{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "69df4a14-d663-414f-9896-bd936423cee3", "code": "351343-77-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=351343-77-6", "code_system": "CAS", "references": [ "171be14b-cdf9-4eca-8d3b-375279c3983c", "0362e00e-4a66-45db-90b8-43ca22897b9e" ] }, { "uuid": "01f3ca94-5290-4fb9-ad2b-e0bda35f0474", "code": "90472176", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90472176", "code_system": "PUBCHEM", "references": [ "171be14b-cdf9-4eca-8d3b-375279c3983c" ] }, { "uuid": "95a4f1b8-00f0-8b96-aa15-0cc07b0784f1", "code": "DTXSID4051376", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4051376", "code_system": "EPA CompTox", "references": [ "1d38b0c2-db19-c384-fc00-ec23a2a6937b" ] }, { "uuid": "76dcd3f9-2e20-40cf-b1db-e8c3990ae03e", "code": "N9NMT97JQN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "f87dc99f-663d-403f-9c0e-b21378c0e8bd", "name": "1H-INDENE, 2,3,3A,4,5,7A-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-6-(2-PROPEN-1-YL)-", "stdName": "1H-INDENE, 2,3,3A,4,5,7A-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-6-(2-PROPEN-1-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0dc4e552-63d0-4c66-8964-03bba7cf01f8" ], "display_name": false }, { "uuid": "1a7b7563-4df5-4d96-81fc-a153bfc78031", "name": "1H-INDENE, 2,3,3A,4,5,7A-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-6-(2-PROPENYL)-", "stdName": "1H-INDENE, 2,3,3A,4,5,7A-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-6-(2-PROPENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dff2d7ec-ffe6-4637-a728-13d43be27e7f" ], "display_name": false }, { "uuid": "86bf48b9-385b-4f9e-a0e4-8177ebe3fff9", "name": "2,3,3A,4,5,7A-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-6-(2-PROPEN-1-YL)-1H-INDENE", "stdName": "2,3,3A,4,5,7A-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-6-(2-PROPEN-1-YL)-1H-INDENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0dc4e552-63d0-4c66-8964-03bba7cf01f8" ], "display_name": true } ], "references": [ { "uuid": "dff2d7ec-ffe6-4637-a728-13d43be27e7f", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0dc4e552-63d0-4c66-8964-03bba7cf01f8", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "171be14b-cdf9-4eca-8d3b-375279c3983c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391591000, "tags": [ "NOMEN" ] }, { "uuid": "42b0843a-1626-4708-8aa9-75e4a6d083ce", "citation": "SRS import [N9NMT97JQN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N9NMT97JQN", "doc_type": "SRS", "public_domain": true, "document_date": 1493391591000, "tags": [ "NOMEN" ] }, { "uuid": "1d38b0c2-db19-c384-fc00-ec23a2a6937b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=351343-77-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0362e00e-4a66-45db-90b8-43ca22897b9e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f62e7024-6290-4f93-8d76-b8e855e1c814", "id": "f62e7024-6290-4f93-8d76-b8e855e1c814", "molfile": "\n Marvin 01132112462D \n\n 17 18 0 0 0 0 999 V2000\n 0.0000 -1.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8300 -1.4724 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.3189 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4838 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6993 -0.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1034 -1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2.8140 -0.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5303 -1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5303 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2466 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9685 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6848 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8140 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1034 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 1.3189 -2.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6993 -2.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4838 -2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 15 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 3 1 0 0 0 0\n 6 7 1 0 0 0 0\n 14 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 13 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 15 1 0 0 0 0\nM END", "smiles": "C=CCC1=CC2C(CC1)C(C)(C)C(C)C2(C)C", "formula": "C17H28", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7fad19fd-26e0-419a-9fb4-20bb8e99efa1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "232.4049", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "9388dba1-6850-4caa-90c7-caed6c1506a5", "version": "3", "structure": { "id": "3397d64e-691e-4da7-b901-5e98282dc359", "molfile": "\n Marvin 01132102452D \n\n 17 18 0 0 0 0 999 V2000\n 5.6848 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9685 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2466 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4838 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6993 -0.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6993 -2.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4838 -2.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5303 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8140 -2.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1034 -1.8930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1034 -1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8140 -0.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5303 -1.0574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3189 -2.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8300 -1.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3189 -0.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 9 1 0 0 0 0\n 4 16 1 0 0 0 0\n 5 17 1 0 0 0 0\n 6 17 1 0 0 0 0\n 7 15 1 0 0 0 0\n 8 15 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 15 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\nM END", "smiles": "C=CCC1=CC2C(CC1)C(C)(C)C(C)C2(C)C", "formula": "C17H28", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "232.4049", "optical_activity": "UNSPECIFIED", "references": [ "dff2d7ec-ffe6-4637-a728-13d43be27e7f", "42b0843a-1626-4708-8aa9-75e4a6d083ce" ], "stereo_centers": 3 }, "unii": "N9NMT97JQN" } ] }