{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "61855c53-8905-4d03-b3bc-4d309a99911e",
          "code": "5746-03-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5746-03-2",
          "code_system": "CAS",
          "references": [
            "120c2597-1b5a-4bbb-8e94-cfa1a75fadad",
            "e3477c4e-9028-429d-8b65-d6b818bfa220"
          ]
        },
        {
          "uuid": "a040efcb-db10-469f-9691-c3770a7a4664",
          "code": "23400779",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23400779",
          "code_system": "PUBCHEM",
          "references": [
            "120c2597-1b5a-4bbb-8e94-cfa1a75fadad"
          ]
        },
        {
          "uuid": "48f52e03-7fa8-49aa-9005-ce5558a07c19",
          "code": "N8KUP1WS1O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dd85ebde-8a0b-5a70-9961-0edac37fabe1",
          "code": "DTXSID20972937",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20972937",
          "code_system": "EPA CompTox",
          "references": [
            "611cc05c-467b-2529-01ca-6d9c467f70ce"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3d304c92-41ab-4b75-9115-8e9558edb419",
          "name": "L-LYSINE, N6-(1-CARBOXYETHYL)-",
          "stdName": "L-LYSINE, N6-(1-CARBOXYETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
            "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010"
          ],
          "display_name": false
        },
        {
          "uuid": "08f5c152-da53-443b-80a7-0bf3f532f274",
          "name": "LYSINE, N6-(1-CARBOXYETHYL)-, L-",
          "stdName": "LYSINE, N6-(1-CARBOXYETHYL)-, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
            "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010"
          ],
          "display_name": false
        },
        {
          "uuid": "44d31547-0c53-4325-b7eb-5e851f99e237",
          "name": "N.EPSILON.-(1-CARBOXYETHYL)LYSINE",
          "stdName": "N.EPSILON.-(1-CARBOXYETHYL)LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
            "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010"
          ],
          "display_name": false
        },
        {
          "uuid": "1ee1dcb0-dbb1-4fd1-9fec-ab2d9c44f649",
          "name": "N6-(1'-CARBOXYETHYL)-L-LYSINE",
          "stdName": "N6-(1'-CARBOXYETHYL)-L-LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
            "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010"
          ],
          "display_name": false
        },
        {
          "uuid": "1c6cfb94-4985-4000-97e1-edfebfca0f79",
          "name": "N6-(1-CARBOXYETHYL)-L-LYSINE",
          "stdName": "N6-(1-CARBOXYETHYL)-L-LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
            "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010"
          ],
          "display_name": true
        },
        {
          "uuid": "886e6077-0bce-4d0e-bbd6-8a460398dd1d",
          "name": "N6-1-CARBOXYETHYL LYSINE",
          "stdName": "N6-1-CARBOXYETHYL LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e423725-34da-42aa-b5bb-6a2dad867e38",
            "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b1ca3250-c20f-4f98-a4c2-eb3fc1c67010",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e423725-34da-42aa-b5bb-6a2dad867e38",
          "citation": "http://www.uniprot.org/uniprot/P16152",
          "url": "http://www.uniprot.org/uniprot/P16152",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "120c2597-1b5a-4bbb-8e94-cfa1a75fadad",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391599000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69b97a5f-4653-42d0-ab46-3459e29e5208",
          "citation": "SRS import [N8KUP1WS1O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N8KUP1WS1O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391599000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3477c4e-9028-429d-8b65-d6b818bfa220",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "611cc05c-467b-2529-01ca-6d9c467f70ce",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f777af92-b3c7-4f28-b44c-72e52c3e6cb7",
          "id": "f777af92-b3c7-4f28-b44c-72e52c3e6cb7",
          "molfile": "\n  Marvin  01132112502D          \n\n 15 14  0  0  1  0            999 V2000\n    9.1351   -3.2804    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.1351   -4.1060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4157   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7013   -3.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9870   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2728   -3.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5532   -2.8678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8389   -3.2804    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.8389   -4.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1243   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4099   -3.2804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1243   -2.0422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8493   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8493   -2.0422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5642   -3.2804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 13  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
          "smiles": "CC(C(=O)O)NCCCC[C@@H](C(=O)O)N",
          "formula": "C9H18N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e7af7990-7788-4f9c-8ae5-e4fb02742bdf"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "218.2506",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "d140d091-57df-4e08-8135-a64bc4695bf2",
      "version": "7",
      "structure": {
        "id": "73b05ad4-0bcc-49d6-82b6-81a0d93dc62a",
        "molfile": "\n  Marvin  01132106002D          \n\n 15 14  0  0  1  0            999 V2000\n    9.8493   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1351   -3.2804    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1351   -4.1060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4157   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7013   -3.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9870   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2728   -3.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5532   -2.8678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8389   -3.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8389   -4.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1243   -2.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4099   -3.2804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1243   -2.0422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8493   -2.0422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5642   -3.2804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  1  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n  1 14  2  0  0  0  0\n  1 15  1  0  0  0  0\nM  END",
        "smiles": "CC(C(=O)O)NCCCC[C@@H](C(=O)O)N",
        "formula": "C9H18N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "218.2506",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "48e02fa7-d48d-47e3-b701-85eee30dd1cd",
          "69b97a5f-4653-42d0-ab46-3459e29e5208"
        ],
        "stereo_centers": 2
      },
      "unii": "N8KUP1WS1O"
    }
  ]
}