{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6fe66a6e-99ab-4285-86e6-00b3cad33830",
          "code": "1163-19-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1163-19-5",
          "code_system": "CAS",
          "references": [
            "9589c66b-48e2-4951-9727-e26d24a4ab4c",
            "d53fc5db-2ca4-4885-81e5-07093b529f4f"
          ]
        },
        {
          "uuid": "86cb081d-56f9-4eaa-bd8a-1e0f8f02caa9",
          "code": "DECABROMODIPHENYL ETHER",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Decabromodiphenyl_ether",
          "code_system": "WIKIPEDIA",
          "references": [
            "9589c66b-48e2-4951-9727-e26d24a4ab4c"
          ]
        },
        {
          "uuid": "14cd1e15-61fd-4c86-a62b-82699068de42",
          "code": "m4118",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4118?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9589c66b-48e2-4951-9727-e26d24a4ab4c"
          ]
        },
        {
          "uuid": "f207b3ab-9637-43ec-b892-ba009da102d4",
          "code": "214-604-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.277",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9589c66b-48e2-4951-9727-e26d24a4ab4c"
          ]
        },
        {
          "uuid": "f0f0ca0a-1faa-494c-a556-1b9e4f6449a6",
          "code": "14410",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14410",
          "code_system": "PUBCHEM",
          "references": [
            "9589c66b-48e2-4951-9727-e26d24a4ab4c"
          ]
        },
        {
          "uuid": "a8d67c30-ba9c-665c-62ee-ac398bd3d121",
          "code": "2911",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2911",
          "code_system": "HSDB",
          "references": [
            "ecf7f015-15bd-46f3-0ede-11a5ea5d15c0"
          ]
        },
        {
          "uuid": "a8b310cf-72d0-bd64-549b-38f43f9934f8",
          "code": "DTXSID9020376",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020376",
          "code_system": "EPA CompTox",
          "references": [
            "843775ac-9403-06cc-56b0-02a3eb398c1e"
          ]
        },
        {
          "uuid": "ff33e0ee-5567-4cd1-b9c4-727a193cf9bf",
          "code": "N80BQ29A0H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5b5caa74-e917-99b4-c645-ae62205e21dd",
          "code": "82436",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:82436",
          "code_system": "CHEBI",
          "references": [
            "0f76da38-8b17-cf3a-dec2-1a06454a4541"
          ]
        },
        {
          "uuid": "a5bb0837-d6d4-7814-08ad-217b85d8a7b2",
          "code": "82553",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=82553",
          "code_system": "NSC",
          "references": [
            "141520b6-e76a-2bb2-2422-631494a77778"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c0e361c-4c8d-45e3-b8b1-dc93d58d053d",
          "name": "1,1'-OXYBIS(2,3,4,5,6-PENTABROMOBENZENE)",
          "stdName": "1,1'-OXYBIS(2,3,4,5,6-PENTABROMOBENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbf828a9-3d08-4fc1-a2ef-c863a986a5ec",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "2f69b6ce-73c4-45dd-86ce-c80926ed2074",
          "name": "BIS(PENTABROMOPHENYL) ETHER",
          "stdName": "BIS(PENTABROMOPHENYL) ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbf828a9-3d08-4fc1-a2ef-c863a986a5ec",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "820ee462-8f6e-4387-a39c-d935dfed587c",
          "name": "DBDPO",
          "stdName": "DBDPO",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbf828a9-3d08-4fc1-a2ef-c863a986a5ec",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "8843bae0-46f4-4d20-91d1-f3383e8d28ec",
          "name": "DECA-BDE",
          "stdName": "DECA-BDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbf828a9-3d08-4fc1-a2ef-c863a986a5ec",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "86979d22-97ac-4bf3-904e-701e6cd00faf",
          "name": "DECABROMOBIPHENYL ETHER [HSDB]",
          "stdName": "DECABROMOBIPHENYL ETHER [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "054e0e65-509d-4df8-9929-421904a15ba4",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "0b96151d-2189-4b1a-9a77-87ec80c7223f",
          "name": "DECABROMODIPHENYL ETHER",
          "stdName": "DECABROMODIPHENYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f5d083e-7683-4b67-8808-a635d3bb3085",
            "bbf828a9-3d08-4fc1-a2ef-c863a986a5ec",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7",
            "5e5583ba-d388-464c-9c66-f4f68cfb78fc"
          ],
          "display_name": true
        },
        {
          "uuid": "1a02e333-893c-45e2-b170-6f7ea0a4ed30",
          "name": "DECABROMODIPHENYL ETHER [MI]",
          "stdName": "DECABROMODIPHENYL ETHER [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f5d083e-7683-4b67-8808-a635d3bb3085",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "c0b9931e-4578-4b1a-87fd-15029b7bf190",
          "name": "DECABROMODIPHENYL OXIDE",
          "stdName": "DECABROMODIPHENYL OXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ded29b16-d6f6-4b68-90a1-051c46fc33d2"
          ],
          "display_name": false
        },
        {
          "uuid": "c5b82c24-3c48-9fe4-42f4-1b8a6eca1e75",
          "name": "DECABROMODIPHENYL OXIDE [IARC]",
          "stdName": "DECABROMODIPHENYL OXIDE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "adbaed75-e9fb-da15-96af-0d21293bd379"
          ],
          "display_name": false
        },
        {
          "uuid": "87ddbd6f-e64f-4af5-b6ce-5e6f9d173783",
          "name": "NCI-C55287",
          "stdName": "NCI-C55287",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3f411d9-ca69-4de4-b1da-de0a2e4cf9d2",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "4d3b64bf-25f3-49a3-8d07-f367abe893f8",
          "name": "NSC-82553",
          "stdName": "NSC-82553",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3f411d9-ca69-4de4-b1da-de0a2e4cf9d2",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        },
        {
          "uuid": "a3493d42-ffed-4c41-9936-ef3d3ac79797",
          "name": "PBDE 209",
          "stdName": "PBDE 209",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc68346d-551f-4a8a-89b9-75e7a7957c39",
            "7421023b-3fd1-4ef9-87fd-f6a167a9eef7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ded29b16-d6f6-4b68-90a1-051c46fc33d2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9f5d083e-7683-4b67-8808-a635d3bb3085",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7421023b-3fd1-4ef9-87fd-f6a167a9eef7",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbf828a9-3d08-4fc1-a2ef-c863a986a5ec",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3f411d9-ca69-4de4-b1da-de0a2e4cf9d2",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "054e0e65-509d-4df8-9929-421904a15ba4",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc68346d-551f-4a8a-89b9-75e7a7957c39",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9589c66b-48e2-4951-9727-e26d24a4ab4c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390889000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe9c691b-86bf-49bb-b998-499e1fedf6dc",
          "citation": "SRS import [N80BQ29A0H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=N80BQ29A0H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390889000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b321f62-fdf6-4a44-b748-b41630e37d19",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e5583ba-d388-464c-9c66-f4f68cfb78fc",
          "citation": "DECABROMODIPHENYL ETHER [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecf7f015-15bd-46f3-0ede-11a5ea5d15c0",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1163-19-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "843775ac-9403-06cc-56b0-02a3eb398c1e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1163-19-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "adbaed75-e9fb-da15-96af-0d21293bd379",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "0f76da38-8b17-cf3a-dec2-1a06454a4541",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d53fc5db-2ca4-4885-81e5-07093b529f4f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "141520b6-e76a-2bb2-2422-631494a77778",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c12c7eb-3173-4868-81f7-11fc6efc775c",
          "id": "0c12c7eb-3173-4868-81f7-11fc6efc775c",
          "molfile": "\n  Marvin  01132100522D          \n\n 23 24  0  0  0  0            999 V2000\n    8.0038   -2.1547    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2827   -2.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2691   -3.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9768   -3.8045    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5481   -3.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5346   -4.6062    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8404   -3.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6050   -4.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4750   -3.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4885   -2.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2095   -2.1000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7808   -2.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7943   -1.2518    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0597   -2.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3521   -2.0533    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0463   -3.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3251   -3.7031    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7539   -3.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7404   -4.5513    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8539   -2.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1462   -2.1082    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5750   -2.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5884   -1.3066    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 22  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n 20  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 18  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1(c(c(c(c(c1Br)Br)Oc2c(c(c(c(c2Br)Br)Br)Br)Br)Br)Br)Br",
          "formula": "C12Br10O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "841108a8-6934-401f-9323-dbe46f569f04"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "959.1635",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5257fb2f-3761-4eb7-aa05-ca6e9e07182b",
      "version": "8",
      "structure": {
        "id": "640c60b9-b2ee-4987-986b-375accda8c0b",
        "molfile": "\n  Marvin  01132105122D          \n\n 23 24  0  0  0  0            999 V2000\n    4.6050   -4.0728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8404   -3.3572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5481   -3.7813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5346   -4.6062    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2691   -3.3804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9768   -3.8045    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2827   -2.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0038   -2.1547    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5750   -2.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5884   -1.3066    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8539   -2.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1462   -2.1082    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4750   -3.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4885   -2.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2095   -2.1000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7808   -2.0767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7943   -1.2518    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0597   -2.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3521   -2.0533    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.0463   -3.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3251   -3.7031    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7539   -3.7265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7404   -4.5513    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11  2  2  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 13  2  0  0  0  0\nM  END",
        "smiles": "c1(c(c(c(c(c1Br)Br)Oc2c(c(c(c(c2Br)Br)Br)Br)Br)Br)Br)Br",
        "formula": "C12Br10O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "959.1635",
        "optical_activity": "NONE",
        "references": [
          "6b321f62-fdf6-4a44-b748-b41630e37d19",
          "fe9c691b-86bf-49bb-b998-499e1fedf6dc"
        ],
        "stereo_centers": 0
      },
      "unii": "N80BQ29A0H"
    }
  ]
}