{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0e5d6990-1892-48cc-a9be-59b3a08b35d6",
          "code": "79241-46-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79241-46-6",
          "code_system": "CAS",
          "references": [
            "80453a92-9599-4e4e-ac30-03d70631f601",
            "79d3a079-3468-4e1b-9ca4-fc0747799163"
          ]
        },
        {
          "uuid": "ee68d1ea-40fd-4fda-80a3-62ffdb982051",
          "code": "122809",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3590",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "80453a92-9599-4e4e-ac30-03d70631f601"
          ]
        },
        {
          "uuid": "e9e73eaa-3a8f-45e1-bfe8-a0025cb4a3d8",
          "code": "3033674",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3033674",
          "code_system": "PUBCHEM",
          "references": [
            "80453a92-9599-4e4e-ac30-03d70631f601"
          ]
        },
        {
          "uuid": "437cad6e-9d41-a3da-033b-f2a6642e5255",
          "code": "DTXSID0034855",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0034855",
          "code_system": "EPA CompTox",
          "references": [
            "6207efc4-9203-6984-c245-800baa19f1e3"
          ]
        },
        {
          "uuid": "eba68032-9448-428c-8497-e85a8bd8c4df",
          "code": "N99K0AJ91S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "21c29e96-7b67-a7d0-d1a9-5fe67f26edd6",
          "code": "fluazifop-P-butyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fluazifop-P-butyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "2bebe29e-0503-1d35-7deb-57957a13caae"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f73432cc-44b7-48ae-9f0b-9d0816355c3a",
          "name": "(+)-FLUAZIFOP-BUTYL",
          "stdName": "(+)-FLUAZIFOP-BUTYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60",
            "e6a7e78b-004e-4dbe-b816-953978124514"
          ],
          "display_name": false
        },
        {
          "uuid": "829765c1-bb04-46c4-8095-0a0953154850",
          "name": "FLUAZIFOP-P BUTYL ESTER",
          "stdName": "FLUAZIFOP-P BUTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6b3b8e6-37d6-435f-9891-aa8a738813ec"
          ],
          "display_name": false
        },
        {
          "uuid": "12588918-d7c8-4bbd-8cbb-867b6367b1bd",
          "name": "FLUAZIFOP-P-BUTYL",
          "stdName": "FLUAZIFOP-P-BUTYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3fc05757-a601-4f6c-a849-2ea545079845",
            "c6cb7868-dabc-4d55-8c18-ed00de435b7f",
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60"
          ],
          "display_name": true
        },
        {
          "uuid": "a9f5a62a-f6d7-4672-8783-895b55b3a553",
          "name": "FLUAZIFOP-P-BUTYL [ISO]",
          "stdName": "FLUAZIFOP-P-BUTYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6cb7868-dabc-4d55-8c18-ed00de435b7f",
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60"
          ],
          "display_name": false
        },
        {
          "uuid": "1b1a015c-8c3b-4ecb-b624-f3f2a1cb38d0",
          "name": "FUSILADE 2000",
          "stdName": "FUSILADE 2000",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60",
            "e6a7e78b-004e-4dbe-b816-953978124514"
          ],
          "display_name": false
        },
        {
          "uuid": "ac2f5865-36b6-49e4-a5c8-945a35cd4a23",
          "name": "FUSILADE FORTE",
          "stdName": "FUSILADE FORTE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60",
            "e6a7e78b-004e-4dbe-b816-953978124514"
          ],
          "display_name": false
        },
        {
          "uuid": "3870a00e-8c3e-43a1-b3b3-8542d212e59c",
          "name": "FUSILADE SUPER",
          "stdName": "FUSILADE SUPER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60",
            "e6a7e78b-004e-4dbe-b816-953978124514"
          ],
          "display_name": false
        },
        {
          "uuid": "46bdf6f5-5df3-4e3c-9dd0-d8193fee7c9f",
          "name": "PROPANOIC ACID, 2-(4-((5-(TRIFLUOROMETHYL)-2-PYRIDINYL)OXY)PHENOXY)-, BUTYL ESTER, (2R)-",
          "stdName": "PROPANOIC ACID, 2-(4-((5-(TRIFLUOROMETHYL)-2-PYRIDINYL)OXY)PHENOXY)-, BUTYL ESTER, (2R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3f4ad6d-718a-4324-8080-2fc4a91eaf60",
            "e6a7e78b-004e-4dbe-b816-953978124514"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d6b3b8e6-37d6-435f-9891-aa8a738813ec",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e6a7e78b-004e-4dbe-b816-953978124514",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3f4ad6d-718a-4324-8080-2fc4a91eaf60",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6cb7868-dabc-4d55-8c18-ed00de435b7f",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80453a92-9599-4e4e-ac30-03d70631f601",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391099000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb91eaa0-fda2-4d2b-8656-2faf6253228c",
          "citation": "SRS import [N99K0AJ91S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N99K0AJ91S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391099000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "424bec6c-788d-4f7a-b607-9968a1565e98",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fc05757-a601-4f6c-a849-2ea545079845",
          "citation": "FLUAZIFOP-P-BUTYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6207efc4-9203-6984-c245-800baa19f1e3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79241-46-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2bebe29e-0503-1d35-7deb-57957a13caae",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "79d3a079-3468-4e1b-9ca4-fc0747799163",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff99e528-ec22-4683-aa3f-4863162cc7ff",
          "id": "ff99e528-ec22-4683-aa3f-4863162cc7ff",
          "molfile": "\n  Marvin  01132113142D          \n\n 27 28  0  0  1  0            999 V2000\n    8.4739   -5.0771    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4739   -5.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7577   -4.6686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0431   -5.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3246   -4.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -5.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -5.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9154   -6.3702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1848   -5.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1848   -5.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4525   -4.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7444   -5.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7444   -5.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4779   -6.3853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0091   -4.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4165   -4.0298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2797   -4.3598    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6073   -5.4944    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3460   -6.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0431   -5.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1840   -4.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1840   -3.8314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9064   -5.0550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6197   -4.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3371   -5.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0500   -4.5964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7652   -4.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 21  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 20  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 19  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 15  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCCCOC(=O)[C@@H](C)Oc1ccc(cc1)Oc2ccc(cn2)C(F)(F)F",
          "formula": "C19H20F3NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "df490d39-2184-4caf-b1a1-66349057ba5c"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "383.3623",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "104bd439-19eb-4b38-8653-63572240fcfe",
      "version": "4",
      "structure": {
        "id": "4aaa1fdc-f38c-47b4-b1b1-56d502a82160",
        "molfile": "\n  Marvin  01132103542D          \n\n 27 28  0  0  1  0            999 V2000\n    4.1848   -5.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9154   -6.3702    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -5.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6293   -5.1146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3246   -4.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0431   -5.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7577   -4.6686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4739   -5.0771    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1840   -4.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9064   -5.0550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6197   -4.6259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3371   -5.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0500   -4.5964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7652   -4.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1840   -3.8314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4739   -5.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0431   -5.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3460   -6.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1848   -5.1380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4525   -4.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7444   -5.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0091   -4.7561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4165   -4.0298    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2797   -4.3598    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6073   -5.4944    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7444   -5.9880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4779   -6.3853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  9 15  2  0  0  0  0\n  8 16  1  1  0  0  0\n 17  6  1  0  0  0  0\n 18 17  2  0  0  0  0\n  3 18  1  0  0  0  0\n  1 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 26 21  2  0  0  0  0\n 27 26  1  0  0  0  0\n  1 27  2  0  0  0  0\nM  END",
        "smiles": "CCCCOC(=O)[C@@H](C)Oc1ccc(cc1)Oc2ccc(cn2)C(F)(F)F",
        "formula": "C19H20F3NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "383.3623",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cb91eaa0-fda2-4d2b-8656-2faf6253228c",
          "424bec6c-788d-4f7a-b607-9968a1565e98"
        ],
        "stereo_centers": 1
      },
      "unii": "N99K0AJ91S"
    }
  ]
}