          "formula": "C11H19NO10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "60b2e085-047a-4d71-8e06-7a2eaf159043"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "325.2697",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8d2d1a96-6335-4c2f-a4d4-17e52b5e425d",
      "version": "14",
      "structure": {
        "id": "ab5df3ce-0787-4608-9b31-2c3f59358bd6",
        "molfile": "Glycolylneuraminic acid\n   JSDraw207222210532D\n\n 22 21  0  0  1  0              0 V2000\n   25.1680   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.1680   -6.9160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4660   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8170  -10.8160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190  -10.8160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -6.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1150   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4660   -6.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -9.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8700   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.5190   -4.5760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7640   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1150  -10.8160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5720   -8.4760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210  -10.8160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2210   -6.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4130   -9.2560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.9230   -9.2560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   30.5720   -6.9160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  6  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  1  0  0  0\n  3  7  1  0  0  0  0\n  3  8  1  6  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  1  1  0  0  0\n  7 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 15  1  0  0  0  0\n 10 16  1  6  0  0  0\n 12 17  1  0  0  0  0\n 12 18  2  0  0  0  0\n 13 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 17 21  1  0  0  0  0\n 17 22  2  0  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)NC(=O)CO)O)C(=O)C(=O)O",
        "formula": "C11H19NO10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "325.2697",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8271c9d0-11f5-231e-d295-6cf47ecd139a",
          "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
        ],
        "stereo_centers": 5
      },
      "unii": "NB446XTC7L",
      "relationships": [
        {
          "uuid": "dcdcc7cc-5e7a-4f07-b66c-5620cf507566",
          "amount": {
            "uuid": "4cf9c46f-7964-4c59-9a0a-df73aea3844a"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "f287b04c-1321-437b-8deb-339392d371f1",
            "refuuid": "e9c3b9ab-eaec-4451-9377-27a12058058f",
            "name": "ALTERNATIVE DEFINITION for [N-Glycolylneuraminic acid]",
            "linking_id": "e9c3b9ab-eaec-4451-9377-27a12058058f",
            "ref_pname": "NO NAME",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "1d02275f-e12e-25bc-3d42-89573e6e5da7",
          "name": "(2S,4S,5R,6R)-2,4-Dihydroxy-5-(2-hydroxyacetamido)-6-((1R,2R)-1,2,3-trihydroxypropyl)tetrahydro-2H-pyran-2-carboxylic acid",
          "stdName": "(2S,4S,5R,6R)-2,4-DIHYDROXY-5-(2-HYDROXYACETAMIDO)-6-((1R,2R)-1,2,3-TRIHYDROXYPROPYL)TETRAHYDRO-2H-PYRAN-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8271c9d0-11f5-231e-d295-6cf47ecd139a",
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ],
          "display_name": false
        },
        {
          "uuid": "8c2e0793-1b9d-46d3-bdc7-3ff85438c68e",
          "name": "D-glycero-D-galacto-2-Nonulosonic acid, 3,5-dideoxy-5-[(hydroxyacetyl)amino]-",
          "stdName": "D-GLYCERO-D-GALACTO-2-NONULOSONIC ACID, 3,5-DIDEOXY-5-((HYDROXYACETYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ],
          "display_name": false
        },
        {
          "uuid": "01694ee1-d8ed-4870-ba66-67b8aae76e42",
          "name": "D-glycero-D-galacto-Nonulosonic acid, 3,5-dideoxy-5-glycolamido-",
          "stdName": "D-GLYCERO-D-GALACTO-NONULOSONIC ACID, 3,5-DIDEOXY-5-GLYCOLAMIDO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ],
          "display_name": false
        },
        {
          "uuid": "b1218c67-55c6-461a-a252-d434fe5c5ce4",
          "name": "N-(2-Hydroxyacetyl)-β-neuraminic acid",
          "stdName": "N-(2-HYDROXYACETYL)-.BETA.-NEURAMINIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ],
          "display_name": false
        },
        {
          "uuid": "cda8aaf4-8520-4665-b5cc-73924d4c140e",
          "name": "N-Glycolylneuraminic acid",
          "stdName": "N-GLYCOLYLNEURAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2de3a171-79b8-b583-ae13-9463f5832316"
          ],
          "display_name": true
        },
        {
          "uuid": "35b82c07-e756-4749-8866-9d96719be6fd",
          "name": "Neu5Gc",
          "stdName": "NEU5GC",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ],
          "display_name": false
        },
        {
          "uuid": "7999b2d0-024d-4989-8a65-272fb833b045",
          "name": "Neuraminic acid, N-(2-hydroxyacetyl)-",
          "stdName": "NEURAMINIC ACID, N-(2-HYDROXYACETYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af905b2c-9d39-4645-9b5d-bce2c0aafaac"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "e527d496-d3cc-4fd4-82bb-05ad9a3b0814"
      }
    }
  ]
}