{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b4b299a1-e3d3-4b4e-b03a-1e6ab70f6798", "code": "224047-41-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=224047-41-0", "code_system": "CAS", "references": [ "f6700d09-69eb-41c7-8ea8-04594f00f45b", "8c485733-9abe-4f48-85e2-be063b004f4b" ] }, { "uuid": "b03675c8-ee44-4d8d-bd88-29e9e4ec8612", "code": "280129-83-1", "type": "ALTERNATIVE", "url": "https://commonchemistry.cas.org/detail?cas_rn=280129-83-1", "code_system": "CAS", "references": [ "f6700d09-69eb-41c7-8ea8-04594f00f45b", "29b007e6-502c-4b77-9ee4-c610d21a9074" ] }, { "uuid": "e903f4fa-4c9c-43fe-a77b-38acd0339f3c", "code": "15477807", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15477807", "code_system": "PUBCHEM", "references": [ "f6700d09-69eb-41c7-8ea8-04594f00f45b" ] }, { "uuid": "18d57ec5-b868-c3fd-11cd-9ba9c1ada2cc", "code": "DTXSID1043708", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1043708", "code_system": "EPA CompTox", "references": [ "58d447f7-63c1-ed3d-d351-dc2fc9a8cfa7" ] }, { "uuid": "6500ece6-c28f-48ef-bacd-8c6241f7200d", "code": "N9XRW3TF90", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "293a184f-51b7-4ba1-a5bb-b2854d122aa7", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5ecd3e1f-fe80-45b4-96a9-72b25c7df06e", "refuuid": "401c76b4-84d0-4ec3-97a7-e1051d20fe2c", "name": "BRASSINAZOLE", "unii": "N9XRW3TF90", "linking_id": "N9XRW3TF90", "ref_pname": "BRASSINAZOLE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "dc2318c3-d0ad-41a9-b335-ab7cf83e8197", "name": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .BETA.-((4-CHLOROPHENYL)METHYL)-.ALPHA.-METHYL-.ALPHA.-PHENYL-", "stdName": "1H-1,2,4-TRIAZOLE-1-ETHANOL, .BETA.-((4-CHLOROPHENYL)METHYL)-.ALPHA.-METHYL-.ALPHA.-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0049d255-6f6f-4a04-8d33-36b5dfa628e4" ], "display_name": false }, { "uuid": "72d5788c-b1c2-4410-9104-1eb2237c75bf", "name": "BRASSINAZOLE", "stdName": "BRASSINAZOLE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cb9e1215-b210-4336-859b-21d44fdef5cc" ], "display_name": true } ], "references": [ { "uuid": "cb9e1215-b210-4336-859b-21d44fdef5cc", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0049d255-6f6f-4a04-8d33-36b5dfa628e4", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f6700d09-69eb-41c7-8ea8-04594f00f45b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393374000, "tags": [ "NOMEN" ] }, { "uuid": "f4a87867-fc79-40bb-8b8c-78958602841b", "citation": "SRS import [N9XRW3TF90]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N9XRW3TF90", "doc_type": "SRS", "public_domain": true, "document_date": 1493393374000, "tags": [ "NOMEN" ] }, { "uuid": "58d447f7-63c1-ed3d-d351-dc2fc9a8cfa7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=224047-41-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "29b007e6-502c-4b77-9ee4-c610d21a9074", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "8c485733-9abe-4f48-85e2-be063b004f4b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "108cdc8d-fae2-49d5-80ed-9eaeb5785905", "id": "108cdc8d-fae2-49d5-80ed-9eaeb5785905", "molfile": "\n Marvin 01132101052D \n\n 23 25 0 0 0 0 999 V2000\n 1.4329 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1462 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.1462 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8594 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 3.5726 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2794 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9927 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7123 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7123 -2.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4256 -2.4738 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9927 -2.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2794 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8594 -2.0562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5276 -2.5445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2706 -3.3285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4417 -3.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1847 -2.5445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4329 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4329 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7132 -2.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7132 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 18 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 13 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 12 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 17 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 19 1 0 0 0 0\n 18 23 2 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 21 2 0 0 0 0\n 23 22 1 0 0 0 0\nM END", "smiles": "CC(c1ccccc1)(C(Cc2ccc(cc2)Cl)n3cncn3)O", "formula": "C18H18ClN3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "74f7efb4-e27e-410a-a24d-e83fde7d98f3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "327.8086", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "INCOMPLETE", "uuid": "401c76b4-84d0-4ec3-97a7-e1051d20fe2c", "version": "3", "structure": { "id": "1db21977-4347-4663-b564-27281bc7e98b", "molfile": "\n Marvin 01132101432D \n\n 23 25 0 0 0 0 999 V2000\n 1.4329 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4329 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7132 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7132 -2.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1462 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8594 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1462 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4329 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8594 -2.0562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5276 -2.5445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1847 -2.5445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2706 -3.3285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4417 -3.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5726 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2794 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9927 -0.8289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2794 -2.0690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7123 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9927 -2.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7123 -2.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4256 -2.4738 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 2 0 0 0 0\n 1 7 1 0 0 0 0\n 2 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 8 16 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "CC(c1ccccc1)(C(Cc2ccc(cc2)Cl)n3cncn3)O", "formula": "C18H18ClN3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "327.8086", "optical_activity": "( + / - )", "references": [ "f4a87867-fc79-40bb-8b8c-78958602841b", "cb9e1215-b210-4336-859b-21d44fdef5cc" ], "stereo_centers": 2 }, "unii": "N9XRW3TF90" } ] }