{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "690a9ca2-22ff-47fb-b249-44a897a191cd",
          "code": "59-02-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=59-02-9",
          "code_system": "CAS",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b",
            "c87d06c1-9008-4308-bba6-4d710a4c0a32"
          ]
        },
        {
          "uuid": "fb50a677-24d3-411f-baa3-a7f5aa70c6df",
          "code": "C2832",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2832",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "597604c6-cf56-4172-b547-765b10fc4d8f",
          "code": "INS-307A",
          "comments": "Codex Alimentarius|Functional Classification|Antioxidant",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=3",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "183d421f-38a2-48c0-b3f6-65b9b4288b7f",
          "code": "INS-307A",
          "comments": "JECFA|Functional Classification|ANTIOXIDANT|NUTRIENT SUPPLEMENT",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=307a",
          "code_system": "JECFA EVALUATION",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "5536d52f-6bfb-4b29-9c5e-b0c63966aba7",
          "code": "220892",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/220892/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "d21354e9-6658-4ec7-8862-e9bf03beb91f",
          "code": "m10923",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10923?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "ef9dcf1d-f9f8-4dbb-bd66-066a1e565528",
          "code": "DB00163",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00163",
          "code_system": "DRUG BANK",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "969b95b6-31bc-4135-a3d1-96cedae77fe8",
          "code": "SUB124293",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "57b04faf-0530-4030-9a83-33ebdb983158",
          "code": "200-412-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.375",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "78317c4d-e19f-4c96-af10-5b202df0cea9",
          "code": "14985",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14985",
          "code_system": "PUBCHEM",
          "references": [
            "a7a21d53-7a31-42a5-b490-4f6de2c8f17b"
          ]
        },
        {
          "uuid": "d5d84e8f-2ace-bac5-0458-e85686185d62",
          "code": "2556",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2556",
          "code_system": "HSDB",
          "references": [
            "ef581268-bee9-499d-c91e-55d316854661"
          ]
        },
        {
          "uuid": "a8ceed1f-d5c9-cd6c-e3d4-88f661fd6f9c",
          "code": "DTXSID0026339",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0026339",
          "code_system": "EPA CompTox",
          "references": [
            "8b310643-4552-a447-1547-c24e919ebb1f"
          ]
        },
        {
          "uuid": "0553af7d-c2b7-c134-367b-b15a47df32a7",
          "code": "C74960",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Tocopherol[C68313]|Alpha-Tocopherol",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74960",
          "code_system": "NCI_THESAURUS",
          "references": [
            "beb9e9f2-be8e-d29e-8ddc-956c1d09bcf0"
          ]
        },
        {
          "uuid": "ae8177b7-b418-49cf-98dd-884f7f93e3a7",
          "code": "N9PR3490H9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b5808e4d-44c2-a74b-b4be-d49c97dbf2a3",
          "code": "18145",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18145",
          "code_system": "CHEBI",
          "references": [
            "beb9e9f2-be8e-d29e-8ddc-956c1d09bcf0"
          ]
        },
        {
          "uuid": "839e7f7d-4abc-43b5-ed4e-feb7dc1416fc",
          "code": "α-Tocopherol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/%CE%91-Tocopherol",
          "code_system": "WIKIPEDIA",
          "references": [
            "af4816e6-6383-8118-01dc-9ac037e2ed52"
          ]
        },
        {
          "uuid": "14902691-0b0e-b857-bf09-1dbe6800ae48",
          "code": "100000145646",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "31a47c78-67f6-da09-00d2-14eb41566132"
          ]
        },
        {
          "uuid": "5ca497c1-e9a0-1c99-12c9-397b234389a6",
          "code": "20812",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=20812",
          "code_system": "NSC",
          "references": [
            "9cbd6ed4-4182-df30-6fd5-55322a4a72e2"
          ]
        },
        {
          "uuid": "2561ec0e-cb0e-fce2-e42f-a7e2378e2a2c",
          "code": "N9PR3490H9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=N9PR3490H9",
          "code_system": "DAILYMED",
          "references": [
            "6b0fd230-d509-8687-f044-a90d52937f6e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2aaad693-936c-402a-af77-435777294d9e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "2a567983-e08e-47a1-801d-546b16509db2",
            "refuuid": "d892b64e-3573-4e4c-b87c-0cf7f98c3073",
            "name": ".ALPHA.-TOCOPHEROL, D-",
            "unii": "N9PR3490H9",
            "linking_id": "N9PR3490H9",
            "ref_pname": ".ALPHA.-TOCOPHEROL, D-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "69b703d5-b858-42e3-978e-c2dd00ddd74b",
          "amount": {
            "uuid": "c35aa5c0-281e-44c5-be56-6cf7de17957f",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 94.5
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (GC)",
          "references": [
            "2e51ede4-7ceb-4882-af94-7050686787c0"
          ],
          "related_substance": {
            "uuid": "5290c4fa-2989-4ea2-9a92-5914f1dc410f",
            "refuuid": "d892b64e-3573-4e4c-b87c-0cf7f98c3073",
            "name": ".ALPHA.-TOCOPHEROL, D-",
            "unii": "N9PR3490H9",
            "linking_id": "N9PR3490H9",
            "ref_pname": ".ALPHA.-TOCOPHEROL, D-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f4af5aa4-e1c6-4cda-bcc4-f9f53b1c45bf",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "2e51ede4-7ceb-4882-af94-7050686787c0"
          ],
          "related_substance": {
            "uuid": "ad52a313-aa16-439a-b36a-b62859a8f4b6",
            "refuuid": "301ba6e1-f3fd-4a1f-8e9e-e35c29755f41",
            "name": ".DELTA.-TOCOPHEROL",
            "unii": "JU84X1II0N",
            "linking_id": "JU84X1II0N",
            "ref_pname": ".DELTA.-TOCOPHEROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bd804123-c013-4ab0-bbd4-eaca63bc101b",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "2e51ede4-7ceb-4882-af94-7050686787c0"
          ],
          "related_substance": {
            "uuid": "b0195190-591a-4830-8b23-f58402f2431d",
            "refuuid": "30fa44ac-88c9-43f7-b136-eb221c19ff91",
            "name": ".BETA.-TOCOPHEROL",
            "unii": "9U6A490501",
            "linking_id": "9U6A490501",
            "ref_pname": ".BETA.-TOCOPHEROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ab399efd-132d-4398-8cbb-5caaf6a7d6b5",
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "2e51ede4-7ceb-4882-af94-7050686787c0"
          ],
          "related_substance": {
            "uuid": "95c0ed58-dc80-4919-9275-df42b6566696",
            "refuuid": "d1f599df-c926-4fe5-9c63-c3a1629b5625",
            "name": ".GAMMA.-TOCOPHEROL",
            "unii": "8EF1Z1238F",
            "linking_id": "8EF1Z1238F",
            "ref_pname": ".GAMMA.-TOCOPHEROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "521bce3f-169f-4131-b23a-474f205e1341",
          "type": "PRODRUG->METABOLITE ACTIVE",
          "references": [
            "4b6d5bf2-0669-4c63-961b-5f85fba53b53"
          ],
          "related_substance": {
            "uuid": "c68739c6-4ce8-4a80-9725-31cda354fe92",
            "refuuid": "adb363b9-f919-43fe-9c7e-fd5b55ff737d",
            "name": "TOCOPHERYL GLUCOSIDE",
            "unii": "9CKD1JE38R",
            "linking_id": "9CKD1JE38R",
            "ref_pname": "TOCOPHERYL GLUCOSIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7326e634-e2ce-4669-a50c-4db16e11a7bd",
          "name": "(+)-ALPHA-TOCOPHEROL-",
          "stdName": "(+)-ALPHA-TOCOPHEROL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27ce3703-3b55-48ff-b4cd-3d50d422b470"
          ],
          "display_name": false
        },
        {
          "uuid": "41fc2c3a-f8e2-4cac-a3d5-189f9ea2746b",
          "name": ".ALPHA.-TOCOPHEROL [MI]",
          "stdName": ".ALPHA.-TOCOPHEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eec2c958-c96f-4838-a44f-0fe8f7b62dcb"
          ],
          "display_name": false
        },
        {
          "uuid": "c2e19b4e-c2ff-4e41-b66f-04878add95c2",
          "name": ".ALPHA.-TOCOPHEROL, D-",
          "stdName": ".ALPHA.-TOCOPHEROL, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ff3b7ff-69be-4d5c-8ddc-39009efc3ac7"
          ],
          "display_name": true
        },
        {
          "uuid": "fdfe90c3-f59f-4b07-ab55-cb5dbcc9940d",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-, (2R)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f4eb0db-23c1-4b64-8dbf-0fb34a0c6830"
          ],
          "display_name": false
        },
        {
          "uuid": "0936c8d8-b613-429b-9118-b3c686e644b1",
          "name": "5,7,8-TRIMETHYLTOCOL",
          "stdName": "5,7,8-TRIMETHYLTOCOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1036d8b9-f84f-4440-834f-b64ca4f54d2b"
          ],
          "display_name": false
        },
        {
          "uuid": "9fc2706c-fd2a-4503-9633-4623b54372e6",
          "name": "ALPHA-TOCOPHEROL (CONSTITUENT OF LYCOPENE AND TOMATO EXTRACT CONTAINING LYCOPENE) [DSC]",
          "stdName": "ALPHA-TOCOPHEROL (CONSTITUENT OF LYCOPENE AND TOMATO EXTRACT CONTAINING LYCOPENE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5c4db6d-1f97-4140-b377-d609a8995a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "c94fe682-5e66-41c7-adbf-6dc083911338",
          "name": "ALPHA-TOCOPHEROL [HSDB]",
          "stdName": "ALPHA-TOCOPHEROL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adf051ef-f87f-45c4-bde7-59a4a6ccfd6d"
          ],
          "display_name": false
        },
        {
          "uuid": "7a07eec1-314a-4838-8b50-31a2def3f9a5",
          "name": "ALPHA-TOCOPHEROL, D-",
          "stdName": "ALPHA-TOCOPHEROL, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53e134fa-0f3a-4e29-8d3f-ab82d2f3a3bd"
          ],
          "display_name": false
        },
        {
          "uuid": "583e9606-2e18-4481-96e8-271e10c6ed04",
          "name": "D-ALPHA TOCOPHEROL",
          "stdName": "D-ALPHA TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cefbd538-089f-45a4-a169-e20d49089b94",
            "3eda151b-1479-4097-ae61-bfe5be306f26",
            "14a7c69c-63ae-4a0d-97ac-55fa0a89b761"
          ],
          "display_name": false
        },
        {
          "uuid": "5fd91747-c7bb-49bc-a2e9-df0a867dc3e3",
          "name": "D-ALPHA TOCOPHEROL [MART.]",
          "stdName": "D-ALPHA TOCOPHEROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "14a7c69c-63ae-4a0d-97ac-55fa0a89b761"
          ],
          "display_name": false
        },
        {
          "uuid": "e1f39616-bab1-4546-9d75-07e9d6809822",
          "name": "D-ALPHA-TOCOPHEROL",
          "stdName": "D-ALPHA-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d92834be-f553-46a2-9c7d-5d7b538b964e"
          ],
          "display_name": false
        },
        {
          "uuid": "eec217cb-d422-4778-99e4-ca46cea134a1",
          "name": "E-307A",
          "stdName": "E-307A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27f9b437-865a-46b8-b851-bfcd076968c4"
          ],
          "display_name": false
        },
        {
          "uuid": "28d986d8-3d83-41aa-ab44-3686288f58eb",
          "name": "INS NO.307A",
          "stdName": "INS NO.307A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27f9b437-865a-46b8-b851-bfcd076968c4"
          ],
          "display_name": false
        },
        {
          "uuid": "8e720bd5-f56a-44bf-addf-93a9c2fdfd8b",
          "name": "INS-307A",
          "stdName": "INS-307A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27f9b437-865a-46b8-b851-bfcd076968c4"
          ],
          "display_name": false
        },
        {
          "uuid": "80c67989-d84c-427c-baa6-1489222619f5",
          "name": "J24.260H",
          "stdName": "J24.260H",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2bd21e83-da4d-40c1-94b0-924e471f436d"
          ],
          "display_name": false
        },
        {
          "uuid": "b4a0530e-9181-40dd-b1eb-19451495bc6f",
          "name": "NSC-20812",
          "stdName": "NSC-20812",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c1cbd0b5-f73a-4c24-aad8-2b9cf2958036"
          ],
          "display_name": false
        },
        {
          "uuid": "d3bcf623-0bba-417e-8553-852b1761a516",
          "name": "R,R,R-.ALPHA.-TOCOPHEROL",
          "stdName": "R,R,R-.ALPHA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1036d8b9-f84f-4440-834f-b64ca4f54d2b"
          ],
          "display_name": false
        },
        {
          "uuid": "0678ac63-01d4-4716-a3d8-0479de658abb",
          "name": "RRR-ALPHA-TOCOPHEROL CONCENTRATE",
          "stdName": "RRR-ALPHA-TOCOPHEROL CONCENTRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa784bd8-5a55-4c28-afd0-76c47530adad",
            "3ae4db08-b61a-41ac-82b6-5b217521df65"
          ],
          "display_name": false
        },
        {
          "uuid": "71cd7e6c-6a7c-4159-8911-05ec27a32183",
          "name": "RRR-ALPHA-TOCOPHEROL CONCENTRATE [FCC]",
          "stdName": "RRR-ALPHA-TOCOPHEROL CONCENTRATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ae4db08-b61a-41ac-82b6-5b217521df65"
          ],
          "display_name": false
        },
        {
          "uuid": "4df368c1-f11c-4cfb-9b94-aa788ed82dfa",
          "name": "TOCOPHEROL, D-ALPHA-",
          "stdName": "TOCOPHEROL, D-ALPHA-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "462b8a8c-2d02-4605-a5b5-ca5dfddbb469"
          ],
          "display_name": false
        },
        {
          "uuid": "e50bedad-97da-49ec-8e15-0a2e24e5f5d0",
          "name": "VITAMIN E D-ALPHA",
          "stdName": "VITAMIN E D-ALPHA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef08f2a5-6d0a-401b-920f-ddde8e248747"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "53e134fa-0f3a-4e29-8d3f-ab82d2f3a3bd",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4ff3b7ff-69be-4d5c-8ddc-39009efc3ac7",
          "citation": "Merck Index 14th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1036d8b9-f84f-4440-834f-b64ca4f54d2b",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3eda151b-1479-4097-ae61-bfe5be306f26",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f4eb0db-23c1-4b64-8dbf-0fb34a0c6830",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eec2c958-c96f-4838-a44f-0fe8f7b62dcb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ae4db08-b61a-41ac-82b6-5b217521df65",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14a7c69c-63ae-4a0d-97ac-55fa0a89b761",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef08f2a5-6d0a-401b-920f-ddde8e248747",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "adf051ef-f87f-45c4-bde7-59a4a6ccfd6d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "462b8a8c-2d02-4605-a5b5-ca5dfddbb469",
          "citation": "VCRP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bd21e83-da4d-40c1-94b0-924e471f436d",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J24.260H",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J24.260H",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5c4db6d-1f97-4140-b377-d609a8995a0c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27ce3703-3b55-48ff-b4cd-3d50d422b470",
          "citation": "http://www.fao.org/ag/agn/jecfa-additives/specs/monograph4/additive-468-m4.pdf",
          "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/monograph4/additive-468-m4.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27f9b437-865a-46b8-b851-bfcd076968c4",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=3",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d92834be-f553-46a2-9c7d-5d7b538b964e",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1cbd0b5-f73a-4c24-aad8-2b9cf2958036",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7a21d53-7a31-42a5-b490-4f6de2c8f17b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391897000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e51ede4-7ceb-4882-af94-7050686787c0",
          "citation": "EP 7.8 RRR-.ALPHA.-TOCOPHEROL MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b63153cd-aff8-4818-a680-99eaf67bf297",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65077c42-7766-4d49-8437-951595a24e39",
          "citation": "SRS import [N9PR3490H9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N9PR3490H9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391897000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "905f93ed-32eb-40cd-b90a-289e6d659c79",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa784bd8-5a55-4c28-afd0-76c47530adad",
          "citation": "RRR-ALPHA-TOCOPHEROL CONCENTRATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cefbd538-089f-45a4-a169-e20d49089b94",
          "citation": "D-ALPHA TOCOPHEROL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef581268-bee9-499d-c91e-55d316854661",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+59-02-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8b310643-4552-a447-1547-c24e919ebb1f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59-02-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "beb9e9f2-be8e-d29e-8ddc-956c1d09bcf0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c87d06c1-9008-4308-bba6-4d710a4c0a32",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4b6d5bf2-0669-4c63-961b-5f85fba53b53",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af4816e6-6383-8118-01dc-9ac037e2ed52",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "6b0fd230-d509-8687-f044-a90d52937f6e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9cbd6ed4-4182-df30-6fd5-55322a4a72e2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "31a47c78-67f6-da09-00d2-14eb41566132",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "41ac8365-96c6-48c1-9485-934838f48ca7",
          "id": "41ac8365-96c6-48c1-9485-934838f48ca7",
          "molfile": "\n  Marvin  01132103282D          \n\n 31 32  0  0  1  0            999 V2000\n    6.4012   -0.9614    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4071   -1.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1099   -0.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8331   -0.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5446   -0.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2678   -0.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9852   -0.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2882   -1.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6809   -0.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9606   -0.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2404   -0.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5375   -1.0021    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.5433   -1.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8201   -0.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1027   -1.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3708   -0.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6563   -1.0282    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.3912   -1.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6563   -1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0552   -2.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7668   -1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697   -2.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697   -3.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2016   -1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9276   -2.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2016   -1.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9218   -0.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697    0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7668   -1.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0552   -0.6186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 17 31  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 30  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 26 28  2  0  0  0  0\n 29 28  1  0  0  0  0\n 28 30  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)O",
          "formula": "C29H50O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b1aed05b-b748-4fe8-8479-a52145215e46"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "430.7072",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d892b64e-3573-4e4c-b87c-0cf7f98c3073",
      "version": "15",
      "structure": {
        "id": "ea826f49-61ed-4c20-956a-33d09d55c88a",
        "molfile": "\n  Marvin  01132112082D          \n\n 31 32  0  0  1  0            999 V2000\n   -0.7668   -1.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7668   -1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697   -0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2016   -1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697   -2.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2016   -1.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0552   -0.6186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0552   -2.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6563   -1.0282    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.6563   -1.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9276   -2.2626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697    0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4697   -3.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9218   -0.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3708   -0.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1027   -1.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8331   -0.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9606   -0.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3912   -1.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5446   -0.5256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2404   -0.5751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8201   -0.5954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6809   -0.5605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1099   -0.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4012   -0.9614    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5375   -1.0021    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.2678   -0.9237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9852   -0.5054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2882   -1.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5433   -1.8240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4071   -1.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n  9 15  1  6  0  0  0\n 16 15  1  0  0  0  0\n 17 24  1  0  0  0  0\n 18 21  1  0  0  0  0\n  9 19  1  1  0  0  0\n 20 17  1  0  0  0  0\n 21 26  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 18  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 22  1  0  0  0  0\n 27 20  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\n 26 30  1  1  0  0  0\n 25 31  1  1  0  0  0\n  4  5  2  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)O",
        "formula": "C29H50O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "430.7072",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "905f93ed-32eb-40cd-b90a-289e6d659c79",
          "65077c42-7766-4d49-8437-951595a24e39"
        ],
        "stereo_centers": 3
      },
      "unii": "N9PR3490H9"
    }
  ]
}