{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3d3a52e7-73b1-4843-9ccf-e4feac7523da",
          "code": "4314-14-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4314-14-1",
          "code_system": "CAS",
          "references": [
            "3f4ef408-05f8-7acf-7736-7b1b18bc01c3"
          ]
        },
        {
          "uuid": "5cd124a9-098c-4f8a-8c52-6b22a6ad6507",
          "code": "224-330-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.119",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c7492bfc-a97e-482c-bfe6-24591935595a"
          ]
        },
        {
          "uuid": "ea91d42c-7e1d-ced8-0e8d-3dbba585a958",
          "code": "DTXSID5052098",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5052098",
          "code_system": "EPA CompTox",
          "references": [
            "43cc13f7-b790-8bf5-a6d4-58cf261e1dcb"
          ]
        },
        {
          "uuid": "8bbad3bc-dfbb-46f4-a8ec-6b84b7c5d5a7",
          "code": "1242853-39-9",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1242853-39-9",
          "code_system": "CAS",
          "references": [
            "3f4ef408-05f8-7acf-7736-7b1b18bc01c3"
          ]
        },
        {
          "uuid": "9ef9a3e2-1d87-4f10-a5ed-2b54974db595",
          "code": "97516-50-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97516-50-2",
          "code_system": "CAS",
          "references": [
            "3f4ef408-05f8-7acf-7736-7b1b18bc01c3"
          ]
        },
        {
          "uuid": "6da1ff21-1565-49b2-8510-5a64fedec609",
          "code": "7625-02-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7625-02-7",
          "code_system": "CAS",
          "references": [
            "3f4ef408-05f8-7acf-7736-7b1b18bc01c3"
          ]
        },
        {
          "uuid": "143bb6ab-4e37-4bc3-b2da-a3246f3308f1",
          "code": "N83897KOD7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e575928d-1373-1707-2052-d5ed21e19a64",
          "code": "Sudan Yellow 3G",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sudan_Yellow_3G",
          "code_system": "WIKIPEDIA",
          "references": [
            "12d0d5d9-633a-cd13-c6df-4a93e2024a61"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "39d79241-baaf-48a3-b7b2-e58689a5878f",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "1bb8c648-1bb4-4785-9005-d09141c4eba4",
            "refuuid": "c9c43c75-16ab-43d7-2449-a3439f2683ff",
            "name": "ALTERNATIVE DEFINITION for [SOLVENT YELLOW 16]",
            "linking_id": "c9c43c75-16ab-43d7-2449-a3439f2683ff",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e82e4a70-b1bb-4f05-931e-88484caa82e8",
          "name": "1-PHENYL-3-METHYL-4-PHENYLAZO-5-PYRAZOLONE",
          "stdName": "1-PHENYL-3-METHYL-4-PHENYLAZO-5-PYRAZOLONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "98d327e8-89cb-4404-893f-9bf1763fa2d0",
          "name": "2,4-DIHYDRO-5-METHYL-2-PHENYL-4-(2-PHENYLDIAZENYL)-3H-PYRAZOL-3-ONE",
          "stdName": "2,4-DIHYDRO-5-METHYL-2-PHENYL-4-(2-PHENYLDIAZENYL)-3H-PYRAZOL-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "e2930c01-9eef-4289-ac5b-123c6d9345ce",
          "name": "3-METHYL-1-PHENYL-4-(PHENYLAZO)-PYRAZOL-5-OL",
          "stdName": "3-METHYL-1-PHENYL-4-(PHENYLAZO)-PYRAZOL-5-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "7ae802bf-9be7-4e23-98e7-a4de240a0519",
          "name": "3H-PYRAZOL-3-ONE, 2,4-DIHYDRO-5-METHYL-2-PHENYL-4-(2-PHENYLDIAZENYL)-",
          "stdName": "3H-PYRAZOL-3-ONE, 2,4-DIHYDRO-5-METHYL-2-PHENYL-4-(2-PHENYLDIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "293f929e-4561-4c35-83c9-4bf90039273f",
          "name": "3H-PYRAZOL-3-ONE, 2,4-DIHYDRO-5-METHYL-2-PHENYL-4-(PHENYLAZO)-",
          "stdName": "3H-PYRAZOL-3-ONE, 2,4-DIHYDRO-5-METHYL-2-PHENYL-4-(PHENYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "98794269-b8d7-4651-874c-1aca04306e2f",
          "name": "4-PHENYLAZO-1-PHENYL-3-METHYL-5-PYRAZOLONE",
          "stdName": "4-PHENYLAZO-1-PHENYL-3-METHYL-5-PYRAZOLONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "76d66c8c-5a2f-4015-95eb-949938321a2b",
          "name": "C.I. 12700",
          "stdName": "C.I. 12700",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "b011c299-8c6b-414c-ae5a-c64d89943ec4",
          "name": "C.I. DISPERSE YELLOW 16",
          "stdName": "C.I. DISPERSE YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "aeb11b59-1b78-4467-8cff-d0b4c7705f11",
          "name": "C.I. SOLVENT YELLOW 16",
          "stdName": "C.I. SOLVENT YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "d6424c05-8246-4d4d-a599-df2aabf95f6b",
          "name": "CI 12700",
          "stdName": "CI 12700",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e79e45a7-8adc-416e-95ba-4af5fa491327"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b691b299-36fc-4152-91df-ac4c949ac5a5",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "72347560-3515-4c47-8e66-f36772ce7a42",
          "name": "DISPERSE YELLOW 16",
          "stdName": "DISPERSE YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "d4448d14-e021-4a4b-8b1a-b56f5349ced0",
          "name": "FAT YELLOW 3G",
          "stdName": "FAT YELLOW 3G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "25cc900a-95e6-4725-82bd-5f97b36e018e",
          "name": "OIL YELLOW 3G",
          "stdName": "OIL YELLOW 3G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "c6e8bffa-d900-40b8-928c-2bc898d47ece",
          "name": "PYRAZOL-5-OL, 3-METHYL-1-PHENYL-4-(PHENYLAZO)-",
          "stdName": "PYRAZOL-5-OL, 3-METHYL-1-PHENYL-4-(PHENYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "91053f7c-b53f-4694-946e-761195cbd91c",
          "name": "SOLVENT YELLOW 16",
          "stdName": "SOLVENT YELLOW 16",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": true
        },
        {
          "uuid": "50bb6eff-2287-4507-a1fe-4d28909eca5e",
          "name": "SUDAN YELLOW 146",
          "stdName": "SUDAN YELLOW 146",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        },
        {
          "uuid": "45f3690e-8749-459c-b6f6-fb68756a7216",
          "name": "SUDAN YELLOW 3G",
          "stdName": "SUDAN YELLOW 3G",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "557b8f39-072a-4616-8e54-cce29fb4091b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3f4ef408-05f8-7acf-7736-7b1b18bc01c3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e79e45a7-8adc-416e-95ba-4af5fa491327",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "557b8f39-072a-4616-8e54-cce29fb4091b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7492bfc-a97e-482c-bfe6-24591935595a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a543bf0-9e0a-4c1b-9c8c-f5091f889c61",
          "citation": "SRS import [N83897KOD7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N83897KOD7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392245000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43cc13f7-b790-8bf5-a6d4-58cf261e1dcb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4314-14-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "871aff77-02e6-50a5-4954-51de7a898ced",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "12d0d5d9-633a-cd13-c6df-4a93e2024a61",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cfa95721-6ab7-293b-9781-b27ce87e57c4",
          "id": "cfa95721-6ab7-293b-9781-b27ce87e57c4",
          "molfile": "\n  Marvin  01132110442D          \n\n 21 23  0  0  0  0            999 V2000\n   15.6698   -5.1468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9247   -4.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7093   -4.1072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7093   -3.2821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3768   -4.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2905   -5.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9580   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7117   -5.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1305   -4.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7979   -4.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4398   -3.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9247   -3.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6698   -2.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6148   -3.6947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2023   -2.9802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3773   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9648   -2.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1398   -2.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7273   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9648   -3.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1398   -3.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 11  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4 12  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  9  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8 10  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 20  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 21  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(n(-c2ccccc2)n1)O)/N=N/c3ccccc3",
          "formula": "C16H14N4O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc5f93a3-f199-4b92-a21a-4913c2d26965"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "278.3092",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f1e404f-7964-4a82-b2f3-aa2ea557752b",
      "version": "11",
      "structure": {
        "id": "d1e890b6-ce37-4fc3-86dc-1fa1efe7f5cd",
        "molfile": "\n  Marvin  01132110512D          \n\n 21 23  0  0  0  0            999 V2000\n   15.6698   -5.1468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9247   -4.3621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7093   -4.1072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7093   -3.2821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3768   -4.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2905   -5.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9580   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7117   -5.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1305   -4.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7979   -4.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4398   -3.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9247   -3.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6698   -2.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6148   -3.6947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2023   -2.9802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3773   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9648   -2.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1398   -2.2658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7273   -2.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9648   -3.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1398   -3.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  8 10  2  0  0  0  0\n  2 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n  4 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 11  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 16 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 19 21  2  0  0  0  0\nM  END",
        "smiles": "Cc1c(c(n(-c2ccccc2)n1)O)/N=N/c3ccccc3",
        "formula": "C16H14N4O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "278.3092",
        "optical_activity": "NONE",
        "references": [
          "e79e45a7-8adc-416e-95ba-4af5fa491327",
          "7a543bf0-9e0a-4c1b-9c8c-f5091f889c61"
        ],
        "stereo_centers": 0
      },
      "unii": "N83897KOD7"
    }
  ]
}