{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "525b3e04-9d50-42b0-8632-4d44298e1f6d",
          "code": "109826-68-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=109826-68-8",
          "code_system": "CAS",
          "references": [
            "94428506-da14-4dad-b5d9-81de72d8df32",
            "0677b714-2d3a-455b-82c2-cb8fac083fab"
          ]
        },
        {
          "uuid": "719920cc-7b4e-7d28-d0c4-03e8e4da316e",
          "code": "9949485",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9949485",
          "code_system": "PUBCHEM",
          "references": [
            "9e174ac7-c56b-ab49-5e04-28d4d8e3752e"
          ]
        },
        {
          "uuid": "09f04f7a-3c43-47a4-8cfa-12d687950f87",
          "code": "N76D6SE9WU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b1097f74-80f7-4553-961d-85fcd30a4752",
          "name": "5,9,13,17-NONADECATETRAEN-2-OL, 6,10,14,18-TETRAMETHYL-, (5E,9E,13E)-",
          "stdName": "5,9,13,17-NONADECATETRAEN-2-OL, 6,10,14,18-TETRAMETHYL-, (5E,9E,13E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa6a362e-ddda-4203-ae04-133778150af4",
            "db213df7-1708-4752-b779-4316b99acfc8"
          ],
          "display_name": false
        },
        {
          "uuid": "3f4de347-dbf4-4149-8616-7dc31d66e1b7",
          "name": "6,10,14,18-TETRAMETHYL-5,9,13,17-NONADECATETRAEN-2-OL, (5E,9E,13E)-",
          "stdName": "6,10,14,18-TETRAMETHYL-5,9,13,17-NONADECATETRAEN-2-OL, (5E,9E,13E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0677b714-2d3a-455b-82c2-cb8fac083fab"
          ],
          "display_name": true
        },
        {
          "uuid": "77cefee6-1e38-410a-bcaf-4b13e49d7671",
          "name": "GERANYLGERANYLISOPROPANOL",
          "stdName": "GERANYLGERANYLISOPROPANOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "062e70c1-11a7-4459-bf48-ebb713e910af",
            "f3893450-36aa-4653-b702-b8ee86e662ce",
            "db213df7-1708-4752-b779-4316b99acfc8"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fd8ea5c0-6162-4a56-8aab-64dcc0e2a133",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a35e29b5-868b-49c4-866a-5f1348b9c236",
          "name": "TEPRENONE IMPURITY 22",
          "stdName": "TEPRENONE IMPURITY 22",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0677b714-2d3a-455b-82c2-cb8fac083fab"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f3893450-36aa-4653-b702-b8ee86e662ce",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "db213df7-1708-4752-b779-4316b99acfc8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa6a362e-ddda-4203-ae04-133778150af4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94428506-da14-4dad-b5d9-81de72d8df32",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393311000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "062e70c1-11a7-4459-bf48-ebb713e910af",
          "citation": "GERANYLGERANYLISOPROPANOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9e174ac7-c56b-ab49-5e04-28d4d8e3752e",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "0677b714-2d3a-455b-82c2-cb8fac083fab",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7875e17d-a182-41f2-b850-bbccd9f1ffc7",
          "id": "7875e17d-a182-41f2-b850-bbccd9f1ffc7",
          "molfile": "\n  Marvin  01132106152D          \n\n 24 23  0  0  0  0            999 V2000\n   14.1018   -4.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4047   -4.1047    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.4040   -3.2576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6825   -4.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9681   -4.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2547   -4.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5406   -4.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5317   -3.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8297   -4.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1078   -4.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3993   -4.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6849   -4.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6762   -3.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9716   -4.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2548   -4.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5415   -4.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8272   -4.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8184   -3.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1165   -4.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3945   -4.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6860   -4.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9716   -4.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9628   -3.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2584   -4.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CCC(C)O)/C)/C)/C)C",
          "formula": "C23H40O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "64e07914-b2ef-4619-b67d-e20b9e695f3f"
          },
          "defined_stereo": 0,
          "ez_centers": 3,
          "molecular_weight": "332.564",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5a2408a9-32de-4182-8f3d-08720be6f15d",
      "version": "8",
      "structure": {
        "id": "5aae1c9c-fc0d-47d9-81b9-a327176006aa",
        "molfile": "\n  Marvin  01132104422D          \n\n 24 23  0  0  0  0            999 V2000\n   11.9681   -4.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2547   -4.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5406   -4.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8297   -4.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1078   -4.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3993   -4.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6849   -4.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9716   -4.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6762   -3.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5317   -3.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8184   -3.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9628   -3.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2584   -4.5817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9716   -4.1608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6860   -4.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3945   -4.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1165   -4.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8272   -4.1405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5415   -4.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2548   -4.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4040   -3.2576    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4047   -4.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6825   -4.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1018   -4.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  3  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 11 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20  8  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n  1 23  1  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CCC(C)O)/C)/C)/C)C",
        "formula": "C23H40O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 3,
        "molecular_weight": "332.564",
        "optical_activity": "( + / - )",
        "references": [
          "aa6a362e-ddda-4203-ae04-133778150af4",
          "0677b714-2d3a-455b-82c2-cb8fac083fab"
        ],
        "stereo_centers": 1
      },
      "unii": "N76D6SE9WU"
    }
  ]
}